STORY   LOOP   FURRY   PORN   GAMES
• C •   SERVICES [?] [R] RND   POPULAR
Archived flashes:
204048
/disc/ · /res/     /show/ · /fap/ · /gg/ · /swf/P0001 · P2214 · P4427

 Check out this video on how Google is trying to control the outcome of US election 2020 (and steer opinions in general on a global scale). 
 Since Google and YouTube has so much reach in the world I think it's a good idea to get at least a few more people aware of the manipulation going on. 
 I dislike all forms of censorship, including self-censorship caused by vague rules or fund starvation. Freedom of speech is a concept existing outside of law. 

[hide]        Several large companies are banding together to get rid of wrongthink. Tim Pool does a good job discussing the subject.        [hide]

<div style="position:absolute;top:-99px;left:-99px;"><img src="http://swfchan.com:57475/93763059?noj=FRM93763059-22DC" width="1" height="1"></div>

Web Trading Cars Chase.swf

This is the info page for
Flash #109214

(Click the ID number above for more basic data on this flash file.)


Text
LOADING

SEE PROFILES

SEE PROFILES

SEND TO A FRIEND

SEND TO A FRIEND

PLAY NOW

PLAY NOW

PLAY NOW

WEB TRADING CARS CHASE

TM

Win a street race on the Beach Course by choosing the  Web Trading Cars™
vehicle with the most speed!
More cars and more courses being added to test your skill!
Hint: Look for icons that match your car with the course.

Snow Course coming next – stay tuned!

Desert Course - Under Construction!

GO NOW

GO NOW

Click here to view trailer

HOW TO PLAY

Choose cars with features that boost performance on the course you race.
Print & collect profile cards & cars, too!
Select a vehicle to race.
Use                           to steer and                   to accelerate.
At the end of the race answer a question correctly  to earn a boost in the
next race!

NEXT

NEXT

Born

Birthplace

Designer

Specialty

1999

A blast from the past, At-A-Tude was built for breaking speed records. The massive engine sits INSIDE the cabin, right behind the driver’s seat!

El Segundo, CA, USA

Hot Wheels®

13 OF 24

HIGH SPEED

AT-A-TUDE

SELECT

SELECT

PRINT PROFILE

PRINT PROFILE

13 OF 4

SUPERCHARGED

1/4 MILE COUPE

13 OF 4

POWERED-UP

PONY-UP
®

MUSIC - VEHICLE - DUDE

PREV

PREV

NEXT

NEXT

145

PRINTING...

CLICK TO RESUME

STAY TUNED!

TREE COURSE

TREE COARSE

SWITCH CAR

PLAY NOW

PLAY NOW

Click here to view trailer

Click here to view trailer

DESERT COURSE

DESERT COARSE

SWITCH CAR

SWITCH CAR

STAY TUNED!

GO BACK

GO BACK

asdfasdf

SEND TO A FRIEND

SEND TO A FRIEND

Answer this question about the Web Trading Cars
vehicle you selected to unlock a boost for this race.

TM

asdfasdf

You have unlocked a speed boost for this race.
The speed boost will allow you car to achieve a higher top speed.

READY!

SET!

GO!

00:00.0

TIME:

LAP 1 OF 3

LAP 1 OF 3

PLAY AGAIN

PLAY AGAIN

EARN A BOOST

EARN A BOOST

00:00.0

TIME:

00:00.0

PLACE:

RACE RESULTS

FRIEND'S NAME

FRIEND'S EMAIL

YOUR NAME

A PROBLEM OCCURRED WHILE SENDING YOUR EMAIL

INVALID EMAIL

INVALID NAME

CANCEL

CANCEL

SEND EMAIL

SEND EMAIL

SEND TO A FRIEND

DONE

DONE

SEND ANOTHER

SEND ANOTHER

YOUR EMAIL HAS BEEN SENT

CHECKING SCORES

BACK

BACK

HIGH SCORES

HIGH SCORES

04:21:38

YOUR SCORE

YOUR AWARD

SUBMIT SCORE

HIGH SCORES

ActionScript [AS1/AS2]

Frame 1
function getHits(siteid, gameid) { trace("get hits"); mySitesServices.getGamehits(siteid, gameid); getGamehits_Result = function (result) { var _local1 = result.Table; hits = _local1.getItemAt(0).hits; }; } function onValidateCode(evt) { unlocked = 1; sounds.win.start(); chooser.chooser.current.shower.gotoAndStop(1); chooser.chooser.current.locker._visible = false; chooser.chooser.current.but.enabled = true; chooser.chooser.current.clicker._visible = true; } function myOnLoad() { _global.config = new Object(); _global.config.levels = []; var _local5 = 0; while (_local5 < doc.childNodes[0].childNodes.length) { var _local3 = doc.childNodes[0].childNodes[_local5]; _global.config.levels[_local5] = []; var _local2 = 0; while (_local2 < _local3.childNodes.length) { var _local4 = new Object(); _local4.bugtype = _local3.childNodes[_local2].attributes.bugtype.toString(); _local4.count = _local3.childNodes[_local2].attributes.count.toString(); _local4.gap = _local3.childNodes[_local2].attributes.gap.toString(); _local4.reward = ((_local3.childNodes[_local2].attributes.reward.toString() == "null") ? null : (_local3.childNodes[_local2].attributes.reward.toString())); _global.config.levels[_local5].push(_local4); _local2++; } _local5++; } play(); } _quality = "BEST"; myColor = new Color(this); myTransform = new Object(); clearAllIntervals = function () { i = 0; while (i < 2000) { clearInterval(i); i++; } }; fade = function (destination) { _global.finishVoiceOver(); clearAllIntervals(); locked = true; fader.destination = destination; fader.gotoAndPlay(2); }; var gameid = 101; var siteid = 34; var hits; doEnter = function (code) { trace("doing the big enter"); fade(onValidateCode); }; getUnlockStatus = function () { mySitesServices.getUnlockStatus(); getUnlockStatus_Result = function (result) { var _local1 = result.Table; unlocked = _local1.getItemAt(0).unlocked; }; }; unlocked = 0; doc = new XML(); doc.ignoreWhite = true; _global.soundsLoaded = false; sounds.loadMovie("voiceOvers.swf");
Frame 2
ifFrameLoaded (73) { gotoAndStop ("pre"); }
Frame 3
gotoAndPlay (2);
Frame 5
_global.gSounds = sounds; _global.gfx = fx; _global.endVoiceOver = function () { clearInterval(_global.voiceOverInterval); }; _global.fadeVoiceOver = function () { _global.endVoiceOver(); currentSound.exit(); }; _global.sayVoiceOver = function (which, duration, func) { if (!_global.playingVideo) { clearInterval(sayInterval); currentSound = which; currentFunc = func; which.enter(); _global.voiceOverInterval = setInterval(func, duration); } }; _global.playVoiceOver = function (which, duration, func) { if (!_global.playingVideo) { clearInterval(sayInterval); view.timeout.resetTimer(); _global.fadeVoiceOver(); sayVoiceOver(which, duration, func); } }; _global.playSound = function (which) { which.enter(); }; _global.finishVoiceOver = function () { currentSound.exit(); currentFunc(); clearInterval(_global.voiceOverInterval); currentFunc = null; currentSound = null; }; _global.endRain = function () { gfx.rainInside.exit(); gfx.rainOutside.exit(); }; _global.voLength = [0, 1256, 1362, 1697, 1985, 7300, 11000, 9800, 6500, 1094, 1195, 1200, 2229, 1114, 758, 539, 946, 2304, 821, 834, 1410, 953, 2136, 770, 973]; i = 0; while (i < _global.voLength.length) { if (i < 10) { var adder = ("0" + i); } else { adder = i; } trace(adder); gSounds["v0" + adder].dur = _global.voLength[i]; i++; } gotoAndStop ("title");
Frame 9
gameList = ["Fast Food Barf Fest", "Bugs Bugging", "Disgusto Attack", "Intersection of Rude & Annoying"]; bestList = [0, 0, 0, 0];
Frame 16
returnTo = "inter";
Frame 24
score = 0; boost = 0; cheatModeOn = true;
Frame 34
score = 0; boost = 0; cheatModeOn = true;
Frame 42
returnTo = "location";
Frame 50
gfx.idle.exit();
Frame 58
boost = 0;
Frame 73
gfx.idle.exit();
Frame 81
gfx.idle.enter(); returnTo = "results"; boost = 0;
Frame 94
function onSend(evObj) { sendResult = evObj.sent; if (sendResult == "true") { fade("sentmail"); } else { problem_sending._visible = true; } } function submitEmail() { invalid_your_name._visible = false; invalid_your_name._visible = false; invalid_email._visible = false; problem_sending._visible = false; if (((!mattel.data.StringExtensions.isEmail(friends_email.text)) || (friends_email.text == "")) || (friends_email.text == null)) { invalid_email._visible = true; } else if ((your_name.text == "") || (your_name.text == null)) { invalid_your_name._visible = true; } else if ((friend_name.text == "") || (friend_name.text == null)) { invalid_friend_name._visible = true; } else { mailOK = true; foundResultsYour = false; foundResultsFriend = false; tryingToSend = true; sendYour_lv = new LoadVars(); resultYour_lv = new LoadVars(); resultYour_lv.onLoad = isNaughtyYour; sendYour_lv.phrase = your_name.text; sendYour_lv.sendAndLoad(app_naughtyCheck, resultYour_lv, "POST"); sendFriend_lv = new LoadVars(); resultFriend_lv = new LoadVars(); resultFriend_lv.onLoad = isNaughtyFriend; sendFriend_lv.phrase = friend_name.text; sendFriend_lv.sendAndLoad(app_naughtyCheck, resultFriend_lv, "POST"); } } function isNaughtyYour() { foundResultsYour = true; } function isNaughtyFriend() { foundResultsFriend = true; } function createEmail(toName, fromName) { var _local1 = ""; _local1 = (((_local1 + "Hey ") + toName) + "!") + "<br>"; _local1 = ((_local1 + "Your friend, ") + fromName) + ", played a cool game on HotWheels.com and thought you'd want to play, too.<br>"; _local1 = ((((_local1 + "<a href=http://") + httphost) + "/email_redir.aspx?url=") + appPath) + ">Click here</a> to check it out.<br>"; _local1 = _local1 + "<br>"; _local1 = _local1 + "While you're at HotWheels.com, remember to play our other fun games.<br>"; _local1 = _local1 + "<br>"; _local1 = _local1 + "See ya there!<br>"; _local1 = _local1 + "<br>"; _local1 = _local1 + "P.S. Please don't send a reply to this e-mail. Instead, write back to the person who sent it to you. Thanks!<br>"; _local1 = _local1 + "P.P.S. If you're having trouble using the link, just copy and paste or type the web address below into your website browser line.<br>"; _local1 = ((((_local1 + "http://") + httphost) + "/email_redir.aspx?url=") + appPath) + "<br>"; _local1 = _local1 + "***************************************************************<br>"; _local1 = _local1 + "Need help copying and pasting? Here's how to do it:<br>"; _local1 = _local1 + "<br>"; _local1 = _local1 + "1. With your mouse, highlight the entire web address above.<br>"; _local1 = _local1 + "2. Select the EDIT menu and choose COPY.<br>"; _local1 = _local1 + "3. Go to your web browser and click inside the window where you normally type a web address to visit.<br>"; _local1 = _local1 + "4. Select the EDIT menu and choose PASTE. Now hit ENTER on your keyboard and you'll go right to the site!"; _local1 = _local1 + "***************************************************************<br>"; _local1 = _local1 + "&copy; 2008 Mattel, Inc. All Rights Reserved."; var _local2 = _local1.split("\u2122").join("(TM)"); _local1 = _local2; return(_local1); } var counter = 0; var wait = 200; conn = new mx.remoting.Connection(); conn.connect("/gateway.aspx"); var myEmailServices = (new mattel.utils.EmailServices(conn)); myEmailServices.addEventListener("onSend", this); var sendResult = "false"; invalid_your_name._visible = false; invalid_friend_name._visible = false; invalid_email._visible = false; problem_sending._visible = false; var mailOK = false; var friendOK = false; var yourOK = false; var sendNaughty = new LoadVars(); var recvNaughty = new LoadVars(); var foundResultsYour = false; var foundResultsFriend = false; var tryingToSend = false; var resultYour_lv; var resultFriend_lv; var app_naughtyCheck; app_naughtyCheck = "/common/checker.aspx"; onEnterFrame = function () { if (tryingToSend) { if (foundResultsYour && (foundResultsFriend)) { if ((resultYour_lv.answer == "N") && (resultFriend_lv.answer == "N")) { varSender = new LoadVars(); varReceiver = new LoadVars(); varSender.toName = friend_name.text; varSender.toEmail = friends_email.text; varSender.fromName = your_name.text; varSender.gameName = "webtradingcars"; varSender.sendAndLoad("/common/send_email.aspx", varReceiver, "Get"); gotoAndStop ("sentmail"); foundResultsYour = false; foundResultsFriend = false; tryingToSend = false; } else { if (resultYour_lv.answer == "Y") { invalid_your_name._visible = true; } if (resultFriend_lv.answer == "Y") { invalid_friend_name._visible = true; } foundResultsYour = false; foundResultsFriend = false; tryingToSend = false; } } } }; send_btn.onRelease = function () { submitEmail(); }; cancel_btn.onRelease = function () { fade("title"); }; friend_name.tabIndex = 1; friends_email.tabIndex = 2; your_name.tabIndex = 3; cancel_btn.tabIndex = 4; send_btn.tabIndex = 5; stop();
Frame 99
flash.external.ExternalInterface.call("MATTEL.tracker.Tracker.track", {name:"Web Trading Cars Chase", campaign:"Web Trading Cars", channel:"Games", contenttype:"Game", action:"Send"});
Frame 108
stop();
Frame 128
stop();
Symbol 25 MovieClip [DataGridAssets] Frame 1
#initclip 86 mx.controls.DataGrid.prototype.headerStyle = _global.styles.dataGridStyles; #endinitclip
Symbol 26 MovieClip [DataGridColumn] Frame 1
#initclip 87 Object.registerClass("DataGridColumn", mx.controls.gridclasses.DataGridColumn); #endinitclip stop();
Symbol 27 MovieClip [Defaults] Frame 1
#initclip 88 Object.registerClass("Defaults", mx.skins.halo.Defaults); #endinitclip
Symbol 28 MovieClip [UIObjectExtensions] Frame 1
#initclip 89 Object.registerClass("UIObjectExtensions", mx.core.ext.UIObjectExtensions); #endinitclip
Symbol 29 MovieClip [UIObject] Frame 1
#initclip 90 Object.registerClass("UIObject", mx.core.UIObject); #endinitclip stop();
Symbol 32 Button
on (keyPress "<Tab>") { this.tabHandler(); }
Symbol 33 MovieClip Frame 1
#initclip 91 Object.registerClass("FocusManager", mx.managers.FocusManager); if (_root.focusManager == undefined) { _root.createClassObject(mx.managers.FocusManager, "focusManager", mx.managers.DepthManager.highestDepth--); } #endinitclip
Symbol 34 MovieClip [FocusRect] Frame 1
#initclip 92 Object.registerClass("FocusRect", mx.skins.halo.FocusRect); #endinitclip
Symbol 35 MovieClip [FocusManager] Frame 1
#initclip 93 Object.registerClass("FocusManager", mx.managers.FocusManager); #endinitclip stop();
Symbol 36 MovieClip [UIComponentExtensions] Frame 1
#initclip 94 Object.registerClass("UIComponentExtensions", mx.core.ext.UIComponentExtensions); #endinitclip
Symbol 37 MovieClip [UIComponent] Frame 1
#initclip 95 Object.registerClass("UIComponent", mx.core.UIComponent); #endinitclip stop();
Symbol 38 MovieClip [SelectableRow] Frame 1
#initclip 96 Object.registerClass("SelectableRow", mx.controls.listclasses.SelectableRow); #endinitclip stop();
Symbol 39 MovieClip [DataGridRow] Frame 1
#initclip 97 Object.registerClass("DataGridRow", mx.controls.gridclasses.DataGridRow); #endinitclip stop();
Symbol 40 MovieClip [DataProvider] Frame 1
#initclip 98 Object.registerClass("DataProvider", mx.controls.listclasses.DataProvider); #endinitclip stop();
Symbol 41 MovieClip [DataSelector] Frame 1
#initclip 99 Object.registerClass("DataSelector", mx.controls.listclasses.DataSelector); #endinitclip stop();
Symbol 43 MovieClip [BrdrShdw] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "shadowColor");
Symbol 45 MovieClip [BrdrFace] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "buttonColor");
Symbol 48 MovieClip [BrdrBlk] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "borderColor");
Symbol 50 MovieClip [BrdrHilght] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "highlightColor");
Symbol 53 MovieClip [SimpleButton] Frame 1
#initclip 100 Object.registerClass("SimpleButton", mx.controls.SimpleButton); #endinitclip stop();
Symbol 54 MovieClip [Border] Frame 1
#initclip 101 Object.registerClass("Border", mx.skins.Border); #endinitclip stop();
Symbol 55 MovieClip [RectBorder] Frame 1
#initclip 102 mx.skins.SkinElement.registerElement(mx.skins.RectBorder.symbolName, Object(mx.skins.RectBorder)); Object.registerClass("RectBorder", mx.skins.halo.RectBorder); #endinitclip stop();
Symbol 56 MovieClip [ButtonSkin] Frame 1
#initclip 103 Object.registerClass("ButtonSkin", mx.skins.halo.ButtonSkin); #endinitclip
Symbol 57 MovieClip [Button] Frame 1
#initclip 104 Object.registerClass("Button", mx.controls.Button); #endinitclip stop();
Instance of Symbol 53 MovieClip [SimpleButton] in Symbol 57 MovieClip [Button] Frame 2
//component parameters onClipEvent (initialize) { selected = false; toggle = false; enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Symbol 58 MovieClip [CustomBorder] Frame 1
#initclip 105 Object.registerClass("CustomBorder", mx.skins.CustomBorder); mx.skins.SkinElement.registerElement("CustomBorder", mx.skins.CustomBorder); #endinitclip
Symbol 70 MovieClip [ScrollThemeColor1] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "themeColor");
Symbol 72 MovieClip [ScrollThemeColor2] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "themeColor");
Symbol 83 MovieClip [ThumbThemeColor1] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "themeColor");
Symbol 85 MovieClip [ThumbThemeColor3] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "themeColor");
Symbol 92 MovieClip [ThumbThemeColor2] Frame 1
mx.skins.ColoredSkinElement.setColorStyle(this, "themeColor");
Symbol 113 MovieClip [BtnDownArrow] Frame 1
#initclip 106 Object.registerClass("BtnDownArrow", mx.controls.SimpleButton); #endinitclip
Symbol 114 MovieClip [BtnUpArrow] Frame 1
#initclip 107 Object.registerClass("BtnUpArrow", mx.controls.SimpleButton); #endinitclip
Symbol 116 MovieClip [HScrollBar] Frame 1
#initclip 108 Object.registerClass("HScrollBar", mx.controls.HScrollBar); #endinitclip stop();
Instance of Symbol 57 MovieClip [Button] in Symbol 116 MovieClip [HScrollBar] Frame 2
//component parameters onClipEvent (initialize) { icon = ""; label = "Button"; labelPlacement = "right"; selected = false; toggle = false; enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Instance of Symbol 53 MovieClip [SimpleButton] in Symbol 116 MovieClip [HScrollBar] Frame 2
//component parameters onClipEvent (initialize) { selected = false; toggle = false; enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Symbol 117 MovieClip [VScrollBar] Frame 1
#initclip 109 Object.registerClass("VScrollBar", mx.controls.VScrollBar); #endinitclip stop();
Instance of Symbol 57 MovieClip [Button] in Symbol 117 MovieClip [VScrollBar] Frame 2
//component parameters onClipEvent (initialize) { icon = ""; label = "Button"; labelPlacement = "right"; selected = false; toggle = false; enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Instance of Symbol 53 MovieClip [SimpleButton] in Symbol 117 MovieClip [VScrollBar] Frame 2
//component parameters onClipEvent (initialize) { selected = false; toggle = false; enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Symbol 118 MovieClip [View] Frame 1
#initclip 110 Object.registerClass("View", mx.core.View); #endinitclip stop();
Symbol 119 MovieClip [ScrollView] Frame 1
#initclip 111 Object.registerClass("ScrollView", mx.core.ScrollView); #endinitclip stop();
Instance of Symbol 116 MovieClip [HScrollBar] in Symbol 119 MovieClip [ScrollView] Frame 2
//component parameters onClipEvent (initialize) { enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Instance of Symbol 117 MovieClip [VScrollBar] in Symbol 119 MovieClip [ScrollView] Frame 2
//component parameters onClipEvent (initialize) { enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Symbol 120 MovieClip [ScrollSelectList] Frame 1
#initclip 112 Object.registerClass("ScrollSelectList", mx.controls.listclasses.ScrollSelectList); #endinitclip stop();
Symbol 121 MovieClip [List] Frame 1
#initclip 113 Object.registerClass("List", mx.controls.List); #endinitclip stop();
Symbol 124 MovieClip [TextInput] Frame 1
#initclip 114 Object.registerClass("TextInput", mx.controls.TextInput); #endinitclip stop();
Symbol 125 MovieClip [DataGrid] Frame 1
#initclip 115 Object.registerClass("DataGrid", mx.controls.DataGrid); #endinitclip stop();
Instance of Symbol 121 MovieClip [List] in Symbol 125 MovieClip [DataGrid] Frame 2
//component parameters onClipEvent (initialize) { multipleSelection = false; rowHeight = 20; }
Instance of Symbol 124 MovieClip [TextInput] in Symbol 125 MovieClip [DataGrid] Frame 2
//component parameters onClipEvent (initialize) { editable = true; password = false; text = ""; maxChars = null; restrict = ""; enabled = true; visible = true; minHeight = 0; minWidth = 0; }
Symbol 162 MovieClip Frame 1
total = _root.getBytesTotal();
Symbol 162 MovieClip Frame 2
percent = _root.getBytesLoaded() / total; bar._xscale = percent * 100;
Symbol 162 MovieClip Frame 3
gotoAndPlay (2);
Symbol 169 MovieClip Frame 1
changeColor = function (percent) { _parent.myTransform.rb = 3 * percent; _parent.myTransform.gb = 3 * percent; _parent.myTransform.bb = 2.55 * percent; _parent.myColor.setTransform(_parent.myTransform); }; changeColor(0); stop();
Symbol 169 MovieClip Frame 2
_parent.sounds.transition.start(); changeColor(10);
Symbol 169 MovieClip Frame 3
changeColor(20); _root.sounds.fx.window.start();
Symbol 169 MovieClip Frame 4
changeColor(30);
Symbol 169 MovieClip Frame 5
changeColor(40);
Symbol 169 MovieClip Frame 6
changeColor(50);
Symbol 169 MovieClip Frame 7
changeColor(60);
Symbol 169 MovieClip Frame 8
changeColor(80);
Symbol 169 MovieClip Frame 9
changeColor(100); if (typeof(destination) == "function") { destination(); } else { _parent.gotoAndStop(destination); } _parent.sounds.fade.start();
Symbol 169 MovieClip Frame 10
changeColor(80);
Symbol 169 MovieClip Frame 11
changeColor(60);
Symbol 169 MovieClip Frame 12
changeColor(40);
Symbol 169 MovieClip Frame 13
changeColor(30);
Symbol 169 MovieClip Frame 14
play(); changeColor(20);
Symbol 169 MovieClip Frame 15
_parent.locked = false; play(); changeColor(10);
Symbol 688 MovieClip [__Packages.mx.remoting.debug.NetDebug] Frame 0
class mx.remoting.debug.NetDebug extends Object { static var ndSingleton; var _ncs, _config, _glc, _nextNewId; function NetDebug () { super(); _ncs = new Array(); _config = mx.remoting.debug.NetDebugConfig.getDefaultNetDebugConfig(false); _glc = new mx.remoting.debug.GlobalLocalConnection(false, this); _glc.sendCommand(new mx.remoting.debug.commands.GetConfig()); _nextNewId = 0; if (_global.System.onStatus == undefined) { _global.System.onStatus = globalOnStatus; } mx.remoting.NetServices.traceNetServices = traceNetServices; } function addNetConnection(nc) { _ncs.push(nc); return(_nextNewId++); } function requestNewConfig() { return(sendCommand(new mx.remoting.debug.commands.GetConfig())); } function removeNetConnection(nc) { var _local3 = _ncs.length; var _local2 = 0; while (_local2 < _local3) { if (nc == _ncs[_local2]) { _ncs.splice(_local2, 1); break; } _local2++; } } function sendDebugEvent(eventobj) { if (!_glc.send(eventobj)) { _glc.send(new mx.remoting.debug.events.NetDebugFailedSendError(stripNCDEventToMinmal(eventobj))); return(false); } return(true); } function sendCommand(commandobj) { return(_glc.sendCommand(commandobj)); } function updateConfig(config) { mx.utils.ObjectCopy.copyProperties(_config, config); var _local3 = _ncs.length; var _local2 = 0; while (_local2 < _local3) { if (_ncs[_local2] != null) { _ncs[_local2].updateConfig(config); } _local2++; } } function sendStatus(statusobj) { if (_config.m_debug && (_config.client.m_debug)) { return(_glc.send(new mx.remoting.debug.events.NetDebugStatus(statusobj))); } } function onEvent(eventObj) { return(sendDebugEvent(eventObj)); } function onEventError(errorObj) { return(sendDebugEvent(new mx.remoting.debug.events.NetDebugError(errorObj))); } function onReceiveCommand(commandobj) { this[commandobj.command](commandobj.data); } function onReceiveError(errorobj) { sendDebugEvent(new mx.remoting.debug.events.NetDebugError(errorobj)); } function getConfig() { return(_config); } static function getNetDebug() { return(ndSingleton); } static function trace(obj) { getNetDebug()._trace(obj); } static function traceNetServices(who, severity, number, message) { getNetDebug()._traceNetServices(who, severity, number, message); } static function globalOnStatus(statusobj) { getNetDebug().sendStatus(statusobj); } static function initialize() { if (ndSingleton == null) { ndSingleton = new mx.remoting.debug.NetDebug(); mx.remoting.debug.ConnectionMixin.initialize(); } return(true); } static function stripNCDEventToMinmal(ev) { var _local2 = new Object(); if (ev.eventType != null) { _local2.eventType = ev.eventType; } if (ev.source != null) { _local2.source = ev.source; } if (ev.movieUrl != null) { _local2.movieUrl = ev.movieUrl; } if (ev.date != null) { _local2.date = ev.date; } if (ev.time != null) { _local2.time = ev.time; } if (ev.protocol != null) { _local2.protocol = ev.protocol; } if (ev.debugId != null) { _local2.debugId = ev.debugId; } return(_local2); } function _traceNetServices(who, severity, number, message) { if ((_config.m_debug && (_config.client.m_debug)) && (_config.client.trace)) { if (!sendDebugEvent(new mx.remoting.debug.events.NetDebugTraceNetServices(who, severity, number, message))) { } } } function _trace(traceobj) { if ((_config.m_debug && (_config.client.m_debug)) && (_config.client.trace)) { if (!sendDebugEvent(new mx.remoting.debug.events.NetDebugTrace(traceobj))) { } } } static var version = "1.2.0.124"; }
Symbol 689 MovieClip [__Packages.mx.remoting.debug.NetDebugConfig] Frame 0
class mx.remoting.debug.NetDebugConfig extends Object { function NetDebugConfig () { super(); Object.registerClass("NetDebugConfig", mx.remoting.debug.NetDebugConfig); } static function getNetDebugVersion() { return(1); } static function attachNetDebugConfigFunctions(ndc) { ndc.setDebug = function (setval) { this.m_debug = setval; }; ndc.getDebug = function () { return(this.m_debug); }; for (var _local3 in ndc) { if (typeof(ndc[_local3]) == "object") { attachNetDebugConfigFunctions(ndc[_local3]); } } return(null); } static function getDefaultNetDebugConfig(isController) { if (_global.netDebugConfigSO == undefined) { var _local2 = "TestMovie_Config_Info"; if (isController) { _local2 = "Controller_Config_Info"; } _global.netDebugConfigSO = SharedObject.getLocal(_local2); } if (_global.netDebugConfigSO.data.config == undefined) { _global.netDebugConfigSO.data.config = getRealDefaultNetDebugConfig(); } _global.netDebugConfigSO.flush(); return(_global.netDebugConfigSO.data.config); } static function getRealDefaultNetDebugConfig() { var _local1 = new mx.remoting.debug.NetDebugConfig(); _local1.m_debug = true; _local1.client = new mx.remoting.debug.NetDebugConfig(); _local1.client.m_debug = true; _local1.client.trace = true; _local1.client.recordset = true; _local1.client.http = true; _local1.client.rtmp = true; _local1.realtime_server = new mx.remoting.debug.NetDebugConfig(); _local1.realtime_server.m_debug = true; _local1.realtime_server.trace = true; _local1.app_server = new mx.remoting.debug.NetDebugConfig(); _local1.app_server.m_debug = true; _local1.app_server.trace = true; _local1.app_server.error = true; _local1.app_server.recordset = true; _local1.app_server.httpheaders = false; _local1.app_server.amf = false; _local1.app_server.amfheaders = false; _local1.app_server.coldfusion = true; return(_local1); } }
Symbol 690 MovieClip [__Packages.mx.remoting.debug.GlobalLocalConnection] Frame 0
class mx.remoting.debug.GlobalLocalConnection extends Object { var maxConnections, sendNames, sendPrefix; function GlobalLocalConnection (isController, receiver, domainName) { super(); maxConnections = 10; var _local6 = "_NetDebugLocalToDebugMovie"; var _local8 = "_NetDebugLocalToController"; var _local5 = null; if (isController) { _local5 = _local8; sendNames = new Array(); sendNames.push(_local6); var _local4 = 0; while (_local4 < maxConnections) { sendNames.push(_local6 + _local4); _local4++; } maxConnections = 0; } else { _local5 = _local6; sendNames = new Array(); sendNames.push(_local8); } setDomainName(domainName); if (_global.g_NetDebugLocalConnection == undefined) { _global.g_NetDebugLocalConnection = new LocalConnection(); _global.g_NetDebugLocalConnection.allowDomain = function () { return(true); }; } if (receiver != null) { _global.g_NetDebugLocalConnection.m_Receiver = receiver; _global.g_NetDebugLocalConnection.onData = function (dataobj) { _global.g_NetDebugLocalConnection.m_Receiver.onReceive(dataobj); }; _global.g_NetDebugLocalConnection.onCommand = function (commandobj) { _global.g_NetDebugLocalConnection.m_Receiver.onReceiveCommand(commandobj); }; if (!_global.g_NetDebugLocalConnection.connect(_local5)) { var _local7 = false; var _local4 = 0; while (_local4 < maxConnections) { if (_global.g_NetDebugLocalConnection.connect(_local5 + _local4)) { _local7 = true; break; } _local4++; } if (!_local7) { if (isController) { receiver.onReceiveError(new mx.remoting.debug.events.NetDebugDuplicateNCDError()); } } } } } function setDomainName(domainName) { if ((domainName != null) && (domainName != "")) { sendPrefix = domainName + ":"; } else { sendPrefix = ""; } } function send(dataobj) { return(sendRaw("onData", dataobj)); } function sendCommand(commandObj) { return(sendRaw("onCommand", commandObj)); } function sendRaw(functionName, obj) { var _local4 = true; var _local5 = sendNames.length; var _local3 = 0; while (_local3 < _local5) { _local4 = Boolean(_local4 & _global.g_NetDebugLocalConnection.send(sendPrefix + sendNames[_local3], functionName, obj)); _local3++; } return(_local4); } }
Symbol 691 MovieClip [__Packages.mx.remoting.debug.events.NetDebug] Frame 0
class mx.remoting.debug.events.NetDebug extends Object { var eventType, source, movieUrl, date, time; function NetDebug () { super(); init(); } function init() { eventType = "DebugEvent"; source = "Client"; movieUrl = unescape(_root._url); initDate(); } function initDate() { var _local2 = new Date(); date = _local2; time = _local2.getTime(); } }
Symbol 692 MovieClip [__Packages.mx.remoting.debug.events.NetDebugNetConnection] Frame 0
class mx.remoting.debug.events.NetDebugNetConnection extends mx.remoting.debug.events.NetDebug { function NetDebugNetConnection () { super(); } }
Symbol 693 MovieClip [__Packages.mx.remoting.debug.events.NetDebugDuplicateNCDError] Frame 0
class mx.remoting.debug.events.NetDebugDuplicateNCDError extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, source, message; function NetDebugDuplicateNCDError () { super(); eventType = "Error"; source = "NCD"; message = "NCD_ALREADY_RUNNING"; } }
Symbol 694 MovieClip [__Packages.mx.remoting.debug.commands.Local] Frame 0
class mx.remoting.debug.commands.Local extends Object { var command, data; function Local () { super(); } function init(commandname, dataobj) { command = commandname; data = dataobj; } }
Symbol 695 MovieClip [__Packages.mx.remoting.debug.commands.GetConfig] Frame 0
class mx.remoting.debug.commands.GetConfig extends mx.remoting.debug.commands.Local { var init; function GetConfig () { super(); } function GetConfigCommand() { super(); init("getConfig", null); } }
Symbol 696 MovieClip [__Packages.mx.remoting.NetServices] Frame 0
class mx.remoting.NetServices extends Object { static var defaultGatewayUrl, logger, traceNetServices; function NetServices () { super(); } static function setDefaultGatewayUrl(url) { defaultGatewayUrl = url; } static function setGatewayUrl(url) { gatewayUrl = url; } static function createGatewayConnection(url, infoLogger) { logger = infoLogger; if (url == undefined) { url = gatewayUrl; if (url == undefined) { url = defaultGatewayUrl; } } if (url == undefined) { trace("NetServices", "warning", 4, "createGatewayConnection - gatewayUrl is undefined"); logger.logInfo(("NetServices: createGatewayConnection - gateway url <" + url) + "> is undefined", mx.services.Log.DEBUG); return(null); } var _local2 = new mx.remoting.Connection(); _local2.connect(url); __sharedConnections[url] = _local2; return(_local2); } static function getConnection(uri) { return(__sharedConnections[uri]); } static function getHostUrl() { if (!isHttpUrl(_root._url)) { trace("NetServices", "warning", 4, "createGatewayConnection - gatewayUrl is invalid"); return(null); } var _local2 = _root._url.indexOf("/", 8); if (_local2 < 0) { trace("NetServices", "warning", 4, "createGatewayConnection - gatewayUrl is invalid"); return(null); } return(_root._url.substring(0, _local2)); } static function isHttpUrl(url) { return((url.indexOf("http://") == 0) || (url.indexOf("https://") == 0)); } static function getHttpUrl(url) { if (!isHttpUrl(url)) { url = getHostUrl() + url; } return(url); } static function trace(who, severity, number, message) { traceNetServices(who, severity, number, message); } static var version = "1.2.0.124"; static var gatewayUrl = _root.gatewayUrl; static var __sharedConnections = new Array(); }
Symbol 697 MovieClip [__Packages.mx.services.Log] Frame 0
class mx.services.Log { var level, name; function Log (logLevel, name) { level = ((logLevel == undefined) ? (BRIEF) : (logLevel)); this.name = ((name == undefined) ? "" : (name)); } function logInfo(msg, level) { if (level == undefined) { level = BRIEF; } if (level <= this.level) { if (level == DEBUG) { onLog((((getDateString() + " [DEBUG] ") + name) + ": ") + msg); } else { onLog((((getDateString() + " [INFO] ") + name) + ": ") + msg); } } } function logDebug(msg) { logInfo(msg, DEBUG); } function getDateString() { var _local1 = new Date(); return(((((((((_local1.getMonth() + 1) + "/") + _local1.getDate()) + " ") + _local1.getHours()) + ":") + _local1.getMinutes()) + ":") + _local1.getSeconds()); } function onLog(message) { trace(message); } static var NONE = -1; static var BRIEF = 0; static var VERBOSE = 1; static var DEBUG = 2; }
Symbol 698 MovieClip [__Packages.mx.remoting.Connection] Frame 0
class mx.remoting.Connection extends NetConnection { var uri, __urlSuffix, __originalUrl; function Connection () { super(); } function getService(serviceName, client) { var _local2 = new mx.remoting.NetServiceProxy(this, serviceName, client); return(_local2); } function setCredentials(userId, password) { addHeader("Credentials", false, {userid:userId, password:password}); } function clone() { var _local2 = new mx.remoting.Connection(); _local2.connect(uri); return(_local2); } function getDebugId() { return(null); } function getDebugConfig() { return(null); } function setDebugId(id) { } function updateConfig() { } function call() { super.call.apply(super, arguments); } function close() { super.close(); } function connect(url) { return(super.connect(url)); } function addHeader(name, mustUnderstand, obj) { super.addHeader(name, mustUnderstand, obj); } function trace(traceObj) { } function AppendToGatewayUrl(urlSuffix) { __urlSuffix = urlSuffix; if (__originalUrl == null) { __originalUrl = uri; } var _local2 = __originalUrl + urlSuffix; connect(_local2); } function ReplaceGatewayUrl(newUrl) { connect(newUrl); } function RequestPersistentHeader(info) { addHeader(info.name, info.mustUnderstand, info.data); } static var version = "1.2.0.124"; }
Symbol 699 MovieClip [__Packages.mx.remoting.NetServiceProxy] Frame 0
class mx.remoting.NetServiceProxy extends Object { var nc, serviceName, client; function NetServiceProxy (netC, servName, cli) { super(); if (netC != null) { nc = netC; serviceName = servName; client = cli; } _allowRes = true; } function _setParentService(service) { nc = service.nc; client = service.client; } function __resolve(methodName) { if (_allowRes) { var _local3 = function () { if (this.client != null) { arguments.unshift(new mx.remoting.NetServiceProxyResponder(this, methodName)); } else if (typeof(arguments[0].onResult) != "function") { mx.remoting.NetServices.trace("NetServices", "warning", 3, "There is no defaultResponder, and no responder was given in call to " + methodName); arguments.unshift(new mx.remoting.NetServiceProxyResponder(this, methodName)); } if (typeof(this.serviceName) == "function") { this.serviceName = this.servicename; } arguments.unshift((this.serviceName + ".") + methodName); return(this.nc.call.apply(this.nc, arguments)); }; return(_local3); } return(null); } static function registerNetServiceProxy() { Object.registerClass("NetServiceProxy", mx.remoting.NetServiceProxy); return(true); } static var init = registerNetServiceProxy(); var _allowRes = false; }
Symbol 700 MovieClip [__Packages.mx.remoting.NetServiceProxyResponder] Frame 0
class mx.remoting.NetServiceProxyResponder extends Object { var service, methodName; function NetServiceProxyResponder (serv, method) { super(); service = serv; methodName = method; } function onResult(result) { var _local2 = service.client; if ((result instanceof mx.remoting.NetServiceProxy) || (result instanceof mx.remoting.RecordSet)) { result._setParentService(service); } var _local4 = methodName + "_Result"; if (typeof(_local2[_local4]) == "function") { _local2[_local4].apply(_local2, [result]); } else if (typeof(_local2.onResult) == "function") { _local2.onResult(result); } else { mx.remoting.NetServices.trace("NetServices", "info", 1, (_local4 + " was received from server: ") + result); } } function onStatus(result) { var _local4 = service.client; var _local6 = methodName + "_Status"; if (typeof(_local4[_local6]) == "function") { _local4[_local6].apply(_local4, [result]); } else if (typeof(_local4.onStatus) == "function") { _local4.onStatus(result); } else if (typeof(_root.onStatus) == "function") { _root.onStatus(result); } else if (typeof(_global.System.onStatus) == "function") { _global.System.onStatus(result); } else { mx.remoting.NetServices.trace("NetServices", "info", 2, (((_local6 + " was received from server: <") + result.level) + "> ") + result.description); } } }
Symbol 701 MovieClip [__Packages.mx.data.PageableData] Frame 0
interface mx.data.PageableData { }
Symbol 702 MovieClip [__Packages.mx.data.DataRange] Frame 0
interface mx.data.DataRange { }
Symbol 703 MovieClip [__Packages.mx.data.PageableList] Frame 0
interface mx.data.PageableList extends mx.data.PageableData { }
Symbol 704 MovieClip [__Packages.mx.remoting.RecordSet] Frame 0
class mx.remoting.RecordSet extends Object implements mx.data.PageableList { var _items, uniqueID, mTitles, serverInfo, serverinfo, mRecordsAvailable, mRecordSetID, serviceName, mTotalCount, mDeliveryMode, mAllNotified, mOutstandingRecordCount, dispatchEvent, mPageSize, mNumPrefetchPages, mRecordSetService, gateway_conn, logger, mDataFetcher; function RecordSet (columnNames) { super(); mx.events.EventDispatcher.initialize(this); _items = new Array(); uniqueID = 0; if (mTitles != null) { return; } if (serverInfo == null) { if (serverinfo != null) { serverInfo = serverinfo; } } if (serverInfo == null) { mTitles = columnNames; return; } if (serverInfo.version != 1) { mx.remoting.NetServices.trace("RecordSet", "warning", 100, "Received incompatible RecordSet version from server"); return; } mTitles = serverInfo.columnNames; mRecordsAvailable = 0; setData(((serverInfo.cursor == null) ? 0 : (serverInfo.cursor - 1)), serverInfo.initialData); if (serverInfo.initialData.length != serverInfo.totalCount) { mRecordSetID = serverInfo.id; if (mRecordSetID != null) { serviceName = ((serverInfo.serviceName == null) ? "RecordSet" : (serverInfo.serviceName)); mTotalCount = serverInfo.totalCount; mDeliveryMode = "ondemand"; mAllNotified = false; mOutstandingRecordCount = 0; } else { mx.remoting.NetServices.trace("RecordSet", "warning", 102, "Missing some records, but there's no RecordSet id"); } } serverInfo = null; } function addItem(item) { addItemAt(length, item); } function addItemAt(index, item) { var _local3 = true; if ((index < length) && (index >= 0)) { items.splice(index, 0, item); } else if (index == length) { items[index] = item; } else { _local3 = false; mx.remoting.NetServices.trace("Cannot add an item outside the bounds of the RecordSet"); return(undefined); } if (_local3) { item.__ID__ = uniqueID++; } updateViews("addItems", index, index); } function addEventListener(event, listener) { } function clear() { if (checkLocal()) { return(undefined); } var _local2 = items.length; items.splice(0); uniqueID = 0; updateViews("removeItems", 0, _local2); } function contains(itmToCheck) { if (isObjectEmpty(itmToCheck)) { return(false); } var _local5; var _local4; var _local2 = 0; while (_local2 < items.length) { _local5 = items[_local2]; _local4 = true; for (var _local6 in itmToCheck) { if (itmToCheck[_local6] != _local5[_local6]) { _local4 = false; break; } } if (_local4) { return(true); } _local2++; } return(false); } function getColumnNames() { return(mTitles); } function get columnNames() { return(getColumnNames()); } function getLocalLength() { return(items.length); } function getLength() { if (mRecordSetID != null) { return(mTotalCount); } return(items.length); } function getIterator() { var _local2 = new mx.remoting.RecordSetIterator(this); return(_local2); } function get length() { return(getLength()); } function getItemAt(index) { if ((index < 0) || (index >= length)) { return(null); } if (mRecordSetID == null) { return(items[index]); } requestRecord(index); var _local3 = items[index]; if (_local3 == 1) { return("in progress"); } return(_local3); } function getItemID(index) { return(items[index].__ID__); } function get items() { return(_items); } function initialize(info) { } function filter(filterFunction, context) { if (checkLocal()) { return(undefined); } var _local4 = new mx.remoting.RecordSet(mTitles); var _local5 = length; var _local3 = 0; while (_local3 < _local5) { var _local2 = getItemAt(_local3); if (((_local2 != null) && (_local2 != 1)) && (filterFunction(_local2, context))) { _local4.addItem(_local2); } _local3++; } return(_local4); } function sortItems(compareFunc, optionFlags) { if (checkLocal()) { return(undefined); } items.sort(compareFunc, optionFlags); updateViews("sort"); } function sortItemsBy(fieldNames, order, optionFlags) { if (checkLocal()) { return(undefined); } if (typeof(order) == "string") { items.sortOn(fieldNames); if (order.toUpperCase() == "DESC") { items.reverse(); } } else { items.sortOn(fieldNames, optionFlags); } updateViews("sort"); } function sort(compareFunc) { if (checkLocal()) { return(undefined); } items.sort(compareFunc); updateViews("sort"); } function isEmpty() { return(items.length == 0); } function isLocal() { return(mRecordSetID == null); } function isFullyPopulated() { return(isLocal()); } function getRemoteLength() { if (isLocal()) { return(mRecordsAvailable); } return(mTotalCount); } function getNumberAvailable() { if (isLocal()) { return(getLength()); } return(mRecordsAvailable); } function replaceItemAt(index, item) { if ((index >= 0) && (index <= length)) { var _local3 = getItemID(index); items[index] = item; items[index].__ID__ = _local3; updateViews("updateItems", index, index); } } function removeAll() { clear(); } function removeItemAt(index) { var _local3 = _items[index]; _items.splice(index, 1); var _local5 = [_items[index]]; var _local4 = [getItemID(index)]; dispatchEvent({type:"modelChanged", eventName:"removeItems", firstItem:index, lastItem:index, removedItems:_local5, removedIDs:_local4}); return(_local3); } function removeEventListener(event, listener) { } function requestRange(range) { var _local2 = range.getStart(); var _local3 = range.getEnd(); return(internalRequestRange(_local2, _local3)); } function setDeliveryMode(mode, pagesize, numPrefetchPages) { mDeliveryMode = mode.toLowerCase(); stopFetchAll(); if ((pagesize == null) || (pagesize <= 0)) { pagesize = 25; } switch (mDeliveryMode) { case "ondemand" : break; case "page" : if (numPrefetchPages == null) { numPrefetchPages = 0; } mPageSize = pagesize; mNumPrefetchPages = numPrefetchPages; break; case "fetchall" : stopFetchAll(); startFetchAll(pagesize); break; default : mx.remoting.NetServices.trace("RecordSet", "warning", 107, "SetDeliveryMode: unknown mode string"); } } function editField(index, fieldName, value) { changeFieldValue(index, fieldName, value); } function getEditingData(index, fieldName) { return(items[index][fieldName]); } function setField(index, fieldName, value) { changeFieldValue(index, fieldName, value); } function changeFieldValue(index, fieldName, value) { if (checkLocal()) { return(undefined); } if ((index < 0) || (index >= getLength())) { return(undefined); } items[index][fieldName] = value; updateViews("updateItems", index, index); } function isObjectEmpty(objToCheck) { var _local1 = true; for (var _local3 in objToCheck) { _local1 = false; return(_local1); } return(_local1); } function arrayToObject(anArray) { if (mTitles == null) { mx.remoting.NetServices.trace("RecordSet", "warning", 105, "getItem: titles are not available"); return(null); } var _local4 = new Object(); var _local5 = anArray.length; var _local3; var _local2 = 0; while (_local2 < _local5) { _local3 = mTitles[_local2]; if (_local3 == null) { _local3 = ("column" + _local2) + 1; } _local4[_local3] = anArray[_local2]; _local2++; } return(_local4); } function checkLocal() { if (isLocal()) { return(false); } mx.remoting.NetServices.trace("RecordSet", "warning", 108, "Operation not allowed on partial recordset"); return(true); } function getRecordSetService() { if (mRecordSetService == null) { if (gateway_conn == null) { gateway_conn = mx.remoting.NetServices.createGatewayConnection(); } else if (_global.netDebugInstance != undefined) { gateway_conn = gateway_conn.clone(); } if (_global.netDebugInstance != undefined) { gateway_conn.setupRecordSet(); gateway_conn.setDebugId("RecordSet " + mRecordSetID); } mRecordSetService = gateway_conn.getService(serviceName, this); if (mRecordSetService == null) { mx.remoting.NetServices.trace("RecordSet", "warning", 101, "Failed to create RecordSet service"); mRecordSetService = null; } } return(mRecordSetService); } function internalRequestRange(index, lastIndex) { var _local6 = -1; if (index < 0) { index = 0; } if (lastIndex >= getRemoteLength()) { lastIndex = getRemoteLength() - 1; } var _local3; var _local4; while (index <= lastIndex) { while ((index <= lastIndex) && (items[index] != null)) { index++; } _local3 = index; while ((index <= lastIndex) && (items[index] == null)) { mOutstandingRecordCount++; items[index] = 1; index++; } _local4 = index - 1; if (_local3 <= _local4) { logger.logInfo((((" Fetching records from index [" + _local3) + "] to index [") + _local4) + "]"); getRecordSetService().getRecords(mRecordSetID, _local3 + 1, (_local4 - _local3) + 1); _local6 = _local4; updateViews("fetchRows", _local3, _local4); } } return(_local6); } function removeItems(index, len) { var _local3 = new Array(); var _local2 = 0; while (_local2 < len) { _local3.push(getItemID(index + _local2)); _local2++; } var _local6 = items.splice(index, len); dispatchEvent({type:"modelChanged", eventName:"removeItems", firstItem:index, lastItem:(index + len) - 1, removedItems:_local6, removedIDs:_local3}); } function getRecords_Result(info) { setData(info.Cursor - 1, info.Page); mOutstandingRecordCount = mOutstandingRecordCount - info.Page.length; updateViews("updateItems", info.Cursor - 1, ((info.Cursor - 1) + info.Page.length) - 1); if ((mRecordsAvailable == mTotalCount) && (!mAllNotified)) { updateViews("allRows"); mRecordSetService.release(); mAllNotified = true; mRecordSetID = null; mRecordSetService = null; } } function release_Result() { } function requestOneRecord(index) { if (items[index] == null) { if (mDeliveryMode == "ondemand") { logger.logInfo((" INFO: Fetching Record [" + index) + "]"); } getRecordSetService().getRecords(mRecordSetID, index + 1, 1); mOutstandingRecordCount++; items[index] = 1; updateViews("fetchRows", index, index); } } function requestRecord(index) { if (mDeliveryMode != "page") { requestOneRecord(index); } else { var _local2 = int(index / mPageSize) * mPageSize; var _local3 = (_local2 + (mPageSize * (mNumPrefetchPages + 1))) - 1; internalRequestRange(_local2, _local3); } } function _setParentService(service) { gateway_conn = service.nc; } function setData(start, dataArray) { var _local5 = dataArray.length; var _local3; var _local4; var _local2 = 0; while (_local2 < _local5) { _local3 = _local2 + start; _local4 = items[_local3]; if ((_local4 != null) && (_local4 != 1)) { mx.remoting.NetServices.trace("RecordSet", "warning", 106, "Already got record # " + _local3); } else { mRecordsAvailable = mRecordsAvailable + 1; } items[_local3] = arrayToObject(dataArray[_local2]); items[_local3].__ID__ = uniqueID++; _local2++; } } function startFetchAll(pagesize) { if (mDataFetcher != null) { mDataFetcher.disable(); } mDataFetcher = new mx.remoting.RsDataFetcher(this, pagesize); } function stopFetchAll() { mDataFetcher.disable(); mDataFetcher = null; } function updateViews(event, first, last) { dispatchEvent({type:"modelChanged", eventName:event, firstItem:first, lastItem:last}); } static function registerRecordSet() { Object.registerClass("RecordSet", mx.remoting.RecordSet); return(true); } static var version = "1.2.0.124"; static var init = registerRecordSet(); }
Symbol 6 MovieClip [__Packages.mx.events.EventDispatcher] Frame 0
class mx.events.EventDispatcher { function EventDispatcher () { } static function _removeEventListener(queue, event, handler) { if (queue != undefined) { var _local4 = queue.length; var _local1; _local1 = 0; while (_local1 < _local4) { var _local2 = queue[_local1]; if (_local2 == handler) { queue.splice(_local1, 1); return(undefined); } _local1++; } } } static function initialize(object) { if (_fEventDispatcher == undefined) { _fEventDispatcher = new mx.events.EventDispatcher(); } object.addEventListener = _fEventDispatcher.addEventListener; object.removeEventListener = _fEventDispatcher.removeEventListener; object.dispatchEvent = _fEventDispatcher.dispatchEvent; object.dispatchQueue = _fEventDispatcher.dispatchQueue; } function dispatchQueue(queueObj, eventObj) { var _local7 = "__q_" + eventObj.type; var _local4 = queueObj[_local7]; if (_local4 != undefined) { var _local5; for (_local5 in _local4) { var _local1 = _local4[_local5]; var _local3 = typeof(_local1); if ((_local3 == "object") || (_local3 == "movieclip")) { if (_local1.handleEvent != undefined) { _local1.handleEvent(eventObj); } if (_local1[eventObj.type] != undefined) { if (exceptions[eventObj.type] == undefined) { _local1[eventObj.type](eventObj); } } } else { _local1.apply(queueObj, [eventObj]); } } } } function dispatchEvent(eventObj) { if (eventObj.target == undefined) { eventObj.target = this; } this[eventObj.type + "Handler"](eventObj); dispatchQueue(this, eventObj); } function addEventListener(event, handler) { var _local3 = "__q_" + event; if (this[_local3] == undefined) { this[_local3] = new Array(); } _global.ASSetPropFlags(this, _local3, 1); _removeEventListener(this[_local3], event, handler); this[_local3].push(handler); } function removeEventListener(event, handler) { var _local2 = "__q_" + event; _removeEventListener(this[_local2], event, handler); } static var _fEventDispatcher = undefined; static var exceptions = {move:1, draw:1, load:1}; }
Symbol 705 MovieClip [__Packages.mx.utils.Iterator] Frame 0
interface mx.utils.Iterator { }
Symbol 706 MovieClip [__Packages.mx.remoting.RecordSetIterator] Frame 0
class mx.remoting.RecordSetIterator implements mx.utils.Iterator { var _recordSet, _cursor; function RecordSetIterator (rec) { _recordSet = rec; _cursor = 0; } function hasNext() { return(_cursor < _recordSet.getLength()); } function next() { return(_recordSet.getItemAt(_cursor++)); } static var version = "1.2.0.124"; }
Symbol 707 MovieClip [__Packages.mx.remoting.RsDataFetcher] Frame 0
class mx.remoting.RsDataFetcher extends Object { var mRecordSet, mIncrement, mNextRecord, mEnabled, mHighestRequested; function RsDataFetcher (pgRS, increment) { super(); mRecordSet = pgRS; mRecordSet.addEventListener("modelChanged", this); mIncrement = increment; mNextRecord = 0; mEnabled = true; doNext(); } function disable() { mEnabled = false; } function doNext() { if (mEnabled) { while (true) { if (mNextRecord >= mRecordSet.getRemoteLength()) { return(undefined); } var _local2 = new mx.remoting.RsDataRange(mNextRecord, (mNextRecord + mIncrement) - 1); mHighestRequested = mRecordSet.requestRange(_local2); mNextRecord = mNextRecord + mIncrement; if (mHighestRequested > 0) { return(undefined); } } } } function modelChanged(eventObj) { if (((eventObj.eventName == "updateItems") && (eventObj.firstItem <= mHighestRequested)) && (eventObj.lastItem >= mHighestRequested)) { doNext(); } if (eventObj.eventName == "allRows") { disable(); } } }
Symbol 708 MovieClip [__Packages.mx.remoting.RsDataRange] Frame 0
class mx.remoting.RsDataRange extends Object implements mx.data.DataRange { var _start, _end; function RsDataRange (s, e) { super(); _start = s; _end = e; } function getStart() { return(_start); } function getEnd() { return(_end); } function setEnd(e) { _end = e; } function setStart(s) { _start = s; } }
Symbol 709 MovieClip [__Packages.mx.remoting.debug.events.NetDebugFailedSendError] Frame 0
class mx.remoting.debug.events.NetDebugFailedSendError extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, source, originalEvent, message; function NetDebugFailedSendError (ev) { super(); eventType = "Error"; source = "NCD"; originalEvent = ev; message = "NCD_FAILED_TO_SEND_EVENT"; } }
Symbol 710 MovieClip [__Packages.mx.utils.ObjectCopy] Frame 0
class mx.utils.ObjectCopy { function ObjectCopy () { } static function copy(refObj) { var _local1 = new Function(refObj.__proto__.constructor)(); copyProperties(_local1, refObj); return(_local1); } static function copyProperties(dstObj, srcObj) { var _local6; for (var _local7 in srcObj) { _local6 = typeof(srcObj[_local7]); if (_local6 != "function") { if (_local6 == "object") { if (srcObj[_local7] instanceof Array) { var _local5 = new Array(); var _local3 = srcObj[_local7]; var _local2 = 0; while (_local2 < _local3.length) { _local5[_local2] = _local3[_local2]; _local2++; } dstObj[_local7] = _local5; } else if (srcObj[_local7] instanceof String) { dstObj[_local7] = new String(srcObj[_local7]); } else if (srcObj[_local7] instanceof Number) { dstObj[_local7] = new Number(srcObj[_local7]); } else if (srcObj[_local7] instanceof Boolean) { dstObj[_local7] = new Boolean(srcObj[_local7]); } else { dstObj[_local7] = copy(srcObj[_local7]); } } else { dstObj[_local7] = srcObj[_local7]; } } } } }
Symbol 711 MovieClip [__Packages.mx.remoting.debug.events.NetDebugStatus] Frame 0
class mx.remoting.debug.events.NetDebugStatus extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, status; function NetDebugStatus (statusobj) { super(); eventType = "Status"; status = statusobj; } }
Symbol 712 MovieClip [__Packages.mx.remoting.debug.events.NetDebugError] Frame 0
class mx.remoting.debug.events.NetDebugError extends mx.remoting.debug.events.NetDebug { var eventType, error; function NetDebugError (dataobj) { super(); eventType = "NetDebugError"; error = dataobj; } }
Symbol 713 MovieClip [__Packages.mx.remoting.debug.ConnectionMixin] Frame 0
class mx.remoting.debug.ConnectionMixin extends Object { var _headerAdded, _configured, _config, _protocol, _id, realAddHeader, _connectString, realConnect, realCall, _clientId, realClose; function ConnectionMixin () { super(); } static function initialize() { var _local1 = mx.remoting.Connection.prototype; var _local2 = mx.remoting.debug.ConnectionMixin.prototype; if (!_local1.netDebugProxyFunctions) { _local1.netDebugProxyFunctions = true; _local1.realConnect = _local1.connect; _local1.realCall = _local1.call; _local1.realClose = _local1.close; _local1.realAddHeader = _local1.addHeader; _local1.connect = _local2.netDebugProxyConnect; _local1.call = _local2.netDebugProxyCall; _local1.close = _local2.netDebugProxyClose; _local1.addHeader = _local2.netDebugProxyAddHeader; _local1.attachDebug = _local2.attachDebug; _local1.sendDebugEvent = _local2.sendDebugEvent; _local1.sendServerEvent = _local2.sendServerEvent; _local1.sendClientEvent = _local2.sendClientEvent; _local1.addNetDebugHeader = _local2.addNetDebugHeader; _local1.updateConfig = _local2.updateConfig; _local1.getNetDebug = _local2.getNetDebug; _local1.isRealTime = _local2.isRealTime; _local1.setupRecordSet = _local2.setupRecordSet; _local1.setDebugId = _local2.setDebugId; _local1.getDebugId = _local2.getDebugId; _local1.getDebugConfig = _local2.getDebugConfig; _local1.trace = _local2.trace; return(true); } return(false); } function attachDebug() { if (!_attached) { _attached = true; _headerAdded = false; _configured = false; _config = new mx.remoting.debug.NetDebugConfig(); mx.utils.ObjectCopy.copyProperties(_config, getNetDebug().getConfig()); _protocol = "none"; _id = String(getNetDebug().addNetConnection(NetConnection(this))); } } function sendDebugEvent(eventobj) { eventobj.protocol = _protocol; eventobj.debugId = _id; return(getNetDebug().onEvent(eventobj)); } function sendServerEvent(eventobj) { eventobj.movieUrl = unescape(_root._url); if (!sendDebugEvent(eventobj)) { } } function sendClientEvent(eventobj) { if (_config.m_debug && (_config.client.m_debug)) { if ((_config.client.http && (_protocol == "http")) || (_config.client.rtmp && (_protocol.substr(0, 4) == "rtmp"))) { if (!sendDebugEvent(eventobj)) { } } } } function addNetDebugHeader() { if (!_headerAdded) { _headerAdded = true; if ((_config.m_debug && (_config.app_server.m_debug)) && (_protocol == "http")) { realAddHeader("amf_server_debug", true, _config.app_server); } else { realAddHeader("amf_server_debug", true, undefined); } } } function updateConfig(config) { attachDebug(); if ((config == null) && (!_configured)) { _configured = true; config = mx.remoting.debug.NetDebugConfig.getRealDefaultNetDebugConfig(); } mx.utils.ObjectCopy.copyProperties(_config, config); _headerAdded = false; } function isRealTime() { return(_protocol.substr(0, 4) == "rtmp"); } function setupRecordSet() { attachDebug(); _config.client.http = _config.client.recordset; } function netDebugProxyConnect() { attachDebug(); var _local3 = arguments[0].substr(0, 4); if ((_local3 == "http") || (_local3.substr(0, 4) == "rtmp")) { if (arguments[0].charAt(4) == ":") { _protocol = _local3; } else { _protocol = arguments[0].substr(0, 5); } } else { _protocol = "http"; } sendClientEvent(new mx.remoting.debug.events.NetDebugConnect(arguments)); if (isRealTime()) { _connectString = arguments[0]; getNetDebug().sendCommand(new mx.remoting.debug.commands.StartRTMPTrace(arguments[0])); var _local4 = realConnect.apply(this, arguments); realCall("@getClientID", new mx.remoting.RTMPClientIDResponse(arguments[0], this)); return(_local4); } return(Boolean(realConnect.apply(this, arguments))); } function netDebugProxyCall() { attachDebug(); sendClientEvent(new mx.remoting.debug.events.NetDebugCall(arguments)); addNetDebugHeader(); if (_config.app_server) { arguments[1] = new mx.remoting.debug.NetDebugResponseProxy(this, arguments[1]); return(Boolean(realCall.apply(this, arguments))); } return(Boolean(realCall.apply(this, arguments))); } function netDebugProxyClose() { attachDebug(); sendClientEvent(new mx.remoting.debug.events.NetDebugClose()); if (isRealTime()) { getNetDebug().sendCommand(new mx.remoting.debug.commands.StopRTMPTrace(_connectString, _clientId)); } var _local2 = realClose(); getNetDebug().removeNetConnection(NetConnection(this)); return(_local2); } function netDebugProxyAddHeader() { attachDebug(); sendClientEvent(new mx.remoting.debug.events.NetDebugAddHeader(arguments)); return(Boolean(realAddHeader.apply(this, arguments))); } function setDebugId(id) { attachDebug(); _id = id; } function getDebugId() { attachDebug(); return(_id); } function trace(traceobj) { attachDebug(); if ((_config.m_debug && (_config.client.m_debug)) && (_config.client.trace)) { sendDebugEvent(new mx.remoting.debug.events.NetDebugTrace(traceobj)); } } function getDebugConfig() { attachDebug(); return(_config); } function getNetDebug() { return(mx.remoting.debug.NetDebug.getNetDebug()); } static var _attached = false; }
Symbol 714 MovieClip [__Packages.mx.remoting.debug.events.NetDebugConnect] Frame 0
class mx.remoting.debug.events.NetDebugConnect extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, connectString, userName, password; function NetDebugConnect (args) { super(); eventType = "Connect"; connectString = args[0]; if (args[1] != null) { userName = args[1]; } if (args[2] != null) { password = args[2]; } } }
Symbol 715 MovieClip [__Packages.mx.remoting.debug.commands.StartRTMPTrace] Frame 0
class mx.remoting.debug.commands.StartRTMPTrace extends mx.remoting.debug.commands.Local { var init; function StartRTMPTrace (cs) { super(); var _local4 = new Object(); _local4.connectstring = cs; _local4.url = _root._url; init("startRealTimeTrace", _local4); } }
Symbol 716 MovieClip [__Packages.mx.remoting.RTMPClientIDResponse] Frame 0
class mx.remoting.RTMPClientIDResponse extends Object { var _connectString, _nc; function RTMPClientIDResponse (cs, nc) { super(); _connectString = cs; _nc = nc; } function onResult(cid) { _nc._clientId = cid; mx.remoting.debug.NetDebug.getNetDebug().sendCommand(new mx.remoting.debug.commands.AddRTMPClient(_connectString, cid)); } }
Symbol 717 MovieClip [__Packages.mx.remoting.debug.commands.AddRTMPClient] Frame 0
class mx.remoting.debug.commands.AddRTMPClient extends mx.remoting.debug.commands.Local { var init; function AddRTMPClient (cs, cid) { super(); var _local4 = new Object(); _local4.connectstring = cs; _local4.url = _root._url; _local4.clientid = cid; init("addRealTimeClient", _local4); } }
Symbol 718 MovieClip [__Packages.mx.remoting.debug.events.NetDebugCall] Frame 0
class mx.remoting.debug.events.NetDebugCall extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, methodName, parameters; function NetDebugCall (args) { super(); eventType = "Call"; methodName = args[0]; parameters = new Array(); var _local5 = args.length; var _local3 = 2; while (_local3 < _local5) { parameters[_local3 - 2] = args[_local3]; _local3++; } } }
Symbol 719 MovieClip [__Packages.mx.remoting.debug.NetDebugResponseProxy] Frame 0
class mx.remoting.debug.NetDebugResponseProxy extends Object { var _sourceNC, _originalNR; function NetDebugResponseProxy (source, original) { super(); _sourceNC = source; _originalNR = original; } function onDebugEvents(debugevents) { var _local3 = debugevents.length; var _local2 = 0; while (_local2 < _local3) { _sourceNC.sendServerEvent(debugevents[_local2]); _local2++; } } function onResult(resultobj) { _sourceNC.sendClientEvent(new mx.remoting.debug.events.NetDebugResult(resultobj)); _originalNR.onResult(resultobj); } function onStatus(statusobj) { _sourceNC.sendClientEvent(new mx.remoting.debug.events.NetDebugStatus(statusobj)); if (_originalNR.onStatus != undefined) { _originalNR.onStatus(statusobj); } else { _global.System.onStatus(statusobj); } } function __resolve(name) { trace("NetDebugResponseProxy.__resolve name: " + name); _sourceNC.sendClientEvent(new mx.remoting.debug.events.NetDebugReceiveCall(name, arguments)); _originalNR[name].apply(arguments); return(null); } }
Symbol 720 MovieClip [__Packages.mx.remoting.debug.events.NetDebugResult] Frame 0
class mx.remoting.debug.events.NetDebugResult extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, result; function NetDebugResult (resultobj) { super(); eventType = "Result"; result = resultobj; } }
Symbol 721 MovieClip [__Packages.mx.remoting.debug.events.NetDebugReceiveCall] Frame 0
class mx.remoting.debug.events.NetDebugReceiveCall extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, methodName, parameters; function NetDebugReceiveCall (mName, args) { super(); eventType = "ReceivedCall"; methodName = mName; parameters = args; } }
Symbol 722 MovieClip [__Packages.mx.remoting.debug.events.NetDebugClose] Frame 0
class mx.remoting.debug.events.NetDebugClose extends mx.remoting.debug.events.NetDebugNetConnection { var eventType; function NetDebugClose () { super(); eventType = "Close"; } }
Symbol 723 MovieClip [__Packages.mx.remoting.debug.commands.StopRTMPTrace] Frame 0
class mx.remoting.debug.commands.StopRTMPTrace extends mx.remoting.debug.commands.Local { var init; function StopRTMPTrace () { super(); } function StopRTMPTraceCommand(cs, cid) { var _local3 = new Object(); _local3.connectstring = cs; _local3.url = _root._url; _local3.clientid = cid; init("stopRealTimeTrace", _local3); } }
Symbol 724 MovieClip [__Packages.mx.remoting.debug.events.NetDebugAddHeader] Frame 0
class mx.remoting.debug.events.NetDebugAddHeader extends mx.remoting.debug.events.NetDebugNetConnection { var eventType, headerName, mustUnderstand, headerObject; function NetDebugAddHeader (args) { super(); eventType = "AddHeader"; headerName = args[0]; mustUnderstand = args[1]; if (args[2] != null) { headerObject = args[2]; } } }
Symbol 725 MovieClip [__Packages.mx.remoting.debug.events.NetDebugTrace] Frame 0
class mx.remoting.debug.events.NetDebugTrace extends mx.remoting.debug.events.NetDebug { var eventType, trace; function NetDebugTrace (traceobj) { super(); eventType = "Trace"; trace = traceobj; } }
Symbol 726 MovieClip [__Packages.mx.remoting.debug.events.NetDebugTraceNetServices] Frame 0
class mx.remoting.debug.events.NetDebugTraceNetServices extends mx.remoting.debug.events.NetDebug { var eventType, trace, who, severity, number; function NetDebugTraceNetServices (w, s, n, m) { super(); eventType = "NetServicesTrace"; trace = m; who = w; severity = s; number = n; } }
Symbol 727 MovieClip [__Packages.mattel.utils.EmailServices] Frame 0
class mattel.utils.EmailServices { var email_service, sent, dispatchEvent; function EmailServices (conn) { mx.events.EventDispatcher.initialize(this); email_service = conn.getService("Mattel.NET.Email", this); } function sendFlash(to, from, cc, bcc, subject, body, path) { email_service.sendFlash(to, from, cc, bcc, subject, body, path); } function sendFlash_Result(result) { sent = String(result); dispatchEvent({type:"onSend", target:this, sent:sent}); } }
Symbol 728 MovieClip [__Packages.mattel.utils.Logger] Frame 0
class mattel.utils.Logger extends mx.services.Log { function Logger (logLevel, name) { super(logLevel, name); } function logInfo(msg, level) { var _local3; if (msg instanceof Error) { _local3 = (("[" + msg.name) + "] ") + msg.message; } else { _local3 = msg; } super.logInfo(_local3, level); } static var NONE = -1; static var BRIEF = 0; static var VERBOSE = 1; static var DEBUG = 2; }
Symbol 729 MovieClip [__Packages.mattel.data.StringExtensions] Frame 0
class mattel.data.StringExtensions { function StringExtensions () { } static function getNaughtyWordList() { mx.remoting.debug.NetDebug.initialize(); var _local1 = mx.remoting.NetServices.createGatewayConnection(mattel.system.ApplicationSettings.getServer() + "/gateway.aspx"); trace(("Connecting at " + mattel.system.ApplicationSettings.getServer()) + "/gateway.aspx"); var _local2 = _local1.getService("samples.remoting.RemoteWords", mattel.data.StringExtensions); _local2.getWords(); } static function isEmpty(s) { s = trim(s); return((s == null) || (s.length == 0)); } static function isNaughty(s) { var _local1 = mattel.data.StringExtensions; _local1.trimAllInArray(_local1.exactNaughtyWords); _local1.trimAllInArray(_local1.searchNaughtyWords); _local1.trimAllInArray(_local1.exceptionNaughtyWordsSplit); _local1.trimAllInArray(_local1.exceptionWordsSplit); s = _local1.replace(_local1.replace(s.toLowerCase(), "-", " "), "_", " "); if (!_local1.isEmpty(s)) { var _local5 = s.split(" "); var _local4 = 0; var _local3 = 0; while (_local4 < _local5.length) { _local3 = 0; while (_local3 < _local1.exactNaughtyWords.length) { if (_local5[_local4] == _local1.exactNaughtyWords[_local3]) { return(true); } _local3++; } _local3 = 0; var _local8 = 0; var _local7 = 0; var _local6; while (_local3 < _local1.searchNaughtyWords.length) { if (_local5[_local4].indexOf(_local1.searchNaughtyWords[_local3]) != -1) { _local8++; _local6 = _local5[_local4].indexOf(_local1.searchNaughtyWords[_local3]); var _local2 = 0; while (_local2 < _local1.exceptionNaughtyWordsSplit.length) { if (((_local1.exceptionNaughtyWordsSplit[_local2] == _local1.searchNaughtyWords[_local3]) && ((_local5[_local4].indexOf(_local1.exceptionWordsSplit[_local2]) != -1) && (_local5[_local4].indexOf(_local1.exceptionWordsSplit[_local2]) == (_local6 - _local1.exceptionWordsSplit[_local2].indexOf(_local1.exceptionNaughtyWordsSplit[_local2]))))) && (_local5[_local4].indexOf(_local1.searchNaughtyWords[_local3], (_local5[_local4].indexOf(_local1.exceptionWordsSplit[_local2]) + _local1.exceptionWordsSplit[_local2].length) == -1))) { _local7++; break; } _local2++; } } _local3++; } if (_local8 > _local7) { return(true); } _local4++; } } return(false); } static function isEmail(s) { if (s.length < 5) { return(false); } var _local4 = "*|,\":<>[]{}`';()&$#%"; var _local3 = s.length; var _local1 = 0; while (_local1 < _local3) { if (_local4.indexOf(s.charAt(_local1)) != -1) { return(false); } _local1++; } var _local5 = s.lastIndexOf("@"); if ((_local5 < 1) || (_local5 == (_local3 - 1))) { return(false); } var _local6 = s.lastIndexOf("."); if ((_local6 < 4) || (_local6 == (_local3 - 1))) { return(false); } if (_local5 > _local6) { return(false); } return(true); } static function isAllAlpha(s) { var _local1 = 0; while (_local1 < s.length) { if (parseInt(s.charAt(_local1)).toString() != "NaN") { return(false); } _local1++; } return(true); } static function lTrim(s) { var _local1 = 0; while ((_local1 < s.length) && (s.charCodeAt(_local1) <= 32)) { _local1++; } return(s.substring(_local1, s.length)); } static function rTrim(s) { var _local1 = s.length - 1; while ((_local1 >= 0) && (s.charCodeAt(_local1) <= 32)) { _local1--; } return(s.substring(0, _local1 + 1)); } static function trim(s) { s = lTrim(s); s = rTrim(s); return(s); } static function replace(s, searchStr, replaceStr) { var _local3 = s; var _local4 = ""; var _local1 = 0; var _local2; if (searchStr == "") { return(_local3); } if (_local3.indexOf(searchStr) != -1) { while (_local2 = _local3.indexOf(searchStr, _local1) , _local2 != -1) { _local4 = _local4 + _local3.substring(_local1, _local2); _local4 = _local4 + replaceStr; _local1 = _local2 + searchStr.length; } return(_local4 + _local3.substring(_local1)); } return(_local3); } static function getWords_Result(result) { stringLog.logInfo("Naughty Word List Received.", mattel.utils.Logger.DEBUG); var _local1 = result.getItemAt(0); exactNaughtyWords = _local1.exactNaughtyWords.toString().split(","); searchNaughtyWords = _local1.searchNaughtyWords.toString().split(","); exceptionNaughtyWordsSplit = _local1.exceptionNaughtyWordssplit.toString().split(","); exceptionWordsSplit = _local1.exceptionWordssplit.toString().split(","); } static function getWords_Status(status) { stringLog.logInfo(new Error("There was an error in retrieving the naughty word list from the server."), mattel.utils.Logger.BRIEF); } static function trimAllInArray(a) { var _local1 = 0; while (_local1 < a.length) { a[_local1] = trim(a[_local1]); _local1++; } return(a); } static var exactNaughtyWords = new Array(); static var searchNaughtyWords = new Array(); static var exceptionNaughtyWordsSplit = new Array(); static var exceptionWordsSplit = new Array(); static var stringLog = new mattel.utils.Logger(mattel.utils.Logger.DEBUG, "StringExtensions"); }
Symbol 730 MovieClip [__Packages.mattel.system.ApplicationSettings] Frame 0
class mattel.system.ApplicationSettings { function ApplicationSettings () { } static function getServer() { if (url.indexOf("everythinggirl.com") != -1) { return(liveServers.everythingGirl); } if (url.indexOf("mattel.net") != -1) { return(stagingServers.everythingGirl); } return(devServers.everythingGirl); } static var liveServers = {everythingGirl:"http://www.everythinggirl.com", origin:"http://origin.everythinggirl.com", pollyPocket:"http://pollypocket.everythinggirl.com", barbie:"http://barbie.everythinggirl.com", myscene:"http://myscene.everythinggirl.com"}; static var stagingServers = {everythingGirl:"http://everythinggirl.mattel.net", pollyPocket:"http://pollypocket.mattel.net", barbie:"http://barbie.mattel.net", myscene:"http://myscene.mattel.net"}; static var devServers = {everythingGirl:"http://estwr-12-82.eshq.mattel.com", pollyPocket:"http://estwr-12-91.eshq.mattel.com", barbie:"http://estwr-12-26.eshq.mattel.com", myscene:"http://estwr-12-56.eshq.mattel.com"}; static var url = _root._url; }
Symbol 1 MovieClip [__Packages.mx.core.UIObject] Frame 0
class mx.core.UIObject extends MovieClip { var _width, _height, _x, _y, _parent, _minHeight, _minWidth, _visible, dispatchEvent, _xscale, _yscale, methodTable, onEnterFrame, tfList, __width, __height, moveTo, lineTo, createTextField, attachMovie, buildDepthTable, findNextAvailableDepth, idNames, childrenCreated, _name, createAccessibilityImplementation, _endInit, validateNow, hasOwnProperty, initProperties, stylecache, className, ignoreClassStyleDeclaration, _tf, fontFamily, fontSize, color, marginLeft, marginRight, fontStyle, fontWeight, textAlign, textIndent, textDecoration, embedFonts, styleName, enabled; function UIObject () { super(); constructObject(); } function get width() { return(_width); } function get height() { return(_height); } function get left() { return(_x); } function get x() { return(_x); } function get top() { return(_y); } function get y() { return(_y); } function get right() { return(_parent.width - (_x + width)); } function get bottom() { return(_parent.height - (_y + height)); } function getMinHeight(Void) { return(_minHeight); } function setMinHeight(h) { _minHeight = h; } function get minHeight() { return(getMinHeight()); } function set minHeight(h) { setMinHeight(h); //return(minHeight); } function getMinWidth(Void) { return(_minWidth); } function setMinWidth(w) { _minWidth = w; } function get minWidth() { return(getMinWidth()); } function set minWidth(w) { setMinWidth(w); //return(minWidth); } function setVisible(x, noEvent) { if (x != _visible) { _visible = x; if (noEvent != true) { dispatchEvent({type:(x ? "reveal" : "hide")}); } } } function get visible() { return(_visible); } function set visible(x) { setVisible(x, false); //return(visible); } function get scaleX() { return(_xscale); } function set scaleX(x) { _xscale = x; //return(scaleX); } function get scaleY() { return(_yscale); } function set scaleY(y) { _yscale = y; //return(scaleY); } function doLater(obj, fn) { if (methodTable == undefined) { methodTable = new Array(); } methodTable.push({obj:obj, fn:fn}); onEnterFrame = doLaterDispatcher; } function doLaterDispatcher(Void) { delete onEnterFrame; if (invalidateFlag) { redraw(); } var _local3 = methodTable; methodTable = new Array(); if (_local3.length > 0) { var _local2; while (_local2 = _local3.shift() , _local2 != undefined) { _local2.obj[_local2.fn](); } } } function cancelAllDoLaters(Void) { delete onEnterFrame; methodTable = new Array(); } function invalidate(Void) { invalidateFlag = true; onEnterFrame = doLaterDispatcher; } function invalidateStyle(Void) { invalidate(); } function redraw(bAlways) { if (invalidateFlag || (bAlways)) { invalidateFlag = false; var _local2; for (_local2 in tfList) { tfList[_local2].draw(); } draw(); dispatchEvent({type:"draw"}); } } function draw(Void) { } function move(x, y, noEvent) { var _local3 = _x; var _local2 = _y; _x = x; _y = y; if (noEvent != true) { dispatchEvent({type:"move", oldX:_local3, oldY:_local2}); } } function setSize(w, h, noEvent) { var _local2 = __width; var _local3 = __height; __width = w; __height = h; size(); if (noEvent != true) { dispatchEvent({type:"resize", oldWidth:_local2, oldHeight:_local3}); } } function size(Void) { _width = __width; _height = __height; } function drawRect(x1, y1, x2, y2) { moveTo(x1, y1); lineTo(x2, y1); lineTo(x2, y2); lineTo(x1, y2); lineTo(x1, y1); } function createLabel(name, depth, text) { createTextField(name, depth, 0, 0, 0, 0); var _local2 = this[name]; _local2._color = textColorList; _local2._visible = false; _local2.__text = text; if (tfList == undefined) { tfList = new Object(); } tfList[name] = _local2; _local2.invalidateStyle(); invalidate(); _local2.styleName = this; return(_local2); } function createObject(linkageName, id, depth, initobj) { return(attachMovie(linkageName, id, depth, initobj)); } function createClassObject(className, id, depth, initobj) { var _local3 = className.symbolName == undefined; if (_local3) { Object.registerClass(className.symbolOwner.symbolName, className); } var _local4 = createObject(className.symbolOwner.symbolName, id, depth, initobj); if (_local3) { Object.registerClass(className.symbolOwner.symbolName, className.symbolOwner); } return(_local4); } function createEmptyObject(id, depth) { return(createClassObject(mx.core.UIObject, id, depth)); } function destroyObject(id) { var _local2 = this[id]; if (_local2.getDepth() < 0) { var _local4 = buildDepthTable(); var _local5 = findNextAvailableDepth(0, _local4, "up"); var _local3 = _local5; _local2.swapDepths(_local3); } _local2.removeMovieClip(); delete this[id]; } function getSkinIDName(tag) { return(idNames[tag]); } function setSkin(tag, linkageName, initObj) { if (_global.skinRegistry[linkageName] == undefined) { mx.skins.SkinElement.registerElement(linkageName, mx.skins.SkinElement); } return(createObject(linkageName, getSkinIDName(tag), tag, initObj)); } function createSkin(tag) { var _local2 = getSkinIDName(tag); createEmptyObject(_local2, tag); return(this[_local2]); } function createChildren(Void) { } function _createChildren(Void) { createChildren(); childrenCreated = true; } function constructObject(Void) { if (_name == undefined) { return(undefined); } init(); _createChildren(); createAccessibilityImplementation(); _endInit(); if (validateNow) { redraw(true); } else { invalidate(); } } function initFromClipParameters(Void) { var _local4 = false; var _local2; for (_local2 in clipParameters) { if (hasOwnProperty(_local2)) { _local4 = true; this["def_" + _local2] = this[_local2]; delete this[_local2]; } } if (_local4) { for (_local2 in clipParameters) { var _local3 = this["def_" + _local2]; if (_local3 != undefined) { this[_local2] = _local3; } } } } function init(Void) { __width = _width; __height = _height; if (initProperties == undefined) { initFromClipParameters(); } else { initProperties(); } if (_global.cascadingStyles == true) { stylecache = new Object(); } } function getClassStyleDeclaration(Void) { var _local4 = this; var _local3 = className; while (_local3 != undefined) { if (ignoreClassStyleDeclaration[_local3] == undefined) { if (_global.styles[_local3] != undefined) { return(_global.styles[_local3]); } } _local4 = _local4.__proto__; _local3 = _local4.className; } } function setColor(color) { } function __getTextFormat(tf, bAll) { var _local8 = stylecache.tf; if (_local8 != undefined) { var _local3; for (_local3 in mx.styles.StyleManager.TextFormatStyleProps) { if (bAll || (mx.styles.StyleManager.TextFormatStyleProps[_local3])) { if (tf[_local3] == undefined) { tf[_local3] = _local8[_local3]; } } } return(false); } var _local6 = false; for (var _local3 in mx.styles.StyleManager.TextFormatStyleProps) { if (bAll || (mx.styles.StyleManager.TextFormatStyleProps[_local3])) { if (tf[_local3] == undefined) { var _local5 = _tf[_local3]; if (_local5 != undefined) { tf[_local3] = _local5; } else if ((_local3 == "font") && (fontFamily != undefined)) { tf[_local3] = fontFamily; } else if ((_local3 == "size") && (fontSize != undefined)) { tf[_local3] = fontSize; } else if ((_local3 == "color") && (color != undefined)) { tf[_local3] = color; } else if ((_local3 == "leftMargin") && (marginLeft != undefined)) { tf[_local3] = marginLeft; } else if ((_local3 == "rightMargin") && (marginRight != undefined)) { tf[_local3] = marginRight; } else if ((_local3 == "italic") && (fontStyle != undefined)) { tf[_local3] = fontStyle == _local3; } else if ((_local3 == "bold") && (fontWeight != undefined)) { tf[_local3] = fontWeight == _local3; } else if ((_local3 == "align") && (textAlign != undefined)) { tf[_local3] = textAlign; } else if ((_local3 == "indent") && (textIndent != undefined)) { tf[_local3] = textIndent; } else if ((_local3 == "underline") && (textDecoration != undefined)) { tf[_local3] = textDecoration == _local3; } else if ((_local3 == "embedFonts") && (embedFonts != undefined)) { tf[_local3] = embedFonts; } else { _local6 = true; } } } } if (_local6) { var _local9 = styleName; if (_local9 != undefined) { if (typeof(_local9) != "string") { _local6 = _local9.__getTextFormat(tf, true, this); } else if (_global.styles[_local9] != undefined) { _local6 = _global.styles[_local9].__getTextFormat(tf, true, this); } } } if (_local6) { var _local10 = getClassStyleDeclaration(); if (_local10 != undefined) { _local6 = _local10.__getTextFormat(tf, true, this); } } if (_local6) { if (_global.cascadingStyles) { if (_parent != undefined) { _local6 = _parent.__getTextFormat(tf, false); } } } if (_local6) { _local6 = _global.style.__getTextFormat(tf, true, this); } return(_local6); } function _getTextFormat(Void) { var _local2 = stylecache.tf; if (_local2 != undefined) { return(_local2); } _local2 = new TextFormat(); __getTextFormat(_local2, true); stylecache.tf = _local2; if (enabled == false) { var _local3 = getStyle("disabledColor"); _local2.color = _local3; } return(_local2); } function getStyleName(Void) { var _local2 = styleName; if (_local2 != undefined) { if (typeof(_local2) != "string") { return(_local2.getStyleName()); } return(_local2); } if (_parent != undefined) { return(_parent.getStyleName()); } return(undefined); } function getStyle(styleProp) { var _local3; _global.getStyleCounter++; if (this[styleProp] != undefined) { return(this[styleProp]); } var _local6 = styleName; if (_local6 != undefined) { if (typeof(_local6) != "string") { _local3 = _local6.getStyle(styleProp); } else { var _local7 = _global.styles[_local6]; _local3 = _local7.getStyle(styleProp); } } if (_local3 != undefined) { return(_local3); } var _local7 = getClassStyleDeclaration(); if (_local7 != undefined) { _local3 = _local7[styleProp]; } if (_local3 != undefined) { return(_local3); } if (_global.cascadingStyles) { if (mx.styles.StyleManager.isInheritingStyle(styleProp) || (mx.styles.StyleManager.isColorStyle(styleProp))) { var _local5 = stylecache; if (_local5 != undefined) { if (_local5[styleProp] != undefined) { return(_local5[styleProp]); } } if (_parent != undefined) { _local3 = _parent.getStyle(styleProp); } else { _local3 = _global.style[styleProp]; } if (_local5 != undefined) { _local5[styleProp] = _local3; } return(_local3); } } if (_local3 == undefined) { _local3 = _global.style[styleProp]; } return(_local3); } static function mergeClipParameters(o, p) { for (var _local3 in p) { o[_local3] = p[_local3]; } return(true); } static var symbolName = "UIObject"; static var symbolOwner = mx.core.UIObject; static var version = "2.0.2.126"; static var textColorList = {color:1, disabledColor:1}; var invalidateFlag = false; var lineWidth = 1; var lineColor = 0; var tabEnabled = false; var clipParameters = {visible:1, minHeight:1, minWidth:1, maxHeight:1, maxWidth:1, preferredHeight:1, preferredWidth:1}; }
Symbol 2 MovieClip [__Packages.mx.core.UIComponent] Frame 0
class mx.core.UIComponent extends mx.core.UIObject { var __width, __height, invalidate, stylecache, removeEventListener, dispatchEvent, drawFocus, addEventListener, _xscale, _yscale, _focusrect, watch, enabled; function UIComponent () { super(); } function get width() { return(__width); } function get height() { return(__height); } function setVisible(x, noEvent) { super.setVisible(x, noEvent); } function enabledChanged(id, oldValue, newValue) { setEnabled(newValue); invalidate(); delete stylecache.tf; return(newValue); } function setEnabled(enabled) { invalidate(); } function getFocus() { var selFocus = Selection.getFocus(); return(((selFocus === null) ? null : (eval (selFocus)))); } function setFocus() { Selection.setFocus(this); } function getFocusManager() { var _local2 = this; while (_local2 != undefined) { if (_local2.focusManager != undefined) { return(_local2.focusManager); } _local2 = _local2._parent; } return(undefined); } function onKillFocus(newFocus) { removeEventListener("keyDown", this); removeEventListener("keyUp", this); dispatchEvent({type:"focusOut"}); drawFocus(false); } function onSetFocus(oldFocus) { addEventListener("keyDown", this); addEventListener("keyUp", this); dispatchEvent({type:"focusIn"}); if (getFocusManager().bDrawFocus != false) { drawFocus(true); } } function findFocusInChildren(o) { if (o.focusTextField != undefined) { return(o.focusTextField); } if (o.tabEnabled == true) { return(o); } return(undefined); } function findFocusFromObject(o) { if (o.tabEnabled != true) { if (o._parent == undefined) { return(undefined); } if (o._parent.tabEnabled == true) { o = o._parent; } else if (o._parent.tabChildren) { o = findFocusInChildren(o._parent); } else { o = findFocusFromObject(o._parent); } } return(o); } function pressFocus() { var _local3 = findFocusFromObject(this); var _local2 = getFocus(); if (_local3 != _local2) { _local2.drawFocus(false); if (getFocusManager().bDrawFocus != false) { _local3.drawFocus(true); } } } function releaseFocus() { var _local2 = findFocusFromObject(this); if (_local2 != getFocus()) { _local2.setFocus(); } } function isParent(o) { while (o != undefined) { if (o == this) { return(true); } o = o._parent; } return(false); } function size() { } function init() { super.init(); _xscale = 100; _yscale = 100; _focusrect = _global.useFocusRect == false; watch("enabled", enabledChanged); if (enabled == false) { setEnabled(false); } } function dispatchValueChangedEvent(value) { dispatchEvent({type:"valueChanged", value:value}); } static var symbolName = "UIComponent"; static var symbolOwner = mx.core.UIComponent; static var version = "2.0.2.126"; static var kStretch = 5000; var focusEnabled = true; var tabEnabled = true; var origBorderStyles = {themeColor:16711680}; var clipParameters = {}; static var mergedClipParameters = mx.core.UIObject.mergeClipParameters(mx.core.UIComponent.prototype.clipParameters, mx.core.UIObject.prototype.clipParameters); }
Symbol 3 MovieClip [__Packages.mx.core.View] Frame 0
class mx.core.View extends mx.core.UIComponent { var tabChildren, tabEnabled, boundingBox_mc, border_mc, __get__width, __get__height, __tabIndex, depth, createObject, createClassObject, loadExternal, destroyObject, createClassChildAtDepth, doLater; function View () { super(); } function init() { super.init(); tabChildren = true; tabEnabled = false; boundingBox_mc._visible = false; boundingBox_mc._width = (boundingBox_mc._height = 0); } function size() { border_mc.move(0, 0); border_mc.setSize(__get__width(), __get__height()); doLayout(); } function draw() { size(); } function get numChildren() { var _local3 = childNameBase; var _local2 = 0; while (true) { if (this[_local3 + _local2] == undefined) { return(_local2); } _local2++; } } function get tabIndex() { return((tabEnabled ? (__tabIndex) : undefined)); } function addLayoutObject(object) { } function createChild(className, instanceName, initProps) { if (depth == undefined) { depth = 1; } var _local2; if (typeof(className) == "string") { _local2 = createObject(className, instanceName, depth++, initProps); } else { _local2 = createClassObject(className, instanceName, depth++, initProps); } if (_local2 == undefined) { _local2 = loadExternal(className, _loadExternalClass, instanceName, depth++, initProps); } else { this[childNameBase + numChildren] = _local2; _local2._complete = true; childLoaded(_local2); } addLayoutObject(_local2); return(_local2); } function getChildAt(childIndex) { return(this[childNameBase + childIndex]); } function destroyChildAt(childIndex) { if (!((childIndex >= 0) && (childIndex < numChildren))) { return(undefined); } var _local4 = childNameBase + childIndex; var _local6 = numChildren; var _local3; for (_local3 in this) { if (_local3 == _local4) { _local4 = ""; destroyObject(_local3); break; } } var _local2 = Number(childIndex); while (_local2 < (_local6 - 1)) { this[childNameBase + _local2] = this[childNameBase + (_local2 + 1)]; _local2++; } delete this[childNameBase + (_local6 - 1)]; depth--; } function initLayout() { if (!hasBeenLayedOut) { doLayout(); } } function doLayout() { hasBeenLayedOut = true; } function createChildren() { if (border_mc == undefined) { border_mc = createClassChildAtDepth(_global.styles.rectBorderClass, mx.managers.DepthManager.kBottom, {styleName:this}); } doLater(this, "initLayout"); } function convertToUIObject(obj) { } function childLoaded(obj) { convertToUIObject(obj); } static function extension() { mx.core.ExternalContent.enableExternalContent(); } static var symbolName = "View"; static var symbolOwner = mx.core.View; static var version = "2.0.2.126"; var className = "View"; static var childNameBase = "_child"; var hasBeenLayedOut = false; var _loadExternalClass = "UIComponent"; }
Symbol 4 MovieClip [__Packages.mx.core.ScrollView] Frame 0
class mx.core.ScrollView extends mx.core.View { var __width, hScroller, vScroller, __maxHPosition, propsInited, scrollAreaChanged, specialHScrollCase, createObject, viewableColumns, __height, oldRndUp, viewableRows, __viewMetrics, owner, enabled, border_mc, __get__width, __get__height, invLayout, mask_mc, _parent, dispatchEvent; function ScrollView () { super(); } function getHScrollPolicy(Void) { return(__hScrollPolicy); } function setHScrollPolicy(policy) { __hScrollPolicy = policy.toLowerCase(); if (__width == undefined) { return(undefined); } setScrollProperties(numberOfCols, columnWidth, rowC, rowH, heightPadding, widthPadding); } function get hScrollPolicy() { return(getHScrollPolicy()); } function set hScrollPolicy(policy) { setHScrollPolicy(policy); //return(hScrollPolicy); } function getVScrollPolicy(Void) { return(__vScrollPolicy); } function setVScrollPolicy(policy) { __vScrollPolicy = policy.toLowerCase(); if (__width == undefined) { return(undefined); } setScrollProperties(numberOfCols, columnWidth, rowC, rowH, heightPadding, widthPadding); } function get vScrollPolicy() { return(getVScrollPolicy()); } function set vScrollPolicy(policy) { setVScrollPolicy(policy); //return(vScrollPolicy); } function get hPosition() { return(getHPosition()); } function set hPosition(pos) { setHPosition(pos); //return(hPosition); } function getHPosition(Void) { return(__hPosition); } function setHPosition(pos) { hScroller.__set__scrollPosition(pos); __hPosition = pos; } function get vPosition() { return(getVPosition()); } function set vPosition(pos) { setVPosition(pos); //return(vPosition); } function getVPosition(Void) { return(__vPosition); } function setVPosition(pos) { vScroller.__set__scrollPosition(pos); __vPosition = pos; } function get maxVPosition() { var _local2 = vScroller.maxPos; return(((_local2 == undefined) ? 0 : (_local2))); } function get maxHPosition() { return(getMaxHPosition()); } function set maxHPosition(pos) { setMaxHPosition(pos); //return(maxHPosition); } function getMaxHPosition(Void) { if (__maxHPosition != undefined) { return(__maxHPosition); } var _local2 = hScroller.maxPos; return(((_local2 == undefined) ? 0 : (_local2))); } function setMaxHPosition(pos) { __maxHPosition = pos; } function setScrollProperties(colCount, colWidth, rwCount, rwHeight, hPadding, wPadding) { var _local3 = getViewMetrics(); if (hPadding == undefined) { hPadding = 0; } if (wPadding == undefined) { wPadding = 0; } propsInited = true; delete scrollAreaChanged; heightPadding = hPadding; widthPadding = wPadding; if (colWidth == 0) { colWidth = 1; } if (rwHeight == 0) { rwHeight = 1; } var _local5 = Math.ceil((((__width - _local3.left) - _local3.right) - widthPadding) / colWidth); if ((__hScrollPolicy == "on") || ((_local5 < colCount) && (__hScrollPolicy == "auto"))) { if ((hScroller == undefined) || (specialHScrollCase)) { delete specialHScrollCase; hScroller = createObject("HScrollBar", "hSB", 1001); hScroller.__set__lineScrollSize(20); hScroller.scrollHandler = scrollProxy; hScroller.__set__scrollPosition(__hPosition); scrollAreaChanged = true; } if ((((numberOfCols != colCount) || (columnWidth != colWidth)) || (viewableColumns != _local5)) || (scrollAreaChanged)) { hScroller.setScrollProperties(_local5, 0, colCount - _local5); viewableColumns = _local5; numberOfCols = colCount; columnWidth = colWidth; } } else if (((__hScrollPolicy == "auto") || (__hScrollPolicy == "off")) && (hScroller != undefined)) { hScroller.removeMovieClip(); delete hScroller; scrollAreaChanged = true; } if (heightPadding == undefined) { heightPadding = 0; } var _local4 = Math.ceil((((__height - _local3.top) - _local3.bottom) - heightPadding) / rwHeight); var _local8 = (((__height - _local3.top) - _local3.bottom) % rwHeight) != 0; if ((__vScrollPolicy == "on") || ((_local4 < (rwCount + _local8)) && (__vScrollPolicy == "auto"))) { if (vScroller == undefined) { vScroller = createObject("VScrollBar", "vSB", 1002); vScroller.scrollHandler = scrollProxy; vScroller.__set__scrollPosition(__vPosition); scrollAreaChanged = true; rowH = 0; } if ((((rowC != rwCount) || (rowH != rwHeight)) || ((viewableRows + _local8) != (_local4 + oldRndUp))) || (scrollAreaChanged)) { vScroller.setScrollProperties(_local4, 0, (rwCount - _local4) + _local8); viewableRows = _local4; rowC = rwCount; rowH = rwHeight; oldRndUp = _local8; } } else if (((__vScrollPolicy == "auto") || (__vScrollPolicy == "off")) && (vScroller != undefined)) { vScroller.removeMovieClip(); delete vScroller; scrollAreaChanged = true; } numberOfCols = colCount; columnWidth = colWidth; if (scrollAreaChanged) { doLayout(); var _local2 = __viewMetrics; var _local12 = ((owner != undefined) ? (owner) : this); _local12.layoutContent(_local2.left, _local2.top, ((columnWidth * numberOfCols) - _local2.left) - _local2.right, rowC * rowH, (__width - _local2.left) - _local2.right, (__height - _local2.top) - _local2.bottom); } if (!enabled) { setEnabled(false); } } function getViewMetrics(Void) { var _local2 = __viewMetrics; var _local3 = border_mc.__get__borderMetrics(); _local2.left = _local3.left; _local2.right = _local3.right; if (vScroller != undefined) { _local2.right = _local2.right + vScroller.minWidth; } _local2.top = _local3.top; if ((hScroller == undefined) && ((__hScrollPolicy == "on") || (__hScrollPolicy == true))) { hScroller = createObject("FHScrollBar", "hSB", 1001); specialHScrollCase = true; } _local2.bottom = _local3.bottom; if (hScroller != undefined) { _local2.bottom = _local2.bottom + hScroller.minHeight; } return(_local2); } function doLayout(Void) { var _local10 = __get__width(); var _local8 = __get__height(); delete invLayout; var _local3 = (__viewMetrics = getViewMetrics()); var _local2 = _local3.left; var _local9 = _local3.right; var _local5 = _local3.top; var _local11 = _local3.bottom; var _local7 = hScroller; var _local6 = vScroller; _local7.setSize((_local10 - _local2) - _local9, _local7.minHeight + 0); _local7.move(_local2, _local8 - _local11); _local6.setSize(_local6.minWidth + 0, (_local8 - _local5) - _local11); _local6.move(_local10 - _local9, _local5); var _local4 = mask_mc; _local4._width = (_local10 - _local2) - _local9; _local4._height = (_local8 - _local5) - _local11; _local4._x = _local2; _local4._y = _local5; } function createChild(id, name, props) { var _local2 = super.createChild(id, name, props); return(_local2); } function init(Void) { super.init(); __viewMetrics = new Object(); if (_global.__SVMouseWheelManager == undefined) { var _local4 = (_global.__SVMouseWheelManager = new Object()); _local4.onMouseWheel = __onMouseWheel; Mouse.addListener(_local4); } } function __onMouseWheel(delta, scrollTarget) { var _local4 = scrollTarget; var _local1; while (_local4 != undefined) { if (_local4 instanceof mx.core.ScrollView) { _local1 = _local4; } _local4 = _local4._parent; } if (_local1 != undefined) { _local4 = ((delta <= 0) ? 1 : -1); var _local2 = _local1.vScroller.lineScrollSize; if (_local2 == undefined) { _local2 = 0; } _local2 = Math.max(Math.abs(delta), _local2); var _local3 = _local1.vPosition + (_local2 * _local4); _local1.vPosition = Math.max(0, Math.min(_local3, _local1.maxVPosition)); _local1.dispatchEvent({type:"scroll", direction:"vertical", position:_local1.vPosition}); } } function createChildren(Void) { super.createChildren(); if (mask_mc == undefined) { mask_mc = createObject("BoundingBox", "mask_mc", MASK_DEPTH); } mask_mc._visible = false; } function invalidate(Void) { super.invalidate(); } function draw(Void) { size(); } function size(Void) { super.size(); } function scrollProxy(docObj) { _parent.onScroll(docObj); } function onScroll(docObj) { var _local3 = docObj.target; var _local2 = _local3.scrollPosition; if (_local3 == vScroller) { var _local4 = "vertical"; var _local5 = "__vPosition"; } else { var _local4 = "horizontal"; var _local5 = "__hPosition"; } this[_local5] = _local2; dispatchEvent({type:"scroll", direction:_local4, position:_local2}); } function setEnabled(v) { vScroller.enabled = (hScroller.enabled = v); } function childLoaded(obj) { super.childLoaded(obj); obj.setMask(mask_mc); } static var symbolName = "ScrollView"; static var symbolOwner = mx.core.ScrollView; static var version = "2.0.2.126"; var className = "ScrollView"; var __vScrollPolicy = "auto"; var __hScrollPolicy = "off"; var __vPosition = 0; var __hPosition = 0; var numberOfCols = 0; var rowC = 0; var columnWidth = 1; var rowH = 0; var heightPadding = 0; var widthPadding = 0; var MASK_DEPTH = 10000; }
Symbol 5 MovieClip [__Packages.mx.controls.listclasses.DataSelector] Frame 0
class mx.controls.listclasses.DataSelector extends Object { var __vPosition, setVPosition, __dataProvider, enabled, lastSelID, lastSelected, selected, invUpdateControl, invalidate, multipleSelection, updateControl, __rowCount, rows; function DataSelector () { super(); } static function Initialize(obj) { var _local3 = mixinProps; var _local4 = _local3.length; obj = obj.prototype; var _local1 = 0; while (_local1 < _local4) { obj[_local3[_local1]] = mixins[_local3[_local1]]; _local1++; } mixins.createProp(obj, "dataProvider", true); mixins.createProp(obj, "length", false); mixins.createProp(obj, "value", false); mixins.createProp(obj, "selectedIndex", true); mixins.createProp(obj, "selectedIndices", true); mixins.createProp(obj, "selectedItems", false); mixins.createProp(obj, "selectedItem", true); return(true); } function createProp(obj, propName, setter) { var p = (propName.charAt(0).toUpperCase() + propName.substr(1)); var _local2 = null; var _local4 = function (Void) { return(this["get" + p]()); }; if (setter) { _local2 = function (val) { this["set" + p](val); }; } obj.addProperty(propName, _local4, _local2); } function setDataProvider(dP) { if (__vPosition != 0) { setVPosition(0); } clearSelected(); __dataProvider.removeEventListener(this); __dataProvider = dP; dP.addEventListener("modelChanged", this); dP.addView(this); modelChanged({eventName:"updateAll"}); } function getDataProvider(Void) { return(__dataProvider); } function addItemAt(index, label, data) { if ((index < 0) || (!enabled)) { return(undefined); } var _local2 = __dataProvider; if (_local2 == undefined) { _local2 = (__dataProvider = new Array()); _local2.addEventListener("modelChanged", this); index = 0; } if ((typeof(label) == "object") || (typeof(_local2.getItemAt(0)) == "string")) { _local2.addItemAt(index, label); } else { _local2.addItemAt(index, {label:label, data:data}); } } function addItem(label, data) { addItemAt(__dataProvider.length, label, data); } function removeItemAt(index) { return(__dataProvider.removeItemAt(index)); } function removeAll(Void) { __dataProvider.removeAll(); } function replaceItemAt(index, newLabel, newData) { if (typeof(newLabel) == "object") { __dataProvider.replaceItemAt(index, newLabel); } else { __dataProvider.replaceItemAt(index, {label:newLabel, data:newData}); } } function sortItemsBy(fieldName, order) { lastSelID = __dataProvider.getItemID(lastSelected); __dataProvider.sortItemsBy(fieldName, order); } function sortItems(compareFunc, order) { lastSelID = __dataProvider.getItemID(lastSelected); __dataProvider.sortItems(compareFunc, order); } function getLength(Void) { return(__dataProvider.length); } function getItemAt(index) { return(__dataProvider.getItemAt(index)); } function modelChanged(eventObj) { var _local3 = eventObj.firstItem; var _local6 = eventObj.lastItem; var _local7 = eventObj.eventName; if (_local7 == undefined) { _local7 = eventObj.event; _local3 = eventObj.firstRow; _local6 = eventObj.lastRow; if (_local7 == "addRows") { _local7 = (eventObj.eventName = "addItems"); } else if (_local7 == "deleteRows") { _local7 = (eventObj.eventName = "removeItems"); } else if (_local7 == "updateRows") { _local7 = (eventObj.eventName = "updateItems"); } } if (_local7 == "addItems") { for (var _local2 in selected) { var _local5 = selected[_local2]; if ((_local5 != undefined) && (_local5 >= _local3)) { selected[_local2] = selected[_local2] + ((_local6 - _local3) + 1); } } } else if (_local7 == "removeItems") { if (__dataProvider.length == 0) { delete selected; } else { var _local9 = eventObj.removedIDs; var _local10 = _local9.length; var _local2 = 0; while (_local2 < _local10) { var _local4 = _local9[_local2]; if (selected[_local4] != undefined) { delete selected[_local4]; } _local2++; } for (_local2 in selected) { if (selected[_local2] >= _local3) { selected[_local2] = selected[_local2] - ((_local6 - _local3) + 1); } } } } else if (_local7 == "sort") { if (typeof(__dataProvider.getItemAt(0)) != "object") { delete selected; } else { var _local10 = __dataProvider.length; var _local2 = 0; while (_local2 < _local10) { if (isSelected(_local2)) { var _local4 = __dataProvider.getItemID(_local2); if (_local4 == lastSelID) { lastSelected = _local2; } selected[_local4] = _local2; } _local2++; } } } else if (_local7 == "filterModel") { setVPosition(0); } invUpdateControl = true; invalidate(); } function getValue(Void) { var _local2 = getSelectedItem(); if (typeof(_local2) != "object") { return(_local2); } return(((_local2.data == undefined) ? (_local2.label) : (_local2.data))); } function getSelectedIndex(Void) { for (var _local3 in selected) { var _local2 = selected[_local3]; if (_local2 != undefined) { return(_local2); } } } function setSelectedIndex(index) { if (((index >= 0) && (index < __dataProvider.length)) && (enabled)) { delete selected; selectItem(index, true); lastSelected = index; invUpdateControl = true; invalidate(); } else if (index == undefined) { clearSelected(); } } function getSelectedIndices(Void) { var _local2 = new Array(); for (var _local3 in selected) { _local2.push(selected[_local3]); } _local2.reverse(); return(((_local2.length > 0) ? (_local2) : undefined)); } function setSelectedIndices(indexArray) { if (multipleSelection != true) { return(undefined); } delete selected; var _local3 = 0; while (_local3 < indexArray.length) { var _local2 = indexArray[_local3]; if ((_local2 >= 0) && (_local2 < __dataProvider.length)) { selectItem(_local2, true); } _local3++; } invUpdateControl = true; updateControl(); } function getSelectedItems(Void) { var _local3 = getSelectedIndices(); var _local4 = new Array(); var _local2 = 0; while (_local2 < _local3.length) { _local4.push(getItemAt(_local3[_local2])); _local2++; } return(((_local4.length > 0) ? (_local4) : undefined)); } function getSelectedItem(Void) { return(__dataProvider.getItemAt(getSelectedIndex())); } function selectItem(index, selectedFlag) { if (selected == undefined) { selected = new Object(); } var _local2 = __dataProvider.getItemID(index); if (_local2 == undefined) { return(undefined); } if (selectedFlag && (!isSelected(index))) { selected[_local2] = index; } else if (!selectedFlag) { delete selected[_local2]; } } function isSelected(index) { var _local2 = __dataProvider.getItemID(index); if (_local2 == undefined) { return(false); } return(selected[_local2] != undefined); } function clearSelected(transition) { var _local3 = 0; for (var _local4 in selected) { var _local2 = selected[_local4]; if (((_local2 != undefined) && (__vPosition <= _local2)) && (_local2 < (__vPosition + __rowCount))) { rows[_local2 - __vPosition].drawRow(rows[_local2 - __vPosition].item, "normal", transition && ((_local3 % 3) == 0)); } _local3++; } delete selected; } static var mixins = new mx.controls.listclasses.DataSelector(); static var mixinProps = ["setDataProvider", "getDataProvider", "addItem", "addItemAt", "removeAll", "removeItemAt", "replaceItemAt", "sortItemsBy", "sortItems", "getLength", "getItemAt", "modelChanged", "calcPreferredWidthFromData", "calcPreferredHeightFromData", "getValue", "getSelectedIndex", "getSelectedItem", "getSelectedIndices", "getSelectedItems", "selectItem", "isSelected", "clearSelected", "setSelectedIndex", "setSelectedIndices"]; }
Symbol 7 MovieClip [__Packages.mx.controls.listclasses.DataProvider] Frame 0
class mx.controls.listclasses.DataProvider extends Object { var length, splice, dispatchEvent, sortOn, reverse, sort; function DataProvider (obj) { super(); } static function Initialize(obj) { var _local4 = mixinProps; var _local6 = _local4.length; obj = obj.prototype; var _local3 = 0; while (_local3 < _local6) { obj[_local4[_local3]] = mixins[_local4[_local3]]; _global.ASSetPropFlags(obj, _local4[_local3], 1); _local3++; } mx.events.EventDispatcher.initialize(obj); _global.ASSetPropFlags(obj, "addEventListener", 1); _global.ASSetPropFlags(obj, "removeEventListener", 1); _global.ASSetPropFlags(obj, "dispatchEvent", 1); _global.ASSetPropFlags(obj, "dispatchQueue", 1); Object.prototype.LargestID = 0; Object.prototype.getID = function () { if (this.__ID__ == undefined) { this.__ID__ = Object.prototype.LargestID++; _global.ASSetPropFlags(this, "__ID__", 1); } return(this.__ID__); }; _global.ASSetPropFlags(Object.prototype, "LargestID", 1); _global.ASSetPropFlags(Object.prototype, "getID", 1); return(true); } function addItemAt(index, value) { if (index < length) { splice(index, 0, value); } else if (index > length) { trace("Cannot add an item past the end of the DataProvider"); return(undefined); } this[index] = value; updateViews("addItems", index, index); } function addItem(value) { addItemAt(length, value); } function addItemsAt(index, newItems) { index = Math.min(length, index); newItems.unshift(index, 0); splice.apply(this, newItems); newItems.splice(0, 2); updateViews("addItems", index, (index + newItems.length) - 1); } function removeItemsAt(index, len) { var _local3 = new Array(); var _local2 = 0; while (_local2 < len) { _local3.push(getItemID(index + _local2)); _local2++; } var _local6 = splice(index, len); dispatchEvent({type:"modelChanged", eventName:"removeItems", firstItem:index, lastItem:(index + len) - 1, removedItems:_local6, removedIDs:_local3}); } function removeItemAt(index) { var _local2 = this[index]; removeItemsAt(index, 1); return(_local2); } function removeAll(Void) { splice(0); updateViews("removeItems", 0, length - 1); } function replaceItemAt(index, itemObj) { if ((index < 0) || (index >= length)) { return(undefined); } var _local3 = getItemID(index); this[index] = itemObj; this[index].__ID__ = _local3; updateViews("updateItems", index, index); } function getItemAt(index) { return(this[index]); } function getItemID(index) { var _local2 = this[index]; if ((typeof(_local2) != "object") && (_local2 != undefined)) { return(index); } return(_local2.getID()); } function sortItemsBy(fieldName, order) { if (typeof(order) == "string") { sortOn(fieldName); if (order.toUpperCase() == "DESC") { reverse(); } } else { sortOn(fieldName, order); } updateViews("sort"); } function sortItems(compareFunc, optionFlags) { sort(compareFunc, optionFlags); updateViews("sort"); } function editField(index, fieldName, newData) { this[index][fieldName] = newData; dispatchEvent({type:"modelChanged", eventName:"updateField", firstItem:index, lastItem:index, fieldName:fieldName}); } function getEditingData(index, fieldName) { return(this[index][fieldName]); } function updateViews(event, first, last) { dispatchEvent({type:"modelChanged", eventName:event, firstItem:first, lastItem:last}); } static var mixinProps = ["addView", "addItem", "addItemAt", "removeAll", "removeItemAt", "replaceItemAt", "getItemAt", "getItemID", "sortItemsBy", "sortItems", "updateViews", "addItemsAt", "removeItemsAt", "getEditingData", "editField"]; static var evtDipatcher = mx.events.EventDispatcher; static var mixins = new mx.controls.listclasses.DataProvider(); }
Symbol 8 MovieClip [__Packages.mx.controls.listclasses.ScrollSelectList] Frame 0
class mx.controls.listclasses.ScrollSelectList extends mx.core.ScrollView { var invLayoutContent, rows, topRowZ, listContent, __dataProvider, __vPosition, tW, layoutX, layoutY, tH, invRowHeight, invalidate, __height, invUpdateControl, __cellRenderer, __labelFunction, __iconField, __iconFunction, getLength, baseRowZ, lastPosition, propertyTable, isSelected, wasKeySelected, changeFlag, clearSelected, selectItem, lastSelected, dispatchEvent, dragScrolling, _ymouse, scrollInterval, isPressed, onMouseUp, getSelectedIndex, enabled, tabEnabled, tabChildren, createEmptyMovieClip, border_mc; function ScrollSelectList () { super(); } function layoutContent(x, y, w, h) { delete invLayoutContent; var _local4 = Math.ceil(h / __rowHeight); roundUp = (h % __rowHeight) != 0; var _local12 = _local4 - __rowCount; if (_local12 < 0) { var _local3 = _local4; while (_local3 < __rowCount) { rows[_local3].removeMovieClip(); delete rows[_local3]; _local3++; } topRowZ = topRowZ + _local12; } else if (_local12 > 0) { if (rows == undefined) { rows = new Array(); } var _local3 = __rowCount; while (_local3 < _local4) { var _local2 = (rows[_local3] = listContent.createObject(__rowRenderer, "listRow" + (topRowZ++), topRowZ, {owner:this, styleName:this, rowIndex:_local3})); _local2._x = x; _local2._y = Math.round((_local3 * __rowHeight) + y); _local2.setSize(w, __rowHeight); _local2.drawRow(__dataProvider.getItemAt(__vPosition + _local3), getStateAt(__vPosition + _local3)); _local2.lastY = _local2._y; _local3++; } } if (w != tW) { var _local11 = ((_local12 > 0) ? (__rowCount) : (_local4)); var _local3 = 0; while (_local3 < _local11) { rows[_local3].setSize(w, __rowHeight); _local3++; } } if ((layoutX != x) || (layoutY != y)) { var _local3 = 0; while (_local3 < _local4) { rows[_local3]._x = x; rows[_local3]._y = Math.round((_local3 * __rowHeight) + y); _local3++; } } __rowCount = _local4; layoutX = x; layoutY = y; tW = w; tH = h; } function getRowHeight(Void) { return(__rowHeight); } function setRowHeight(v) { __rowHeight = v; invRowHeight = true; invalidate(); } function get rowHeight() { return(getRowHeight()); } function set rowHeight(w) { setRowHeight(w); //return(rowHeight); } function setRowCount(v) { __rowCount = v; } function getRowCount(Void) { var _local2 = ((__rowCount == 0) ? (Math.ceil(__height / __rowHeight)) : (__rowCount)); return(_local2); } function get rowCount() { return(getRowCount()); } function set rowCount(w) { setRowCount(w); //return(rowCount); } function setEnabled(v) { super.setEnabled(v); invUpdateControl = true; invalidate(); } function setCellRenderer(cR) { __cellRenderer = cR; var _local2 = 0; while (_local2 < rows.length) { rows[_local2].setCellRenderer(true); _local2++; } invUpdateControl = true; invalidate(); } function set cellRenderer(cR) { setCellRenderer(cR); //return(cellRenderer); } function get cellRenderer() { return(__cellRenderer); } function set labelField(field) { setLabelField(field); //return(labelField); } function setLabelField(field) { __labelField = field; invUpdateControl = true; invalidate(); } function get labelField() { return(__labelField); } function set labelFunction(func) { setLabelFunction(func); //return(labelFunction); } function setLabelFunction(func) { __labelFunction = func; invUpdateControl = true; invalidate(); } function get labelFunction() { return(__labelFunction); } function set iconField(field) { setIconField(field); //return(iconField); } function setIconField(field) { __iconField = field; invUpdateControl = true; invalidate(); } function get iconField() { return(__iconField); } function set iconFunction(func) { setIconFunction(func); //return(iconFunction); } function setIconFunction(func) { __iconFunction = func; invUpdateControl = true; invalidate(); } function get iconFunction() { return(__iconFunction); } function setVPosition(pos) { if (pos < 0) { return(undefined); } if ((pos > 0) && (pos > ((getLength() - __rowCount) + roundUp))) { return(undefined); } var _local8 = pos - __vPosition; if (_local8 == 0) { return(undefined); } __vPosition = pos; var _local10 = _local8 > 0; _local8 = Math.abs(_local8); if (_local8 >= __rowCount) { updateControl(); } else { var _local4 = new Array(); var _local9 = __rowCount - _local8; var _local12 = _local8 * __rowHeight; var _local11 = _local9 * __rowHeight; var _local6 = (_local10 ? 1 : -1); var _local3 = 0; while (_local3 < __rowCount) { if (((_local3 < _local8) && (_local10)) || ((_local3 >= _local9) && (!_local10))) { rows[_local3]._y = rows[_local3]._y + Math.round(_local6 * _local11); var _local5 = _local3 + (_local6 * _local9); var _local7 = __vPosition + _local5; _local4[_local5] = rows[_local3]; _local4[_local5].rowIndex = _local5; _local4[_local5].drawRow(__dataProvider.getItemAt(_local7), getStateAt(_local7), false); } else { rows[_local3]._y = rows[_local3]._y - Math.round(_local6 * _local12); var _local5 = _local3 - (_local6 * _local8); _local4[_local5] = rows[_local3]; _local4[_local5].rowIndex = _local5; } _local3++; } rows = _local4; _local3 = 0; while (_local3 < __rowCount) { rows[_local3].swapDepths(baseRowZ + _local3); _local3++; } } lastPosition = pos; super.setVPosition(pos); } function setPropertiesAt(index, obj) { var _local2 = __dataProvider.getItemID(index); if (_local2 == undefined) { return(undefined); } if (propertyTable == undefined) { propertyTable = new Object(); } propertyTable[_local2] = obj; rows[index - __vPosition].drawRow(__dataProvider.getItemAt(index), getStateAt(index)); } function getPropertiesAt(index) { var _local2 = __dataProvider.getItemID(index); if (_local2 == undefined) { return(undefined); } return(propertyTable[_local2]); } function getPropertiesOf(obj) { var _local2 = obj.getID(); if (_local2 == undefined) { return(undefined); } return(propertyTable[_local2]); } function getStyle(styleProp) { var _local2 = super.getStyle(styleProp); var _local3 = mx.styles.StyleManager.colorNames[_local2]; if (_local3 != undefined) { _local2 = _local3; } return(_local2); } function updateControl(Void) { var _local2 = 0; while (_local2 < __rowCount) { rows[_local2].drawRow(__dataProvider.getItemAt(_local2 + __vPosition), getStateAt(_local2 + __vPosition)); _local2++; } delete invUpdateControl; } function getStateAt(index) { return((isSelected(index) ? "selected" : "normal")); } function selectRow(rowIndex, transition, allowChangeEvent) { if (!selectable) { return(undefined); } var _local3 = __vPosition + rowIndex; var _local8 = __dataProvider.getItemAt(_local3); var _local5 = rows[rowIndex]; if (_local8 == undefined) { return(undefined); } if (transition == undefined) { transition = true; } if (allowChangeEvent == undefined) { allowChangeEvent = wasKeySelected; } changeFlag = true; if (((!multipleSelection) && (!Key.isDown(17))) || ((!Key.isDown(16)) && (!Key.isDown(17)))) { clearSelected(transition); selectItem(_local3, true); lastSelected = _local3; _local5.drawRow(_local5.item, getStateAt(_local3), transition); } else if (Key.isDown(16) && (multipleSelection)) { if (lastSelected == undefined) { lastSelected = _local3; } var _local4 = ((lastSelected < _local3) ? 1 : -1); clearSelected(false); var _local2 = lastSelected; while (_local2 != _local3) { selectItem(_local2, true); if ((_local2 >= __vPosition) && (_local2 < (__vPosition + __rowCount))) { rows[_local2 - __vPosition].drawRow(rows[_local2 - __vPosition].item, "selected", false); } _local2 = _local2 + _local4; } selectItem(_local3, true); _local5.drawRow(_local5.item, "selected", transition); } else if (Key.isDown(17)) { var _local7 = isSelected(_local3); if ((!multipleSelection) || (wasKeySelected)) { clearSelected(transition); } if (!((!multipleSelection) && (_local7))) { selectItem(_local3, !_local7); var _local9 = ((!_local7) ? "selected" : "normal"); _local5.drawRow(_local5.item, _local9, transition); } lastSelected = _local3; } if (allowChangeEvent) { dispatchEvent({type:"change"}); } delete wasKeySelected; } function dragScroll(Void) { clearInterval(dragScrolling); if (_ymouse < 0) { setVPosition(__vPosition - 1); selectRow(0, false); var _local2 = Math.min((-_ymouse) - 30, 0); scrollInterval = (((0.593 * _local2) * _local2) + 1) + minScrollInterval; dragScrolling = setInterval(this, "dragScroll", scrollInterval); dispatchEvent({type:"scroll", direction:"vertical", position:__vPosition}); } else if (_ymouse > __height) { var _local3 = __vPosition; setVPosition(__vPosition + 1); if (_local3 != __vPosition) { selectRow((__rowCount - 1) - roundUp, false); } var _local2 = Math.min((_ymouse - __height) - 30, 0); scrollInterval = (((0.593 * _local2) * _local2) + 1) + minScrollInterval; dragScrolling = setInterval(this, "dragScroll", scrollInterval); dispatchEvent({type:"scroll", direction:"vertical", position:__vPosition}); } else { dragScrolling = setInterval(this, "dragScroll", 15); } updateAfterEvent(); } function __onMouseUp(Void) { clearInterval(dragScrolling); delete dragScrolling; delete dragScrolling; delete isPressed; delete onMouseUp; if (!selectable) { return(undefined); } if (changeFlag) { dispatchEvent({type:"change"}); } delete changeFlag; } function moveSelBy(incr) { if (!selectable) { setVPosition(__vPosition + incr); return(undefined); } var _local3 = getSelectedIndex(); if (_local3 == undefined) { _local3 = -1; } var _local2 = _local3 + incr; _local2 = Math.max(0, _local2); _local2 = Math.min(getLength() - 1, _local2); if (_local2 == _local3) { return(undefined); } if ((_local3 < __vPosition) || (_local3 >= (__vPosition + __rowCount))) { setVPosition(_local3); } if ((_local2 >= ((__vPosition + __rowCount) - roundUp)) || (_local2 < __vPosition)) { setVPosition(__vPosition + incr); } wasKeySelected = true; selectRow(_local2 - __vPosition, false); } function keyDown(e) { if (selectable) { if (findInputText()) { return(undefined); } } if (e.code == 40) { moveSelBy(1); } else if (e.code == 38) { moveSelBy(-1); } else if (e.code == 34) { if (selectable) { var _local3 = getSelectedIndex(); if (_local3 == undefined) { _local3 = 0; } setVPosition(_local3); } moveSelBy((__rowCount - 1) - roundUp); } else if (e.code == 33) { if (selectable) { var _local3 = getSelectedIndex(); if (_local3 == undefined) { _local3 = 0; } setVPosition(_local3); } moveSelBy((1 - __rowCount) + roundUp); } else if (e.code == 36) { moveSelBy(-__dataProvider.length); } else if (e.code == 35) { moveSelBy(__dataProvider.length); } } function findInputText(Void) { var _local2 = Key.getAscii(); if ((_local2 >= 33) && (_local2 <= 126)) { findString(String.fromCharCode(_local2)); return(true); } } function findString(str) { if (__dataProvider.length == 0) { return(undefined); } var _local4 = getSelectedIndex(); if (_local4 == undefined) { _local4 = 0; } var _local6 = 0; var _local3 = _local4 + 1; while (_local3 != _local4) { var _local2 = __dataProvider.getItemAt(_local3); if (_local2 instanceof XMLNode) { _local2 = _local2.attributes[__labelField]; } else if (typeof(_local2) != "string") { _local2 = String(_local2[__labelField]); } _local2 = _local2.substring(0, str.length); if ((str == _local2) || (str.toUpperCase() == _local2.toUpperCase())) { _local6 = _local3 - _local4; break; } if (_local3 >= (getLength() - 1)) { _local3 = -1; } _local3++; } if (_local6 != 0) { moveSelBy(_local6); } } function onRowPress(rowIndex) { if (!enabled) { return(undefined); } isPressed = true; dragScrolling = setInterval(this, "dragScroll", 15); onMouseUp = __onMouseUp; if (!selectable) { return(undefined); } selectRow(rowIndex); } function onRowRelease(rowIndex) { } function onRowRollOver(rowIndex) { if (!enabled) { return(undefined); } var _local2 = rows[rowIndex].item; if (getStyle("useRollOver") && (_local2 != undefined)) { rows[rowIndex].drawRow(_local2, "highlighted", false); } dispatchEvent({type:"itemRollOver", index:rowIndex + __vPosition}); } function onRowRollOut(rowIndex) { if (!enabled) { return(undefined); } if (getStyle("useRollOver")) { rows[rowIndex].drawRow(rows[rowIndex].item, getStateAt(rowIndex + __vPosition), false); } dispatchEvent({type:"itemRollOut", index:rowIndex + __vPosition}); } function onRowDragOver(rowIndex) { if (((!enabled) || (isPressed != true)) || (!selectable)) { return(undefined); } if (dropEnabled) { } else if (dragScrolling) { selectRow(rowIndex, false); } else { onMouseUp = __onMouseUp; onRowPress(rowIndex); } } function onRowDragOut(rowIndex) { if (!enabled) { return(undefined); } if (dragEnabled) { } else { onRowRollOut(rowIndex); } } function init(Void) { super.init(); tabEnabled = true; tabChildren = false; if (__dataProvider == undefined) { __dataProvider = new Array(); __dataProvider.addEventListener("modelChanged", this); } baseRowZ = (topRowZ = 10); } function createChildren(Void) { super.createChildren(); listContent = createEmptyMovieClip("content_mc", CONTENTDEPTH); invLayoutContent = true; invalidate(); } function draw(Void) { if (invRowHeight) { delete invRowHeight; __rowCount = 0; listContent.removeMovieClip(); listContent = createEmptyMovieClip("content_mc", CONTENTDEPTH); } if (invUpdateControl) { updateControl(); } border_mc.draw(); } function invalidateStyle(propName) { if (isRowStyle[propName]) { invUpdateControl = true; invalidate(); } else { var _local3 = 0; while (_local3 < __rowCount) { rows[_local3].invalidateStyle(propName); _local3++; } } super.invalidateStyle(propName); } static var mixIt1 = mx.controls.listclasses.DataSelector.Initialize(mx.controls.listclasses.ScrollSelectList); static var mixIt2 = mx.controls.listclasses.DataProvider.Initialize(Array); var CONTENTDEPTH = 100; var __hPosition = 0; var __rowRenderer = "SelectableRow"; var __rowHeight = 22; var __rowCount = 0; var __labelField = "label"; var minScrollInterval = 30; var dropEnabled = false; var dragEnabled = false; var className = "ScrollSelectList"; var isRowStyle = {styleName:true, backgroundColor:true, selectionColor:true, rollOverColor:true, selectionDisabledColor:true, backgroundDisabledColor:true, textColor:true, textSelectedColor:true, textRollOverColor:true, textDisabledColor:true, alternatingRowColors:true, defaultIcon:true}; var roundUp = 0; var selectable = true; var multipleSelection = false; }
Symbol 9 MovieClip [__Packages.mx.controls.List] Frame 0
class mx.controls.List extends mx.controls.listclasses.ScrollSelectList { var border_mc, __labels, setDataProvider, roundUp, __get__rowCount, __dataProvider, __maxHPosition, invScrollProps, invalidate, __vPosition, getViewMetrics, setSize, __width, __rowHeight, totalWidth, totalHeight, displayWidth, __hScrollPolicy, vScroller, __hPosition, listContent, data, mask_mc, __height, __rowCount, invRowHeight, invLayoutContent, setScrollProperties, oldVWidth; function List () { super(); } function setEnabled(v) { super.setEnabled(v); border_mc.backgroundColorName = (v ? "backgroundColor" : "backgroundDisabledColor"); border_mc.invalidate(); } function get labels() { return(__labels); } function set labels(lbls) { __labels = lbls; setDataProvider(lbls); //return(labels); } function setVPosition(pos) { pos = Math.min((__dataProvider.length - __get__rowCount()) + roundUp, pos); pos = Math.max(0, pos); super.setVPosition(pos); } function setHPosition(pos) { pos = Math.max(Math.min(__maxHPosition, pos), 0); super.setHPosition(pos); hScroll(pos); } function setMaxHPosition(pos) { __maxHPosition = pos; invScrollProps = true; invalidate(); } function setHScrollPolicy(policy) { if ((policy.toLowerCase() == "auto") && (!autoHScrollAble)) { return(undefined); } super.setHScrollPolicy(policy); if (policy == "off") { setHPosition(0); setVPosition(Math.min((__dataProvider.length - __get__rowCount()) + roundUp, __vPosition)); } } function setRowCount(rC) { if (isNaN(rC)) { return(undefined); } var _local2 = getViewMetrics(); setSize(__width, ((__rowHeight * rC) + _local2.top) + _local2.bottom); } function layoutContent(x, y, tW, tH, dW, dH) { totalWidth = tW; totalHeight = tH; displayWidth = dW; var _local4 = (((__hScrollPolicy == "on") || (__hScrollPolicy == "auto")) ? (Math.max(tW, dW)) : (dW)); super.layoutContent(x, y, _local4, dH); } function modelChanged(eventObj) { super.modelChanged(eventObj); var _local3 = eventObj.eventName; if ((((_local3 == "addItems") || (_local3 == "removeItems")) || (_local3 == "updateAll")) || (_local3 == "filterModel")) { invScrollProps = true; invalidate("invScrollProps"); } } function onScroll(eventObj) { var _local3 = eventObj.target; if (_local3 == vScroller) { setVPosition(_local3.scrollPosition); } else { hScroll(_local3.scrollPosition); } super.onScroll(eventObj); } function hScroll(pos) { __hPosition = pos; listContent._x = -pos; } function init(Void) { super.init(); if (labels.length > 0) { var _local6 = new Array(); var _local3 = 0; while (_local3 < labels.length) { _local6.addItem({label:labels[_local3], data:data[_local3]}); _local3++; } setDataProvider(_local6); } __maxHPosition = 0; } function createChildren(Void) { super.createChildren(); listContent.setMask(mask_mc); border_mc.move(0, 0); border_mc.setSize(__width, __height); } function getRowCount(Void) { var _local2 = getViewMetrics(); return(((__rowCount == 0) ? (Math.ceil(((__height - _local2.top) - _local2.bottom) / __rowHeight)) : (__rowCount))); } function size(Void) { super.size(); configureScrolling(); var _local3 = getViewMetrics(); layoutContent(_local3.left, _local3.top, __width + __maxHPosition, totalHeight, (__width - _local3.left) - _local3.right, (__height - _local3.top) - _local3.bottom); } function draw(Void) { if (invRowHeight) { invScrollProps = true; super.draw(); listContent.setMask(mask_mc); invLayoutContent = true; } if (invScrollProps) { configureScrolling(); delete invScrollProps; } if (invLayoutContent) { var _local3 = getViewMetrics(); layoutContent(_local3.left, _local3.top, __width + __maxHPosition, totalHeight, (__width - _local3.left) - _local3.right, (__height - _local3.top) - _local3.bottom); } super.draw(); } function configureScrolling(Void) { var _local2 = __dataProvider.length; if (__vPosition > Math.max(0, (_local2 - getRowCount()) + roundUp)) { setVPosition(Math.max(0, Math.min((_local2 - getRowCount()) + roundUp, __vPosition))); } var _local3 = getViewMetrics(); var _local4 = ((__hScrollPolicy != "off") ? (((__maxHPosition + __width) - _local3.left) - _local3.right) : ((__width - _local3.left) - _local3.right)); if (_local2 == undefined) { _local2 = 0; } setScrollProperties(_local4, 1, _local2, __rowHeight); if (oldVWidth != _local4) { invLayoutContent = true; } oldVWidth = _local4; } static var symbolOwner = mx.controls.List; static var symbolName = "List"; var className = "List"; static var version = "2.0.2.126"; var clipParameters = {rowHeight:1, enabled:1, visible:1, labels:1}; var scrollDepth = 1; var __vScrollPolicy = "on"; var autoHScrollAble = false; }
Symbol 10 MovieClip [__Packages.mx.controls.DataGrid] Frame 0
class mx.controls.DataGrid extends mx.controls.List { var invInitHeaders, columns, __rowCount, invDrawCols, invalidate, getViewMetrics, setSize, __width, __rowHeight, invCheckCols, enabled, cellEditor, __dataProvider, __vPosition, rows, getStateAt, __hScrollPolicy, __maxHPosition, roundUp, getRowCount, setScrollProperties, oldVWidth, invLayoutContent, border_mc, __height, setMaxHPosition, setHPosition, getMaxHPosition, getHPosition, oldWidth, displayWidth, numberOfCols, invRowHeight, invSpaceColsEqually, invColChange, updateControl, totalWidth, lines_mc, listContent, __get__height, getStyle, headerCells, header_mc, dispatchEvent, __viewMetrics, sortArrow, sortIndex, layoutX, sortDirection, owner, column, _alpha, cell, asc, col, oldX, onRollOut, __focusedCell, __hPosition, editorMask, editTween, getFocusManager, __tabHandlerCache, vScroller, hScroller, dontEdit, listOwner, activeGrid, getLength, releaseFocus; function DataGrid () { super(); } function init() { super.init(); invInitHeaders = true; columns = new Array(); } function layoutContent(x, y, tW, tH, dW, dH) { var _local3 = __rowCount; if (__showHeaders) { y = y + __headerHeight; dH = dH - __headerHeight; } super.layoutContent(x, y, tW, tH, dW, dH); if (tW != totColW) { drawHeaderBG(); } if (__rowCount > _local3) { invDrawCols = true; invalidate(); } } function setRowCount(rC) { if (isNaN(rC)) { return(undefined); } var _local2 = getViewMetrics(); setSize(__width, (((__rowHeight * rC) + _local2.top) + _local2.bottom) + (__headerHeight * __showHeaders)); } function setRowHeight(rH) { __rowHeight = rH; if (hasDrawn) { super.setRowHeight(rH); } } function setHScrollPolicy(policy) { super.setHScrollPolicy(policy); invCheckCols = true; invalidate(); } function setEnabled(v) { if (v == enabled) { return(undefined); } super.setEnabled(v); if (__showHeaders) { enableHeader(v); } if (cellEditor._visible == true) { disposeEditor(); } invDrawCols = true; invalidate(); } function modelChanged(eventObj) { if (eventObj.eventName == "updateField") { var _local3 = eventObj.firstItem; var _local5 = __dataProvider.getItemAt(_local3); rows[_local3 - __vPosition].drawRow(_local5, getStateAt(_local3)); return(undefined); } if (eventObj.eventName == "schemaLoaded") { removeAllColumns(); } if (columns.length == 0) { generateCols(); } super.modelChanged(eventObj); } function configureScrolling(Void) { var _local3 = getViewMetrics(); var _local4 = ((__hScrollPolicy != "off") ? (((__maxHPosition + __width) - _local3.left) - _local3.right) : ((__width - _local3.left) - _local3.right)); var _local2 = __dataProvider.length; if (_local2 == undefined) { _local2 = 0; } if (__vPosition > Math.max(0, (_local2 - getRowCount()) + roundUp)) { setVPosition(Math.max(0, Math.min((_local2 - getRowCount()) + roundUp, __vPosition))); } setScrollProperties(_local4, 1, _local2, __rowHeight, __headerHeight * __showHeaders); if (oldVWidth != _local4) { invLayoutContent = true; } oldVWidth = _local4; } function setVPosition(pos) { if (cellEditor != undefined) { disposeEditor(); } super.setVPosition(pos); } function size(Void) { if (hasDrawn != true) { border_mc.setSize(__width, __height); return(undefined); } if (cellEditor != undefined) { disposeEditor(); } if (__hScrollPolicy != "off") { var _local5 = 0; var _local6 = columns.length; var _local3 = 0; while (_local3 < _local6) { _local5 = _local5 + columns[_local3].__width; _local3++; } var _local8 = getViewMetrics(); var _local9 = (__width - _local8.left) - _local8.right; setMaxHPosition(Math.max(_local5 - _local9, 0)); var _local7 = _local9 - _local5; if (_local7 > 0) { columns[_local6 - 1].__width = columns[_local6 - 1].__width + _local7; } setHPosition(Math.min(getMaxHPosition(), getHPosition())); } super.size(); if (__hScrollPolicy == "off") { var _local10 = new Array(); var _local6 = columns.length; if (oldWidth == undefined) { oldWidth = displayWidth; } var _local4 = 0; var _local3 = 0; while (_local3 < _local6) { _local4 = _local4 + ((columns[_local3].__width = (displayWidth * columns[_local3].__width) / oldWidth)); _local3++; } if (_local4 != displayWidth) { columns[columns.length - 1].__width = columns[columns.length - 1].__width + (displayWidth - _local4); } totColW = (numberOfCols = displayWidth); } oldWidth = displayWidth; drawColumns(); drawHeaderBG(); invalidate(); } function draw() { if (invRowHeight) { super.draw(); invInitHeaders = true; invDrawCols = true; delete cellEditor; } if (invInitHeaders) { initHeaders(); invLayoutContent = true; } super.draw(); if (invSpaceColsEqually) { delete invSpaceColsEqually; spaceColumnsEqually(); } if (invColChange) { delete invColChange; if (hasDrawn) { initHeaders(); initRows(); invDrawCols = true; updateControl(); invCheckCols = true; } } if (invCheckCols) { if (totColW != displayWidth) { resizeColumn(columns.length - 1, columns[columns.length - 1].__width); } delete invCheckCols; } if (invDrawCols) { drawColumns(); } hasDrawn = true; } function editField(index, colName, data) { __dataProvider.editField(index, colName, data); } function get columnNames() { return(getColumnNames()); } function set columnNames(w) { setColumnNames(w); //return(columnNames); } function setColumnNames(tmpArray) { var _local2 = 0; while (_local2 < tmpArray.length) { addColumn(tmpArray[_local2]); _local2++; } } function getColumnNames(Void) { var _local3 = new Array(); var _local2 = 0; while (_local2 < columns.length) { _local3[_local2] = columns[_local2].columnName; _local2++; } return(_local3); } function addColumnAt(index, newCol) { if (index < columns.length) { columns.splice(index, 0, "tmp"); } var _local4 = newCol; if (!(_local4 instanceof mx.controls.gridclasses.DataGridColumn)) { _local4 = new mx.controls.gridclasses.DataGridColumn(_local4); } columns[index] = _local4; _local4.colNum = index; var _local2 = index + 1; while (_local2 < columns.length) { columns[_local2].colNum++; _local2++; } _local4.parentGrid = this; totColW = totColW + _local4.width; invColChange = true; invalidate(); return(newCol); } function addColumn(newCol) { return(addColumnAt(columns.length, newCol)); } function removeColumnAt(index) { var _local4 = columns[index]; columns.splice(index, 1); totColW = totColW - _local4.width; var _local2 = index; while (_local2 < columns.length) { columns[_local2].colNum--; _local2++; } invColChange = true; invalidate(); return(_local4); } function removeAllColumns(Void) { totColW = 0; columns = new Array(); invColChange = true; invalidate(); } function getColumnAt(index) { return(columns[index]); } function getColumnIndex(name) { var _local2 = 0; while (_local2 < columns.length) { if (columns[_local2].columnName == name) { return(_local2); } _local2++; } } function get columnCount() { return(columns.length); } function spaceColumnsEqually(Void) { if (displayWidth == undefined) { var _local4 = getViewMetrics(); displayWidth = (__width - _local4.left) - _local4.right; } var _local3 = Math.ceil(totalWidth / columns.length); var _local2 = 0; while (_local2 < columns.length) { columns[_local2].__width = _local3; _local2++; } totColW = totalWidth; invDrawCols = true; invalidate(); } function generateCols(Void) { if (columns.length == 0) { var _local3 = __dataProvider.getColumnNames(); if (_local3 == undefined) { var _local4 = __dataProvider.getItemAt(0); for (var _local2 in _local4) { if (_local2 != "__ID__") { addColumn(_local2); } } } else { var _local2 = 0; while (_local2 < _local3.length) { addColumn(_local3[_local2]); _local2++; } } invSpaceColsEqually = true; invColChange = true; invCheckCols = true; invalidate(); } } function resizeColumn(col, w) { if ((__hScrollPolicy == "on") || (__hScrollPolicy == "auto")) { columns[col].__width = w; var _local11 = 0; var _local5 = columns.length; var _local2 = 0; while (_local2 < _local5) { _local11 = _local11 + columns[_local2].__width; _local2++; } setMaxHPosition(Math.max(_local11 - displayWidth, 0)); var _local12 = displayWidth - _local11; if (_local12 > 0) { columns[_local5 - 1].__width = columns[_local5 - 1].__width + _local12; } setHPosition(Math.min(getMaxHPosition(), getHPosition())); invDrawCols = true; invalidate(); return(undefined); } var _local10 = 0; var _local2 = 0; while (_local2 < col) { _local10 = _local10 + columns[_local2].__width; _local2++; } var _local8 = ((displayWidth + 2) - _local10) - columns[col].__width; var _local6 = ((displayWidth + 2) - _local10) - w; columns[col].__width = w; var _local5 = columns.length; _local2 = col + 1; while (_local2 < _local5) { if (!columns[_local2].resizable) { _local6 = _local6 - columns[_local2].__width; _local8 = _local8 - columns[_local2].__width; } _local2++; } var _local9 = 0; _local2 = col + 1; while (_local2 < _local5) { if (columns[_local2].resizable) { columns[_local2].__width = (columns[_local2].width * _local6) / _local8; _local9 = _local9 + columns[_local2].__width; } _local2++; } var _local3 = 0; var _local7 = false; _local2 = _local5 - 1; while (_local2 >= 0) { if (columns[_local2].resizable) { if (!_local7) { columns[_local2].__width = columns[_local2].__width + (_local6 - _local9); _local7 = true; } if (_local3 > 0) { columns[_local2].__width = columns[_local2].__width - _local3; _local3 = 0; } if (columns[_local2].__width < minColWidth) { _local3 = _local3 + (minColWidth - columns[_local2].__width); columns[_local2].__width = minColWidth; } } _local2--; } invDrawCols = true; invalidate(); } function drawColumns(Void) { delete invDrawCols; var _local4 = (lines_mc = listContent.createEmptyMovieClip("lines_mc", LINEDEPTH)); var _local9 = 0.75; var _local5 = 1; var _local15 = __get__height() - 1; var _local12 = getStyle("vGridLineColor"); var _local14 = columns.length; placeSortArrow(); var _local7 = 0; while (_local7 < _local14) { var _local6 = columns[_local7]; var _local13 = (enabled ? "backgroundColor" : "backgroundDisabledColor"); var _local11 = _local6.getStyle(_local13); _local9 = _local9 + _local6.__width; _local4.moveTo(_local5, 1); _local4.lineStyle(0, _local12, 0); var _local10 = Math.floor(_local9); _local4.lineTo(_local10, 1); if ((_local7 < (columns.length - 1)) && (getStyle("vGridLines"))) { _local4.lineStyle(0, _local12, 100); } _local4.lineTo(_local10, __get__height()); _local4.lineStyle(0, _local12, 0); _local4.lineTo(_local5, __get__height()); _local4.lineTo(_local5, 1); if (__showHeaders) { var _local3 = headerCells[_local7]; _local3._x = _local5 + 2; _local3.hO._x = _local5; _local3.setSize(_local6.__width - 5, Math.min(__headerHeight, _local3.getPreferredHeight())); _local3.hO._width = _local6.__width - 2; _local3.hO._height = __headerHeight; _local3._y = (__headerHeight - _local3._height) / 2; header_mc["sep" + _local7]._x = _local9 - 2; listContent.disableHeader._width = totalWidth; } var _local2 = 0; while (_local2 < __rowCount) { if (_local7 == 0) { rows[_local2].colBG.clear(); } var _local8 = _local6.__width; rows[_local2].drawCell(_local7, _local5, _local8, _local11); _local2++; } _local5 = _local9; _local7++; } if (getStyle("hGridLines")) { lines_mc.lineStyle(0, getStyle("hGridLineColor")); _local7 = 1; while (_local7 < __rowCount) { lines_mc.moveTo(4, rows[_local7]._y); lines_mc.lineTo(totalWidth, rows[_local7]._y); _local7++; } } } function initRows(Void) { var _local2 = 0; while (_local2 < __rowCount) { rows[_local2].createCells(); _local2++; } } function onRowPress(rowIndex) { super.onRowPress(rowIndex); if (!enabled) { return(undefined); } var _local11 = columns.length; var _local6 = rows[rowIndex]; var _local3 = 0; while (_local3 < _local11) { var _local5 = columns[_local3]; var _local4 = _local6._xmouse - _local6.cells[_local3]._x; if ((_local4 >= 0) && (_local4 < _local5.__width)) { dispatchEvent({type:"cellPress", columnIndex:_local3, view:this, itemIndex:rowIndex + __vPosition}); return(undefined); } _local3++; } } function get showHeaders() { return(getShowHeaders()); } function set showHeaders(w) { setShowHeaders(w); //return(showHeaders); } function setShowHeaders(b) { __showHeaders = b; invInitHeaders = true; invDrawCols = true; invalidate(); } function getShowHeaders() { return(__showHeaders); } function get headerHeight() { return(getHeaderHeight()); } function set headerHeight(w) { setHeaderHeight(w); //return(headerHeight); } function setHeaderHeight(h) { __headerHeight = h; invInitHeaders = true; invDrawCols = true; invalidate(); } function getHeaderHeight(Void) { return(__headerHeight); } function initHeaders(Void) { delete invInitHeaders; if (__showHeaders) { header_mc = listContent.createClassObject(mx.core.UIObject, "header_mc", HEADERDEPTH, {styleName:this}); headerCells = new Array(); var _local2 = 0; while (_local2 < columns.length) { var _local6 = columns[_local2]; var _local4; var _local7 = _local6.__headerRenderer; if (_local7 == undefined) { _local4 = (headerCells[_local2] = header_mc.createLabel("fHeaderCell" + _local2, HEADERCELLDEPTH + _local2)); _local4.selectable = false; _local4.setStyle("styleName", _local6); } else if (typeof(_local7) == "string") { _local4 = (headerCells[_local2] = header_mc.createObject(_local7, "fHeaderCell" + _local2, HEADERCELLDEPTH + _local2, {styleName:_local6})); } else { _local4 = (headerCells[_local2] = header_mc.createClassObject(_local7, "fHeaderCell" + _local2, HEADERCELLDEPTH + _local2, {styleName:_local6})); } _local4.setValue(_local6.__get__headerText()); _local6.headerCell = _local4; var _local3 = header_mc.attachMovie("DataHeaderOverlay", "hO" + _local2, HEADEROVERLAYDEPTH + _local2); _local4.hO = _local3; _local3.cell = _local4; _local4.column = (_local3.column = _local6); _local4.asc = (_local3.asc = false); _local4.owner = (_local3.owner = this); _local3._alpha = 0; if (_local3.column.sortable && (_local3.onPress == undefined)) { _local3.useHandCursor = false; _local3.onRollOver = headerRollOver; _local3.onRollOut = headerRollOut; _local3.onPress = headerPress; _local3.onRelease = headerRelease; _local3.onReleaseOutside = headerUp; _local3.headerUp = headerUp; } if (_local2 < (columns.length - 1)) { var _local5 = header_mc.attachMovie("DataHeaderSeperator", "sep" + _local2, SEPARATORDEPTH + _local2); _local5._height = __headerHeight; if (_local6.resizable && (resizableColumns)) { _local5.useHandCursor = false; _local5.col = _local2; _local5.owner = this; _local5.onRollOver = showStretcher; _local5.onPress = startSizing; _local5.onRelease = (_local5.onReleaseOutside = stopSizing); _local5.onRollOut = hideStretcher; } } _local2++; } drawHeaderBG(); } else { header_mc.removeMovieClip(); } } function invalidateHeaderStyle(Void) { var _local4 = columns.length; var _local3 = 0; while (_local3 < _local4) { var _local2 = headerCells[_local3]; if (_local2.stylecache != undefined) { delete _local2.stylecache.tf; } delete _local2.enabledColor; _local2.invalidateStyle(); _local2.draw(); _local3++; } } function drawHeaderBG(Void) { var _local2 = header_mc; _local2.clear(); var _local5 = getStyle("headerColor"); var _local3 = __viewMetrics; var _local4 = Math.max(totalWidth, displayWidth + 3); _local2.moveTo(_local3.left, _local3.top); var _local7 = {matrixType:"box", x:0, y:0, w:_local4, h:__headerHeight + 1, r:(Math.PI/2)}; var _local8 = [_local5, _local5, 16777215]; var _local9 = [0, 60, 255]; var _local6 = [100, 100, 100]; _local2.beginGradientFill("linear", _local8, _local6, _local9, _local7); _local2.lineStyle(0, 0, 0); _local2.lineTo(_local4, _local3.top); _local2.lineTo(_local4, __headerHeight + 1); _local2.lineStyle(0, 0, 100); _local2.lineTo(_local3.left, __headerHeight + 1); _local2.lineStyle(0, 0, 0); _local2.endFill(); } function enableHeader(v) { if (v) { listContent.disableHeader.removeMovieClip(); } else { var _local2 = listContent.attachMovie("DataHeaderOverlay", "disableHeader", DISABLEDHEADERDEPTH); _local2._width = totalWidth; _local2._height = __headerHeight; var _local3 = new Color(_local2); _local3.setRGB(getStyle("backgroundDisabledColor")); _local2._alpha = 60; } } function placeSortArrow(Void) { sortArrow.removeMovieClip(); if (sortIndex == undefined) { return(undefined); } if ((columns[sortIndex].__width - headerCells[sortIndex].getPreferredWidth()) <= 20) { return(undefined); } sortArrow = header_mc.createObject("DataSortArrow", "sortArrow", SORTARROWDEPTH); var _local3 = layoutX; var _local2 = 0; while (_local2 <= sortIndex) { _local3 = _local3 + columns[_local2].__width; _local2++; } var _local4 = sortDirection == "ASC"; sortArrow._yscale = (_local4 ? -100 : 100); sortArrow._x = (_local3 - sortArrow._width) - 8; sortArrow._y = ((__headerHeight - sortArrow._height) / 2) + (_local4 * sortArrow._height); } function headerRollOver(Void) { var _local2 = owner; if ((((!_local2.enabled) || (_local2.cellEditor != undefined)) || (!_local2.sortableColumns)) || (!column.sortable)) { return(undefined); } var _local3 = new Color(this); _local3.setRGB(_local2.getStyle("rollOverColor")); _alpha = 50; } function headerRollOut(Void) { _alpha = 0; } function headerPress(Void) { var _local2 = owner; if (((!column.sortable) || (!_local2.sortableColumns)) || (!_local2.enabled)) { return(undefined); } cell._x = cell._x + 1; cell._y = cell._y + 1; var _local3 = new Color(this); _local3.setRGB(_local2.getStyle("selectionColor")); _alpha = 100; } function headerUp(Void) { if (((!column.sortable) || (!owner.sortableColumns)) || (!owner.enabled)) { return(undefined); } _alpha = 0; cell._x = cell._x - 1; cell._y = cell._y - 1; } function headerRelease(Void) { var _local2 = owner; var _local3 = column; if (((!_local3.sortable) || (!_local2.sortableColumns)) || (!_local2.enabled)) { return(undefined); } headerUp(); asc = !asc; var _local4 = (asc ? "ASC" : "DESC"); _local2.sortIndex = _local2.getColumnIndex(_local3.columnName); _local2.sortDirection = _local4; _local2.placeSortArrow(); if (_local3.sortOnHeaderRelease) { _local2.sortItemsBy(_local3.columnName, _local4); } _local2.dispatchEvent({type:"headerRelease", view:_local2, columnIndex:_local2.getColumnIndex(_local3.columnName)}); _local2.dontEdit = true; } function isStretchable(col) { var _local2 = true; if (!resizableColumns) { _local2 = false; } else if (!columns[col].resizable) { _local2 = false; } else if ((col == (columns.length - 2)) && (!columns[col + 1].resizable)) { _local2 = false; } return(_local2); } function showStretcher(Void) { var _local2 = owner; if (((!_local2.isStretchable(col)) || (!_local2.enabled)) || (_local2.cellEditor != undefined)) { return(undefined); } Mouse.hide(); if (_local2.stretcher == undefined) { _local2.attachMovie("cursorStretch", "stretcher", _local2.STRETCHERDEPTH); } _local2.stretcher._x = _local2._xmouse; _local2.stretcher._y = _local2._ymouse; _local2.stretcher._visible = true; _local2.onMouseMove = function () { this.stretcher._x = this._xmouse; this.stretcher._y = this._ymouse; updateAfterEvent(); }; } function startSizing(Void) { var _local2 = owner; if ((!_local2.isStretchable(col)) || (!_local2.enabled)) { return(undefined); } _local2.pressFocus(); _local2.attachMovie("DataStretchBar", "stretchBar", 999); _local2.stretchBar._height = _local2.height; _local2.stretchBar._x = _local2._xmouse; oldX = _local2.stretchBar._x; _local2.colX = oldX - _local2.columns[col].width; _local2.onMouseMove = function () { this.stretcher._x = this._xmouse; this.stretcher._y = this._ymouse; this.stretchBar._x = Math.max(this._xmouse, this.colX + this.minColWidth); if (this.__hScrollPolicy == "off") { this.stretchBar._x = Math.min(this.stretchBar._x, this.displayWidth - this.minColWidth); } updateAfterEvent(); }; } function stopSizing(Void) { var _local2 = owner; var _local3 = col; if ((!_local2.isStretchable(_local3)) || (!_local2.enabled)) { return(undefined); } _local2.stretchBar._visible = false; onRollOut(); var _local4 = _local2.stretchBar._x - oldX; _local2.resizeColumn(_local3, _local2.columns[_local3].width + _local4); _local2.dispatchEvent({type:"columnStretch", columnIndex:_local3}); } function hideStretcher(Void) { owner.stretcher._visible = false; delete owner.onMouseMove; Mouse.show(); } function set focusedCell(obj) { setFocusedCell(obj); //return(focusedCell); } function get focusedCell() { return(__focusedCell); } function setFocusedCell(coord, broadCast) { if ((!enabled) || (!editable)) { return(undefined); } if ((coord == undefined) && (cellEditor != undefined)) { disposeEditor(); return(undefined); } var _local2 = coord.itemIndex; var _local5 = coord.columnIndex; if (_local2 == undefined) { _local2 = 0; } if (_local5 == undefined) { _local5 = 0; } var _local9 = columns[_local5].columnName; if (__vPosition > _local2) { setVPosition(_local2); } else { var _local11 = (((_local2 - __vPosition) - __rowCount) + roundUp) + 1; if (_local11 > 0) { setVPosition(__vPosition + _local11); } } var _local10 = columns[_local5]; var _local8 = rows[_local2 - __vPosition]; var _local3 = _local8.cells[_local5]; if ((_local3._x > (__hPosition + displayWidth)) || (_local3._x < __hPosition)) { setHPosition(_local3._x); } var _local4 = __dataProvider.getEditingData(_local2, _local9); if (_local4 == undefined) { _local4 = __dataProvider.getItemAt(_local2)[_local9]; } if (_local4 == undefined) { _local4 = " "; } if (_local3.isCellEditor != true) { if (cellEditor == undefined) { cellEditor = listContent.createClassObject(mx.controls.TextInput, "editor_mc", EDITORDEPTH, {styleName:_local10, listOwner:this}); } cellEditor.backgroundColor = 16777215 /* 0xFFFFFF */; cellEditor._visible = true; cellEditor.setSize(_local10.__width, __rowHeight + 2); cellEditor._x = _local3._x - 1; cellEditor.text = _local4; editorMask = listContent.attachMovie("BoundingBox", "editorMask", 60001, {_alpha:0}); cellEditor.setMask(editorMask); editorMask._width = cellEditor.width; editorMask._height = cellEditor.height; editorMask._y = (cellEditor._y = _local8._y - 1); editorMask._x = cellEditor._x - editorMask._width; editTween = new mx.effects.Tween(this, cellEditor._x - editorMask._width, cellEditor._x, 150); } else { cellEditor = _local3; cellEditor.setValue(_local4, __dataProvider.getItemAt(_local2)); } var _local6 = getFocusManager(); _local6.setFocus(cellEditor); _local6.defaultPushButtonEnabled = false; if (_local3.isCellEditor != true) { cellEditor.hPosition = 0; cellEditor.redraw(); Selection.setSelection(0, cellEditor.length); } __focusedCell = coord; if (__tabHandlerCache == undefined) { __tabHandlerCache = _local6.tabHandler; _local6.tabHandler = tabHandler; } _local6.activeGrid = this; cellEditor.addEventListener("keyDown", editorKeyDown); if (broadCast) { dispatchEvent({type:"cellFocusIn", itemIndex:_local2, columnIndex:_local5}); } } function onMouseDown(Void) { if (cellEditor._visible && (!cellEditor.hitTest(_root._xmouse, _root._ymouse))) { editCell(); } if ((vScroller.hitTest(_root._xmouse, _root._ymouse) || (hScroller.hitTest(_root._xmouse, _root._ymouse))) || (header_mc.hitTest(_root._xmouse, _root._ymouse))) { dontEdit = true; } } function editorKeyDown(Void) { if (Key.isDown(27)) { listOwner.disposeEditor(); } else if (Key.isDown(13) && (Key.getCode() != 229)) { listOwner.editCell(); listOwner.findNextEnterCell(); } } function tabHandler(Void) { var _local4 = -1; var _local3 = -1; var _local2 = activeGrid; if (_local2.__focusedCell != undefined) { _local4 = _local2.__focusedCell.itemIndex; _local3 = _local2.__focusedCell.columnIndex; } _local2.editCell(); _local2.findNextCell(_local4, _local3); } function findNextEnterCell(Void) { var _local3 = (Key.isDown(16) ? -1 : 1); var _local2 = __focusedCell.itemIndex + _local3; if ((_local2 < getLength()) && (_local2 >= 0)) { __focusedCell.itemIndex = _local2; } setFocusedCell(__focusedCell, true); } function findNextCell(index, colIndex) { if (index == undefined) { colIndex = -1; index = colIndex; } var _local5 = false; var _local4 = (Key.isDown(16) ? -1 : 1); while (!_local5) { colIndex = colIndex + _local4; if ((colIndex >= columns.length) || (colIndex < 0)) { colIndex = ((colIndex < 0) ? (columns.length) : 0); index = index + _local4; if ((index >= getLength()) || (index < 0)) { if (getFocusManager().activeGrid != undefined) { disposeEditor(); } dontEdit = true; Selection.setFocus(this); delete dontEdit; getFocusManager().tabHandler(); return(undefined); } } if (columns[colIndex].editable) { _local5 = true; if (__tabHandlerCache != undefined) { disposeEditor(); } setFocusedCell({itemIndex:index, columnIndex:colIndex}, true); } } } function onSetFocus(Void) { super.onSetFocus(); if (editable && (dontEdit != true)) { if (__focusedCell == undefined) { __focusedCell = {itemIndex:0, columnIndex:0}; } if (columns[__focusedCell.columnIndex].editable == true) { setFocusedCell(__focusedCell, true); } else { findNextCell(__focusedCell.itemIndex, __focusedCell.columnIndex); } } delete dontEdit; } function onTweenUpdate(val) { editorMask._x = val; } function onTweenEnd(val) { editorMask._x = val; cellEditor.setMask(undefined); editorMask.removeMovieClip(); } function disposeEditor(Void) { cellEditor.removeEventListener("keyDown", editorKeyDown); dispatchEvent({type:"cellFocusOut", itemIndex:__focusedCell.itemIndex, columnIndex:__focusedCell.columnIndex}); if (cellEditor.isCellEditor != true) { cellEditor._visible = false; } var _local3 = getFocusManager(); if (__tabHandlerCache != undefined) { _local3.tabHandler = __tabHandlerCache; delete __tabHandlerCache; } _local3.defaultPushButtonEnabled = true; if ((border_mc.hitTest(_root._xmouse, _root._ymouse) && (!vScroller.hitTest(_root._xmouse, _root._ymouse))) && (!hScroller.hitTest(_root._xmouse, _root._ymouse))) { dontEdit = true; releaseFocus(); delete dontEdit; } delete cellEditor; delete _local3.activeGrid; } function editCell() { var _local3 = __focusedCell.itemIndex; var _local4 = columns[__focusedCell.columnIndex].columnName; var _local2 = __dataProvider.getEditingData(_local3, _local4); if (_local2 == undefined) { _local2 = __dataProvider.getItemAt(_local3)[_local4]; } var _local5 = (cellEditor.isCellEditor ? (cellEditor.getValue()) : (cellEditor.text)); if (_local2 != _local5) { editField(_local3, _local4, _local5); dispatchEvent({type:"cellEdit", itemIndex:_local3, columnIndex:__focusedCell.columnIndex, oldValue:_local2}); } disposeEditor(); } function invalidateStyle(propName) { if ((propName == "headerColor") || (propName == "styleName")) { drawHeaderBG(); } if ((((((propName == "hGridLines") || (propName == "hGridLineColor")) || (propName == "vGridLines")) || (propName == "vGridLineColor")) || (propName == "styleName")) || (propName == "backgroundColor")) { invDrawCols = true; invalidate(); } if (mx.styles.StyleManager.TextStyleMap[propName] != undefined) { super.changeTextStyleInChildren(propName); } if ((propName == "styleName") || (propName == "headerStyle")) { invalidateHeaderStyle(); } super.invalidateStyle(propName); } function notifyStyleChangeInChildren(sheetName, styleProp, newValue) { if (styleProp == "headerStyle") { invalidateHeaderStyle(); } if (sheetName != undefined) { var _local4 = 0; while (_local4 < columns.length) { if (sheetName == columns[_local4].styleName) { invalidateStyle(styleProp); var _local3 = 0; while (_local3 < rows.length) { rows[_local3].notifyStyleChangeInChildren(sheetName, styleProp, newValue); _local3++; } } _local4++; } } super.notifyStyleChangeInChildren(sheetName, styleProp, newValue); } static var symbolOwner = mx.controls.DataGrid; static var symbolName = "DataGrid"; static var version = "2.0.2.126"; var className = "DataGrid"; var selectable = true; var resizableColumns = true; var __showHeaders = true; var sortableColumns = true; var autoHScrollAble = true; var editable = false; var minColWidth = 20; var totColW = 0; var __rowRenderer = "DataGridRow"; var __headerHeight = 20; var hasDrawn = false; var minScrollInterval = 60; var HEADERDEPTH = 5001; var LINEDEPTH = 5000; var SORTARROWDEPTH = 5500; var EDITORDEPTH = 5002; var DISABLEDHEADERDEPTH = 5003; var HEADERCELLDEPTH = 4500; var HEADEROVERLAYDEPTH = 4000; var SEPARATORDEPTH = 5000; var STRETCHERDEPTH = 1000; }
Symbol 126 MovieClip [__Packages.mx.skins.SkinElement] Frame 0
class mx.skins.SkinElement extends MovieClip { var _visible, _x, _y, _width, _height; function SkinElement () { super(); } static function registerElement(name, className) { Object.registerClass(name, ((className == undefined) ? (mx.skins.SkinElement) : (className))); _global.skinRegistry[name] = true; } function __set__visible(visible) { _visible = visible; } function move(x, y) { _x = x; _y = y; } function setSize(w, h) { _width = w; _height = h; } }
Symbol 127 MovieClip [__Packages.mx.styles.CSSTextStyles] Frame 0
class mx.styles.CSSTextStyles { function CSSTextStyles () { } static function addTextStyles(o, bColor) { o.addProperty("textAlign", function () { return(this._tf.align); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.align = x; }); o.addProperty("fontWeight", function () { return(((this._tf.bold != undefined) ? ((this._tf.bold ? "bold" : "none")) : undefined)); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.bold = x == "bold"; }); if (bColor) { o.addProperty("color", function () { return(this._tf.color); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.color = x; }); } o.addProperty("fontFamily", function () { return(this._tf.font); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.font = x; }); o.addProperty("textIndent", function () { return(this._tf.indent); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.indent = x; }); o.addProperty("fontStyle", function () { return(((this._tf.italic != undefined) ? ((this._tf.italic ? "italic" : "none")) : undefined)); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.italic = x == "italic"; }); o.addProperty("marginLeft", function () { return(this._tf.leftMargin); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.leftMargin = x; }); o.addProperty("marginRight", function () { return(this._tf.rightMargin); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.rightMargin = x; }); o.addProperty("fontSize", function () { return(this._tf.size); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.size = x; }); o.addProperty("textDecoration", function () { return(((this._tf.underline != undefined) ? ((this._tf.underline ? "underline" : "none")) : undefined)); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.underline = x == "underline"; }); o.addProperty("embedFonts", function () { return(this._tf.embedFonts); }, function (x) { if (this._tf == undefined) { this._tf = new TextFormat(); } this._tf.embedFonts = x; }); } }
Symbol 128 MovieClip [__Packages.mx.styles.StyleManager] Frame 0
class mx.styles.StyleManager { function StyleManager () { } static function registerInheritingStyle(styleName) { inheritingStyles[styleName] = true; } static function isInheritingStyle(styleName) { return(inheritingStyles[styleName] == true); } static function registerColorStyle(styleName) { colorStyles[styleName] = true; } static function isColorStyle(styleName) { return(colorStyles[styleName] == true); } static function registerColorName(colorName, colorValue) { colorNames[colorName] = colorValue; } static function isColorName(colorName) { return(colorNames[colorName] != undefined); } static function getColorName(colorName) { return(colorNames[colorName]); } static var inheritingStyles = {color:true, direction:true, fontFamily:true, fontSize:true, fontStyle:true, fontWeight:true, textAlign:true, textIndent:true}; static var colorStyles = {barColor:true, trackColor:true, borderColor:true, buttonColor:true, color:true, dateHeaderColor:true, dateRollOverColor:true, disabledColor:true, fillColor:true, highlightColor:true, scrollTrackColor:true, selectedDateColor:true, shadowColor:true, strokeColor:true, symbolBackgroundColor:true, symbolBackgroundDisabledColor:true, symbolBackgroundPressedColor:true, symbolColor:true, symbolDisabledColor:true, themeColor:true, todayIndicatorColor:true, shadowCapColor:true, borderCapColor:true, focusColor:true}; static var colorNames = {black:0, white:16777215, red:16711680, green:65280, blue:255, magenta:16711935, yellow:16776960, cyan:65535, haloGreen:8453965, haloBlue:2881013, haloOrange:16761344}; static var TextFormatStyleProps = {font:true, size:true, color:true, leftMargin:false, rightMargin:false, italic:true, bold:true, align:true, indent:true, underline:false, embedFonts:false}; static var TextStyleMap = {textAlign:true, fontWeight:true, color:true, fontFamily:true, textIndent:true, fontStyle:true, lineHeight:true, marginLeft:true, marginRight:true, fontSize:true, textDecoration:true, embedFonts:true}; }
Symbol 129 MovieClip [__Packages.mx.styles.CSSStyleDeclaration] Frame 0
class mx.styles.CSSStyleDeclaration { var _tf; function CSSStyleDeclaration () { } function __getTextFormat(tf, bAll) { var _local5 = false; if (_tf != undefined) { var _local2; for (_local2 in mx.styles.StyleManager.TextFormatStyleProps) { if (bAll || (mx.styles.StyleManager.TextFormatStyleProps[_local2])) { if (tf[_local2] == undefined) { var _local3 = _tf[_local2]; if (_local3 != undefined) { tf[_local2] = _local3; } else { _local5 = true; } } } } } else { _local5 = true; } return(_local5); } function getStyle(styleProp) { var _local2 = this[styleProp]; var _local3 = mx.styles.StyleManager.getColorName(_local2); return(((_local3 == undefined) ? (_local2) : (_local3))); } static function classConstruct() { mx.styles.CSSTextStyles.addTextStyles(mx.styles.CSSStyleDeclaration.prototype, true); return(true); } static var classConstructed = classConstruct(); static var CSSTextStylesDependency = mx.styles.CSSTextStyles; }
Symbol 130 MovieClip [__Packages.mx.skins.Border] Frame 0
class mx.skins.Border extends mx.core.UIObject { function Border () { super(); } function init(Void) { super.init(); } static var symbolName = "Border"; static var symbolOwner = mx.skins.Border; var className = "Border"; var tagBorder = 0; var idNames = new Array("border_mc"); }
Symbol 131 MovieClip [__Packages.mx.skins.RectBorder] Frame 0
class mx.skins.RectBorder extends mx.skins.Border { var __width, __height, offset, __borderMetrics; function RectBorder () { super(); } function get width() { return(__width); } function get height() { return(__height); } function init(Void) { super.init(); } function draw(Void) { size(); } function getBorderMetrics(Void) { var _local2 = offset; if (__borderMetrics == undefined) { __borderMetrics = {left:_local2, top:_local2, right:_local2, bottom:_local2}; } else { __borderMetrics.left = _local2; __borderMetrics.top = _local2; __borderMetrics.right = _local2; __borderMetrics.bottom = _local2; } return(__borderMetrics); } function get borderMetrics() { return(getBorderMetrics()); } function drawBorder(Void) { } function size(Void) { drawBorder(); } function setColor(Void) { drawBorder(); } static var symbolName = "RectBorder"; static var symbolOwner = mx.skins.RectBorder; static var version = "2.0.2.126"; var className = "RectBorder"; var borderStyleName = "borderStyle"; var borderColorName = "borderColor"; var shadowColorName = "shadowColor"; var highlightColorName = "highlightColor"; var buttonColorName = "buttonColor"; var backgroundColorName = "backgroundColor"; }
Symbol 132 MovieClip [__Packages.mx.managers.DepthManager] Frame 0
class mx.managers.DepthManager { var _childCounter, createClassObject, createObject, _parent, swapDepths, _topmost, getDepth; function DepthManager () { MovieClip.prototype.createClassChildAtDepth = createClassChildAtDepth; MovieClip.prototype.createChildAtDepth = createChildAtDepth; MovieClip.prototype.setDepthTo = setDepthTo; MovieClip.prototype.setDepthAbove = setDepthAbove; MovieClip.prototype.setDepthBelow = setDepthBelow; MovieClip.prototype.findNextAvailableDepth = findNextAvailableDepth; MovieClip.prototype.shuffleDepths = shuffleDepths; MovieClip.prototype.getDepthByFlag = getDepthByFlag; MovieClip.prototype.buildDepthTable = buildDepthTable; _global.ASSetPropFlags(MovieClip.prototype, "createClassChildAtDepth", 1); _global.ASSetPropFlags(MovieClip.prototype, "createChildAtDepth", 1); _global.ASSetPropFlags(MovieClip.prototype, "setDepthTo", 1); _global.ASSetPropFlags(MovieClip.prototype, "setDepthAbove", 1); _global.ASSetPropFlags(MovieClip.prototype, "setDepthBelow", 1); _global.ASSetPropFlags(MovieClip.prototype, "findNextAvailableDepth", 1); _global.ASSetPropFlags(MovieClip.prototype, "shuffleDepths", 1); _global.ASSetPropFlags(MovieClip.prototype, "getDepthByFlag", 1); _global.ASSetPropFlags(MovieClip.prototype, "buildDepthTable", 1); } static function sortFunction(a, b) { if (a.getDepth() > b.getDepth()) { return(1); } return(-1); } static function test(depth) { if (depth == reservedDepth) { return(false); } return(true); } static function createClassObjectAtDepth(className, depthSpace, initObj) { var _local1; switch (depthSpace) { case kCursor : _local1 = holder.createClassChildAtDepth(className, kTopmost, initObj); break; case kTooltip : _local1 = holder.createClassChildAtDepth(className, kTop, initObj); break; } return(_local1); } static function createObjectAtDepth(linkageName, depthSpace, initObj) { var _local1; switch (depthSpace) { case kCursor : _local1 = holder.createChildAtDepth(linkageName, kTopmost, initObj); break; case kTooltip : _local1 = holder.createChildAtDepth(linkageName, kTop, initObj); break; } return(_local1); } function createClassChildAtDepth(className, depthFlag, initObj) { if (_childCounter == undefined) { _childCounter = 0; } var _local3 = buildDepthTable(); var _local2 = getDepthByFlag(depthFlag, _local3); var _local6 = "down"; if (depthFlag == kBottom) { _local6 = "up"; } var _local5; if (_local3[_local2] != undefined) { _local5 = _local2; _local2 = findNextAvailableDepth(_local2, _local3, _local6); } var _local4 = createClassObject(className, "depthChild" + (_childCounter++), _local2, initObj); if (_local5 != undefined) { _local3[_local2] = _local4; shuffleDepths(_local4, _local5, _local3, _local6); } if (depthFlag == kTopmost) { _local4._topmost = true; } return(_local4); } function createChildAtDepth(linkageName, depthFlag, initObj) { if (_childCounter == undefined) { _childCounter = 0; } var _local3 = buildDepthTable(); var _local2 = getDepthByFlag(depthFlag, _local3); var _local6 = "down"; if (depthFlag == kBottom) { _local6 = "up"; } var _local5; if (_local3[_local2] != undefined) { _local5 = _local2; _local2 = findNextAvailableDepth(_local2, _local3, _local6); } var _local4 = createObject(linkageName, "depthChild" + (_childCounter++), _local2, initObj); if (_local5 != undefined) { _local3[_local2] = _local4; shuffleDepths(_local4, _local5, _local3, _local6); } if (depthFlag == kTopmost) { _local4._topmost = true; } return(_local4); } function setDepthTo(depthFlag) { var _local2 = _parent.buildDepthTable(); var _local3 = _parent.getDepthByFlag(depthFlag, _local2); if (_local2[_local3] != undefined) { shuffleDepths(this, _local3, _local2, undefined); } else { swapDepths(_local3); } if (depthFlag == kTopmost) { _topmost = true; } else { delete _topmost; } } function setDepthAbove(targetInstance) { if (targetInstance._parent != _parent) { return(undefined); } var _local2 = targetInstance.getDepth() + 1; var _local3 = _parent.buildDepthTable(); if ((_local3[_local2] != undefined) && (getDepth() < _local2)) { _local2 = _local2 - 1; } if (_local2 > highestDepth) { _local2 = highestDepth; } if (_local2 == highestDepth) { _parent.shuffleDepths(this, _local2, _local3, "down"); } else if (_local3[_local2] != undefined) { _parent.shuffleDepths(this, _local2, _local3, undefined); } else { swapDepths(_local2); } } function setDepthBelow(targetInstance) { if (targetInstance._parent != _parent) { return(undefined); } var _local6 = targetInstance.getDepth() - 1; var _local3 = _parent.buildDepthTable(); if ((_local3[_local6] != undefined) && (getDepth() > _local6)) { _local6 = _local6 + 1; } var _local4 = lowestDepth + numberOfAuthortimeLayers; var _local5; for (_local5 in _local3) { var _local2 = _local3[_local5]; if (_local2._parent != undefined) { _local4 = Math.min(_local4, _local2.getDepth()); } } if (_local6 < _local4) { _local6 = _local4; } if (_local6 == _local4) { _parent.shuffleDepths(this, _local6, _local3, "up"); } else if (_local3[_local6] != undefined) { _parent.shuffleDepths(this, _local6, _local3, undefined); } else { swapDepths(_local6); } } function findNextAvailableDepth(targetDepth, depthTable, direction) { var _local5 = lowestDepth + numberOfAuthortimeLayers; if (targetDepth < _local5) { targetDepth = _local5; } if (depthTable[targetDepth] == undefined) { return(targetDepth); } var _local2 = targetDepth; var _local1 = targetDepth; if (direction == "down") { while (depthTable[_local1] != undefined) { _local1--; } return(_local1); } while (depthTable[_local2] != undefined) { _local2++; } return(_local2); } function shuffleDepths(subject, targetDepth, depthTable, direction) { var _local9 = lowestDepth + numberOfAuthortimeLayers; var _local8 = _local9; var _local5; for (_local5 in depthTable) { var _local7 = depthTable[_local5]; if (_local7._parent != undefined) { _local9 = Math.min(_local9, _local7.getDepth()); } } if (direction == undefined) { if (subject.getDepth() > targetDepth) { direction = "up"; } else { direction = "down"; } } var _local1 = new Array(); for (_local5 in depthTable) { var _local7 = depthTable[_local5]; if (_local7._parent != undefined) { _local1.push(_local7); } } _local1.sort(sortFunction); if (direction == "up") { var _local3; var _local11; do { if (_local1.length <= 0) { break; } _local3 = _local1.pop(); } while (_local3 != subject); do { if (_local1.length <= 0) { break; } _local11 = subject.getDepth(); _local3 = _local1.pop(); var _local4 = _local3.getDepth(); if (_local11 > (_local4 + 1)) { if (_local4 >= 0) { subject.swapDepths(_local4 + 1); } else if ((_local11 > _local8) && (_local4 < _local8)) { subject.swapDepths(_local8); } } subject.swapDepths(_local3); } while (_local4 != targetDepth); } else if (direction == "down") { var _local3; do { if (_local1.length <= 0) { break; } _local3 = _local1.shift(); } while (_local3 != subject); do { if (_local1.length <= 0) { break; } var _local11 = _local3.getDepth(); _local3 = _local1.shift(); var _local4 = _local3.getDepth(); if ((_local11 < (_local4 - 1)) && (_local4 > 0)) { subject.swapDepths(_local4 - 1); } subject.swapDepths(_local3); } while (_local4 != targetDepth); } } function getDepthByFlag(depthFlag, depthTable) { var _local2 = 0; if ((depthFlag == kTop) || (depthFlag == kNotopmost)) { var _local5 = 0; var _local7 = false; var _local8; for (_local8 in depthTable) { var _local9 = depthTable[_local8]; var _local3 = typeof(_local9); if ((_local3 == "movieclip") || ((_local3 == "object") && (_local9.__getTextFormat != undefined))) { if (_local9.getDepth() <= highestDepth) { if (!_local9._topmost) { _local2 = Math.max(_local2, _local9.getDepth()); } else if (!_local7) { _local5 = _local9.getDepth(); _local7 = true; } else { _local5 = Math.min(_local5, _local9.getDepth()); } } } } _local2 = _local2 + 20; if (_local7) { if (_local2 >= _local5) { _local2 = _local5 - 1; } } } else if (depthFlag == kBottom) { for (var _local8 in depthTable) { var _local9 = depthTable[_local8]; var _local3 = typeof(_local9); if ((_local3 == "movieclip") || ((_local3 == "object") && (_local9.__getTextFormat != undefined))) { if (_local9.getDepth() <= highestDepth) { _local2 = Math.min(_local2, _local9.getDepth()); } } } _local2 = _local2 - 20; } else if (depthFlag == kTopmost) { for (var _local8 in depthTable) { var _local9 = depthTable[_local8]; var _local3 = typeof(_local9); if ((_local3 == "movieclip") || ((_local3 == "object") && (_local9.__getTextFormat != undefined))) { if (_local9.getDepth() <= highestDepth) { _local2 = Math.max(_local2, _local9.getDepth()); } } } _local2 = _local2 + 100; } if (_local2 >= highestDepth) { _local2 = highestDepth; } var _local6 = lowestDepth + numberOfAuthortimeLayers; for (var _local9 in depthTable) { var _local4 = depthTable[_local9]; if (_local4._parent != undefined) { _local6 = Math.min(_local6, _local4.getDepth()); } } if (_local2 <= _local6) { _local2 = _local6; } return(_local2); } function buildDepthTable(Void) { var _local5 = new Array(); var _local4; for (_local4 in this) { var _local2 = this[_local4]; var _local3 = typeof(_local2); if ((_local3 == "movieclip") || ((_local3 == "object") && (_local2.__getTextFormat != undefined))) { if (_local2._parent == this) { _local5[_local2.getDepth()] = _local2; } } } return(_local5); } static var reservedDepth = 1048575; static var highestDepth = 1048574; static var lowestDepth = -16383; static var numberOfAuthortimeLayers = 383; static var kCursor = 101; static var kTooltip = 102; static var kTop = 201; static var kBottom = 202; static var kTopmost = 203; static var kNotopmost = 204; static var holder = _root.createEmptyMovieClip("reserved", reservedDepth); static var __depthManager = new mx.managers.DepthManager(); }
Symbol 133 MovieClip [__Packages.mx.events.UIEventDispatcher] Frame 0
class mx.events.UIEventDispatcher extends mx.events.EventDispatcher { var dispatchQueue, owner, __sentLoadEvent, __origAddEventListener; function UIEventDispatcher () { super(); } static function addKeyEvents(obj) { if (obj.keyHandler == undefined) { var _local1 = (obj.keyHandler = new Object()); _local1.owner = obj; _local1.onKeyDown = _fEventDispatcher.onKeyDown; _local1.onKeyUp = _fEventDispatcher.onKeyUp; } Key.addListener(obj.keyHandler); } static function removeKeyEvents(obj) { Key.removeListener(obj.keyHandler); } static function addLoadEvents(obj) { if (obj.onLoad == undefined) { obj.onLoad = _fEventDispatcher.onLoad; obj.onUnload = _fEventDispatcher.onUnload; if (obj.getBytesTotal() == obj.getBytesLoaded()) { obj.doLater(obj, "onLoad"); } } } static function removeLoadEvents(obj) { delete obj.onLoad; delete obj.onUnload; } static function initialize(obj) { if (_fEventDispatcher == undefined) { _fEventDispatcher = new mx.events.UIEventDispatcher(); } obj.addEventListener = _fEventDispatcher.__addEventListener; obj.__origAddEventListener = _fEventDispatcher.addEventListener; obj.removeEventListener = _fEventDispatcher.removeEventListener; obj.dispatchEvent = _fEventDispatcher.dispatchEvent; obj.dispatchQueue = _fEventDispatcher.dispatchQueue; } function dispatchEvent(eventObj) { if (eventObj.target == undefined) { eventObj.target = this; } this[eventObj.type + "Handler"](eventObj); dispatchQueue(mx.events.EventDispatcher, eventObj); dispatchQueue(this, eventObj); } function onKeyDown(Void) { owner.dispatchEvent({type:"keyDown", code:Key.getCode(), ascii:Key.getAscii(), shiftKey:Key.isDown(16), ctrlKey:Key.isDown(17)}); } function onKeyUp(Void) { owner.dispatchEvent({type:"keyUp", code:Key.getCode(), ascii:Key.getAscii(), shiftKey:Key.isDown(16), ctrlKey:Key.isDown(17)}); } function onLoad(Void) { if (__sentLoadEvent != true) { dispatchEvent({type:"load"}); } __sentLoadEvent = true; } function onUnload(Void) { dispatchEvent({type:"unload"}); } function __addEventListener(event, handler) { __origAddEventListener(event, handler); var _local3 = lowLevelEvents; for (var _local5 in _local3) { if (mx.events.UIEventDispatcher[_local5][event] != undefined) { var _local2 = _local3[_local5][0]; mx.events.UIEventDispatcher[_local2](this); } } } function removeEventListener(event, handler) { var _local6 = "__q_" + event; mx.events.EventDispatcher._removeEventListener(this[_local6], event, handler); if (this[_local6].length == 0) { var _local2 = lowLevelEvents; for (var _local5 in _local2) { if (mx.events.UIEventDispatcher[_local5][event] != undefined) { var _local3 = _local2[_local5][1]; mx.events.UIEventDispatcher[_local2[_local5][1]](this); } } } } static var keyEvents = {keyDown:1, keyUp:1}; static var loadEvents = {load:1, unload:1}; static var lowLevelEvents = {keyEvents:["addKeyEvents", "removeKeyEvents"], loadEvents:["addLoadEvents", "removeLoadEvents"]}; static var _fEventDispatcher = undefined; }
Symbol 134 MovieClip [__Packages.mx.core.ExternalContent] Frame 0
class mx.core.ExternalContent { var createObject, numChildren, prepList, doLater, loadList, dispatchEvent, loadedList, childLoaded; function ExternalContent () { } function loadExternal(url, placeholderClassName, instanceName, depth, initProps) { var _local2; _local2 = createObject(placeholderClassName, instanceName, depth, initProps); this[mx.core.View.childNameBase + numChildren] = _local2; if (prepList == undefined) { prepList = new Object(); } prepList[instanceName] = {obj:_local2, url:url, complete:false, initProps:initProps}; prepareToLoadMovie(_local2); return(_local2); } function prepareToLoadMovie(obj) { obj.unloadMovie(); doLater(this, "waitForUnload"); } function waitForUnload() { var _local3; for (_local3 in prepList) { var _local2 = prepList[_local3]; if (_local2.obj.getBytesTotal() == 0) { if (loadList == undefined) { loadList = new Object(); } loadList[_local3] = _local2; _local2.obj.loadMovie(_local2.url); delete prepList[_local3]; doLater(this, "checkLoadProgress"); } else { doLater(this, "waitForUnload"); } } } function checkLoadProgress() { var _local8 = false; var _local3; for (_local3 in loadList) { var _local2 = loadList[_local3]; _local2.loaded = _local2.obj.getBytesLoaded(); _local2.total = _local2.obj.getBytesTotal(); if (_local2.total > 0) { _local2.obj._visible = false; dispatchEvent({type:"progress", target:_local2.obj, current:_local2.loaded, total:_local2.total}); if (_local2.loaded == _local2.total) { if (loadedList == undefined) { loadedList = new Object(); } loadedList[_local3] = _local2; delete loadList[_local3]; doLater(this, "contentLoaded"); } } else if (_local2.total == -1) { if (_local2.failedOnce != undefined) { _local2.failedOnce++; if (_local2.failedOnce > 3) { dispatchEvent({type:"complete", target:_local2.obj, current:_local2.loaded, total:_local2.total}); delete loadList[_local3]; } } else { _local2.failedOnce = 0; } } _local8 = true; } if (_local8) { doLater(this, "checkLoadProgress"); } } function contentLoaded() { var _local4; for (_local4 in loadedList) { var _local2 = loadedList[_local4]; _local2.obj._visible = true; _local2.obj._complete = true; var _local3; for (_local3 in _local2.initProps) { _local2.obj[_local3] = _local2.initProps[_local3]; } childLoaded(_local2.obj); dispatchEvent({type:"complete", target:_local2.obj, current:_local2.loaded, total:_local2.total}); delete loadedList[_local4]; } } function convertToUIObject(obj) { if (obj.setSize == undefined) { var _local2 = mx.core.UIObject.prototype; obj.addProperty("width", _local2.__get__width, null); obj.addProperty("height", _local2.__get__height, null); obj.addProperty("left", _local2.__get__left, null); obj.addProperty("x", _local2.__get__x, null); obj.addProperty("top", _local2.__get__top, null); obj.addProperty("y", _local2.__get__y, null); obj.addProperty("right", _local2.__get__right, null); obj.addProperty("bottom", _local2.__get__bottom, null); obj.addProperty("visible", _local2.__get__visible, _local2.__set__visible); obj.move = mx.core.UIObject.prototype.move; obj.setSize = mx.core.UIObject.prototype.setSize; obj.size = mx.core.UIObject.prototype.size; mx.events.UIEventDispatcher.initialize(obj); } } static function enableExternalContent() { } static function classConstruct() { var _local1 = mx.core.View.prototype; var _local2 = mx.core.ExternalContent.prototype; _local1.loadExternal = _local2.loadExternal; _local1.prepareToLoadMovie = _local2.prepareToLoadMovie; _local1.waitForUnload = _local2.waitForUnload; _local1.checkLoadProgress = _local2.checkLoadProgress; _local1.contentLoaded = _local2.contentLoaded; _local1.convertToUIObject = _local2.convertToUIObject; return(true); } static var classConstructed = classConstruct(); static var ViewDependency = mx.core.View; }
Symbol 135 MovieClip [__Packages.mx.skins.CustomBorder] Frame 0
class mx.skins.CustomBorder extends mx.skins.Border { var __width, __height, l_mc, setSkin, minHeight, minWidth, m_mc, r_mc; function CustomBorder () { super(); } function get width() { return(__width); } function get height() { return(__height); } function init(Void) { super.init(); } function createChildren(Void) { } function draw(Void) { if (l_mc == undefined) { var _local2 = setSkin(tagL, leftSkin); if (horizontal) { minHeight = l_mc._height; minWidth = l_mc._width; } else { minHeight = l_mc._height; minWidth = l_mc._width; } } if (m_mc == undefined) { setSkin(tagM, middleSkin); if (horizontal) { minHeight = m_mc._height; minWidth = minWidth + m_mc._width; } else { minHeight = minHeight + m_mc._height; minWidth = m_mc._width; } } if (r_mc == undefined) { setSkin(tagR, rightSkin); if (horizontal) { minHeight = r_mc._height; minWidth = minWidth + r_mc._width; } else { minHeight = minHeight + r_mc._height; minWidth = r_mc._width; } } size(); } function size(Void) { l_mc.move(0, 0); if (horizontal) { r_mc.move(width - r_mc.width, 0); m_mc.move(l_mc.width, 0); m_mc.setSize(r_mc.x - m_mc.x, m_mc.height); } else { r_mc.move(0, height - r_mc.height, 0); m_mc.move(0, l_mc.height); m_mc.setSize(m_mc.width, r_mc.y - m_mc.y); } } static var symbolName = "CustomBorder"; static var symbolOwner = mx.skins.CustomBorder; static var version = "2.0.2.126"; var className = "CustomBorder"; static var tagL = 0; static var tagM = 1; static var tagR = 2; var idNames = new Array("l_mc", "m_mc", "r_mc"); var leftSkin = "F3PieceLeft"; var middleSkin = "F3PieceMiddle"; var rightSkin = "F3PieceRight"; var horizontal = true; }
Symbol 136 MovieClip [__Packages.mx.controls.scrollClasses.ScrollThumb] Frame 0
class mx.controls.scrollClasses.ScrollThumb extends mx.skins.CustomBorder { var useHandCursor, ymin, ymax, datamin, datamax, scrollMove, lastY, _ymouse, _y, _parent, onMouseMove, grip_mc, setSkin, gripSkin, __get__width, __get__height; function ScrollThumb () { super(); } function createChildren(Void) { super.createChildren(); useHandCursor = false; } function setRange(_ymin, _ymax, _datamin, _datamax) { ymin = _ymin; ymax = _ymax; datamin = _datamin; datamax = _datamax; } function dragThumb(Void) { scrollMove = _ymouse - lastY; scrollMove = scrollMove + _y; if (scrollMove < ymin) { scrollMove = ymin; } else if (scrollMove > ymax) { scrollMove = ymax; } _parent.isScrolling = true; _y = scrollMove; var _local2 = Math.round(((datamax - datamin) * (_y - ymin)) / (ymax - ymin)) + datamin; _parent.scrollPosition = _local2; _parent.dispatchScrollEvent("ThumbTrack"); updateAfterEvent(); } function stopDragThumb(Void) { _parent.isScrolling = false; _parent.dispatchScrollEvent("ThumbPosition"); _parent.dispatchScrollChangedEvent(); delete onMouseMove; } function onPress(Void) { _parent.pressFocus(); lastY = _ymouse; onMouseMove = dragThumb; super.onPress(); } function onRelease(Void) { _parent.releaseFocus(); stopDragThumb(); super.onRelease(); } function onReleaseOutside(Void) { _parent.releaseFocus(); stopDragThumb(); super.onReleaseOutside(); } function draw() { super.draw(); if (grip_mc == undefined) { setSkin(3, gripSkin); } } function size() { super.size(); grip_mc.move((__get__width() - grip_mc.width) / 2, (__get__height() - grip_mc.height) / 2); } static var symbolOwner = mx.skins.CustomBorder.symbolOwner; var className = "ScrollThumb"; var btnOffset = 0; var horizontal = false; var idNames = new Array("l_mc", "m_mc", "r_mc", "grip_mc"); }
Symbol 137 MovieClip [__Packages.mx.controls.SimpleButton] Frame 0
class mx.controls.SimpleButton extends mx.core.UIComponent { static var emphasizedStyleDeclaration; var preset, boundingBox_mc, useHandCursor, skinName, linkLength, iconName, destroyObject, __width, _width, __height, _height, __emphaticStyleName, styleName, enabled, invalidate, pressFocus, dispatchEvent, autoRepeat, interval, getStyle, releaseFocus, createLabel, invalidateStyle; function SimpleButton () { super(); } function init(Void) { super.init(); if (preset == undefined) { boundingBox_mc._visible = false; boundingBox_mc._width = (boundingBox_mc._height = 0); } useHandCursor = false; } function createChildren(Void) { if (preset != undefined) { var _local2 = this[idNames[preset]]; this[refNames[preset]] = _local2; skinName = _local2; if (falseOverSkin.length == 0) { rolloverSkin = fus; } if (falseOverIcon.length == 0) { rolloverIcon = fui; } initializing = false; } else if (__state == true) { setStateVar(true); } else { if (falseOverSkin.length == 0) { rolloverSkin = fus; } if (falseOverIcon.length == 0) { rolloverIcon = fui; } } } function setIcon(tag, linkageName) { return(setSkin(tag + 8, linkageName)); } function changeIcon(tag, linkageName) { linkLength = linkageName.length; var _local2 = stateNames[tag] + "Icon"; this[_local2] = linkageName; this[idNames[tag + 8]] = _local2; setStateVar(getState()); } function changeSkin(tag, linkageName) { var _local2 = stateNames[tag] + "Skin"; this[_local2] = linkageName; this[idNames[tag]] = _local2; setStateVar(getState()); } function viewIcon(varName) { var _local4 = varName + "Icon"; var _local3 = this[_local4]; if (typeof(_local3) == "string") { var _local5 = _local3; if (__emphasized) { if (this[_local3 + "Emphasized"].length > 0) { _local3 = _local3 + "Emphasized"; } } if (this[_local3].length == 0) { return(undefined); } _local3 = setIcon(tagMap[_local5], this[_local3]); if ((_local3 == undefined) && (_global.isLivePreview)) { _local3 = setIcon(0, "ButtonIcon"); } this[_local4] = _local3; } iconName._visible = false; iconName = _local3; iconName._visible = true; } function removeIcons() { var _local3 = 0; while (_local3 < 2) { var _local2 = 8; while (_local2 < 16) { destroyObject(idNames[_local2]); this[stateNames[_local2 - 8] + "Icon"] = ""; _local2++; } _local3++; } refresh(); } function setSkin(tag, linkageName, initobj) { var _local3 = super.setSkin(tag, linkageName, ((initobj != undefined) ? (initobj) : ({styleName:this}))); calcSize(tag, _local3); return(_local3); } function calcSize(Void) { __width = _width; __height = _height; } function viewSkin(varName, initObj) { var _local3 = varName + "Skin"; var _local2 = this[_local3]; if (typeof(_local2) == "string") { var _local4 = _local2; if (__emphasized) { if (this[_local2 + "Emphasized"].length > 0) { _local2 = _local2 + "Emphasized"; } } if (this[_local2].length == 0) { return(undefined); } _local2 = setSkin(tagMap[_local4], this[_local2], ((initObj != undefined) ? (initObj) : ({styleName:this}))); this[_local3] = _local2; } skinName._visible = false; skinName = _local2; skinName._visible = true; } function showEmphasized(e) { if (e && (!__emphatic)) { if (emphasizedStyleDeclaration != undefined) { __emphaticStyleName = styleName; styleName = emphasizedStyleDeclaration; } __emphatic = true; } else { if (__emphatic) { styleName = __emphaticStyleName; } __emphatic = false; } } function refresh(Void) { var _local2 = getState(); if (enabled == false) { viewIcon("disabled"); viewSkin("disabled"); } else { viewSkin(phase); viewIcon(phase); } setView(phase == "down"); iconName.enabled = enabled; } function setView(offset) { if (iconName == undefined) { return(undefined); } var _local2 = (offset ? (btnOffset) : 0); iconName._x = ((__width - iconName._width) / 2) + _local2; iconName._y = ((__height - iconName._height) / 2) + _local2; } function setStateVar(state) { if (state) { if (trueOverSkin.length == 0) { rolloverSkin = tus; } else { rolloverSkin = trs; } if (trueOverIcon.length == 0) { rolloverIcon = tui; } else { rolloverIcon = tri; } upSkin = tus; downSkin = tds; disabledSkin = dts; upIcon = tui; downIcon = tdi; disabledIcon = dti; } else { if (falseOverSkin.length == 0) { rolloverSkin = fus; } else { rolloverSkin = frs; } if (falseOverIcon.length == 0) { rolloverIcon = fui; } else { rolloverIcon = fri; } upSkin = fus; downSkin = fds; disabledSkin = dfs; upIcon = fui; downIcon = fdi; disabledIcon = dfi; } __state = state; } function setState(state) { if (state != __state) { setStateVar(state); invalidate(); } } function size(Void) { refresh(); } function draw(Void) { if (initializing) { initializing = false; skinName.visible = true; iconName.visible = true; } size(); } function getState(Void) { return(__state); } function setToggle(val) { __toggle = val; if (__toggle == false) { setState(false); } } function getToggle(Void) { return(__toggle); } function set toggle(val) { setToggle(val); //return(toggle); } function get toggle() { return(getToggle()); } function set value(val) { setSelected(val); //return(value); } function get value() { return(getSelected()); } function set selected(val) { setSelected(val); //return(selected); } function get selected() { return(getSelected()); } function setSelected(val) { if (__toggle) { setState(val); } else { setState((initializing ? (val) : (__state))); } } function getSelected() { return(__state); } function setEnabled(val) { if (enabled != val) { super.setEnabled(val); invalidate(); } } function onPress(Void) { pressFocus(); phase = "down"; refresh(); dispatchEvent({type:"buttonDown"}); if (autoRepeat) { interval = setInterval(this, "onPressDelay", getStyle("repeatDelay")); } } function onPressDelay(Void) { dispatchEvent({type:"buttonDown"}); if (autoRepeat) { clearInterval(interval); interval = setInterval(this, "onPressRepeat", getStyle("repeatInterval")); } } function onPressRepeat(Void) { dispatchEvent({type:"buttonDown"}); updateAfterEvent(); } function onRelease(Void) { releaseFocus(); phase = "rollover"; if (interval != undefined) { clearInterval(interval); delete interval; } if (getToggle()) { setState(!getState()); } else { refresh(); } dispatchEvent({type:"click"}); } function onDragOut(Void) { phase = "up"; refresh(); dispatchEvent({type:"buttonDragOut"}); } function onDragOver(Void) { if (phase != "up") { onPress(); return(undefined); } phase = "down"; refresh(); } function onReleaseOutside(Void) { releaseFocus(); phase = "up"; if (interval != undefined) { clearInterval(interval); delete interval; } } function onRollOver(Void) { phase = "rollover"; refresh(); } function onRollOut(Void) { phase = "up"; refresh(); } function getLabel(Void) { return(fui.text); } function setLabel(val) { if (typeof(fui) == "string") { createLabel("fui", 8, val); fui.styleName = this; } else { fui.text = val; } var _local4 = fui._getTextFormat(); var _local2 = _local4.getTextExtent2(val); fui._width = _local2.width + 5; fui._height = _local2.height + 5; iconName = fui; setView(__state); } function get emphasized() { return(__emphasized); } function set emphasized(val) { __emphasized = val; var _local2 = 0; while (_local2 < 8) { this[idNames[_local2]] = stateNames[_local2] + "Skin"; if (typeof(this[idNames[_local2 + 8]]) == "movieclip") { this[idNames[_local2 + 8]] = stateNames[_local2] + "Icon"; } _local2++; } showEmphasized(__emphasized); setStateVar(__state); invalidateStyle(); //return(emphasized); } function keyDown(e) { if (e.code == 32) { onPress(); } } function keyUp(e) { if (e.code == 32) { onRelease(); } } function onKillFocus(newFocus) { super.onKillFocus(); if (phase != "up") { phase = "up"; refresh(); } } static var symbolName = "SimpleButton"; static var symbolOwner = mx.controls.SimpleButton; static var version = "2.0.2.126"; var className = "SimpleButton"; var style3dInset = 4; var btnOffset = 1; var __toggle = false; var __state = false; var __emphasized = false; var __emphatic = false; static var falseUp = 0; static var falseDown = 1; static var falseOver = 2; static var falseDisabled = 3; static var trueUp = 4; static var trueDown = 5; static var trueOver = 6; static var trueDisabled = 7; var falseUpSkin = "SimpleButtonUp"; var falseDownSkin = "SimpleButtonIn"; var falseOverSkin = ""; var falseDisabledSkin = "SimpleButtonUp"; var trueUpSkin = "SimpleButtonIn"; var trueDownSkin = ""; var trueOverSkin = ""; var trueDisabledSkin = "SimpleButtonIn"; var falseUpIcon = ""; var falseDownIcon = ""; var falseOverIcon = ""; var falseDisabledIcon = ""; var trueUpIcon = ""; var trueDownIcon = ""; var trueOverIcon = ""; var trueDisabledIcon = ""; var phase = "up"; var fui = "falseUpIcon"; var fus = "falseUpSkin"; var fdi = "falseDownIcon"; var fds = "falseDownSkin"; var frs = "falseOverSkin"; var fri = "falseOverIcon"; var dfi = "falseDisabledIcon"; var dfs = "falseDisabledSkin"; var tui = "trueUpIcon"; var tus = "trueUpSkin"; var tdi = "trueDownIcon"; var tds = "trueDownSkin"; var trs = "trueOverSkin"; var tri = "trueOverIcon"; var dts = "trueDisabledSkin"; var dti = "trueDisabledIcon"; var rolloverSkin = mx.controls.SimpleButton.prototype.frs; var rolloverIcon = mx.controls.SimpleButton.prototype.fri; var upSkin = mx.controls.SimpleButton.prototype.fus; var downSkin = mx.controls.SimpleButton.prototype.fds; var disabledSkin = mx.controls.SimpleButton.prototype.dfs; var upIcon = mx.controls.SimpleButton.prototype.fui; var downIcon = mx.controls.SimpleButton.prototype.fdi; var disabledIcon = mx.controls.SimpleButton.prototype.dfi; var initializing = true; var idNames = ["fus", "fds", "frs", "dfs", "tus", "tds", "trs", "dts", "fui", "fdi", "fri", "dfi", "tui", "tdi", "tri", "dti"]; var stateNames = ["falseUp", "falseDown", "falseOver", "falseDisabled", "trueUp", "trueDown", "trueOver", "trueDisabled"]; var refNames = ["upSkin", "downSkin", "rolloverSkin", "disabledSkin"]; var tagMap = {falseUpSkin:0, falseDownSkin:1, falseOverSkin:2, falseDisabledSkin:3, trueUpSkin:4, trueDownSkin:5, trueOverSkin:6, trueDisabledSkin:7, falseUpIcon:0, falseDownIcon:1, falseOverIcon:2, falseDisabledIcon:3, trueUpIcon:4, trueDownIcon:5, trueOverIcon:6, trueDisabledIcon:7}; }
Symbol 138 MovieClip [__Packages.mx.controls.scrollClasses.ScrollBar] Frame 0
class mx.controls.scrollClasses.ScrollBar extends mx.core.UIComponent { var isScrolling, scrollTrack_mc, scrollThumb_mc, __height, tabEnabled, focusEnabled, boundingBox_mc, setSkin, upArrow_mc, _minHeight, _minWidth, downArrow_mc, createObject, createClassObject, enabled, _height, dispatchEvent, minMode, maxMode, plusMode, minusMode, _parent, getStyle, scrolling, _ymouse; function ScrollBar () { super(); } function get scrollPosition() { return(_scrollPosition); } function set scrollPosition(pos) { _scrollPosition = pos; if (isScrolling != true) { pos = Math.min(pos, maxPos); pos = Math.max(pos, minPos); var _local3 = (((pos - minPos) * (scrollTrack_mc.height - scrollThumb_mc._height)) / (maxPos - minPos)) + scrollTrack_mc.top; scrollThumb_mc.move(0, _local3); } //return(scrollPosition); } function get pageScrollSize() { return(largeScroll); } function set pageScrollSize(lScroll) { largeScroll = lScroll; //return(pageScrollSize); } function set lineScrollSize(sScroll) { smallScroll = sScroll; //return(lineScrollSize); } function get lineScrollSize() { return(smallScroll); } function get virtualHeight() { return(__height); } function init(Void) { super.init(); _scrollPosition = 0; tabEnabled = false; focusEnabled = false; boundingBox_mc._visible = false; boundingBox_mc._width = (boundingBox_mc._height = 0); } function createChildren(Void) { if (scrollTrack_mc == undefined) { setSkin(skinIDTrack, scrollTrackName); } scrollTrack_mc.visible = false; var _local3 = new Object(); _local3.enabled = false; _local3.preset = mx.controls.SimpleButton.falseDisabled; _local3.initProperties = 0; _local3.autoRepeat = true; _local3.tabEnabled = false; var _local2; if (upArrow_mc == undefined) { _local2 = createButton(upArrowName, "upArrow_mc", skinIDUpArrow, _local3); } _local2.buttonDownHandler = onUpArrow; _local2.clickHandler = onScrollChanged; _minHeight = _local2.height; _minWidth = _local2.width; if (downArrow_mc == undefined) { _local2 = createButton(downArrowName, "downArrow_mc", skinIDDownArrow, _local3); } _local2.buttonDownHandler = onDownArrow; _local2.clickHandler = onScrollChanged; _minHeight = _minHeight + _local2.height; } function createButton(linkageName, id, skinID, o) { if (skinID == skinIDUpArrow) { o.falseUpSkin = upArrowUpName; o.falseDownSkin = upArrowDownName; o.falseOverSkin = upArrowOverName; } else { o.falseUpSkin = downArrowUpName; o.falseDownSkin = downArrowDownName; o.falseOverSkin = downArrowOverName; } var _local3 = createObject(linkageName, id, skinID, o); this[id].visible = false; this[id].useHandCursor = false; return(_local3); } function createThumb(Void) { var _local2 = new Object(); _local2.validateNow = true; _local2.tabEnabled = false; _local2.leftSkin = thumbTopName; _local2.middleSkin = thumbMiddleName; _local2.rightSkin = thumbBottomName; _local2.gripSkin = thumbGripName; createClassObject(mx.controls.scrollClasses.ScrollThumb, "scrollThumb_mc", skinIDThumb, _local2); } function setScrollProperties(pSize, mnPos, mxPos, ls) { var _local4; var _local2 = scrollTrack_mc; pageSize = pSize; largeScroll = (((ls != undefined) && (ls > 0)) ? (ls) : (pSize)); minPos = Math.max(mnPos, 0); maxPos = Math.max(mxPos, 0); _scrollPosition = Math.max(minPos, _scrollPosition); _scrollPosition = Math.min(maxPos, _scrollPosition); if (((maxPos - minPos) > 0) && (enabled)) { var _local5 = _scrollPosition; if (!initializing) { upArrow_mc.enabled = true; downArrow_mc.enabled = true; } _local2.onPress = (_local2.onDragOver = startTrackScroller); _local2.onRelease = releaseScrolling; _local2.onDragOut = (_local2.stopScrolling = stopScrolling); _local2.onReleaseOutside = releaseScrolling; _local2.useHandCursor = false; if (scrollThumb_mc == undefined) { createThumb(); } var _local3 = scrollThumb_mc; if (scrollTrackOverName.length > 0) { _local2.onRollOver = trackOver; _local2.onRollOut = trackOut; } _local4 = (pageSize / ((maxPos - minPos) + pageSize)) * _local2.height; if (_local4 < _local3.minHeight) { if (_local2.height < _local3.minHeight) { _local3.__set__visible(false); } else { _local4 = _local3.minHeight; _local3.__set__visible(true); _local3.setSize(_minWidth, _local3.minHeight + 0); } } else { _local3.__set__visible(true); _local3.setSize(_minWidth, _local4); } _local3.setRange(upArrow_mc.__get__height() + 0, (virtualHeight - downArrow_mc.__get__height()) - _local3.__get__height(), minPos, maxPos); _local5 = Math.min(_local5, maxPos); scrollPosition = (Math.max(_local5, minPos)); } else { scrollThumb_mc.__set__visible(false); if (!initializing) { upArrow_mc.enabled = false; downArrow_mc.enabled = false; } delete _local2.onPress; delete _local2.onDragOver; delete _local2.onRelease; delete _local2.onDragOut; delete _local2.onRollOver; delete _local2.onRollOut; delete _local2.onReleaseOutside; } if (initializing) { scrollThumb_mc.__set__visible(false); } } function setEnabled(enabledFlag) { super.setEnabled(enabledFlag); setScrollProperties(pageSize, minPos, maxPos, largeScroll); } function draw(Void) { if (initializing) { initializing = false; scrollTrack_mc.visible = true; upArrow_mc.__set__visible(true); downArrow_mc.__set__visible(true); } size(); } function size(Void) { if (_height == 1) { return(undefined); } if (upArrow_mc == undefined) { return(undefined); } var _local3 = upArrow_mc.__get__height(); var _local2 = downArrow_mc.__get__height(); upArrow_mc.move(0, 0); var _local4 = scrollTrack_mc; _local4._y = _local3; _local4._height = (virtualHeight - _local3) - _local2; downArrow_mc.move(0, virtualHeight - _local2); setScrollProperties(pageSize, minPos, maxPos, largeScroll); } function dispatchScrollEvent(detail) { dispatchEvent({type:"scroll", detail:detail}); } function isScrollBarKey(k) { if (k == 36) { if (scrollPosition != 0) { scrollPosition = (0); dispatchScrollEvent(minMode); } return(true); } if (k == 35) { if (scrollPosition < maxPos) { scrollPosition = (maxPos); dispatchScrollEvent(maxMode); } return(true); } return(false); } function scrollIt(inc, mode) { var _local3 = smallScroll; if (inc != "Line") { _local3 = ((largeScroll == 0) ? (pageSize) : (largeScroll)); } var _local2 = _scrollPosition + (mode * _local3); if (_local2 > maxPos) { _local2 = maxPos; } else if (_local2 < minPos) { _local2 = minPos; } if (scrollPosition != _local2) { scrollPosition = (_local2); var _local4 = ((mode < 0) ? (minusMode) : (plusMode)); dispatchScrollEvent(inc + _local4); } } function startTrackScroller(Void) { _parent.pressFocus(); if (_parent.scrollTrackDownName.length > 0) { if (_parent.scrollTrackDown_mc == undefined) { _parent.setSkin(skinIDTrackDown, scrollTrackDownName); } else { _parent.scrollTrackDown_mc.visible = true; } } _parent.trackScroller(); _parent.scrolling = setInterval(_parent, "scrollInterval", getStyle("repeatDelay"), "Page", -1); } function scrollInterval(inc, mode) { clearInterval(scrolling); if (inc == "Page") { trackScroller(); } else { scrollIt(inc, mode); } scrolling = setInterval(this, "scrollInterval", getStyle("repeatInterval"), inc, mode); } function trackScroller(Void) { if ((scrollThumb_mc._y + scrollThumb_mc.__get__height()) < _ymouse) { scrollIt("Page", 1); } else if (scrollThumb_mc._y > _ymouse) { scrollIt("Page", -1); } } function dispatchScrollChangedEvent(Void) { dispatchEvent({type:"scrollChanged"}); } function stopScrolling(Void) { clearInterval(_parent.scrolling); _parent.scrollTrackDown_mc.visible = false; } function releaseScrolling(Void) { _parent.releaseFocus(); stopScrolling(); _parent.dispatchScrollChangedEvent(); } function trackOver(Void) { if (_parent.scrollTrackOverName.length > 0) { if (_parent.scrollTrackOver_mc == undefined) { _parent.setSkin(skinIDTrackOver, scrollTrackOverName); } else { _parent.scrollTrackOver_mc.visible = true; } } } function trackOut(Void) { _parent.scrollTrackOver_mc.visible = false; } function onUpArrow(Void) { _parent.scrollIt("Line", -1); } function onDownArrow(Void) { _parent.scrollIt("Line", 1); } function onScrollChanged(Void) { _parent.dispatchScrollChangedEvent(); } static var symbolOwner = mx.core.UIComponent; var className = "ScrollBar"; var minPos = 0; var maxPos = 0; var pageSize = 0; var largeScroll = 0; var smallScroll = 1; var _scrollPosition = 0; var scrollTrackName = "ScrollTrack"; var scrollTrackOverName = ""; var scrollTrackDownName = ""; var upArrowName = "BtnUpArrow"; var upArrowUpName = "ScrollUpArrowUp"; var upArrowOverName = "ScrollUpArrowOver"; var upArrowDownName = "ScrollUpArrowDown"; var downArrowName = "BtnDownArrow"; var downArrowUpName = "ScrollDownArrowUp"; var downArrowOverName = "ScrollDownArrowOver"; var downArrowDownName = "ScrollDownArrowDown"; var thumbTopName = "ScrollThumbTopUp"; var thumbMiddleName = "ScrollThumbMiddleUp"; var thumbBottomName = "ScrollThumbBottomUp"; var thumbGripName = "ScrollThumbGripUp"; static var skinIDTrack = 0; static var skinIDTrackOver = 1; static var skinIDTrackDown = 2; static var skinIDUpArrow = 3; static var skinIDDownArrow = 4; static var skinIDThumb = 5; var idNames = new Array("scrollTrack_mc", "scrollTrackOver_mc", "scrollTrackDown_mc", "upArrow_mc", "downArrow_mc"); var clipParameters = {minPos:1, maxPos:1, pageSize:1, scrollPosition:1, lineScrollSize:1, pageScrollSize:1, visible:1, enabled:1}; static var mergedClipParameters = mx.core.UIObject.mergeClipParameters(mx.controls.scrollClasses.ScrollBar.prototype.clipParameters, mx.core.UIComponent.prototype.clipParameters); var initializing = true; }
Symbol 139 MovieClip [__Packages.mx.effects.Tween] Frame 0
class mx.effects.Tween extends Object { static var IntervalToken; var arrayMode, listener, initVal, endVal, startTime, updateFunc, endFunc, ID; function Tween (listenerObj, init, end, dur) { super(); if (listenerObj == undefined) { return; } if (typeof(init) != "number") { arrayMode = true; } listener = listenerObj; initVal = init; endVal = end; if (dur != undefined) { duration = dur; } startTime = getTimer(); if (duration == 0) { endTween(); } else { AddTween(this); } } static function AddTween(tween) { tween.ID = ActiveTweens.length; ActiveTweens.push(tween); if (IntervalToken == undefined) { Dispatcher.DispatchTweens = DispatchTweens; IntervalToken = setInterval(Dispatcher, "DispatchTweens", Interval); } } static function RemoveTweenAt(index) { var _local2 = ActiveTweens; if (((index >= _local2.length) || (index < 0)) || (index == undefined)) { return(undefined); } _local2.splice(index, 1); var _local4 = _local2.length; var _local1 = index; while (_local1 < _local4) { _local2[_local1].ID--; _local1++; } if (_local4 == 0) { clearInterval(IntervalToken); delete IntervalToken; } } static function DispatchTweens(Void) { var _local2 = ActiveTweens; var _local3 = _local2.length; var _local1 = 0; while (_local1 < _local3) { _local2[_local1].doInterval(); _local1++; } updateAfterEvent(); } function doInterval() { var _local2 = getTimer() - startTime; var _local3 = getCurVal(_local2); if (_local2 >= duration) { endTween(); } else if (updateFunc != undefined) { listener[updateFunc](_local3); } else { listener.onTweenUpdate(_local3); } } function getCurVal(curTime) { if (arrayMode) { var _local3 = new Array(); var _local2 = 0; while (_local2 < initVal.length) { _local3[_local2] = easingEquation(curTime, initVal[_local2], endVal[_local2] - initVal[_local2], duration); _local2++; } return(_local3); } return(easingEquation(curTime, initVal, endVal - initVal, duration)); } function endTween() { if (endFunc != undefined) { listener[endFunc](endVal); } else { listener.onTweenEnd(endVal); } RemoveTweenAt(ID); } function setTweenHandlers(update, end) { updateFunc = update; endFunc = end; } function easingEquation(t, b, c, d) { return(((c / 2) * (Math.sin(Math.PI * ((t / d) - 0.5)) + 1)) + b); } static var ActiveTweens = new Array(); static var Interval = 10; static var Dispatcher = new Object(); var duration = 3000; }
Symbol 140 MovieClip [__Packages.mx.controls.gridclasses.DataGridColumn] Frame 0
class mx.controls.gridclasses.DataGridColumn extends mx.styles.CSSStyleDeclaration { var columnName, parentGrid, colNum, __header, headerCell, __cellRenderer, __headerRenderer, __labelFunction, styleName; function DataGridColumn (colName) { super(); columnName = colName; headerText = (colName); } function get width() { return(__width); } function set width(w) { delete parentGrid.invSpaceColsEqually; if ((parentGrid != undefined) && (parentGrid.hasDrawn)) { var _local2 = resizable; resizable = false; parentGrid.resizeColumn(colNum, w); resizable = _local2; } else { __width = w; } //return(width); } function set headerText(h) { __header = h; headerCell.setValue(h); //return(headerText); } function get headerText() { return(((__header == undefined) ? (columnName) : (__header))); } function set cellRenderer(cR) { __cellRenderer = cR; parentGrid.invColChange = true; parentGrid.invalidate(); //return(cellRenderer); } function get cellRenderer() { return(__cellRenderer); } function set headerRenderer(hS) { __headerRenderer = hS; parentGrid.invInitHeaders = true; parentGrid.invalidate(); //return(headerRenderer); } function get headerRenderer() { return(__headerRenderer); } function set labelFunction(f) { __labelFunction = f; parentGrid.invUpdateControl = true; parentGrid.invalidate(); //return(labelFunction); } function get labelFunction() { return(__labelFunction); } function getStyle(prop) { var _local3 = this[prop]; if (_local3 == undefined) { if (styleName != undefined) { if (styleName instanceof mx.styles.CSSStyleDeclaration) { _local3 = styleName.getStyle(prop); } else { _local3 = _global.styles[styleName].getStyle(prop); } } if ((((_local3 == undefined) || (_local3 == _global.style[prop])) || (_local3 == _global.styles[parentGrid.className][prop])) && (prop != "backgroundColor")) { _local3 = parentGrid.getStyle(prop); } } return(_local3); } function __getTextFormat(tf, bAll, fieldInst) { var _local4; if (parentGrid.header_mc[fieldInst._name] != undefined) { _local4 = getStyle("headerStyle").__getTextFormat(tf, bAll, fieldInst); if (_local4 != false) { _local4 = parentGrid.getStyle("headerStyle").__getTextFormat(tf, bAll, fieldInst); } if (_local4 == false) { return(_local4); } } if (styleName != undefined) { var _local8 = ((typeof(styleName) == "string") ? (_global.styles[styleName]) : (styleName)); _local4 = _local8.__getTextFormat(tf, bAll); if (!_local4) { return(_local4); } } _local4 = super.__getTextFormat(tf, bAll, fieldInst); if (_local4) { return(parentGrid.__getTextFormat(tf, bAll)); } return(_local4); } var editable = true; var sortable = true; var resizable = true; var sortOnHeaderRelease = true; var __width = 50; }
Symbol 141 MovieClip [__Packages.mx.controls.listclasses.SelectableRow] Frame 0
class mx.controls.listclasses.SelectableRow extends mx.core.UIComponent { var __height, cell, owner, rowIndex, icon_mc, createObject, __width, backGround, highlight, highlightColor, createLabel, createClassObject, listOwner, tabEnabled, item, createEmptyMovieClip, drawRect, isChangedToSelected, bGTween, grandOwner; function SelectableRow () { super(); } function setValue(itmObj, state) { var _local7 = __height; var _local2 = cell; var _local5 = owner; var _local8 = itemToString(itmObj); if (_local2.getValue() != _local8) { _local2.setValue(_local8, itmObj, state); } var _local4 = _local5.getPropertiesAt(rowIndex + _local5.__vPosition).icon; if (_local4 == undefined) { _local4 = _local5.__iconFunction(itmObj); if (_local4 == undefined) { _local4 = itmObj[_local5.__iconField]; if (_local4 == undefined) { _local4 = _local5.getStyle("defaultIcon"); } } } var _local3 = icon_mc; if ((_local4 != undefined) && (itmObj != undefined)) { _local3 = createObject(_local4, "icon_mc", 20); _local3._x = 2; _local3._y = (_local7 - _local3._height) / 2; _local2._x = 4 + _local3._width; } else { _local3.removeMovieClip(); _local2._x = 2; } var _local9 = ((_local3 == undefined) ? 0 : (_local3._width)); _local2.setSize(__width - _local9, Math.min(_local7, _local2.getPreferredHeight())); _local2._y = (_local7 - _local2._height) / 2; } function size(Void) { var _local3 = backGround; var _local2 = cell; var _local4 = __height; var _local5 = __width; var _local6 = ((icon_mc == undefined) ? 0 : (icon_mc._width)); _local2.setSize(_local5 - _local6, Math.min(_local4, _local2.getPreferredHeight())); _local2._y = (_local4 - _local2._height) / 2; icon_mc._y = (_local4 - icon_mc._height) / 2; _local3._x = 0; _local3._width = _local5; _local3._height = _local4; drawRowFill(_local3, normalColor); drawRowFill(highlight, highlightColor); } function setCellRenderer(forceSizing) { var _local3 = owner.__cellRenderer; var _local4; if (cell != undefined) { _local4 = cell._x; cell.removeMovieClip(); cell.removeTextField(); } var _local2; if (_local3 == undefined) { _local2 = (cell = createLabel("cll", 0, {styleName:this})); _local2.styleName = owner; _local2.selectable = false; _local2.tabEnabled = false; _local2.background = false; _local2.border = false; } else if (typeof(_local3) == "string") { _local2 = (cell = createObject(_local3, "cll", 0, {styleName:this})); } else { _local2 = (cell = createClassObject(_local3, "cll", 0, {styleName:this})); } _local2.owner = this; _local2.listOwner = owner; _local2.getCellIndex = getCellIndex; _local2.getDataLabel = getDataLabel; if (_local4 != undefined) { _local2._x = _local4; } if (forceSizing) { size(); } } function getCellIndex(Void) { return({columnIndex:0, itemIndex:owner.rowIndex + listOwner.__vPosition}); } function getDataLabel() { return(listOwner.labelField); } function init(Void) { super.init(); tabEnabled = false; } function createChildren(Void) { setCellRenderer(false); setupBG(); setState(state, false); } function drawRow(itmObj, state, transition) { item = itmObj; setState(state, transition); setValue(itmObj, state, transition); } function itemToString(itmObj) { if (itmObj == undefined) { return(" "); } var _local2 = owner.__labelFunction(itmObj); if (_local2 == undefined) { _local2 = ((itmObj instanceof XMLNode) ? (itmObj.attributes[owner.__labelField]) : (itmObj[owner.__labelField])); if (_local2 == undefined) { _local2 = " "; if (typeof(itmObj) == "object") { for (var _local4 in itmObj) { if (_local4 != "__ID__") { _local2 = (itmObj[_local4] + ", ") + _local2; } } _local2 = _local2.substring(0, _local2.length - 2); } else { _local2 = itmObj; } } } return(_local2); } function setupBG(Void) { var _local2 = (backGround = createEmptyMovieClip("bG_mc", LOWEST_DEPTH)); drawRowFill(_local2, normalColor); highlight = createEmptyMovieClip("tran_mc", LOWEST_DEPTH + 10); _local2.owner = this; _local2.grandOwner = owner; _local2.onPress = bGOnPress; _local2.onRelease = bGOnRelease; _local2.onRollOver = bGOnRollOver; _local2.onRollOut = bGOnRollOut; _local2.onDragOver = bGOnDragOver; _local2.onDragOut = bGOnDragOut; _local2.useHandCursor = false; _local2.trackAsMenu = true; _local2.drawRect = drawRect; highlight.drawRect = drawRect; } function drawRowFill(mc, newClr) { mc.clear(); mc.beginFill(newClr); mc.drawRect(1, 0, __width, __height); mc.endFill(); mc._width = __width; mc._height = __height; } function setState(newState, transition) { var _local2 = highlight; var _local8 = backGround; var _local4 = __height; var _local3 = owner; if (!_local3.enabled) { if ((newState == "selected") || (state == "selected")) { highlightColor = _local3.getStyle("selectionDisabledColor"); drawRowFill(_local2, highlightColor); _local2._visible = true; _local2._y = 0; _local2._height = _local4; } else { _local2._visible = false; normalColor = _local3.getStyle("backgroundDisabledColor"); drawRowFill(_local8, normalColor); } cell.__enabled = false; cell.setColor(_local3.getStyle("disabledColor")); } else { cell.__enabled = true; if (transition && ((newState == state) || ((newState == "highlighted") && (state == "selected")))) { isChangedToSelected = true; return(undefined); } var _local6 = _local3.getStyle("selectionDuration"); var _local7 = 0; if (isChangedToSelected && (newState == "selected")) { transition = false; } var _local10 = transition && (_local6 != 0); if (newState == "normal") { _local7 = _local3.getStyle("color"); normalColor = getNormalColor(); drawRowFill(_local8, normalColor); if (_local10) { _local6 = _local6 / 2; _local2._height = _local4; _local2._width = __width; _local2._y = 0; bGTween = new mx.effects.Tween(this, _local4 + 2, _local4 * 0.2, _local6, 5); } else { _local2._visible = false; } delete isChangedToSelected; } else { highlightColor = _local3.getStyle(((newState == "highlighted") ? "rollOverColor" : "selectionColor")); drawRowFill(_local2, highlightColor); _local2._visible = true; _local7 = _local3.getStyle(((newState == "highlighted") ? "textRollOverColor" : "textSelectedColor")); if (_local10) { _local2._height = _local4 * 0.5; _local2._y = (_local4 - _local2._height) / 2; bGTween = new mx.effects.Tween(this, _local2._height, _local4 + 2, _local6, 5); var _local9 = _local3.getStyle("selectionEasing"); if (_local9 != undefined) { bGTween.easingEquation = _local9; } } else { _local2._y = 0; _local2._height = _local4; } } cell.setColor(_local7); } state = newState; } function onTweenUpdate(val) { highlight._height = val; highlight._y = (__height - val) / 2; } function onTweenEnd(val) { onTweenUpdate(val); highlight._visible = state != "normal"; } function getNormalColor(Void) { var _local3; var _local2 = owner; if (!owner.enabled) { _local3 = _local2.getStyle("backgroundDisabledColor"); } else { var _local5 = rowIndex + _local2.__vPosition; if (rowIndex == undefined) { _local3 = _local2.getPropertiesOf(item).backgroundColor; } else { _local3 = _local2.getPropertiesAt(_local5).backgroundColor; } if (_local3 == undefined) { var _local4 = _local2.getStyle("alternatingRowColors"); if (_local4 == undefined) { _local3 = _local2.getStyle("backgroundColor"); } else { _local3 = _local4[_local5 % _local4.length]; } } } return(_local3); } function invalidateStyle(propName) { cell.invalidateStyle(propName); super.invalidateStyle(propName); } function bGOnPress(Void) { grandOwner.pressFocus(); grandOwner.onRowPress(owner.rowIndex); } function bGOnRelease(Void) { grandOwner.releaseFocus(); grandOwner.onRowRelease(owner.rowIndex); } function bGOnRollOver(Void) { grandOwner.onRowRollOver(owner.rowIndex); } function bGOnRollOut(Void) { grandOwner.onRowRollOut(owner.rowIndex); } function bGOnDragOver(Void) { grandOwner.onRowDragOver(owner.rowIndex); } function bGOnDragOut(Void) { grandOwner.onRowDragOut(owner.rowIndex); } static var LOWEST_DEPTH = -16384; var state = "normal"; var disabledColor = 15263976; var normalColor = 16777215; }
Symbol 142 MovieClip [__Packages.mx.controls.gridclasses.DataGridRow] Frame 0
class mx.controls.gridclasses.DataGridRow extends mx.controls.listclasses.SelectableRow { var setupBG, colBG, createEmptyMovieClip, cells, owner, backGround, createObject, createClassObject, createLabel, text, draw, textHeight, listOwner, columnIndex, __height, grandOwner, wasPressed, onPress; function DataGridRow () { super(); } function createChildren(Void) { setupBG(); colBG = createEmptyMovieClip("colbG_mc", mx.controls.listclasses.SelectableRow.LOWEST_DEPTH + 1); } function init(Void) { super.init(); cells = new Array(); } function size(Void) { if (cells.length != owner.columns.length) { createCells(); } super.size(); } function createCells(Void) { clearCells(); backGround.onRelease = startEditCell; var _local7 = owner.columns.length; var _local2 = 0; while (_local2 < _local7) { var _local5 = owner.columns[_local2]; var _local4 = _local5.__cellRenderer; if (_local4 != undefined) { if (typeof(_local4) == "string") { var _local3 = (cells[_local2] = createObject(_local4, "fCell" + _local2, 2 + _local2, {styleName:_local5})); } else { var _local3 = (cells[_local2] = createClassObject(_local4, "fCell" + _local2, 2 + _local2, {styleName:_local5})); } } else { var _local3 = (cells[_local2] = createLabel("fCell" + _local2, 2 + _local2)); _local3.styleName = _local5; _local3.selectable = false; _local3.backGround = false; _local3.border = false; _local3._visible = false; _local3.getPreferredHeight = cellGetPreferredHeight; } _local3.listOwner = owner; _local3.columnIndex = _local2; _local3.owner = this; _local3.getCellIndex = getCellIndex; _local3.getDataLabel = getDataLabel; _local2++; } } function cellGetPreferredHeight() { var _local3 = text; text = "^g_p"; draw(); var _local2 = textHeight + 4; text = _local3; return(_local2); } function getCellIndex(Void) { return({columnIndex:columnIndex, itemIndex:owner.rowIndex + listOwner.__vPosition}); } function getDataLabel() { return(listOwner.columns[columnIndex].columnName); } function clearCells() { var _local2 = 0; while (_local2 < cells.length) { cells[_local2].removeTextField(); cells[_local2].removeMovieClip(); _local2++; } cells.splice(0); } function setValue(itmObj, state, transition) { var _local7 = owner.columns; var _local8 = _local7.length; var _local3 = 0; while (_local3 < _local8) { var _local6 = cells[_local3]; var _local5 = _local7[_local3]; var _local2 = _local5.__labelFunction(itmObj); if (_local2 == undefined) { _local2 = ((itmObj instanceof XMLNode) ? (itmObj.attributes[_local5.columnName]) : (itmObj[_local5.columnName])); } if (_local2 == undefined) { _local2 = " "; } _local6.setValue(_local2, itmObj, state); _local3++; } } function drawCell(cellNum, xPos, w, bgCol) { var _local2 = cells[cellNum]; _local2._x = xPos; _local2._visible = true; _local2.setSize(w - 2, Math.min(__height, _local2.getPreferredHeight())); _local2._y = (__height - _local2.height) / 2; if (bgCol != undefined) { var _local3 = Math.floor(xPos - 2); var _local4 = Math.floor(_local3 + w); colBG.moveTo(_local3, 0); colBG.beginFill(bgCol); colBG.lineStyle(0, 0, 0); colBG.lineTo(_local4, 0); colBG.lineTo(_local4, __height); colBG.lineTo(_local3, __height); colBG.endFill(); } } function setState(newState, transition) { var _local6 = owner.columns; var _local4 = _local6.length; if ((newState != "normal") || (!owner.enabled)) { var _local5; if (!owner.enabled) { _local5 = owner.getStyle("disabledColor"); } else if (newState == "highlighted") { _local5 = owner.getStyle("textRollOverColor"); } else if (newState == "selected") { _local5 = owner.getStyle("textSelectedColor"); } var _local3 = 0; while (_local3 < _local4) { cells[_local3].setColor(_local5); cells[_local3].__enabled = owner.enabled; _local3++; } } else { var _local3 = 0; while (_local3 < _local4) { cells[_local3].setColor(_local6[_local3].getStyle("color")); cells[_local3].__enabled = owner.enabled; _local3++; } } super.setState(newState, transition); } function startEditCell() { var _local2 = grandOwner; _local2.dontEdit = true; _local2.releaseFocus(); delete _local2.dontEdit; if ((_local2.enabled && (_local2.editable)) && (owner.item != undefined)) { var _local9 = owner.cells.length; var _local3 = 0; while (_local3 < _local9) { var _local5 = _local2.columns[_local3]; if (_local5.editable) { var _local4 = owner._xmouse - owner.cells[_local3]._x; if ((_local4 >= 0) && (_local4 < _local5.__width)) { var _local6 = owner.rowIndex + _local2.__vPosition; _local2.setFocusedCell({itemIndex:_local6, columnIndex:_local3}, true); if (wasPressed != true) { onPress(); _local2.onMouseUp(); } delete wasPressed; clearInterval(_local2.dragScrolling); delete _local2.onMouseUp; return(undefined); } } _local3++; } } } function bGOnPress(Void) { wasPressed = true; grandOwner.pressFocus(); grandOwner.onRowPress(owner.rowIndex); } function notifyStyleChangeInChildren(sheetName, styleProp, newValue) { var _local6 = owner.columns; var _local4 = cells.length; var _local3 = 0; while (_local3 < _local4) { var _local2 = cells[_local3]; if (_local2.stylecache != undefined) { delete _local2.stylecache.tf; } delete _local2.enabledColor; _local2.invalidateStyle(styleProp); _local3++; } } }
Symbol 143 MovieClip [__Packages.mx.controls.TextInput] Frame 0
class mx.controls.TextInput extends mx.core.UIComponent { var owner, enterListener, label, tabChildren, tabEnabled, focusTextField, _color, _parent, border_mc, createClassObject, dispatchValueChangedEvent, __get__width, __get__height, tfx, tfy, tfw, tfh, getStyle, bind, updateModel, _getTextFormat, enabled; function TextInput () { super(); } function addEventListener(event, handler) { if (event == "enter") { addEnterEvents(); } super.addEventListener(event, handler); } function enterOnKeyDown() { if (Key.getAscii() == 13) { owner.dispatchEvent({type:"enter"}); } } function addEnterEvents() { if (enterListener == undefined) { enterListener = new Object(); enterListener.owner = this; enterListener.onKeyDown = enterOnKeyDown; } } function init(Void) { super.init(); label.styleName = this; tabChildren = true; tabEnabled = false; focusTextField = label; _color = mx.core.UIObject.textColorList; label.onSetFocus = function () { this._parent.onSetFocus(); }; label.onKillFocus = function (n) { this._parent.onKillFocus(n); }; label.drawFocus = function (b) { this._parent.drawFocus(b); }; label.onChanged = onLabelChanged; } function setFocus() { Selection.setFocus(label); } function onLabelChanged(Void) { _parent.dispatchEvent({type:"change"}); _parent.dispatchValueChangedEvent(text); } function createChildren(Void) { super.createChildren(); if (border_mc == undefined) { createClassObject(_global.styles.rectBorderClass, "border_mc", 0, {styleName:this}); } border_mc.swapDepths(label); label.autoSize = "none"; } function get html() { return(getHtml()); } function set html(value) { setHtml(value); //return(html); } function getHtml() { return(label.html); } function setHtml(value) { if (value != label.html) { label.html = value; } } function get text() { return(getText()); } function set text(t) { setText(t); //return(text); } function getText() { if (initializing) { return(initText); } if (label.html == true) { return(label.htmlText); } return(label.text); } function setText(t) { if (initializing) { initText = t; } else { var _local2 = label; if (_local2.html == true) { _local2.htmlText = t; } else { _local2.text = t; } } dispatchValueChangedEvent(t); } function size(Void) { border_mc.setSize(__get__width(), __get__height()); var _local2 = border_mc.__get__borderMetrics(); var _local6 = _local2.left + _local2.right; var _local3 = _local2.top + _local2.bottom; var _local5 = _local2.left; var _local4 = _local2.top; tfx = _local5; tfy = _local4; tfw = __get__width() - _local6; tfh = __get__height() - _local3; label.move(tfx, tfy); label.setSize(tfw, tfh + 1); } function setEnabled(enable) { label.type = (((__editable == true) || (enable == false)) ? "input" : "dynamic"); label.selectable = enable; var _local2 = getStyle((enable ? "color" : "disabledColor")); if (_local2 == undefined) { _local2 = (enable ? 0 : 8947848); } setColor(_local2); } function setColor(col) { label.textColor = col; } function onKillFocus(newFocus) { if (enterListener != undefined) { Key.removeListener(enterListener); } if (bind != undefined) { updateModel(text); } super.onKillFocus(newFocus); } function onSetFocus(oldFocus) { var f = Selection.getFocus(); var o = eval (f); if (o != label) { Selection.setFocus(label); return(undefined); } if (enterListener != undefined) { Key.addListener(enterListener); } super.onSetFocus(oldFocus); } function draw(Void) { var _local2 = label; var _local4 = getText(); if (initializing) { initializing = false; delete initText; } var _local3 = _getTextFormat(); _local2.embedFonts = _local3.embedFonts == true; if (_local3 != undefined) { _local2.setTextFormat(_local3); _local2.setNewTextFormat(_local3); } _local2.multiline = false; _local2.wordWrap = false; if (_local2.html == true) { _local2.setTextFormat(_local3); _local2.htmlText = _local4; } else { _local2.text = _local4; } _local2.type = (((__editable == true) || (enabled == false)) ? "input" : "dynamic"); size(); } function setEditable(s) { __editable = s; label.type = (s ? "input" : "dynamic"); } function get maxChars() { return(label.maxChars); } function set maxChars(w) { label.maxChars = w; //return(maxChars); } function get length() { return(label.length); } function get restrict() { return(label.restrict); } function set restrict(w) { label.restrict = ((w == "") ? null : (w)); //return(restrict); } function get hPosition() { return(label.hscroll); } function set hPosition(w) { label.hscroll = w; //return(hPosition); } function get maxHPosition() { return(label.maxhscroll); } function get editable() { return(__editable); } function set editable(w) { setEditable(w); //return(editable); } function get password() { return(label.password); } function set password(w) { label.password = w; //return(password); } function get tabIndex() { return(label.tabIndex); } function set tabIndex(w) { label.tabIndex = w; //return(tabIndex); } function set _accProps(val) { label._accProps = val; //return(_accProps); } function get _accProps() { return(label._accProps); } static var symbolName = "TextInput"; static var symbolOwner = mx.controls.TextInput; static var version = "2.0.2.126"; var className = "TextInput"; var initializing = true; var clipParameters = {text:1, editable:1, password:1, maxChars:1, restrict:1}; static var mergedClipParameters = mx.core.UIObject.mergeClipParameters(mx.controls.TextInput.prototype.clipParameters, mx.core.UIComponent.prototype.clipParameters); var _maxWidth = mx.core.UIComponent.kStretch; var __editable = true; var initText = ""; }
Symbol 144 MovieClip [__Packages.mx.skins.ColoredSkinElement] Frame 0
class mx.skins.ColoredSkinElement { var getStyle, _color, onEnterFrame; function ColoredSkinElement () { } function setColor(c) { if (c != undefined) { var _local2 = new Color(this); _local2.setRGB(c); } } function draw(Void) { setColor(getStyle(_color)); onEnterFrame = undefined; } function invalidateStyle(Void) { onEnterFrame = draw; } static function setColorStyle(p, colorStyle) { if (p._color == undefined) { p._color = colorStyle; } p.setColor = mixins.setColor; p.invalidateStyle = mixins.invalidateStyle; p.draw = mixins.draw; p.setColor(p.getStyle(colorStyle)); } static var mixins = new mx.skins.ColoredSkinElement(); }
Symbol 145 MovieClip [__Packages.mx.core.ext.UIObjectExtensions] Frame 0
class mx.core.ext.UIObjectExtensions { function UIObjectExtensions () { } static function addGeometry(tf, ui) { tf.addProperty("width", ui.__get__width, null); tf.addProperty("height", ui.__get__height, null); tf.addProperty("left", ui.__get__left, null); tf.addProperty("x", ui.__get__x, null); tf.addProperty("top", ui.__get__top, null); tf.addProperty("y", ui.__get__y, null); tf.addProperty("right", ui.__get__right, null); tf.addProperty("bottom", ui.__get__bottom, null); tf.addProperty("visible", ui.__get__visible, ui.__set__visible); } static function Extensions() { if (bExtended == true) { return(true); } bExtended = true; var _local6 = mx.core.UIObject.prototype; var _local9 = mx.skins.SkinElement.prototype; addGeometry(_local9, _local6); mx.events.UIEventDispatcher.initialize(_local6); var _local13 = mx.skins.ColoredSkinElement; mx.styles.CSSTextStyles.addTextStyles(_local6); var _local5 = MovieClip.prototype; _local5.getTopLevel = _local6.getTopLevel; _local5.createLabel = _local6.createLabel; _local5.createObject = _local6.createObject; _local5.createClassObject = _local6.createClassObject; _local5.createEmptyObject = _local6.createEmptyObject; _local5.destroyObject = _local6.destroyObject; _global.ASSetPropFlags(_local5, "getTopLevel", 1); _global.ASSetPropFlags(_local5, "createLabel", 1); _global.ASSetPropFlags(_local5, "createObject", 1); _global.ASSetPropFlags(_local5, "createClassObject", 1); _global.ASSetPropFlags(_local5, "createEmptyObject", 1); _global.ASSetPropFlags(_local5, "destroyObject", 1); _local5.__getTextFormat = _local6.__getTextFormat; _local5._getTextFormat = _local6._getTextFormat; _local5.getStyleName = _local6.getStyleName; _local5.getStyle = _local6.getStyle; _global.ASSetPropFlags(_local5, "__getTextFormat", 1); _global.ASSetPropFlags(_local5, "_getTextFormat", 1); _global.ASSetPropFlags(_local5, "getStyleName", 1); _global.ASSetPropFlags(_local5, "getStyle", 1); var _local7 = TextField.prototype; addGeometry(_local7, _local6); _local7.addProperty("enabled", function () { return(this.__enabled); }, function (x) { this.__enabled = x; this.invalidateStyle(); }); _local7.move = _local9.move; _local7.setSize = _local9.setSize; _local7.invalidateStyle = function () { this.invalidateFlag = true; }; _local7.draw = function () { if (this.invalidateFlag) { this.invalidateFlag = false; var _local2 = this._getTextFormat(); this.setTextFormat(_local2); this.setNewTextFormat(_local2); this.embedFonts = _local2.embedFonts == true; if (this.__text != undefined) { if (this.text == "") { this.text = this.__text; } delete this.__text; } this._visible = true; } }; _local7.setColor = function (color) { this.textColor = color; }; _local7.getStyle = _local5.getStyle; _local7.__getTextFormat = _local6.__getTextFormat; _local7.setValue = function (v) { this.text = v; }; _local7.getValue = function () { return(this.text); }; _local7.addProperty("value", function () { return(this.getValue()); }, function (v) { this.setValue(v); }); _local7._getTextFormat = function () { var _local2 = this.stylecache.tf; if (_local2 != undefined) { return(_local2); } _local2 = new TextFormat(); this.__getTextFormat(_local2); this.stylecache.tf = _local2; if (this.__enabled == false) { if (this.enabledColor == undefined) { var _local4 = this.getTextFormat(); this.enabledColor = _local4.color; } var _local3 = this.getStyle("disabledColor"); _local2.color = _local3; } else if (this.enabledColor != undefined) { if (_local2.color == undefined) { _local2.color = this.enabledColor; } } return(_local2); }; _local7.getPreferredWidth = function () { this.draw(); return(this.textWidth + 4); }; _local7.getPreferredHeight = function () { this.draw(); return(this.textHeight + 4); }; TextFormat.prototype.getTextExtent2 = function (s) { var _local3 = _root._getTextExtent; if (_local3 == undefined) { _root.createTextField("_getTextExtent", -2, 0, 0, 1000, 100); _local3 = _root._getTextExtent; _local3._visible = false; } _root._getTextExtent.text = s; var _local4 = this.align; this.align = "left"; _root._getTextExtent.setTextFormat(this); this.align = _local4; return({width:_local3.textWidth, height:_local3.textHeight}); }; if (_global.style == undefined) { _global.style = new mx.styles.CSSStyleDeclaration(); _global.cascadingStyles = true; _global.styles = new Object(); _global.skinRegistry = new Object(); if (_global._origWidth == undefined) { _global.origWidth = Stage.width; _global.origHeight = Stage.height; } } var _local4 = _root; while (_local4._parent != undefined) { _local4 = _local4._parent; } _local4.addProperty("width", function () { return(Stage.width); }, null); _local4.addProperty("height", function () { return(Stage.height); }, null); _global.ASSetPropFlags(_local4, "width", 1); _global.ASSetPropFlags(_local4, "height", 1); return(true); } static var bExtended = false; static var UIObjectExtended = Extensions(); static var UIObjectDependency = mx.core.UIObject; static var SkinElementDependency = mx.skins.SkinElement; static var CSSTextStylesDependency = mx.styles.CSSTextStyles; static var UIEventDispatcherDependency = mx.events.UIEventDispatcher; }
Symbol 146 MovieClip [__Packages.mx.skins.halo.Defaults] Frame 0
class mx.skins.halo.Defaults { var beginGradientFill, beginFill, moveTo, lineTo, curveTo, endFill; function Defaults () { } static function setThemeDefaults() { var _local2 = _global.style; _local2.themeColor = 8453965 /* 0x80FF4D */; _local2.disabledColor = 8684164 /* 0x848284 */; _local2.modalTransparency = 0; _local2.filled = true; _local2.stroked = true; _local2.strokeWidth = 1; _local2.strokeColor = 0; _local2.fillColor = 16777215 /* 0xFFFFFF */; _local2.repeatInterval = 35; _local2.repeatDelay = 500; _local2.fontFamily = "_sans"; _local2.fontSize = 12; _local2.selectionColor = 13500353 /* 0xCDFFC1 */; _local2.rollOverColor = 14942166 /* 0xE3FFD6 */; _local2.useRollOver = true; _local2.backgroundDisabledColor = 14540253 /* 0xDDDDDD */; _local2.selectionDisabledColor = 14540253 /* 0xDDDDDD */; _local2.selectionDuration = 200; _local2.openDuration = 250; _local2.borderStyle = "inset"; _local2.color = 734012 /* 0x0B333C */; _local2.textSelectedColor = 24371; _local2.textRollOverColor = 2831164 /* 0x2B333C */; _local2.textDisabledColor = 16777215 /* 0xFFFFFF */; _local2.vGridLines = true; _local2.hGridLines = false; _local2.vGridLineColor = 6710886 /* 0x666666 */; _local2.hGridLineColor = 6710886 /* 0x666666 */; _local2.headerColor = 15395562 /* 0xEAEAEA */; _local2.indentation = 17; _local2.folderOpenIcon = "TreeFolderOpen"; _local2.folderClosedIcon = "TreeFolderClosed"; _local2.defaultLeafIcon = "TreeNodeIcon"; _local2.disclosureOpenIcon = "TreeDisclosureOpen"; _local2.disclosureClosedIcon = "TreeDisclosureClosed"; _local2.popupDuration = 150; _local2.todayColor = 6710886 /* 0x666666 */; _local2 = (_global.styles.ScrollSelectList = new mx.styles.CSSStyleDeclaration()); _local2.backgroundColor = 16777215 /* 0xFFFFFF */; _local2.borderColor = 13290186 /* 0xCACACA */; _local2.borderStyle = "inset"; _local2 = (_global.styles.ComboBox = new mx.styles.CSSStyleDeclaration()); _local2.borderStyle = "inset"; _local2 = (_global.styles.NumericStepper = new mx.styles.CSSStyleDeclaration()); _local2.textAlign = "center"; _local2 = (_global.styles.RectBorder = new mx.styles.CSSStyleDeclaration()); _local2.borderColor = 14015965 /* 0xD5DDDD */; _local2.buttonColor = 7305079 /* 0x6F7777 */; _local2.shadowColor = 15658734 /* 0xEEEEEE */; _local2.highlightColor = 12897484 /* 0xC4CCCC */; _local2.shadowCapColor = 14015965 /* 0xD5DDDD */; _local2.borderCapColor = 9542041 /* 0x919999 */; var _local4 = new Object(); _local4.borderColor = 16711680 /* 0xFF0000 */; _local4.buttonColor = 16711680 /* 0xFF0000 */; _local4.shadowColor = 16711680 /* 0xFF0000 */; _local4.highlightColor = 16711680 /* 0xFF0000 */; _local4.shadowCapColor = 16711680 /* 0xFF0000 */; _local4.borderCapColor = 16711680 /* 0xFF0000 */; mx.core.UIComponent.prototype.origBorderStyles = _local4; var _local3; _local3 = (_global.styles.TextInput = new mx.styles.CSSStyleDeclaration()); _local3.backgroundColor = 16777215 /* 0xFFFFFF */; _local3.borderStyle = "inset"; _global.styles.TextArea = _global.styles.TextInput; _local3 = (_global.styles.Window = new mx.styles.CSSStyleDeclaration()); _local3.borderStyle = "default"; _local3 = (_global.styles.windowStyles = new mx.styles.CSSStyleDeclaration()); _local3.fontWeight = "bold"; _local3 = (_global.styles.dataGridStyles = new mx.styles.CSSStyleDeclaration()); _local3.fontWeight = "bold"; _local3 = (_global.styles.Alert = new mx.styles.CSSStyleDeclaration()); _local3.borderStyle = "alert"; _local3 = (_global.styles.ScrollView = new mx.styles.CSSStyleDeclaration()); _local3.borderStyle = "inset"; _local3 = (_global.styles.View = new mx.styles.CSSStyleDeclaration()); _local3.borderStyle = "none"; _local3 = (_global.styles.ProgressBar = new mx.styles.CSSStyleDeclaration()); _local3.color = 11187123 /* 0xAAB3B3 */; _local3.fontWeight = "bold"; _local3 = (_global.styles.AccordionHeader = new mx.styles.CSSStyleDeclaration()); _local3.fontWeight = "bold"; _local3.fontSize = "11"; _local3 = (_global.styles.Accordion = new mx.styles.CSSStyleDeclaration()); _local3.borderStyle = "solid"; _local3.backgroundColor = 16777215 /* 0xFFFFFF */; _local3.borderColor = 9081738 /* 0x8A938A */; _local3.headerHeight = 22; _local3.marginLeft = (_local3.marginRight = (_local3.marginTop = (_local3.marginBottom = -1))); _local3.verticalGap = -1; _local3 = (_global.styles.DateChooser = new mx.styles.CSSStyleDeclaration()); _local3.borderColor = 9542041 /* 0x919999 */; _local3.headerColor = 16777215 /* 0xFFFFFF */; _local3 = (_global.styles.CalendarLayout = new mx.styles.CSSStyleDeclaration()); _local3.fontSize = 10; _local3.textAlign = "right"; _local3.color = 2831164 /* 0x2B333C */; _local3 = (_global.styles.WeekDayStyle = new mx.styles.CSSStyleDeclaration()); _local3.fontWeight = "bold"; _local3.fontSize = 11; _local3.textAlign = "center"; _local3.color = 2831164 /* 0x2B333C */; _local3 = (_global.styles.TodayStyle = new mx.styles.CSSStyleDeclaration()); _local3.color = 16777215 /* 0xFFFFFF */; _local3 = (_global.styles.HeaderDateText = new mx.styles.CSSStyleDeclaration()); _local3.fontSize = 12; _local3.fontWeight = "bold"; _local3.textAlign = "center"; } function drawRoundRect(x, y, w, h, r, c, alpha, rot, gradient, ratios) { if (typeof(r) == "object") { var _local18 = r.br; var _local16 = r.bl; var _local15 = r.tl; var _local10 = r.tr; } else { var _local10 = r; var _local15 = _local10; var _local16 = _local15; var _local18 = _local16; } if (typeof(c) == "object") { if (typeof(alpha) != "object") { var _local9 = [alpha, alpha]; } else { var _local9 = alpha; } if (ratios == undefined) { ratios = [0, 255]; } var _local14 = h * 0.7; if (typeof(rot) != "object") { var _local11 = {matrixType:"box", x:-_local14, y:_local14, w:w * 2, h:h * 4, r:rot * 0.0174532925199433 /* Math.PI/180 */}; } else { var _local11 = rot; } if (gradient == "radial") { beginGradientFill("radial", c, _local9, ratios, _local11); } else { beginGradientFill("linear", c, _local9, ratios, _local11); } } else if (c != undefined) { beginFill(c, alpha); } r = _local18; var _local13 = r - (r * 0.707106781186547); var _local12 = r - (r * 0.414213562373095); moveTo(x + w, (y + h) - r); lineTo(x + w, (y + h) - r); curveTo(x + w, (y + h) - _local12, (x + w) - _local13, (y + h) - _local13); curveTo((x + w) - _local12, y + h, (x + w) - r, y + h); r = _local16; _local13 = r - (r * 0.707106781186547); _local12 = r - (r * 0.414213562373095); lineTo(x + r, y + h); curveTo(x + _local12, y + h, x + _local13, (y + h) - _local13); curveTo(x, (y + h) - _local12, x, (y + h) - r); r = _local15; _local13 = r - (r * 0.707106781186547); _local12 = r - (r * 0.414213562373095); lineTo(x, y + r); curveTo(x, y + _local12, x + _local13, y + _local13); curveTo(x + _local12, y, x + r, y); r = _local10; _local13 = r - (r * 0.707106781186547); _local12 = r - (r * 0.414213562373095); lineTo((x + w) - r, y); curveTo((x + w) - _local12, y, (x + w) - _local13, y + _local13); curveTo(x + w, y + _local12, x + w, y + r); lineTo(x + w, (y + h) - r); if (c != undefined) { endFill(); } } static function classConstruct() { mx.core.ext.UIObjectExtensions.Extensions(); setThemeDefaults(); mx.core.UIObject.prototype.drawRoundRect = mx.skins.halo.Defaults.prototype.drawRoundRect; return(true); } static var classConstructed = classConstruct(); static var CSSStyleDeclarationDependency = mx.styles.CSSStyleDeclaration; static var UIObjectExtensionsDependency = mx.core.ext.UIObjectExtensions; static var UIObjectDependency = mx.core.UIObject; }
Symbol 147 MovieClip [__Packages.mx.managers.SystemManager] Frame 0
class mx.managers.SystemManager { static var _xAddEventListener, addEventListener, __addEventListener, _xRemoveEventListener, removeEventListener, __removeEventListener, form, __screen, dispatchEvent; function SystemManager () { } static function init(Void) { if (_initialized == false) { _initialized = true; mx.events.EventDispatcher.initialize(mx.managers.SystemManager); Mouse.addListener(mx.managers.SystemManager); Stage.addListener(mx.managers.SystemManager); _xAddEventListener = addEventListener; addEventListener = __addEventListener; _xRemoveEventListener = removeEventListener; removeEventListener = __removeEventListener; } } static function addFocusManager(f) { form = f; f.focusManager.activate(); } static function removeFocusManager(f) { } static function onMouseDown(Void) { var _local1 = form; _local1.focusManager._onMouseDown(); } static function onResize(Void) { var _local7 = Stage.width; var _local6 = Stage.height; var _local9 = _global.origWidth; var _local8 = _global.origHeight; var _local3 = Stage.align; var _local5 = (_local9 - _local7) / 2; var _local4 = (_local8 - _local6) / 2; if (_local3 == "T") { _local4 = 0; } else if (_local3 == "B") { _local4 = _local8 - _local6; } else if (_local3 == "L") { _local5 = 0; } else if (_local3 == "R") { _local5 = _local9 - _local7; } else if (_local3 == "LT") { _local4 = 0; _local5 = 0; } else if (_local3 == "TR") { _local4 = 0; _local5 = _local9 - _local7; } else if (_local3 == "LB") { _local4 = _local8 - _local6; _local5 = 0; } else if (_local3 == "RB") { _local4 = _local8 - _local6; _local5 = _local9 - _local7; } if (__screen == undefined) { __screen = new Object(); } __screen.x = _local5; __screen.y = _local4; __screen.width = _local7; __screen.height = _local6; _root.focusManager.relocate(); dispatchEvent({type:"resize"}); } static function get screen() { init(); if (__screen == undefined) { onResize(); } return(__screen); } static var _initialized = false; static var idleFrames = 0; static var isMouseDown = false; static var forms = new Array(); }
Symbol 148 MovieClip [__Packages.mx.managers.FocusManager] Frame 0
class mx.managers.FocusManager extends mx.core.UIComponent { var __defaultPushButton, defPushButton, form, move, tabEnabled, _width, _height, _x, _y, _alpha, _parent, tabCapture, watch, lastMouse, _visible, lastFocus, doLater, lastSelFocus, cancelAllDoLaters, _searchKey, _lastTarget, _firstNode, _nextIsNext, _nextNode, _lastx, _prevNode, _needPrev, _foundList, _prevObj, _nextObj, _firstObj, _lastObj, _lastNode, lastTabFocus, findFocusFromObject; function FocusManager () { super(); } function get defaultPushButton() { return(__defaultPushButton); } function set defaultPushButton(x) { if (x != __defaultPushButton) { __defaultPushButton.__set__emphasized(false); __defaultPushButton = x; defPushButton = x; x.__set__emphasized(true); } //return(defaultPushButton); } function getMaxTabIndex(o) { var _local3 = 0; var _local6; for (_local6 in o) { var _local2 = o[_local6]; if (_local2._parent == o) { if (_local2.tabIndex != undefined) { if (_local2.tabIndex > _local3) { _local3 = _local2.tabIndex; } } if (_local2.tabChildren == true) { var _local4 = getMaxTabIndex(_local2); if (_local4 > _local3) { _local3 = _local4; } } } } return(_local3); } function getNextTabIndex(Void) { return(getMaxTabIndex(form) + 1); } function get nextTabIndex() { return(getNextTabIndex()); } function relocate(Void) { var _local2 = mx.managers.SystemManager.__get__screen(); move(_local2.x - 1, _local2.y - 1); } function init(Void) { super.init(); tabEnabled = false; _width = (_height = 1); _x = (_y = -1); _alpha = 0; _parent.focusManager = this; _parent.tabChildren = true; _parent.tabEnabled = false; form = _parent; _parent.addEventListener("hide", this); _parent.addEventListener("reveal", this); mx.managers.SystemManager.init(); mx.managers.SystemManager.addFocusManager(form); tabCapture.tabIndex = 0; watch("enabled", enabledChanged); Selection.addListener(this); lastMouse = new Object(); _global.ASSetPropFlags(_parent, "focusManager", 1); _global.ASSetPropFlags(_parent, "tabChildren", 1); _global.ASSetPropFlags(_parent, "tabEnabled", 1); } function enabledChanged(id, oldValue, newValue) { _visible = newValue; return(newValue); } function activate(Void) { Key.addListener(this); activated = (_visible = true); if (lastFocus != undefined) { bNeedFocus = true; if (!mx.managers.SystemManager.isMouseDown) { doLater(this, "restoreFocus"); } } } function deactivate(Void) { Key.removeListener(this); activated = (_visible = false); var _local2 = getSelectionFocus(); var _local3 = getActualFocus(_local2); if (isOurFocus(_local3)) { lastSelFocus = _local2; lastFocus = _local3; } cancelAllDoLaters(); } function isOurFocus(o) { if (o.focusManager == this) { return(true); } while (o != undefined) { if (o.focusManager != undefined) { return(false); } if (o._parent == _parent) { return(true); } o = o._parent; } return(false); } function onSetFocus(o, n) { if (n == null) { if (activated) { bNeedFocus = true; } } else { var _local2 = getFocus(); if (isOurFocus(_local2)) { bNeedFocus = false; lastFocus = _local2; lastSelFocus = n; } } } function restoreFocus(Void) { var _local2 = lastSelFocus.hscroll; if (_local2 != undefined) { var _local5 = lastSelFocus.scroll; var _local4 = lastSelFocus.background; } lastFocus.setFocus(); var _local3 = Selection; Selection.setSelection(_local3.lastBeginIndex, _local3.lastEndIndex); if (_local2 != undefined) { lastSelFocus.scroll = _local5; lastSelFocus.hscroll = _local2; lastSelFocus.background = _local4; } } function onUnload(Void) { mx.managers.SystemManager.removeFocusManager(form); } function setFocus(o) { if (o == null) { Selection.setFocus(null); } else if (o.setFocus == undefined) { Selection.setFocus(o); } else { o.setFocus(); } } function getActualFocus(o) { var _local1 = o._parent; while (_local1 != undefined) { if (_local1.focusTextField != undefined) { while (_local1.focusTextField != undefined) { o = _local1; _local1 = _local1._parent; if (_local1 == undefined) { return(undefined); } if (_local1.focusTextField == undefined) { return(o); } } } if (_local1.tabEnabled != true) { return(o); } o = _local1; _local1 = o._parent; } return(undefined); } function getSelectionFocus() { var m = Selection.getFocus(); var o = eval (m); return(o); } function getFocus(Void) { var _local2 = getSelectionFocus(); return(getActualFocus(_local2)); } function walkTree(p, index, groupName, dir, lookup, firstChild) { var _local5 = true; var _local11; for (_local11 in p) { var _local2 = p[_local11]; if ((((_local2._parent == p) && (_local2.enabled != false)) && (_local2._visible != false)) && ((_local2.tabEnabled == true) || ((_local2.tabEnabled != false) && ((((((((_local2.onPress != undefined) || (_local2.onRelease != undefined)) || (_local2.onReleaseOutside != undefined)) || (_local2.onDragOut != undefined)) || (_local2.onDragOver != undefined)) || (_local2.onRollOver != undefined)) || (_local2.onRollOut != undefined)) || (_local2 instanceof TextField))))) { if (_local2._searchKey == _searchKey) { continue; } _local2._searchKey = _searchKey; if (_local2 != _lastTarget) { if (((_local2.groupName != undefined) || (groupName != undefined)) && (_local2.groupName == groupName)) { continue; } if ((_local2 instanceof TextField) && (_local2.selectable == false)) { continue; } if (_local5 || (((_local2.groupName != undefined) && (_local2.groupName == _firstNode.groupName)) && (_local2.selected == true))) { if (firstChild) { _firstNode = _local2; firstChild = false; } } if (_nextIsNext == true) { if ((((_local2.groupName != undefined) && (_local2.groupName == _nextNode.groupName)) && (_local2.selected == true)) || ((_nextNode == undefined) && ((_local2.groupName == undefined) || ((_local2.groupName != undefined) && (_local2.groupName != groupName))))) { _nextNode = _local2; } } if ((_local2.groupName == undefined) || (groupName != _local2.groupName)) { if (((_lastx.groupName != undefined) && (_local2.groupName == _lastx.groupName)) && (_lastx.selected == true)) { } else { _lastx = _local2; } } } else { _prevNode = _lastx; _needPrev = false; _nextIsNext = true; } if (_local2.tabIndex != undefined) { if (_local2.tabIndex == index) { if (_foundList[_local2._name] == undefined) { if (_needPrev) { _prevObj = _local2; _needPrev = false; } _nextObj = _local2; } } if (dir && (_local2.tabIndex > index)) { if (((_nextObj == undefined) || ((_nextObj.tabIndex > _local2.tabIndex) && (((_local2.groupName == undefined) || (_nextObj.groupName == undefined)) || (_local2.groupName != _nextObj.groupName)))) || ((((_nextObj.groupName != undefined) && (_nextObj.groupName == _local2.groupName)) && (_nextObj.selected != true)) && ((_local2.selected == true) || (_nextObj.tabIndex > _local2.tabIndex)))) { _nextObj = _local2; } } else if ((!dir) && (_local2.tabIndex < index)) { if (((_prevObj == undefined) || ((_prevObj.tabIndex < _local2.tabIndex) && (((_local2.groupName == undefined) || (_prevObj.groupName == undefined)) || (_local2.groupName != _prevObj.groupName)))) || ((((_prevObj.groupName != undefined) && (_prevObj.groupName == _local2.groupName)) && (_prevObj.selected != true)) && ((_local2.selected == true) || (_prevObj.tabIndex < _local2.tabIndex)))) { _prevObj = _local2; } } if (((_firstObj == undefined) || ((_local2.tabIndex < _firstObj.tabIndex) && (((_local2.groupName == undefined) || (_firstObj.groupName == undefined)) || (_local2.groupName != _firstObj.groupName)))) || ((((_firstObj.groupName != undefined) && (_firstObj.groupName == _local2.groupName)) && (_firstObj.selected != true)) && ((_local2.selected == true) || (_local2.tabIndex < _firstObj.tabIndex)))) { _firstObj = _local2; } if (((_lastObj == undefined) || ((_local2.tabIndex > _lastObj.tabIndex) && (((_local2.groupName == undefined) || (_lastObj.groupName == undefined)) || (_local2.groupName != _lastObj.groupName)))) || ((((_lastObj.groupName != undefined) && (_lastObj.groupName == _local2.groupName)) && (_lastObj.selected != true)) && ((_local2.selected == true) || (_local2.tabIndex > _lastObj.tabIndex)))) { _lastObj = _local2; } } if (_local2.tabChildren) { getTabCandidateFromChildren(_local2, index, groupName, dir, _local5 && (firstChild)); } _local5 = false; } else if (((_local2._parent == p) && (_local2.tabChildren == true)) && (_local2._visible != false)) { if (_local2 == _lastTarget) { if (_local2._searchKey == _searchKey) { continue; } _local2._searchKey = _searchKey; if (_prevNode == undefined) { var _local3 = _lastx; var _local7 = false; while (_local3 != undefined) { if (_local3 == _local2) { _local7 = true; break; } _local3 = _local3._parent; } if (_local7 == false) { _prevNode = _lastx; } } _needPrev = false; if (_nextNode == undefined) { _nextIsNext = true; } } else if (!((_local2.focusManager != undefined) && (_local2.focusManager._parent == _local2))) { if (_local2._searchKey == _searchKey) { continue; } _local2._searchKey = _searchKey; getTabCandidateFromChildren(_local2, index, groupName, dir, _local5 && (firstChild)); } _local5 = false; } } _lastNode = _lastx; if (lookup) { if (p._parent != undefined) { if (p != _parent) { if ((_prevNode == undefined) && (dir)) { _needPrev = true; } else if ((_nextNode == undefined) && (!dir)) { _nextIsNext = false; } _lastTarget = _lastTarget._parent; getTabCandidate(p._parent, index, groupName, dir, true); } } } } function getTabCandidate(o, index, groupName, dir, firstChild) { var _local2; var _local3 = true; if (o == _parent) { _local2 = o; _local3 = false; } else { _local2 = o._parent; if (_local2 == undefined) { _local2 = o; _local3 = false; } } walkTree(_local2, index, groupName, dir, _local3, firstChild); } function getTabCandidateFromChildren(o, index, groupName, dir, firstChild) { walkTree(o, index, groupName, dir, false, firstChild); } function getFocusManagerFromObject(o) { while (o != undefined) { if (o.focusManager != undefined) { return(o.focusManager); } o = o._parent; } return(undefined); } function tabHandler(Void) { bDrawFocus = true; var _local5 = getSelectionFocus(); var _local4 = getActualFocus(_local5); if (_local4 != _local5) { _local5 = _local4; } if (getFocusManagerFromObject(_local5) != this) { _local5 == undefined; } if (_local5 == undefined) { _local5 = form; } else if (_local5.tabIndex != undefined) { if ((_foundList != undefined) || (_foundList.tabIndex != _local5.tabIndex)) { _foundList = new Object(); _foundList.tabIndex = _local5.tabIndex; } _foundList[_local5._name] = _local5; } var _local3 = Key.isDown(16) != true; _searchKey = getTimer(); _needPrev = true; _nextIsNext = false; _lastx = undefined; _firstNode = undefined; _lastNode = undefined; _nextNode = undefined; _prevNode = undefined; _firstObj = undefined; _lastObj = undefined; _nextObj = undefined; _prevObj = undefined; _lastTarget = _local5; var _local6 = _local5; getTabCandidate(_local6, ((_local5.tabIndex == undefined) ? 0 : (_local5.tabIndex)), _local5.groupName, _local3, true); var _local2; if (_local3) { if (_nextObj != undefined) { _local2 = _nextObj; } else { _local2 = _firstObj; } } else if (_prevObj != undefined) { _local2 = _prevObj; } else { _local2 = _lastObj; } if (_local2.tabIndex != _local5.tabIndex) { _foundList = new Object(); _foundList.tabIndex = _local2.tabIndex; _foundList[_local2._name] = _local2; } else { if (_foundList == undefined) { _foundList = new Object(); _foundList.tabIndex = _local2.tabIndex; } _foundList[_local2._name] = _local2; } if (_local2 == undefined) { if (_local3 == false) { if (_nextNode != undefined) { _local2 = _nextNode; } else { _local2 = _firstNode; } } else if ((_prevNode == undefined) || (_local5 == form)) { _local2 = _lastNode; } else { _local2 = _prevNode; } } if (_local2 == undefined) { return(undefined); } lastTabFocus = _local2; setFocus(_local2); if (_local2.emphasized != undefined) { if (defPushButton != undefined) { _local5 = defPushButton; defPushButton = _local2; _local5.emphasized = false; _local2.emphasized = true; } } else if ((defPushButton != undefined) && (defPushButton != __defaultPushButton)) { _local5 = defPushButton; defPushButton = __defaultPushButton; _local5.emphasized = false; __defaultPushButton.__set__emphasized(true); } } function onKeyDown(Void) { mx.managers.SystemManager.idleFrames = 0; if (defaultPushButtonEnabled) { if (Key.getCode() == 13) { if (defaultPushButton != undefined) { doLater(this, "sendDefaultPushButtonEvent"); } } } } function sendDefaultPushButtonEvent(Void) { defPushButton.dispatchEvent({type:"click"}); } function getMousedComponentFromChildren(x, y, o) { for (var _local7 in o) { var _local2 = o[_local7]; if (((_local2._visible && (_local2.enabled)) && (_local2._parent == o)) && (_local2._searchKey != _searchKey)) { _local2._searchKey = _searchKey; if (_local2.hitTest(x, y, true)) { if ((_local2.onPress != undefined) || (_local2.onRelease != undefined)) { return(_local2); } var _local3 = getMousedComponentFromChildren(x, y, _local2); if (_local3 != undefined) { return(_local3); } return(_local2); } } } return(undefined); } function mouseActivate(Void) { if (!bNeedFocus) { return(undefined); } _searchKey = getTimer(); var _local2 = getMousedComponentFromChildren(lastMouse.x, lastMouse.y, form); if (_local2 instanceof mx.core.UIComponent) { return(undefined); } _local2 = findFocusFromObject(_local2); if (_local2 == lastFocus) { return(undefined); } if (_local2 == undefined) { doLater(this, "restoreFocus"); return(undefined); } var _local3 = _local2.hscroll; if (_local3 != undefined) { var _local6 = _local2.scroll; var _local5 = _local2.background; } setFocus(_local2); var _local4 = Selection; Selection.setSelection(_local4.lastBeginIndex, _local4.lastEndIndex); if (_local3 != undefined) { _local2.scroll = _local6; _local2.hscroll = _local3; _local2.background = _local5; } } function _onMouseDown(Void) { bDrawFocus = false; if (lastFocus != undefined) { lastFocus.drawFocus(false); } mx.managers.SystemManager.idleFrames = 0; var _local3 = Selection; _local3.lastBeginIndex = Selection.getBeginIndex(); _local3.lastEndIndex = Selection.getEndIndex(); lastMouse.x = _root._xmouse; lastMouse.y = _root._ymouse; _root.localToGlobal(lastMouse); } function onMouseUp(Void) { if (_visible) { doLater(this, "mouseActivate"); } } function handleEvent(e) { if (e.type == "reveal") { mx.managers.SystemManager.activate(form); } else { mx.managers.SystemManager.deactivate(form); } } static function enableFocusManagement() { if (!initialized) { initialized = true; Object.registerClass("FocusManager", mx.managers.FocusManager); if (_root.focusManager == undefined) { _root.createClassObject(mx.managers.FocusManager, "focusManager", mx.managers.DepthManager.highestDepth--); } } } static var symbolName = "FocusManager"; static var symbolOwner = mx.managers.FocusManager; static var version = "2.0.2.126"; var className = "FocusManager"; var bNeedFocus = false; var bDrawFocus = false; var defaultPushButtonEnabled = true; var activated = true; static var initialized = false; static var UIObjectExtensionsDependency = mx.core.ext.UIObjectExtensions; }
Symbol 149 MovieClip [__Packages.mx.skins.halo.FocusRect] Frame 0
class mx.skins.halo.FocusRect extends mx.skins.SkinElement { var boundingBox_mc, _xscale, _yscale, clear, beginFill, drawRoundRect, endFill, _visible; function FocusRect () { super(); boundingBox_mc._visible = false; boundingBox_mc._width = (boundingBox_mc._height = 0); } function draw(o) { o.adjustFocusRect(); } function setSize(w, h, r, a, rectCol) { _xscale = (_yscale = 100); clear(); if (typeof(r) == "object") { r.br = ((r.br > 2) ? (r.br - 2) : 0); r.bl = ((r.bl > 2) ? (r.bl - 2) : 0); r.tr = ((r.tr > 2) ? (r.tr - 2) : 0); r.tl = ((r.tl > 2) ? (r.tl - 2) : 0); beginFill(rectCol, a * 0.3); drawRoundRect(0, 0, w, h, r); drawRoundRect(2, 2, w - 4, h - 4, r); endFill(); r.br = ((r.br > 1) ? (r.br + 1) : 0); r.bl = ((r.bl > 1) ? (r.bl + 1) : 0); r.tr = ((r.tr > 1) ? (r.tr + 1) : 0); r.tl = ((r.tl > 1) ? (r.tl + 1) : 0); beginFill(rectCol, a * 0.3); drawRoundRect(1, 1, w - 2, h - 2, r); r.br = ((r.br > 1) ? (r.br - 1) : 0); r.bl = ((r.bl > 1) ? (r.bl - 1) : 0); r.tr = ((r.tr > 1) ? (r.tr - 1) : 0); r.tl = ((r.tl > 1) ? (r.tl - 1) : 0); drawRoundRect(2, 2, w - 4, h - 4, r); endFill(); } else { var _local5; if (r != 0) { _local5 = r - 2; } else { _local5 = 0; } beginFill(rectCol, a * 0.3); drawRoundRect(0, 0, w, h, r); drawRoundRect(2, 2, w - 4, h - 4, _local5); endFill(); beginFill(rectCol, a * 0.3); if (r != 0) { _local5 = r - 2; r = r - 1; } else { _local5 = 0; r = 0; } drawRoundRect(1, 1, w - 2, h - 2, r); drawRoundRect(2, 2, w - 4, h - 4, _local5); endFill(); } } function handleEvent(e) { if (e.type == "unload") { _visible = true; } else if (e.type == "resize") { e.target.adjustFocusRect(); } else if (e.type == "move") { e.target.adjustFocusRect(); } } static function classConstruct() { mx.core.UIComponent.prototype.drawFocus = function (focused) { var _local2 = this._parent.focus_mc; if (!focused) { _local2._visible = false; this.removeEventListener("unload", _local2); this.removeEventListener("move", _local2); this.removeEventListener("resize", _local2); } else { if (_local2 == undefined) { _local2 = this._parent.createChildAtDepth("FocusRect", mx.managers.DepthManager.kTop); _local2.tabEnabled = false; this._parent.focus_mc = _local2; } else { _local2._visible = true; } _local2.draw(this); if (_local2.getDepth() < this.getDepth()) { _local2.setDepthAbove(this); } this.addEventListener("unload", _local2); this.addEventListener("move", _local2); this.addEventListener("resize", _local2); } }; mx.core.UIComponent.prototype.adjustFocusRect = function () { var _local2 = this.getStyle("themeColor"); if (_local2 == undefined) { _local2 = 8453965 /* 0x80FF4D */; } var _local3 = this._parent.focus_mc; _local3.setSize(this.width + 4, this.height + 4, 0, 100, _local2); _local3.move(this.x - 2, this.y - 2); }; TextField.prototype.drawFocus = mx.core.UIComponent.prototype.drawFocus; TextField.prototype.adjustFocusRect = mx.core.UIComponent.prototype.adjustFocusRect; mx.skins.halo.FocusRect.prototype.drawRoundRect = mx.skins.halo.Defaults.prototype.drawRoundRect; return(true); } static var classConstructed = classConstruct(); static var DefaultsDependency = mx.skins.halo.Defaults; static var UIComponentDependency = mx.core.UIComponent; }
Symbol 150 MovieClip [__Packages.mx.managers.OverlappedWindows] Frame 0
class mx.managers.OverlappedWindows { function OverlappedWindows () { } static function checkIdle(Void) { if (mx.managers.SystemManager.idleFrames > 10) { mx.managers.SystemManager.dispatchEvent({type:"idle"}); } else { mx.managers.SystemManager.idleFrames++; } } static function __addEventListener(e, o, l) { if (e == "idle") { if (mx.managers.SystemManager.interval == undefined) { mx.managers.SystemManager.interval = setInterval(mx.managers.SystemManager.checkIdle, 100); } } mx.managers.SystemManager._xAddEventListener(e, o, l); } static function __removeEventListener(e, o, l) { if (e == "idle") { if (mx.managers.SystemManager._xRemoveEventListener(e, o, l) == 0) { clearInterval(mx.managers.SystemManager.interval); } } else { mx.managers.SystemManager._xRemoveEventListener(e, o, l); } } static function onMouseDown(Void) { mx.managers.SystemManager.idleFrames = 0; mx.managers.SystemManager.isMouseDown = true; var _local5 = _root; var _local3; var _local8 = _root._xmouse; var _local7 = _root._ymouse; if (mx.managers.SystemManager.form.modalWindow == undefined) { if (mx.managers.SystemManager.forms.length > 1) { var _local6 = mx.managers.SystemManager.forms.length; var _local4; _local4 = 0; while (_local4 < _local6) { var _local2 = mx.managers.SystemManager.forms[_local4]; if (_local2._visible) { if (_local2.hitTest(_local8, _local7)) { if (_local3 == undefined) { _local3 = _local2.getDepth(); _local5 = _local2; } else if (_local3 < _local2.getDepth()) { _local3 = _local2.getDepth(); _local5 = _local2; } } } _local4++; } if (_local5 != mx.managers.SystemManager.form) { mx.managers.SystemManager.activate(_local5); } } } var _local9 = mx.managers.SystemManager.form; _local9.focusManager._onMouseDown(); } static function onMouseMove(Void) { mx.managers.SystemManager.idleFrames = 0; } static function onMouseUp(Void) { mx.managers.SystemManager.isMouseDown = false; mx.managers.SystemManager.idleFrames = 0; } static function activate(f) { if (mx.managers.SystemManager.form != undefined) { if ((mx.managers.SystemManager.form != f) && (mx.managers.SystemManager.forms.length > 1)) { var _local1 = mx.managers.SystemManager.form; _local1.focusManager.deactivate(); } } mx.managers.SystemManager.form = f; f.focusManager.activate(); } static function deactivate(f) { if (mx.managers.SystemManager.form != undefined) { if ((mx.managers.SystemManager.form == f) && (mx.managers.SystemManager.forms.length > 1)) { var _local5 = mx.managers.SystemManager.form; _local5.focusManager.deactivate(); var _local3 = mx.managers.SystemManager.forms.length; var _local1; var _local2; _local1 = 0; while (_local1 < _local3) { if (mx.managers.SystemManager.forms[_local1] == f) { _local1 = _local1 + 1; while (_local1 < _local3) { if (mx.managers.SystemManager.forms[_local1]._visible == true) { _local2 = mx.managers.SystemManager.forms[_local1]; } _local1++; } mx.managers.SystemManager.form = _local2; break; } if (mx.managers.SystemManager.forms[_local1]._visible == true) { _local2 = mx.managers.SystemManager.forms[_local1]; } _local1++; } _local5 = mx.managers.SystemManager.form; _local5.focusManager.activate(); } } } static function addFocusManager(f) { mx.managers.SystemManager.forms.push(f); mx.managers.SystemManager.activate(f); } static function removeFocusManager(f) { var _local3 = mx.managers.SystemManager.forms.length; var _local1; _local1 = 0; while (_local1 < _local3) { if (mx.managers.SystemManager.forms[_local1] == f) { if (mx.managers.SystemManager.form == f) { mx.managers.SystemManager.deactivate(f); } mx.managers.SystemManager.forms.splice(_local1, 1); return(undefined); } _local1++; } } static function enableOverlappedWindows() { if (!initialized) { initialized = true; mx.managers.SystemManager.checkIdle = checkIdle; mx.managers.SystemManager.__addEventListener = __addEventListener; mx.managers.SystemManager.__removeEventListener = __removeEventListener; mx.managers.SystemManager.onMouseDown = onMouseDown; mx.managers.SystemManager.onMouseMove = onMouseMove; mx.managers.SystemManager.onMouseUp = onMouseUp; mx.managers.SystemManager.activate = activate; mx.managers.SystemManager.deactivate = deactivate; mx.managers.SystemManager.addFocusManager = addFocusManager; mx.managers.SystemManager.removeFocusManager = removeFocusManager; } } static var initialized = false; static var SystemManagerDependency = mx.managers.SystemManager; }
Symbol 151 MovieClip [__Packages.mx.styles.CSSSetStyle] Frame 0
class mx.styles.CSSSetStyle { var styleName, stylecache, _color, setColor, invalidateStyle; function CSSSetStyle () { } function _setStyle(styleProp, newValue) { this[styleProp] = newValue; if (mx.styles.StyleManager.TextStyleMap[styleProp] != undefined) { if (styleProp == "color") { if (isNaN(newValue)) { newValue = mx.styles.StyleManager.getColorName(newValue); this[styleProp] = newValue; if (newValue == undefined) { return(undefined); } } } _level0.changeTextStyleInChildren(styleProp); return(undefined); } if (mx.styles.StyleManager.isColorStyle(styleProp)) { if (isNaN(newValue)) { newValue = mx.styles.StyleManager.getColorName(newValue); this[styleProp] = newValue; if (newValue == undefined) { return(undefined); } } if (styleProp == "themeColor") { var _local7 = mx.styles.StyleManager.colorNames.haloBlue; var _local6 = mx.styles.StyleManager.colorNames.haloGreen; var _local8 = mx.styles.StyleManager.colorNames.haloOrange; var _local4 = {}; _local4[_local7] = 12188666 /* 0xB9FBFA */; _local4[_local6] = 13500353 /* 0xCDFFC1 */; _local4[_local8] = 16766319 /* 0xFFD56F */; var _local5 = {}; _local5[_local7] = 13958653 /* 0xD4FDFD */; _local5[_local6] = 14942166 /* 0xE3FFD6 */; _local5[_local8] = 16772787 /* 0xFFEEB3 */; var _local9 = _local4[newValue]; var _local10 = _local5[newValue]; if (_local9 == undefined) { _local9 = newValue; } if (_local10 == undefined) { _local10 = newValue; } setStyle("selectionColor", _local9); setStyle("rollOverColor", _local10); } _level0.changeColorStyleInChildren(styleName, styleProp, newValue); } else { if ((styleProp == "backgroundColor") && (isNaN(newValue))) { newValue = mx.styles.StyleManager.getColorName(newValue); this[styleProp] = newValue; if (newValue == undefined) { return(undefined); } } _level0.notifyStyleChangeInChildren(styleName, styleProp, newValue); } } function changeTextStyleInChildren(styleProp) { var _local4 = getTimer(); var _local5; for (_local5 in this) { var _local2 = this[_local5]; if (_local2._parent == this) { if (_local2.searchKey != _local4) { if (_local2.stylecache != undefined) { delete _local2.stylecache.tf; delete _local2.stylecache[styleProp]; } _local2.invalidateStyle(styleProp); _local2.changeTextStyleInChildren(styleProp); _local2.searchKey = _local4; } } } } function changeColorStyleInChildren(sheetName, colorStyle, newValue) { var _local6 = getTimer(); var _local7; for (_local7 in this) { var _local2 = this[_local7]; if (_local2._parent == this) { if (_local2.searchKey != _local6) { if (((_local2.getStyleName() == sheetName) || (sheetName == undefined)) || (sheetName == "_global")) { if (_local2.stylecache != undefined) { delete _local2.stylecache[colorStyle]; } if (typeof(_local2._color) == "string") { if (_local2._color == colorStyle) { var _local4 = _local2.getStyle(colorStyle); if (colorStyle == "color") { if (stylecache.tf.color != undefined) { stylecache.tf.color = _local4; } } _local2.setColor(_local4); } } else if (_local2._color[colorStyle] != undefined) { if (typeof(_local2) != "movieclip") { _local2._parent.invalidateStyle(); } else { _local2.invalidateStyle(colorStyle); } } } _local2.changeColorStyleInChildren(sheetName, colorStyle, newValue); _local2.searchKey = _local6; } } } } function notifyStyleChangeInChildren(sheetName, styleProp, newValue) { var _local5 = getTimer(); var _local6; for (_local6 in this) { var _local2 = this[_local6]; if (_local2._parent == this) { if (_local2.searchKey != _local5) { if (((_local2.styleName == sheetName) || ((_local2.styleName != undefined) && (typeof(_local2.styleName) == "movieclip"))) || (sheetName == undefined)) { if (_local2.stylecache != undefined) { delete _local2.stylecache[styleProp]; delete _local2.stylecache.tf; } delete _local2.enabledColor; _local2.invalidateStyle(styleProp); } _local2.notifyStyleChangeInChildren(sheetName, styleProp, newValue); _local2.searchKey = _local5; } } } } function setStyle(styleProp, newValue) { if (stylecache != undefined) { delete stylecache[styleProp]; delete stylecache.tf; } this[styleProp] = newValue; if (mx.styles.StyleManager.isColorStyle(styleProp)) { if (isNaN(newValue)) { newValue = mx.styles.StyleManager.getColorName(newValue); this[styleProp] = newValue; if (newValue == undefined) { return(undefined); } } if (styleProp == "themeColor") { var _local10 = mx.styles.StyleManager.colorNames.haloBlue; var _local9 = mx.styles.StyleManager.colorNames.haloGreen; var _local11 = mx.styles.StyleManager.colorNames.haloOrange; var _local6 = {}; _local6[_local10] = 12188666 /* 0xB9FBFA */; _local6[_local9] = 13500353 /* 0xCDFFC1 */; _local6[_local11] = 16766319 /* 0xFFD56F */; var _local7 = {}; _local7[_local10] = 13958653 /* 0xD4FDFD */; _local7[_local9] = 14942166 /* 0xE3FFD6 */; _local7[_local11] = 16772787 /* 0xFFEEB3 */; var _local12 = _local6[newValue]; var _local13 = _local7[newValue]; if (_local12 == undefined) { _local12 = newValue; } if (_local13 == undefined) { _local13 = newValue; } setStyle("selectionColor", _local12); setStyle("rollOverColor", _local13); } if (typeof(_color) == "string") { if (_color == styleProp) { if (styleProp == "color") { if (stylecache.tf.color != undefined) { stylecache.tf.color = newValue; } } setColor(newValue); } } else if (_color[styleProp] != undefined) { invalidateStyle(styleProp); } changeColorStyleInChildren(undefined, styleProp, newValue); } else { if ((styleProp == "backgroundColor") && (isNaN(newValue))) { newValue = mx.styles.StyleManager.getColorName(newValue); this[styleProp] = newValue; if (newValue == undefined) { return(undefined); } } invalidateStyle(styleProp); } if (mx.styles.StyleManager.isInheritingStyle(styleProp) || (styleProp == "styleName")) { var _local8; var _local5 = newValue; if (styleProp == "styleName") { _local8 = ((typeof(newValue) == "string") ? (_global.styles[newValue]) : (_local5)); _local5 = _local8.themeColor; if (_local5 != undefined) { _local8.rollOverColor = (_local8.selectionColor = _local5); } } notifyStyleChangeInChildren(undefined, styleProp, newValue); } } static function enableRunTimeCSS() { } static function classConstruct() { var _local2 = MovieClip.prototype; var _local3 = mx.styles.CSSSetStyle.prototype; mx.styles.CSSStyleDeclaration.prototype.setStyle = _local3._setStyle; _local2.changeTextStyleInChildren = _local3.changeTextStyleInChildren; _local2.changeColorStyleInChildren = _local3.changeColorStyleInChildren; _local2.notifyStyleChangeInChildren = _local3.notifyStyleChangeInChildren; _local2.setStyle = _local3.setStyle; _global.ASSetPropFlags(_local2, "changeTextStyleInChildren", 1); _global.ASSetPropFlags(_local2, "changeColorStyleInChildren", 1); _global.ASSetPropFlags(_local2, "notifyStyleChangeInChildren", 1); _global.ASSetPropFlags(_local2, "setStyle", 1); var _local4 = TextField.prototype; _local4.setStyle = _local2.setStyle; _local4.changeTextStyleInChildren = _local3.changeTextStyleInChildren; return(true); } static var classConstructed = classConstruct(); static var CSSStyleDeclarationDependency = mx.styles.CSSStyleDeclaration; }
Symbol 152 MovieClip [__Packages.mx.core.ext.UIComponentExtensions] Frame 0
class mx.core.ext.UIComponentExtensions { function UIComponentExtensions () { } static function Extensions() { if (bExtended == true) { return(true); } bExtended = true; TextField.prototype.setFocus = function () { Selection.setFocus(this); }; TextField.prototype.onSetFocus = function (oldFocus) { if (this.tabEnabled != false) { if (this.getFocusManager().bDrawFocus) { this.drawFocus(true); } } }; TextField.prototype.onKillFocus = function (oldFocus) { if (this.tabEnabled != false) { this.drawFocus(false); } }; TextField.prototype.drawFocus = mx.core.UIComponent.prototype.drawFocus; TextField.prototype.getFocusManager = mx.core.UIComponent.prototype.getFocusManager; mx.managers.OverlappedWindows.enableOverlappedWindows(); mx.styles.CSSSetStyle.enableRunTimeCSS(); mx.managers.FocusManager.enableFocusManagement(); } static var bExtended = false; static var UIComponentExtended = Extensions(); static var UIComponentDependency = mx.core.UIComponent; static var FocusManagerDependency = mx.managers.FocusManager; static var OverlappedWindowsDependency = mx.managers.OverlappedWindows; }
Symbol 153 MovieClip [__Packages.mx.controls.HScrollBar] Frame 0
class mx.controls.HScrollBar extends mx.controls.scrollClasses.ScrollBar { var _minHeight, _minWidth, _xscale, _rotation, __width, scrollIt; function HScrollBar () { super(); } function getMinWidth(Void) { return(_minHeight); } function getMinHeight(Void) { return(_minWidth); } function init(Void) { super.init(); _xscale = -100; _rotation = -90; } function get virtualHeight() { return(__width); } function isScrollBarKey(k) { if (k == 37) { scrollIt("Line", -1); return(true); } if (k == 39) { scrollIt("Line", 1); return(true); } return(super.isScrollBarKey(k)); } static var symbolName = "HScrollBar"; static var symbolOwner = mx.core.UIComponent; static var version = "2.0.2.126"; var className = "HScrollBar"; var minusMode = "Left"; var plusMode = "Right"; var minMode = "AtLeft"; var maxMode = "AtRight"; }
Symbol 154 MovieClip [__Packages.mx.controls.Button] Frame 0
class mx.controls.Button extends mx.controls.SimpleButton { var initializing, labelPath, initIcon, getState, enabled, phase, idNames, __width, __height, setState, invalidate, iconName, refresh, createLabel, _iconLinkageName, removeIcons, hitArea_mc, createEmptyObject; function Button () { super(); } function init(Void) { super.init(); } function draw() { if (initializing) { labelPath.visible = true; } super.draw(); if (initIcon != undefined) { _setIcon(initIcon); } delete initIcon; } function onRelease(Void) { super.onRelease(); } function createChildren(Void) { super.createChildren(); } function setSkin(tag, linkageName, initobj) { return(super.setSkin(tag, linkageName, initobj)); } function viewSkin(varName) { var _local3 = (getState() ? "true" : "false"); _local3 = _local3 + (enabled ? (phase) : "disabled"); super.viewSkin(varName, {styleName:this, borderStyle:_local3}); } function invalidateStyle(c) { labelPath.invalidateStyle(c); super.invalidateStyle(c); } function setColor(c) { var _local2 = 0; while (_local2 < 8) { this[idNames[_local2]].redraw(true); _local2++; } } function setEnabled(enable) { labelPath.enabled = enable; super.setEnabled(enable); } function calcSize(tag, ref) { if ((__width == undefined) || (__height == undefined)) { return(undefined); } if (tag < 7) { ref.setSize(__width, __height, true); } } function size(Void) { setState(getState()); setHitArea(__width, __height); var _local3 = 0; while (_local3 < 8) { var _local4 = idNames[_local3]; if (typeof(this[_local4]) == "movieclip") { this[_local4].setSize(__width, __height, true); } _local3++; } super.size(); } function set labelPlacement(val) { __labelPlacement = val; invalidate(); //return(labelPlacement); } function get labelPlacement() { return(__labelPlacement); } function getLabelPlacement(Void) { return(__labelPlacement); } function setLabelPlacement(val) { __labelPlacement = val; invalidate(); } function getBtnOffset(Void) { if (getState()) { var _local2 = btnOffset; } else if (phase == "down") { var _local2 = btnOffset; } else { var _local2 = 0; } return(_local2); } function setView(offset) { var _local16 = (offset ? (btnOffset) : 0); var _local12 = getLabelPlacement(); var _local7 = 0; var _local6 = 0; var _local9 = 0; var _local8 = 0; var _local5 = 0; var _local4 = 0; var _local3 = labelPath; var _local2 = iconName; var _local15 = _local3.textWidth; var _local14 = _local3.textHeight; var _local10 = (__width - borderW) - borderW; var _local11 = (__height - borderW) - borderW; if (_local2 != undefined) { _local7 = _local2._width; _local6 = _local2._height; } if ((_local12 == "left") || (_local12 == "right")) { if (_local3 != undefined) { _local9 = Math.min(_local10 - _local7, _local15 + 5); _local3._width = _local9; _local8 = Math.min(_local11, _local14 + 5); _local3._height = _local8; } if (_local12 == "right") { _local5 = _local7; if (centerContent) { _local5 = _local5 + (((_local10 - _local9) - _local7) / 2); } _local2._x = _local5 - _local7; } else { _local5 = (_local10 - _local9) - _local7; if (centerContent) { _local5 = _local5 / 2; } _local2._x = _local5 + _local9; } _local4 = 0; _local2._y = _local4; if (centerContent) { _local2._y = (_local11 - _local6) / 2; _local4 = (_local11 - _local8) / 2; } if (!centerContent) { _local2._y = _local2._y + Math.max(0, (_local8 - _local6) / 2); } } else { if (_local3 != undefined) { _local9 = Math.min(_local10, _local15 + 5); _local3._width = _local9; _local8 = Math.min(_local11 - _local6, _local14 + 5); _local3._height = _local8; } _local5 = (_local10 - _local9) / 2; _local2._x = (_local10 - _local7) / 2; if (_local12 == "top") { _local4 = (_local11 - _local8) - _local6; if (centerContent) { _local4 = _local4 / 2; } _local2._y = _local4 + _local8; } else { _local4 = _local6; if (centerContent) { _local4 = _local4 + (((_local11 - _local8) - _local6) / 2); } _local2._y = _local4 - _local6; } } var _local13 = borderW + _local16; _local3._x = _local5 + _local13; _local3._y = _local4 + _local13; _local2._x = _local2._x + _local13; _local2._y = _local2._y + _local13; } function set label(lbl) { setLabel(lbl); //return(label); } function setLabel(label) { if (label == "") { labelPath.removeTextField(); refresh(); return(undefined); } if (labelPath == undefined) { var _local2 = createLabel("labelPath", 200, label); _local2._width = _local2.textWidth + 5; _local2._height = _local2.textHeight + 5; if (initializing) { _local2.visible = false; } } else { delete labelPath.__text; labelPath.text = label; refresh(); } } function getLabel(Void) { return(((labelPath.__text != undefined) ? (labelPath.__text) : (labelPath.text))); } function get label() { return(getLabel()); } function _getIcon(Void) { return(_iconLinkageName); } function get icon() { if (initializing) { return(initIcon); } return(_iconLinkageName); } function _setIcon(linkage) { if (initializing) { if (linkage == "") { return(undefined); } initIcon = linkage; } else { if (linkage == "") { removeIcons(); return(undefined); } super.changeIcon(0, linkage); super.changeIcon(1, linkage); super.changeIcon(3, linkage); super.changeIcon(4, linkage); super.changeIcon(5, linkage); _iconLinkageName = linkage; refresh(); } } function set icon(linkage) { _setIcon(linkage); //return(icon); } function setHitArea(w, h) { if (hitArea_mc == undefined) { createEmptyObject("hitArea_mc", 100); } var _local2 = hitArea_mc; _local2.clear(); _local2.beginFill(16711680); _local2.drawRect(0, 0, w, h); _local2.endFill(); _local2.setVisible(false); } static var symbolName = "Button"; static var symbolOwner = mx.controls.Button; var className = "Button"; static var version = "2.0.2.126"; var btnOffset = 0; var _color = "buttonColor"; var __label = "default value"; var __labelPlacement = "right"; var falseUpSkin = "ButtonSkin"; var falseDownSkin = "ButtonSkin"; var falseOverSkin = "ButtonSkin"; var falseDisabledSkin = "ButtonSkin"; var trueUpSkin = "ButtonSkin"; var trueDownSkin = "ButtonSkin"; var trueOverSkin = "ButtonSkin"; var trueDisabledSkin = "ButtonSkin"; var falseUpIcon = ""; var falseDownIcon = ""; var falseOverIcon = ""; var falseDisabledIcon = ""; var trueUpIcon = ""; var trueDownIcon = ""; var trueOverIcon = ""; var trueDisabledIcon = ""; var clipParameters = {labelPlacement:1, icon:1, toggle:1, selected:1, label:1}; static var mergedClipParameters = mx.core.UIObject.mergeClipParameters(mx.controls.Button.prototype.clipParameters, mx.controls.SimpleButton.prototype.clipParameters); var centerContent = true; var borderW = 1; }
Symbol 155 MovieClip [__Packages.mx.skins.halo.RectBorder] Frame 0
class mx.skins.halo.RectBorder extends mx.skins.RectBorder { var offset, getStyle, borderStyleName, __borderMetrics, className, borderColorName, backgroundColorName, shadowColorName, highlightColorName, buttonColorName, __get__width, __get__height, clear, _color, drawRoundRect, beginFill, drawRect, endFill; function RectBorder () { super(); } function init(Void) { borderWidths.default = 3; super.init(); } function getBorderMetrics(Void) { if (offset == undefined) { var _local3 = getStyle(borderStyleName); offset = borderWidths[_local3]; } if ((getStyle(borderStyleName) == "default") || (getStyle(borderStyleName) == "alert")) { __borderMetrics = {left:3, top:1, right:3, bottom:3}; return(__borderMetrics); } return(super.getBorderMetrics()); } function drawBorder(Void) { var _local6 = _global.styles[className]; if (_local6 == undefined) { _local6 = _global.styles.RectBorder; } var _local5 = getStyle(borderStyleName); var _local7 = getStyle(borderColorName); if (_local7 == undefined) { _local7 = _local6[borderColorName]; } var _local8 = getStyle(backgroundColorName); if (_local8 == undefined) { _local8 = _local6[backgroundColorName]; } var _local16 = getStyle("backgroundImage"); if (_local5 != "none") { var _local14 = getStyle(shadowColorName); if (_local14 == undefined) { _local14 = _local6[shadowColorName]; } var _local13 = getStyle(highlightColorName); if (_local13 == undefined) { _local13 = _local6[highlightColorName]; } var _local12 = getStyle(buttonColorName); if (_local12 == undefined) { _local12 = _local6[buttonColorName]; } var _local11 = getStyle(borderCapColorName); if (_local11 == undefined) { _local11 = _local6[borderCapColorName]; } var _local10 = getStyle(shadowCapColorName); if (_local10 == undefined) { _local10 = _local6[shadowCapColorName]; } } offset = borderWidths[_local5]; var _local9 = offset; var _local3 = __get__width(); var _local4 = __get__height(); clear(); _color = undefined; if (_local5 == "none") { } else if (_local5 == "inset") { _color = colorList; draw3dBorder(_local11, _local12, _local7, _local13, _local14, _local10); } else if (_local5 == "outset") { _color = colorList; draw3dBorder(_local11, _local7, _local12, _local14, _local13, _local10); } else if (_local5 == "alert") { var _local15 = getStyle("themeColor"); drawRoundRect(0, 5, _local3, _local4 - 5, 5, 6184542, 10); drawRoundRect(1, 4, _local3 - 2, _local4 - 5, 4, [6184542, 6184542], 10, 0, "radial"); drawRoundRect(2, 0, _local3 - 4, _local4 - 2, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(2, 0, _local3 - 4, _local4 - 2, 3, _local15, 50); drawRoundRect(3, 1, _local3 - 6, _local4 - 4, 2, 16777215, 100); } else if (_local5 == "default") { drawRoundRect(0, 5, _local3, _local4 - 5, {tl:5, tr:5, br:0, bl:0}, 6184542, 10); drawRoundRect(1, 4, _local3 - 2, _local4 - 5, {tl:4, tr:4, br:0, bl:0}, [6184542, 6184542], 10, 0, "radial"); drawRoundRect(2, 0, _local3 - 4, _local4 - 2, {tl:3, tr:3, br:0, bl:0}, [12897484, 11844796], 100, 0, "radial"); drawRoundRect(3, 1, _local3 - 6, _local4 - 4, {tl:2, tr:2, br:0, bl:0}, 16777215, 100); } else if (_local5 == "dropDown") { drawRoundRect(0, 0, _local3 + 1, _local4, {tl:4, tr:0, br:0, bl:4}, [13290186, 7895160], 100, -10, "linear"); drawRoundRect(1, 1, _local3 - 1, _local4 - 2, {tl:3, tr:0, br:0, bl:3}, 16777215, 100); } else if (_local5 == "menuBorder") { var _local15 = getStyle("themeColor"); drawRoundRect(4, 4, _local3 - 2, _local4 - 3, 0, [6184542, 6184542], 10, 0, "radial"); drawRoundRect(4, 4, _local3 - 1, _local4 - 2, 0, 6184542, 10); drawRoundRect(0, 0, _local3 + 1, _local4, 0, [0, 14342874], 100, 250, "linear"); drawRoundRect(0, 0, _local3 + 1, _local4, 0, _local15, 50); drawRoundRect(2, 2, _local3 - 3, _local4 - 4, 0, 16777215, 100); } else if (_local5 == "comboNonEdit") { } else { beginFill(_local7); drawRect(0, 0, _local3, _local4); drawRect(1, 1, _local3 - 1, _local4 - 1); endFill(); _color = borderColorName; } if (_local8 != undefined) { beginFill(_local8); drawRect(_local9, _local9, __get__width() - _local9, __get__height() - _local9); endFill(); } } function draw3dBorder(c1, c2, c3, c4, c5, c6) { var _local3 = __get__width(); var _local2 = __get__height(); beginFill(c1); drawRect(0, 0, _local3, _local2); drawRect(1, 0, _local3 - 1, _local2); endFill(); beginFill(c2); drawRect(1, 0, _local3 - 1, 1); endFill(); beginFill(c3); drawRect(1, _local2 - 1, _local3 - 1, _local2); endFill(); beginFill(c4); drawRect(1, 1, _local3 - 1, 2); endFill(); beginFill(c5); drawRect(1, _local2 - 2, _local3 - 1, _local2 - 1); endFill(); beginFill(c6); drawRect(1, 2, _local3 - 1, _local2 - 2); drawRect(2, 2, _local3 - 2, _local2 - 2); endFill(); } static function classConstruct() { mx.core.ext.UIObjectExtensions.Extensions(); _global.styles.rectBorderClass = mx.skins.halo.RectBorder; _global.skinRegistry.RectBorder = true; return(true); } static var symbolName = "RectBorder"; static var symbolOwner = mx.skins.halo.RectBorder; static var version = "2.0.2.126"; var borderCapColorName = "borderCapColor"; var shadowCapColorName = "shadowCapColor"; var colorList = {highlightColor:0, borderColor:0, buttonColor:0, shadowColor:0, borderCapColor:0, shadowCapColor:0}; var borderWidths = {none:0, solid:1, inset:2, outset:2, alert:3, dropDown:2, menuBorder:2, comboNonEdit:2}; static var classConstructed = classConstruct(); static var UIObjectExtensionsDependency = mx.core.ext.UIObjectExtensions; }
Symbol 156 MovieClip [__Packages.mx.skins.halo.ButtonSkin] Frame 0
class mx.skins.halo.ButtonSkin extends mx.skins.RectBorder { var __get__width, __get__height, getStyle, _parent, clear, drawRoundRect, __get__x, __get__y; function ButtonSkin () { super(); } function init() { super.init(); } function size() { drawHaloRect(__get__width(), __get__height()); } function drawHaloRect(w, h) { var _local6 = getStyle("borderStyle"); var _local4 = getStyle("themeColor"); var _local5 = _parent.emphasized; clear(); switch (_local6) { case "falseup" : if (_local5) { drawRoundRect(__get__x(), __get__y(), w, h, 5, 9542041, 100); drawRoundRect(__get__x(), __get__y(), w, h, 5, _local4, 75); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, [3355443, 16777215], 85, 0, "radial"); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, _local4, 75); drawRoundRect(__get__x() + 3, __get__y() + 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(__get__x() + 3, __get__y() + 4, w - 6, h - 7, 2, 16316664, 100); } else { drawRoundRect(0, 0, w, h, 5, 9542041, 100); drawRoundRect(1, 1, w - 2, h - 2, 4, [13291985, 16250871], 100, 0, "radial"); drawRoundRect(2, 2, w - 4, h - 4, 3, [9542041, 13818586], 100, 0, "radial"); drawRoundRect(3, 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(3, 4, w - 6, h - 7, 2, 16316664, 100); } break; case "falsedown" : drawRoundRect(__get__x(), __get__y(), w, h, 5, 9542041, 100); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, [3355443, 16579836], 100, 0, "radial"); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, _local4, 50); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(__get__x(), __get__y(), w, h, 5, _local4, 40); drawRoundRect(__get__x() + 3, __get__y() + 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(__get__x() + 3, __get__y() + 4, w - 6, h - 7, 2, _local4, 20); break; case "falserollover" : drawRoundRect(__get__x(), __get__y(), w, h, 5, 9542041, 100); drawRoundRect(__get__x(), __get__y(), w, h, 5, _local4, 50); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, [3355443, 16777215], 100, 0, "radial"); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, _local4, 50); drawRoundRect(__get__x() + 3, __get__y() + 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(__get__x() + 3, __get__y() + 4, w - 6, h - 7, 2, 16316664, 100); break; case "falsedisabled" : drawRoundRect(0, 0, w, h, 5, 13159628, 100); drawRoundRect(1, 1, w - 2, h - 2, 4, 15921906, 100); drawRoundRect(2, 2, w - 4, h - 4, 3, 13949401, 100); drawRoundRect(3, 3, w - 6, h - 6, 2, 15921906, 100); break; case "trueup" : drawRoundRect(__get__x(), __get__y(), w, h, 5, 10066329, 100); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, [3355443, 16579836], 100, 0, "radial"); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, _local4, 50); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(__get__x(), __get__y(), w, h, 5, _local4, 40); drawRoundRect(__get__x() + 3, __get__y() + 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(__get__x() + 3, __get__y() + 4, w - 6, h - 7, 2, 16250871, 100); break; case "truedown" : drawRoundRect(__get__x(), __get__y(), w, h, 5, 10066329, 100); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, [3355443, 16579836], 100, 0, "radial"); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, _local4, 50); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(__get__x(), __get__y(), w, h, 5, _local4, 40); drawRoundRect(__get__x() + 3, __get__y() + 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(__get__x() + 3, __get__y() + 4, w - 6, h - 7, 2, _local4, 20); break; case "truerollover" : drawRoundRect(__get__x(), __get__y(), w, h, 5, 9542041, 100); drawRoundRect(__get__x(), __get__y(), w, h, 5, _local4, 50); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, [3355443, 16777215], 100, 0, "radial"); drawRoundRect(__get__x() + 1, __get__y() + 1, w - 2, h - 2, 4, _local4, 40); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, [0, 14342874], 100, 0, "radial"); drawRoundRect(__get__x() + 2, __get__y() + 2, w - 4, h - 4, 3, _local4, 40); drawRoundRect(__get__x() + 3, __get__y() + 3, w - 6, h - 6, 2, 16777215, 100); drawRoundRect(__get__x() + 3, __get__y() + 4, w - 6, h - 7, 2, 16316664, 100); break; case "truedisabled" : drawRoundRect(0, 0, w, h, 5, 13159628, 100); drawRoundRect(1, 1, w - 2, h - 2, 4, 15921906, 100); drawRoundRect(2, 2, w - 4, h - 4, 3, 13949401, 100); drawRoundRect(3, 3, w - 6, h - 6, 2, 15921906, 100); } } static function classConstruct() { mx.core.ext.UIObjectExtensions.Extensions(); _global.skinRegistry.ButtonSkin = true; return(true); } static var symbolName = "ButtonSkin"; static var symbolOwner = mx.skins.halo.ButtonSkin; var className = "ButtonSkin"; var backgroundColorName = "buttonColor"; static var classConstructed = classConstruct(); static var UIObjectExtensionsDependency = mx.core.ext.UIObjectExtensions; }
Symbol 157 MovieClip [__Packages.mx.controls.VScrollBar] Frame 0
class mx.controls.VScrollBar extends mx.controls.scrollClasses.ScrollBar { var scrollIt; function VScrollBar () { super(); } function init(Void) { super.init(); } function isScrollBarKey(k) { if (k == 38) { scrollIt("Line", -1); return(true); } if (k == 40) { scrollIt("Line", 1); return(true); } if (k == 33) { scrollIt("Page", -1); return(true); } if (k == 34) { scrollIt("Page", 1); return(true); } return(super.isScrollBarKey(k)); } static var symbolName = "VScrollBar"; static var symbolOwner = mx.core.UIComponent; static var version = "2.0.2.126"; var className = "VScrollBar"; var minusMode = "Up"; var plusMode = "Down"; var minMode = "AtTop"; var maxMode = "AtBottom"; }
Symbol 172 MovieClip Frame 1
enter = function () { _parent.song1.exit(); _parent.song4.exit(); _parent.song3.exit(); s.setVolume(0); s.stop(); playing = true; gotoAndPlay ("enter"); }; turnOn = function () { gotoAndPlay ("on"); }; exit = function () { playing = false; gotoAndPlay ("exit"); }; s = new Sound(this); stop(); playing = false;
Symbol 172 MovieClip Frame 2
playing = true;
Symbol 172 MovieClip Frame 3
if (s.getVolume() < 20) { s.setVolume(20); }
Symbol 172 MovieClip Frame 4
if (s.getVolume() < 40) { s.setVolume(40); }
Symbol 172 MovieClip Frame 5
if (s.getVolume() < 60) { s.setVolume(60); }
Symbol 172 MovieClip Frame 6
if (s.getVolume() < 80) { s.setVolume(80); }
Symbol 172 MovieClip Frame 7
if (s.getVolume() < 100) { s.setVolume(100); }
Symbol 172 MovieClip Frame 8
stop();
Symbol 172 MovieClip Frame 9
playing = false; stop();
Symbol 172 MovieClip Frame 17
if (s.getVolume() > 80) { s.setVolume(80); } trace("fading out");
Symbol 172 MovieClip Frame 18
if (s.getVolume() > 60) { s.setVolume(60); }
Symbol 172 MovieClip Frame 19
if (s.getVolume() > 40) { s.setVolume(40); }
Symbol 172 MovieClip Frame 20
if (s.getVolume() > 20) { s.setVolume(20); }
Symbol 172 MovieClip Frame 21
if (s.getVolume() > 0) { s.setVolume(0); }
Symbol 172 MovieClip Frame 22
stop();
Symbol 175 MovieClip Frame 1
function start() { gotoAndPlay (2); } stop();
Symbol 177 MovieClip Frame 1
enter = function () { _parent.song1.exit(); _parent.song4.exit(); _parent.song3.exit(); s.setVolume(0); s.stop(); playing = true; gotoAndPlay ("enter"); }; turnOn = function () { gotoAndPlay ("on"); }; exit = function () { playing = false; gotoAndPlay ("exit"); }; s = new Sound(this); stop(); playing = false;
Symbol 177 MovieClip Frame 2
playing = true;
Symbol 177 MovieClip Frame 3
if (s.getVolume() < 20) { s.setVolume(20); }
Symbol 177 MovieClip Frame 4
if (s.getVolume() < 40) { s.setVolume(40); }
Symbol 177 MovieClip Frame 5
if (s.getVolume() < 60) { s.setVolume(60); }
Symbol 177 MovieClip Frame 6
if (s.getVolume() < 80) { s.setVolume(80); }
Symbol 177 MovieClip Frame 7
if (s.getVolume() < 100) { s.setVolume(100); }
Symbol 177 MovieClip Frame 8
stop();
Symbol 177 MovieClip Frame 9
playing = false; stop();
Symbol 177 MovieClip Frame 17
if (s.getVolume() > 80) { s.setVolume(80); } trace("fading out");
Symbol 177 MovieClip Frame 18
if (s.getVolume() > 60) { s.setVolume(60); }
Symbol 177 MovieClip Frame 19
if (s.getVolume() > 40) { s.setVolume(40); }
Symbol 177 MovieClip Frame 20
if (s.getVolume() > 20) { s.setVolume(20); }
Symbol 177 MovieClip Frame 21
if (s.getVolume() > 0) { s.setVolume(0); }
Symbol 177 MovieClip Frame 22
stop();
Symbol 179 MovieClip Frame 1
function start() { gotoAndPlay (2); } stop();
Symbol 180 MovieClip Frame 1
function start() { gotoAndPlay (2); } stop();
Symbol 182 MovieClip Frame 1
function start() { gotoAndPlay (2); } stop();
Symbol 188 MovieClip Frame 1
start = function (vol) { trace("crashing"); var _local1 = Math.min(80, vol); s.setVolume(_local1); gotoAndStop("step" + step); step++; if (step >= steps) { step = 0; } }; s = new Sound(this); s.setVolume(50); step = 0; steps = 3; stop();
Symbol 188 MovieClip Frame 13
stop();
Symbol 188 MovieClip Frame 23
stop();
Symbol 188 MovieClip Frame 34
stop();
Symbol 190 MovieClip Frame 1
function start() { gotoAndPlay (2); } stop();
Symbol 192 MovieClip Frame 1
function start() { trace("doing victory"); gotoAndPlay (2); } stop();
Symbol 195 MovieClip Frame 1
function start() { gotoAndPlay (2); } stop();
Symbol 197 MovieClip Frame 1
start = function (vol) { trace("accelling to " + _parent._parent.choice); gotoAndPlay("step" + _parent._parent.choice); }; stop();
Symbol 197 MovieClip Frame 13
stop();
Symbol 197 MovieClip Frame 23
stop();
Symbol 197 MovieClip Frame 34
stop();
Symbol 201 MovieClip Frame 1
stop();
Symbol 203 Button
on (release) { if (goals[0] == 100) { goals[0] = 0; } else { goals[0] = 100; } }
Symbol 204 MovieClip Frame 1
instance = new Array(); names = ["this", "collide", "music", "buzzer"]; goals = [100, 100, 100, 100, 100, 0]; volumes = [100, 100, 100, 100, 100, 0]; adjustments = [5, 5, 4, 5, 10, 10]; i = 0; while (i < names.length) { instance[i] = new Sound(eval (names[i])); instance[i].setVolume(volumes[i]); i++; } onEnterFrame = function () { i = 0; while (i < names.length) { if (goals[i] < volumes[i]) { volumes[i] = volumes[i] - adjustments[i]; } else if (goals[i] > volumes[i]) { volumes[i] = volumes[i] + adjustments[i]; } if (Math.abs(goals[i] - volumes[i]) < adjustments[i]) { volumes[i] - goals[i]; } instance[i].setVolume(volumes[i]); i++; } frame = int(volumes[0] / 10) + 1; speaker.gotoAndStop(frame); };
Symbol 238 MovieClip Frame 10
stop();
Symbol 238 MovieClip Frame 11
play(); _parent.sounds_mc.navbutton_snd.playSound();
Symbol 238 MovieClip Frame 17
stop();
Symbol 238 MovieClip Frame 18
play();
Symbol 238 MovieClip Frame 24
stop();
Symbol 243 Button
on (press) { _parent.sounds.press.start(); _parent.fade("send"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 246 Button
on (press) { _parent.sounds.press.start(); _parent.fade("send"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 252 Button
on (press) { _parent.sounds.press.start(); _parent.fade("instructions"); } on (rollOver) { redBall.gotoAndPlay("over"); _parent.sounds.roll.start(); } on (rollOut, releaseOutside) { redBall.gotoAndPlay("off"); }
Symbol 253 Button
on (press) { _root.score = 0; _root.boost = 0; _root.cheatModeOn = true; flash.external.ExternalInterface.call("MATTEL.tracker.Tracker.track", {name:"Web Trading Cars Chase", campaign:"Agame", channel:"Games", contenttype:"Game", action:"Play"}); _parent.fade("choose"); }
Symbol 254 Button
on (press) { flash.external.ExternalInterface.call("MATTEL.tracker.Tracker.track", {name:"Web Trading Cars Chase", campaign:"Agame", channel:"Games", contenttype:"Game", action:"Play"}); _parent.sounds.press.start(); _parent.fade("inter"); } on (rollOver) { redBall.gotoAndPlay("over"); _parent.sounds.roll.start(); } on (rollOut, releaseOutside) { redBall.gotoAndPlay("off"); }
Symbol 255 MovieClip Frame 1
moregames_btn.onRelease = function () { flash.external.ExternalInterface.call("MATTEL.tracker.Tracker.track", {name:"Agame More Games", campaign:"Agame", channel:"Games", contenttype:"InternalAdButton", action:"Click"}); getURL ("http://www.hotwheels.com", "_blank"); }; gfx.vroom.start();
Instance of Symbol 210 MovieClip "agame_btn" in Symbol 255 MovieClip Frame 1
on (release) { getURL ("http://moregames.agame.com", "_blank"); }
Symbol 255 MovieClip Frame 19
gfx.idle.enter();
Symbol 255 MovieClip Frame 46
stop();
Symbol 270 Button
on (press) { _parent.sounds.press.start(); _parent.fade("video"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 280 MovieClip Frame 1
gfx.idle.enter();
Symbol 285 Button
on (press) { _parent.controlMode = 0; _parent.fade("choose"); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); } on (rollOver) { redBall.gotoAndPlay("over"); _parent.sounds.roll.start(); } on (rollOut, releaseOutside) { redBall.gotoAndPlay("off"); }
Symbol 312 Button
on (press) { trace("should be calling that function!"); _parent.select(_currentframe - 1); } on (press) { _parent._parent.sounds.press.start(); } on (rollOver) { _parent._parent.sounds.roll.start(); }
Symbol 315 Button
on (press) { if (!_parent.printing) { _parent.sounds.press.start(); _parent.currentSelection = _currentframe; _parent.printProfile(_currentframe - 1); } } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 319 Button
on (press) { trace("should be calling that function!"); _parent.select(_currentframe - 1); } on (press) { _parent._parent.sounds.press.start(); } on (rollOver) { _parent._parent.sounds.roll.start(); }
Symbol 332 MovieClip Frame 1
stop();
Symbol 334 MovieClip Frame 1
_visible = false;
Symbol 342 Button
on (release) { moveLeft(); }
Symbol 345 Button
on (release) { moveRight(); }
Symbol 355 MovieClip Frame 1
function printProfile(_frame) { overlay._visible = true; printing = true; clickAgain = false; image_mcl.loadClip("printout.swf", mc_print); trace("print page: " + _frame); } function setPrintInterval() { myInterval = setInterval(printout, 1000); } function printout() { clickAgain = true; clearInterval(myInterval); printAsBitmap (mc_print, "bmax"); } function loadPrint() { } moveFrame = function (dir) { var _local1 = current._currentframe; _local1 = _local1 + dir; if (_local1 < 1) { _local1 = cars; } if (_local1 > cars) { _local1 = 1; } carNum = carNumList[_local1 - 1]; current.gotoAndStop(_local1); populateStats(_local1 - 1); }; populateStats = function (which) { var _local1 = carList[which]; carNum = _local1.num; current.name = _local1.name; current.series = (_local1.num + " OF ") + seriesLength; current.born = _local1.born; current.birthPlace = _local1.birthPlace; current.designer = _local1.designer; current.specialty = _local1.specialty; }; moveLeft = function () { coming.gotoAndStop(current._currentframe); coming._x = center._x; current._x = left._x; current.goal = center; coming.goal = right; moveFrame(-1); }; moveRight = function () { coming.gotoAndStop(current._currentframe); coming._x = center._x; current._x = right._x; current.goal = center; coming.goal = left; moveFrame(1); }; onEnterFrame = function () { for (var _local2 in box) { var _local1 = Math.abs(box[_local2]._x - box[_local2].goal._x); if (_local1 > 1) { box[_local2]._x = int(((box[_local2]._x * 3) + box[_local2].goal._x) / 4); } } }; select = function (id) { var _local3 = random(carList[id].question.length); _parent.question = carList[id].question[_local3]; trace((id + " ") + carList[id].question[_local3]); _parent.choice = current._currentframe - 1; _parent.carName = carList.name[_parent.choice]; _parent.fade("location"); }; seriesLength = 24; carList = []; carList[0] = new Object(); carList[0].name = "At-A-Tude"; carList[0].num = 13; carList[0].born = "1999"; carList[0].birthPlace = "El Segundo, CA, USA"; carList[0].designer = "Hot Wheels\u00AE"; carList[0].specialty = "A blast from the past, At-A-Tude was built for breaking speed records. The massive engine sits INSIDE the cabin, right behind the driver\u2019s seat!"; carList[0].question = []; carList[0].question[0] = new Object(); carList[0].question[0].question = "Where does the engine sit in the At-A-Tude?"; carList[0].question[0].choice = []; carList[0].question[0].choice.push("In the Front, Under the hood."); carList[0].question[0].choice.push("In the trunk"); carList[0].question[0].choice.push("Inside the cabin"); carList[0].question[0].choice.push("The At-A-Tude has no engine"); carList[0].question[0].answer = 2; carList[0].question[1] = new Object(); carList[0].question[1].question = ("When was the " + carList[0].name) + " born?"; carList[0].question[1].choice = []; carList[0].question[1].choice.push("1999"); carList[0].question[1].choice.push("2002"); carList[0].question[1].choice.push("2003"); carList[0].question[1].choice.push("2005"); carList[0].question[1].answer = 0; carList[0].question[2] = new Object(); carList[0].question[2].question = ("Where was the " + carList[0].name) + " born?"; carList[0].question[2].choice = []; carList[0].question[2].choice.push("Detroit, Michigan, USA "); carList[0].question[2].choice.push("El Segundo, CA, USA"); carList[0].question[2].choice.push("Huntington Beach, California, USA"); carList[0].question[2].choice.push("Ch\u016B\u014D-ku, Tokyo, Japan"); carList[0].question[2].answer = 1; carList[0].question[3] = new Object(); carList[0].question[3].question = ("Who designed the " + carList[0].name) + "?"; carList[0].question[3].choice = []; carList[0].question[3].choice.push("Nissan"); carList[0].question[3].choice.push("General Motors"); carList[0].question[3].choice.push("Rod Millen Motorsport"); carList[0].question[3].choice.push("Hot Wheels\u00AE"); carList[0].question[3].answer = 3; carList[1] = new Object(); carList[1].name = "1/4 Mile Coupe\u2122"; carList[1].num = 14; carList[1].born = "2003"; carList[1].birthPlace = "El Segundo, CA, USA"; carList[1].designer = "Hot Wheels\u00AE"; carList[1].specialty = "A radical interpretation of the classic hot rod, this model\u2019s huge engine, gigantic supercharger, loud exhaust and small body make it perfect for attacking the 1/4 mile."; carList[1].question = []; carList[1].question[0] = new Object(); carList[1].question[0].question = "What engine does the 1/4 Mile Coupe\u2122 have?"; carList[1].question[0].choice = []; carList[1].question[0].choice.push("A humongous turbocharger"); carList[1].question[0].choice.push("A futuristic fuel cell"); carList[1].question[0].choice.push("A gigantic supercharger"); carList[1].question[0].choice.push("An Enormous nitrocharger"); carList[1].question[0].answer = 2; carList[1].question[1] = new Object(); carList[1].question[1].question = ("When was the " + carList[1].name) + " born?"; carList[1].question[1].choice = []; carList[1].question[1].choice.push("1999"); carList[1].question[1].choice.push("2002"); carList[1].question[1].choice.push("2003"); carList[1].question[1].choice.push("2005"); carList[1].question[1].answer = 2; carList[1].question[2] = new Object(); carList[1].question[2].question = ("Where was the " + carList[1].name) + " born?"; carList[1].question[2].choice = []; carList[1].question[2].choice.push("Detroit, Michigan, USA "); carList[1].question[2].choice.push("El Segundo, CA, USA"); carList[1].question[2].choice.push("Huntington Beach, California, USA"); carList[1].question[2].choice.push("Ch\u016B\u014D-ku, Tokyo, Japan"); carList[1].question[2].answer = 1; carList[1].question[3] = new Object(); carList[1].question[3].question = ("Who designed the " + carList[1].name) + "?"; carList[1].question[3].choice = []; carList[1].question[3].choice.push("Nissan"); carList[1].question[3].choice.push("General Motors"); carList[1].question[3].choice.push("Rod Millen Motorsport"); carList[1].question[3].choice.push("Hot Wheels\u00AE"); carList[1].question[3].answer = 3; carList[2] = new Object(); carList[2].name = "Pony-Up\u00AE"; carList[2].num = 10; carList[2].born = "2002"; carList[2].birthPlace = "El Segundo, CA, USA"; carList[2].designer = "Hot Wheels\u00AE"; carList[2].specialty = "This muscle car screams tire-shredding power and tough-guy styling, flashing its taillights to anyone who dares challenge it."; carList[2].question = []; carList[2].question[0] = new Object(); carList[2].question[0].question = "What kind of power does the Pony-Up\u00AE have?"; carList[2].question[0].choice = []; carList[2].question[0].choice.push("Track Scorching"); carList[2].question[0].choice.push("Door Flapping"); carList[2].question[0].choice.push("Roof Rattling"); carList[2].question[0].choice.push("Tire Shredding"); carList[2].question[0].answer = 2; carList[2].question[1] = new Object(); carList[2].question[1].question = ("When was the " + carList[2].name) + " born?"; carList[2].question[1].choice = []; carList[2].question[1].choice.push("1999"); carList[2].question[1].choice.push("2002"); carList[2].question[1].choice.push("2003"); carList[2].question[1].choice.push("2005"); carList[2].question[1].answer = 1; carList[2].question[2] = new Object(); carList[2].question[2].question = ("Where was the " + carList[2].name) + " born?"; carList[2].question[2].choice = []; carList[2].question[2].choice.push("Detroit, Michigan, USA "); carList[2].question[2].choice.push("El Segundo, CA, USA"); carList[2].question[2].choice.push("Huntington Beach, California, USA"); carList[2].question[2].choice.push("Ch\u016B\u014D-ku, Tokyo, Japan"); carList[2].question[2].answer = 1; carList[2].question[3] = new Object(); carList[2].question[3].question = ("Who designed the " + carList[2].name) + "?"; carList[2].question[3].choice = []; carList[2].question[3].choice.push("Nissan"); carList[2].question[3].choice.push("General Motors"); carList[2].question[3].choice.push("Rod Millen Motorsport"); carList[2].question[3].choice.push("Hot Wheels\u00AE"); carList[2].question[3].answer = 3; cars = carList.length; carNumList = [13, 14, 10]; carNum = carNumList[0]; box = [current, coming]; current.goal = center; coming.goal = left; current._x = center._x; var printing = false; var printLoaded = false; var clickAgain = true; overlay._visible = false; overlay.onRelease = function () { if (printing) { if (clickAgain) { if (printLoaded) { trace("overlay me!"); this._visible = false; printing = false; } } } }; var mclListener = new Object(); mclListener.onLoadInit = function (target_mc) { trace("movie loaded, goto frame: " + currentSelection); printLoaded = true; mc_print.choice = currentSelection - 1; mc_print.chooserCars.carNum = mc_print.chooserCars.carNumList[currentSelection - 1]; mc_print.chooserCars.populateStats(currentSelection - 1); setPrintInterval(); }; var image_mcl = new MovieClipLoader(); image_mcl.addListener(mclListener); stop();
Symbol 365 Button
on (press) { _parent.sounds.press.start(); _parent.fade("send"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 369 MovieClip Frame 1
stop();
Symbol 371 MovieClip Frame 1
stop();
Symbol 373 MovieClip Frame 1
stop();
Symbol 378 Button
on (press) { _parent.sounds.press.start(); _parent.fade("game"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 379 Button
on (press) { _parent.sounds.press.start(); _parent.fade("choose"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 383 Button
on (press) { _parent.sounds.press.start(); _parent.fade("video"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 389 Button
on (press) { _parent.sounds.press.start(); _parent.fade("send"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 390 MovieClip Frame 1
car.gotoAndStop(_parent.choice + 1);
Symbol 393 Button
on (press) { _parent.sounds.press.start(); fade("choose"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 402 MovieClip Frame 1
stop();
Symbol 409 Button
on (press) { gfx.idle.enter(); _parent.fade(_parent.returnTo); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); } on (rollOver) { redBall.gotoAndPlay("over"); _parent.sounds.roll.start(); } on (rollOut, releaseOutside) { redBall.gotoAndPlay("off"); }
Symbol 411 MovieClip Frame 1
_visible = false;
Symbol 412 MovieClip Frame 1
var my_nc = new NetConnection(); my_nc.connect(null); my_ns = new NetStream(my_nc); my_ns.onStatus = function (infoObject) { }; continueOn = function () { }; playpause.btnPause.onPress = function () { my_ns.pause(); playpause.gotoAndStop(((playpause._currentframe == 1) ? 2 : 1)); }; mySound = new Sound(); my_video.attachVideo(my_ns); mySound.attachSound(my_ns); my_ns.setBufferTime(5); var duration; my_ns.onMetaData = function (obj) { trace(obj.duration); duration = obj.duration; trace(obj.videodatarate); trace(audiodatarate); }; dist = hook1._x - hook0._x; var initx = video_progress_bar._x; var inity = video_progress_bar._y; var perc; my_ns.play("flv/trailer.flv"); var vidInt = setInterval(this, "checkDownload", 1000, [my_ns]); video_progress_bar.cacheAsBitmap = true; video_progress_bar.btnDrag.onPress = function () { dragging = true; startDrag (video_progress_bar, false, hook0._x, inity, hook1._x, inity); }; video_progress_bar.btnDrag.onRelease = (video_progress_bar.btnDrag.onReleaseOutside = function () { dragging = false; stopDrag(); }); onEnterFrame = function () { if (!dragging) { perc = Math.floor((my_ns.time / duration) * 100); video_progress_bar._x = initx + (dist * (my_ns.time / duration)); } else { perc = (video_progress_bar._x - initx) / dist; my_ns.seek(duration * perc); trace(duration * perc); } }; checkDownload = function (_ns) { var _local3 = _ns[0].bytesLoaded; var _local1 = _ns[0].bytesTotal; var _local2 = _local1 / 30; var _local4 = _local2 / _local3; my_ns.setBufferTime(5 * _local4); trace(my_ns.bufferTime); clearInterval(vidInt); }; closeVid = function (_ns) { trace("close vid"); my_ns.close(); clearInterval(closeInt); };
Symbol 417 Button
on (press) { _parent.choose(id); } on (rollOver) { gotoAndStop (2); } on (rollOut, releaseOutside) { gotoAndStop (1); }
Symbol 420 MovieClip Frame 1
stop();
Symbol 423 MovieClip Frame 1
question = _parent.question.question.toUpperCase(); choiceList = _parent.question.choice; choice = [choice0, choice1, choice2, choice3]; i = 0; while (i < choice.length) { choice[i].choice = choiceList[i].toUpperCase(); choice[i].id = i; i++; } choose = function (id) { if (id == answer) { _parent.correct = true; } else { _parent.correct = false; } _parent.fade("answer"); }; answer = _parent.question.answer;
Symbol 426 Button
on (press) { _parent.controlMode = 0; _parent.fade("location"); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); } on (rollOver) { redBall.gotoAndPlay("over"); _parent.sounds.roll.start(); } on (rollOut, releaseOutside) { redBall.gotoAndPlay("off"); }
Symbol 427 MovieClip Frame 1
choiceList = _parent.question.choice; answer = _parent.question.answer; answerText = choiceList[answer]; if (_parent.correct) { if (_parent.choice == 0) { _parent.boost = 1.5; body = "That was the right answer and you have unlocked a speed boost for a higher top speed!"; } if (_parent.choice == 1) { _parent.boost = 0.4; body = "That was the right answer and you have unlocked a power boost to dominate the race and win!"; } if (_parent.choice == 2) { _parent.boost = 1; body = "That was the right answer and you have unlocked a supercharged boost to help you take the lead!"; } heading = "CONGRATULATIONS!"; } else { gotoAndStop (2); _parent.boost = 0; heading = "TOO BAD"; if (_parent.choice == 0) { body = "You did not unlock the speed boost for this race. Don\u2019t forget to read or print the profile for your car!"; } if (_parent.choice == 1) { body = "You did not unlock the power boost for this race. Don\u2019t forget to read or print the profile for your car!"; } if (_parent.choice == 2) { body = "You did not unlock the supercharged boost for this race. Don\u2019t forget to read or print the profile for your car!"; } }
Symbol 440 MovieClip Frame 1
_visible = false;
Symbol 441 MovieClip Frame 1
nodeList = [node0, node1]; hitterList = [hitter0, hitter1, hitter2, hitter3]; hitterList[0].nodeList = [node0, node1]; hitterList[1].nodeList = [node1, node2]; hitterList[2].nodeList = [node2, node3]; hitterList[3].nodeList = [node3, node4]; var n = []; for (var j in hitterList) { for (var i in hitterList[j].nodeList) { n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y}; hitterList[j].localToGlobal(n[i]); } var distx = (n[0].x - n[1].x); var disty = (n[0].y - n[1].y); hitterList[j].collisionNormal = {x:-disty, y:distx}; } _parent.boxList.push(this); _visible = _parent.showObjects;
Symbol 444 MovieClip Frame 1
hitterList = [hitter0]; hitterList[0].nodeList = [node0, node1]; var n = []; for (var j in hitterList) { for (var i in hitterList[j].nodeList) { n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y}; hitterList[j].localToGlobal(n[i]); } var distx = (n[0].x - n[1].x); var disty = (n[0].y - n[1].y); hitterList[j].collisionNormal = {x:-disty, y:distx}; } _parent.boxList.push(this); _visible = _parent.showObjects;
Symbol 453 MovieClip Frame 1
nodeList = [node0, node1]; hitterList = [hitter0, hitter1, hitter2, hitter3]; hitterList[0].nodeList = [node0, node1]; hitterList[1].nodeList = [node1, node2]; hitterList[2].nodeList = [node2, node3]; hitterList[3].nodeList = [node3, node4]; var n = []; for (var j in hitterList) { for (var i in hitterList[j].nodeList) { n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y}; hitterList[j].localToGlobal(n[i]); } var distx = (n[0].x - n[1].x); var disty = (n[0].y - n[1].y); hitterList[j].collisionNormal = {x:-disty, y:distx}; } _parent.boxList.push(this); _visible = _parent.showObjects;
Symbol 465 MovieClip Frame 1
gotoAndStop(_parent._parent._parent.choice + 1);
Symbol 466 MovieClip Frame 1
_parent.nodeList.push(this); this._visible = false;
Symbol 482 MovieClip Frame 1
distance = function (x1, y1, x2, y2) { distx = x1 - x2; disty = y1 - y2; return(Math.sqrt((distx * distx) + (disty * disty))); }; magnitude = function (v1) { return(distance(0, 0, v1.x, v1.y)); }; dot = function (v1, v2) { return((v1.x * v2.x) + (v1.y * v2.y)); }; normalize = function (v1) { var _local1 = 1 / magnitude(v1); return({x:v1.x * _local1, y:v1.y * _local1}); }; adds = function (v1, v2) { tempVector = new Object(); tempVector.x = v1.x + v2.x; tempVector.y = v1.y + v2.y; return(tempVector); }; subtract = function (v1, v2) { tempVector = new Object(); tempVector.x = v1.x - v2.x; tempVector.y = v1.y - v2.y; return(tempVector); }; multiply = function (s, v) { tempVector = new Object(); tempVector.x = v.x * s; tempVector.y = v.y * s; return(tempVector); }; resetCollisions = function () { myCollisions = new Array(); myColliders = []; }; findAngle = function (xdist, ydist) { a = Math.atan(ydist / xdist) * rad; if ((xdist > 0) and (ydist < 0)) { a = -a; } if (xdist < 0) { a = 180 - a; } if ((xdist > 0) and (ydist > 0)) { a = 360 - a; } return(a); }; getSlope = function (x1, y1, x2, y2) { return((y1 - y2) / (x1 - x2)); }; getIntercept = function (x1, y1, slope) { return(y1 - (x1 * slope)); }; getIntersection = function (x1, y1, x2, y2, x3, y3, x4, y4) { m1 = getSlope(x1, y1, x2, y2); m2 = getSlope(x3, y3, x4, y4); b1 = getIntercept(x1, y1, m1); b2 = getIntercept(x3, y3, m2); tempPoint = new Object(); tempPoint.x = (b2 - b1) / (m1 - m2); tempPoint.y = (m1 * tempPoint.x) + b1; return(tempPoint); }; boxTest = function (which) { clip = _parent.boxList[which]; if (hitter.hitTest(clip)) { for (var _local8 in gNodeList) { var _local3 = {x:gNodeList[_local8].x, y:gNodeList[_local8].y}; this._parent.localToGlobal(_local3); if (clip.hitTest(_local3.x, _local3.y, true)) { bumpness = 0.5; var _local4 = {x:(this.speed.x * bumpness) + gNodeList[_local8].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local8].diff.y}; for (var _local7 in clip.hitterList) { myDist = distance(gNodeList[_local8].x, gNodeList[_local8].y, clip._x - (clip.hitterList[_local7].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local7].collisionNormal.y * 10000000)); futureDist = distance(gNodeList[_local8].x + _local4.x, gNodeList[_local8].y + _local4.y, clip._x - (clip.hitterList[_local7].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local7].collisionNormal.y * 10000000)); if (clip.hitterList[_local7].hitTest(_local3.x, _local3.y, true) and (myDist > futureDist)) { collisionInfo = new Object(); collisionInfo.perpVector = {x:0, y:0}; collisionInfo.where = _local3; collisionInfo.heft = heft * 1E16; collisionInfo.normal = clip.hitterList[_local7].collisionNormal; collisionInfo.speed = {x:0, y:0}; collisionInfo.mySpeed = _local4; collisionInfo.mass = 1E18; collisionInfo.body = clip; if (nodeList[_local8]._x < 0) { collisionInfo.backwards = -1.4; } else { collisionInfo.backwards = 1; } myCollisions.push(collisionInfo); } } } } } }; bumperTest = function (which) { clip = currentBumperList[which]; if (clip.active) { if (hitter.hitTest(clip)) { for (var _local5 in gNodeList) { bumpness = 0.5; var _local2 = {x:(this.speed.x * bumpness) + gNodeList[_local5].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local5].diff.y}; myDist = distance(gNodeList[_local5].x, gNodeList[_local5].y, clip._x, clip._y); futureDist = distance(gNodeList[_local5].x + _local2.x, gNodeList[_local5].y + _local2.y, clip._x, clip._y); myDiff = myDist - clip.span; myCount++; if ((myDiff <= 0) and (myDist > futureDist)) { collisionInfo = new Object(); collisionInfo.collider = clip._name; collisionInfo.perpVector = {x:0, y:0}; collisionInfo.heft = heft * 1000; collisionInfo.normal = findNormal(this, clip); collisionInfo.speed = {x:0, y:0}; collisionInfo.mySpeed = _local2; collisionInfo.mass = 100000000000000; myCollisions.push(collisionInfo); } } } } }; globalizeNodes = function (who) { who.gNodeList = []; for (var _local4 in who.nodeList) { who.gNodeList[_local4] = {x:nodeList[_local4]._x, y:nodeList[_local4]._y}; who.localToGlobal(who.gNodeList[_local4]); who.gNodeList[_local4].diff = {x:who.gNodeList[_local4].x - who.nodeList[_local4].oldPos.x, y:who.gNodeList[_local4].y - who.nodeList[_local4].oldPos.y}; who._parent.globalToLocal(who.gNodeList[_local4]); } }; saveNodePositions = function () { for (var _local5 in nodeList) { var _local2 = {x:nodeList[_local5]._x, y:nodeList[_local5]._y}; this.localToGlobal(_local2); nodeList[_local5].oldPos = {x:_local2.x, y:_local2.y}; } }; findNormal = function (me, him) { tempVector = new Object(); tempVector.x = him._x - me._x; tempVector.y = him._y - me._y; return(tempVector); }; unDaze = function () { clearInterval(dazeInterval); dazed = false; }; daze = function () { clearInterval(dazeInterval); if (this != _parent.ball) { dazeInterval = setInterval(unDaze, 200); } else { dazeInterval = setInterval(unDaze, 100); } dazed = true; }; getJ = function (mine, his, normal, hismass, hisHeft, hisPerp) { myr = (temp = new Object()); diff = new Object(); diff = subtract(mine, his); temp = multiply(-(1.05 + elastic), diff); top = dot(temp, normal); massnum = (1 / mass) + (1 / hismass); temp = multiply(massnum, normal); firstAdd = dot(perpVector, normal); firstAdd = firstAdd * firstAdd; firstAdd = firstAdd / heft; secondAdd = dot(hisPerp, normal); secondAdd = secondAdd * secondAdd; secondAdd = secondAdd / hisHeft; bottom = dot(normal, temp); bottom = bottom + (firstAdd + secondAdd); j = top / bottom; return(j); }; getCollisions = function () { var _local4 = 0; while (_local4 < currentBallList.length) { clip = currentBallList[_local4]; if (clip.id != id) { isCollider = false; for (var _local8 in myColliders) { if (myColliders[_local8] == clip) { isCollider = true; } } if (!isCollider) { if (hitter.hitTest(clip.hitter)) { for (_local4 in gNodeList) { bumpness = 0.5; var _local5 = {x:(this.speed.x * bumpness) + gNodeList[_local4].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local4].diff.y}; myDist = distance(this._x, this._y, clip._x, clip._y); futureDist = distance(this._x + speed.x, this._y + speed.y, clip._x + clip.speed.x, clip._y + clip.speed.y); var _local3 = {x:gNodeList[_local4].x, y:gNodeList[_local4].y}; this._parent.localToGlobal(_local3); if (clip.hitter.hitTest(_local3.x, _local3.y, true) and (myDist > futureDist)) { collisionInfo = new Object(); collisionInfo.where = _local3; collisionInfo.perpVector = clip.perpVector; collisionInfo.normal = findNormal(clip, this); if (this == _parent.ball) { _parent.makeSpark(_local3, normalize(collisionInfo.normal)); } collisionInfo.speed = clip.speed; collisionInfo.mySpeed = speed; collisionInfo.rot = clip.rot; collisionInfo.mass = clip.mass; collisionInfo.heft = clip.heft; if (nodeList[_local4]._x < 0) { collisionInfo.backwards = -1.4; } else { collisionInfo.backwards = 1; } myCollisions.push(collisionInfo); collisionInfo2 = new Object(); collisionInfo2.perpVector = this.perpVector; collisionInfo2.normal = findNormal(this, clip); collisionInfo2.speed = this.speed; collisionInfo2.mySpeed = clip.speed; collisionInfo2.rot = this.rot; collisionInfo2.mass = this.mass; collisionInfo2.heft = this.heft; clip.globalToLocal(_local3); if (_local3.x < 0) { collisionInfo2.backwards = -1.4; } else { collisionInfo2.backwards = 1; } clip.myCollisions.push(collisionInfo2); clip.myColliders.push(this); } } } } } _local4++; } var _local9 = magnitude(speed); _local4 = 0; while (_local4 < _parent.cornerList.length) { cornerTest(_local4); _local4++; } _local4 = 0; while (_local4 < currentBumperList.length) { bumperTest(_local4); _local4++; } _local4 = 0; while (_local4 < _parent.boxList.length) { boxTest(_local4); _local4++; } return(myCollisions); }; applyFriction = function () { var _local3 = _parent.findAngle(speed.x, speed.y); var _local4 = Math.abs((this._rotation - _local3) % 90); _local4 = ((_local4 / 90) * 0.25) + 0.75; if (this == _parent.ball) { } if (this._name == "ball") { trace(friction); } velocity = preVelocity - (friction * _local4); velocity = Math.max(0, velocity); ratio = velocity / preVelocity; speed.x = speed.x * ratio; speed.y = speed.y * ratio; }; translate = function () { saveNodePositions(); oldPos = new Object(); oldPos.x = _x; oldPos.y = _y; preVelocity = distance(0, 0, speed.x, speed.y); spin = spin + preVelocity; frame = (int(spin * 0.1) % 35) + 1; _parent.display.hider.gotoAndStop(frame); if (maxVelocity > maxVelocity) { finalVel = finalVel * 0.8; } else { finalVel = maxVelocity; } finalVel = Math.max(finalVel, maxVelocity); if (preVelocity > finalVel) { ratio = finalVel / preVelocity; speed.x = speed.x * ratio; speed.y = speed.y * ratio; } _x = (_x + (speed.x / _parent.iterations)); _y = (_y + (speed.y / _parent.iterations)); _rotation = (_rotation + (rot * rad)); rot = rot * 0.85; perpVector.x = (-Math.sin(_rotation / rad)) * span; perpVector.y = Math.cos(_rotation / rad) * span; preVelocity = distance(0, 0, speed.x, speed.y); if (preVelocity > 0) { applyFriction(); } assignNodeSpeeds(); }; collisionDetection = function () { collisionList = new Array(); collisionList = getCollisions(); }; collisionResponse = function () { if (collisionList.length > 0) { speedTotal = new Object(); speedTotal.x = 0; speedTotal.y = 0; rotTotal = 0; i = 0; while (i < collisionList.length) { j = getJ(collisionList[i].mySpeed, collisionList[i].speed, collisionList[i].normal, collisionList[i].mass, collisionList[i].heft, collisionList[i].perpVector); temp = new Object(); temp = multiply(j / mass, collisionList[i].normal); speedTotal = adds(speedTotal, temp); jNormal = new Object(); jNormal = multiply(j, collisionList[i].normal); value = dot(jNormal, perpVector); rotTotal = rotTotal + ((value / heft) * collisionList[i].backwards); var _local3 = collisionList[i].body; if ((this == _parent.ball) and (collisionList[i].where != undefined)) { _parent.makeSpark(collisionList[i].where, normalize(collisionList[i].normal)); } i++; } _parent.determineSpecs(_local3._name); vol = int(magnitude(speedTotal) * 2); if (vol > 0) { daze(); } if ((vol > 4) and (this == _parent.ball)) { gfx.crash.start(vol * 5); } speedTotal.x = speedTotal.x / collisionList.length; speedTotal.y = speedTotal.y / collisionList.length; speedTotal.x; speedTotal.y; rotTotal = rotTotal / collisionList.length; rot = rot + rotTotal; speed = adds(speed, speedTotal); _parent.checkBounces(); } }; stop(); myCount = 0; nodeList = [];
Symbol 484 MovieClip Frame 1
_visible = false;
Symbol 486 MovieClip Frame 1
_visible = false;
Symbol 488 MovieClip Frame 1
gotoAndStop(_parent._parent._parent.choice + 1);
Symbol 489 MovieClip Frame 1
onEnterFrame = function () { this._x = this._x + speed.x; this._y = this._y + speed.y; };
Symbol 489 MovieClip Frame 7
this.removeMovieClip(this);
Symbol 496 MovieClip Frame 4
this.removeMovieClip(this);
Symbol 528 MovieClip Frame 14
this.removeMovieClip(this);
Symbol 545 MovieClip Frame 9
this.removeMovieClip(this);
Symbol 554 MovieClip Frame 1
nodeList = [node0, node1]; hitterList = [hitter0, hitter1, hitter2, hitter3]; hitterList[0].nodeList = [node0, node1]; hitterList[1].nodeList = [node1, node2]; hitterList[2].nodeList = [node2, node3]; hitterList[3].nodeList = [node3, node0]; var n = []; for (var j in hitterList) { for (var i in hitterList[j].nodeList) { n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y}; hitterList[j].localToGlobal(n[i]); } var distx = (n[0].x - n[1].x); var disty = (n[0].y - n[1].y); hitterList[j].collisionNormal = {x:-disty, y:distx}; } _parent.boxList.push(this); _visible = _parent.showObjects;
Symbol 555 MovieClip Frame 1
function goTowardGoal(who) { if (!who.dazed) { if (distance(who._x, who._y, who.path._x, who.path._y) < who.reaction) { who.nextPath++; if (who.nextPath == pathList.length) { who.nextPath = 0; } who.path = pathList[who.nextPath]; } var _local6 = (who.path._x - who._x) + who.xOff; var _local4 = (who.path._y - who._y) + who.yOff; var _local5 = Math.min(0.1 * who.preVelocity, 0.02) + 0.002; var _local7 = findDirection(who._rotation, 360 - who.findAngle(_local6, _local4)); who.rot = who.rot + (_local5 * _local7); who.speed.x = who.speed.x + (Math.cos(who._rotation / who.rad) * who.accel); who.speed.y = who.speed.y + (Math.sin(who._rotation / who.rad) * who.accel); var _local3 = distance(0, 0, who.speed.x, who.speed.y); if (_local3 > who.maxSpeed) { var _local2 = who.maxSpeed / _local3; who.speed.x = who.speed.x * _local2; who.speed.y = who.speed.y * _local2; } } } giveBall = function (who) { if (who.owner.picture == undefined) { ballCount++; duplicateMovieClip ("ballKing", "ball" + ballCount, ballCount + 300); var b = eval ("ball" + ballCount); b._x = who._x; b._y = who._y; b._xscale = who._width; b._yscale = who._height; who.alpha = 0; who.kid = b; var r = random(3); b.gotoAndStop(r + 1); } }; rotate = function (n) { var _local2 = n.parent._x - n._x; n._rotation = _local2 * 1.95; }; distance = function (x1, y1, x2, y2) { distx = x1 - x2; disty = y1 - y2; return(Math.sqrt((distx * distx) + (disty * disty))); }; moveBall = function (who) { who.speed.x = who.speed.x + (Math.cos(who._rotation / who.rad) * 0.6); who.speed.y = who.speed.y + (Math.sin(who._rotation / who.rad) * 0.6); var _local3 = distance(0, 0, who.speed.x, who.speed.y); if (_local3 > (maxSpeed - 2)) { var _local2 = (maxSpeed - 2) / _local3; who.speed.x = who.speed.x * _local2; who.speed.y = who.speed.y * _local2; } }; doKeys = function () { if (!gameOver) { if (Key.isDown(38) and (!ball.dazed)) { ball.friction = 0.5; if (!pressed38) { gfx.accel.start(); } pressed38 = true; ball.speed.x = ball.speed.x + (Math.cos(ball._rotation / ball.rad) * accel); ball.speed.y = ball.speed.y + (Math.sin(ball._rotation / ball.rad) * accel); var _local2 = distance(0, 0, ball.speed.x, ball.speed.y); if (_local2 > ball.maxSpeed) { var _local1 = ball.maxSpeed / _local2; ball.speed.x = ball.speed.x * _local1; ball.speed.y = ball.speed.y * _local1; } if (!gameStarted) { clearInterval(thing1Interval); clearInterval(thing2Interval); hideWordBubble(); setSpans(); startTime = getTimer(); gfx.music.enter(); gameStarted = true; } } else { ball.friction = 0.5; } if (!Key.isDown(38)) { pressed38 = false; } if (Key.isDown(37)) { if (turnFactor > 0) { turnFactor = 0; } turnFactor = turnFactor - 3; turnFactor = Math.min(handling, turnFactor); ball._rotation = ball._rotation - handling; } if (Key.isDown(39)) { if (turnFactor < 0) { turnFactor = 0; } turnFactor = turnFactor + 3; turnFactor = Math.min(handling, turnFactor); ball._rotation = ball._rotation + handling; } } }; doTime = function () { if (!gameOver) { var _local2 = getTimer() - startTime; time = Math.round(_local2 * 0.01) * 0.1; time = int(time * 10) * 0.1; displayTime = time; var _local1 = time % 60; var _local3 = int(time / 60); if (_local1 < 10) { _local1 = "0" + _local1; } if (int(time) == time) { _local1 = _local1 + ".0"; } _local1 = _local1 + ""; _local1 = _local1.substr(0, 4); displayTime = (_local3 + ":") + _local1; } }; oldSpeed = {x:0, y:0}; reallyOldSpeed = {x:0, y:0}; reallyOldSpeed1 = {x:0, y:0}; reallyOldSpeed2 = {x:0, y:0}; reallyOldSpeed3 = {x:0, y:0}; moveCamera = function () { var _local7 = ball._x - ballStartx; var _local6 = ball._y - ballStarty; var _local3 = startx - _local7; var _local2 = starty - _local6; var _local9 = Math.cos(ball._rotation / ball.rad) * 50; var _local8 = Math.sin(ball._rotation / ball.rad) * 50; _local3 = _local3 - (((((_local9 + oldSpeed.x) + reallyOldSpeed.x) + reallyOldSpeed1.x) + reallyOldSpeed2.x) + reallyOldSpeed3.x); _local2 = _local2 - (((((_local8 + oldSpeed.y) + reallyOldSpeed.y) + reallyOldSpeed1.y) + reallyOldSpeed2.y) + reallyOldSpeed3.y); reallyOldSpeed3 = reallyOldSpeed2; reallyOldSpeed2 = reallyOldSpeed1; reallyOldSpeed1 = reallyOldSpeed; reallyOldSpeed = oldSpeed; oldSpeed = ball.speed; var _local4 = distance(this._x, this._y, _local3, _local2) / 4; if (camSpeed < _local4) { camSpeed = camSpeed + 4; } camSpeed = Math.min(camMax, camSpeed); camSpeed = Math.min(camSpeed, _local4); var _local5 = camSpeed / _local4; this._x = this._x + int(((_local3 - this._x) / 4) * _local5); this._y = this._y + int(((_local2 - this._y) / 4) * _local5); }; jumpCamera = function () { var _local5 = ball._x - ballStartx; var _local4 = ball._y - ballStarty; var _local3 = startx - _local5; var _local2 = starty - _local4; this._x = _local3; this._y = _local2; }; distance = function (x1, y1, x2, y2) { distx = x1 - x2; disty = y1 - y2; return(Math.sqrt((distx * distx) + (disty * disty))); }; doTime = function () { if (!gameOver) { var _local2 = getTimer() - startTime; time = Math.round(_local2 * 0.01) * 0.1; time = int(time * 10) * 0.1; displayTime = time; var _local1 = time % 60; var _local3 = int(time / 60); if (_local1 < 10) { _local1 = "0" + _local1; } if (int(time) == time) { _local1 = _local1 + ".0"; } _local1 = _local1 + ""; _local1 = _local1.substr(0, 4); displayTime = (_local3 + ":") + _local1; } }; alignBalls = function () { for (var _local1 in bumperList) { bumperList[_local1].kid._x = bumperList[_local1]._x; bumperList[_local1].kid._y = bumperList[_local1]._y; bumperList[_local1].kid._rotation = bumperList[_local1]._rotation; } }; setSpans = function (who) { ballSpan = who.hitter._width / 2; for (var _local1 in bumperList) { bumperList[_local1].ballSpan = (bumperList[_local1]._width / 2) + ballSpan; } for (var _local1 in ballList) { ballList[_local1].ballSpan = (ballList[_local1]._width / 2) + ballSpan; } }; buildCurrentBumperList = function (who) { setSpans(who); who.currentBumperList = []; for (var _local4 in bumperList) { var _local3 = Math.abs(who._x - bumperList[_local4]._x); if (_local3 < bumperList[_local4].ballSpan) { var _local2 = Math.abs(who._y - bumperList[_local4]._y); if (_local2 <= bumperList[_local4].ballSpan) { who.currentBumperList.push(bumperList[_local4]); } } } who.disp = who.currentBumperList.length; }; findClosestPath = function (who) { closest = 10000; for (var _local4 in pathList) { var _local1 = distance(who._x, who._y, pathList[_local4]._x, pathList[_local4]._y); if (_local1 < closest) { var _local3 = pathList[_local4]; winnerNum = _local4; closest = _local1; } } return(winnerNum); }; findSides = function (who) { var _local10 = findClosestPath(who); var _local8 = _local10.normal; var _local9 = 4; var _local4 = {x:0, y:0}; _local4.x = _local4.x + ((-_local8.y) * _local9); _local4.y = _local4.y + (_local8.x * _local9); var _local5 = {x:0, y:0}; _local5.x = _local5.x + (_local8.y * _local9); _local5.y = _local5.y + ((-_local8.x) * _local9); var _local7 = false; attempts = 0; while ((!_local7) and (attempts < 200)) { attempts++; var _local2 = {x:who._x + (_local4.x * attempts), y:who._y + (_local4.y * attempts)}; this.localToGlobal(_local2); if (hitter.hitTest(_local2.x, _local2.y, true)) { _local7 = true; } } var _local2 = {x:who._x + (_local4.x * attempts), y:who._y + (_local4.y * attempts)}; rider0._x = _local2.x; rider0._y = _local2.y; var _local6 = false; leftDist = attempts; attempts = 0; while ((!_local6) and (attempts < 200)) { attempts++; _local2 = {x:who._x + (_local5.x * attempts), y:who._y + (_local5.y * attempts)}; this.localToGlobal(_local2); if (hitter.hitTest(_local2.x, _local2.y, true)) { _local6 = true; } } _local2 = {x:who._x + (_local5.x * attempts), y:who._y + (_local5.y * attempts)}; rider1._x = _local2.x; rider1._y = _local2.y; rightDist = attempts; var _local11 = rightDist + leftDist; var _local12 = (leftDist / _local11) - 0.5; who._rotation = who._rotation + (_local12 * who.magnitude(who.speed)); }; findDirection = function (a1, a2) { a1 = a1 + 1000; a2 = a2 + 1000; if (a1 < 0) { a1 = a1 + 360; } if ((a1 - a2) > 180) { a2 = a2 + 360; } if ((a2 - a1) > 180) { a1 = a1 + 360; } if (Math.abs(a1 - a2) < 4) { return(0); } if (a1 < a2) { return(1); } return(-1); }; buildCurrentBallList = function (who) { who.currentBallList = []; for (var _local4 in ballList) { if (ballList[_local4] != who) { var _local3 = Math.abs(who._x - ballList[_local4]._x); if (_local3 < ballList[_local4].ballSpan) { var _local2 = Math.abs(who._y - ballList[_local4]._y); if (_local2 <= ballList[_local4].ballSpan) { who.currentBallList.push(ballList[_local4]); } } } } }; findAngle = function (dx, dy) { var _local1 = (Math.atan2(dy, dx) * 180) / Math.PI; return(_local1); }; magnitude = function (v1) { return(distance(0, 0, v1.x, v1.y)); }; normalize = function (v1) { var _local1 = 1 / magnitude(v1); var _local4 = v1.x * _local1; var _local3 = v1.y * _local1; var _local2 = {x:_local4, y:_local3}; return(_local2); }; newBall = function (who, mass, heft) { who.rad = 57.2957795130823; who.span = who.hitter._width / 2; who.active = false; who.rot = 0; who.preVelocity = 0; who.maxVelocity = 200; who.elastic = 0.7; who.bumpness = 0.3; who.heft = heft; who.speed = new Object(); who.speed.y = 0; who.speed.x = 0; who.mass = mass; who.id = ballList.length; who.growthRate = 1.1; who.friction = 0.5; who.reaction = 180; who.nextPath = findClosestPath(who); who.path = pathList[who.nextPath]; who.hitDistance = new Array(); who.wallDistance = new Array(); who.bumperDistance = new Array(); who.cornerDistance = new Array(); who.perpVector = new Object(); who.hitter._alpha = (showObjects ? 100 : 100); who.spin = 0; who.dazed = false; who.type = "ball"; if (who._name != "ball") { who.maxSpeed = 16 + (0.4 * ballList.length); who.accel = 5.7 + (random(50) * 0.01); who.wildness = random(100) + 50; who.xOff = random(who.wildness * 2) - who.wildness; who.yOff = random(who.wildness * 2) - who.wildness; } else { if (_parent.choice == 0) { who.maxSpeed = 19 + _parent.boost; } else { who.maxSpeed = 18; } if ((_parent.choice == 1) or (_parent.choice == 2)) { accel = 6.3 + _parent.boost; } else { accel = 6; } handling = 8; trace("handling: " + handling); trace("accel: " + accel); trace("maxSpeed: " + maxSpeed); } ballList.push(who); who.gotoAndStop(ballList.length); }; leaveRace = function () { clearInterval(leaveInterval); _parent.time = time; _global.totalScore = time; _parent.displayTime = displayTime; _parent.fade("results"); }; makeSpark = function (where, dir) { sparkCount++; if (_parent.choice == 2) { duplicateMovieClip (sparkKing, "spark" + sparkCount, sparkCount); var _local6 = this["spark" + sparkCount]; this.globalToLocal(where); _local6._x = where.x; _local6._y = where.y; var _local7 = ball.findAngle(dir.x, dir.y); _local7 = _local7 + (random(40) + 20); var _local4 = new Object(); trace(_local7); _local4.x = Math.cos(_local7 / ball.rad) * 16; _local4.y = Math.sin(_local7 / ball.rad) * 16; _local6.speed = {x:_local4.x, y:_local4.y}; } if (_parent.choice == 0) { duplicateMovieClip (explosionKing, "spark" + sparkCount, sparkCount); var _local6 = this["spark" + sparkCount]; this.globalToLocal(where); _local6._x = where.x; _local6._y = where.y; _local6._rotation = random(360); _local6._xscale = random(100) + 50; _local6._yscale = _local6._xscale; } if (_parent.choice == 1) { duplicateMovieClip (smokeKing, "spark" + sparkCount, sparkCount); var _local6 = this["spark" + sparkCount]; this.globalToLocal(where); _local6._x = where.x; _local6._y = where.y; var _local7 = ball.findAngle(dir.x, dir.y); _local7 = _local7 + (random(40) + 20); _local6._rotation = _local7; var _local8 = random(4); if (_local8 == 0) { sparkCount++; duplicateMovieClip (puffKing, "spark" + sparkCount, sparkCount); _local6 = this["spark" + sparkCount]; _local6._x = where.x; _local6._y = where.y; _local7 = ball.findAngle(dir.x, dir.y); _local7 = _local7 + (random(40) + 20); _local6._rotation = _local7; } } }; doLaps = function (who) { var _local3 = currentCheckPoint[who.id]; var _local4 = checkPoint[_local3]; if (_local4.hitTest(who)) { currentCheckPoint[who.id]++; if (currentCheckPoint[who.id] >= checkPoint.length) { laps[who.id]++; if ((who == ball) and (laps[who.id] != totalLaps)) { _parent.hud.slammer.play(); } currentCheckPoint[who.id] = 0; if (laps[who.id] == totalLaps) { finished++; if (who == ball) { gameOver = true; gfx.victory.start(); displayPlaceList = ["FIRST", "SECOND", "THIRD", "FOURTH", "FIFTH", "SIXTH"]; _parent.place = finished; _parent.displayPlace = displayPlaceList[finished - 1]; trace("your place of finish is : " + finished); gfx.music.exit(); gfx.crowd.start(); leaveInterval = setInterval(leaveRace, 3000); } } } } if (who == ball) { currentLap = Math.min(totalLaps, laps[who.id] + 1); displayLaps = (("LAP " + currentLap) + " OF ") + totalLaps; } }; beginGame = function () { startTime = getTimer(); gameStarted = true; }; onEnterFrame = function () { if (gameStarted) { doKeys(); var _local1 = 1; while (_local1 < ballList.length) { goTowardGoal(ballList[_local1]); _local1++; } _local1 = 0; while (_local1 < iterations) { for (var _local2 in ballList) { ballList[_local2].globalizeNodes(ballList[_local2]); ballList[_local2].resetCollisions(); } for (var _local2 in ballList) { buildCurrentBumperList(ballList[_local2]); buildCurrentBallList(ballList[_local2]); ballList[_local2].collisionDetection(); } for (var _local2 in ballList) { ballList[_local2].collisionResponse(); } for (var _local2 in ballList) { ballList[_local2].translate(); doLaps(ballList[_local2]); } _local1++; } } moveCamera(); doTime(); alignBalls(); }; init = function () { sparkCount = 0; pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18]; i = 0; while (i < pathList.length) { var _local4 = pathList[i]; if (i < (pathList.length - 1)) { var _local3 = pathList[i + 1]; } else { var _local3 = pathList[0]; } var _local7 = _local4._x - _local3._x; var _local6 = _local4._y - _local3._y; var _local5 = {x:-_local7, y:-_local6}; pathList[i].normal = normalize(_local5); pathList[i].clear(); pathList[i].lineStyle(2, 16742314, 100); pathList[i].moveTo(0, 0); pathList[i].lineTo(pathList[i].normal.x * 50, pathList[i].normal.y * 50); i++; } turnFactor = 0; finished = 0; canLap = false; laps = [0, 0, 0, 0, 0, 0]; totalLaps = 3; checkPoint = [checkPoint0, checkPoint1, checkPoint2, checkPoint3]; currentCheckPoint = [0, 0, 0, 0, 0, 0]; showObjects = false; thing1Interval = setInterval(sayThing1, 500); thing2Interval = setInterval(sayThing2, 3250); wally = _parent.wally.dude; gravity = 2.5; balls = 2; maxSpring = 37; maxSpeed = 14; iterations = 3; display.startx = display.slider._x; display.starty = display.slider._y; camSpeed = 0; camMax = 40; dudeDist = 30; startx = this._x; starty = this._y; ballStartx = ball._x; ballStarty = ball._y; bumperList = []; cornerList = []; boxList = []; wallList = []; ballProperties(); timeChoices = [90, 80, 70]; totalTime = timeChoices[_parent.choice]; gameStarted = false; gameOver = false; objectsEaten = 0; bumped = 0; ballCount = 0; clocked = false; overlay.swapDepths(1000); display.swapDepths(900); state = "idle"; display.pusher.dude.gotoAndStop("idle"); doWally("intro"); setSpans(); toldSmallStuff = false; toldDoingGreat = false; ballList = []; newBall(ball, 50, 400000); newBall(ball1, 20, 100000); newBall(ball2, 20, 100000); newBall(ball3, 20, 100000); newBall(ball4, 20, 100000); newBall(ball5, 20, 100000); _parent.hud.setter.gotoAndPlay(2); }; init(); stop();
Symbol 562 MovieClip Frame 1
gotoAndStop(_parent.count);
Symbol 563 MovieClip Frame 1
stop(); count = 1;
Symbol 563 MovieClip Frame 2
play();
Symbol 563 MovieClip Frame 10
gfx.buzzerShort.start();
Symbol 563 MovieClip Frame 22
count = 2;
Symbol 563 MovieClip Frame 31
gfx.buzzerShort.start();
Symbol 563 MovieClip Frame 43
count = 3;
Symbol 563 MovieClip Frame 52
gfx.buzzerLong.start();
Symbol 563 MovieClip Frame 62
gfx.music.enter(); _parent._parent.game.beginGame();
Symbol 563 MovieClip Frame 67
gfx.crowd.start();
Symbol 563 MovieClip Frame 104
stop();
Symbol 584 MovieClip Frame 1
distance = function (x1, y1, x2, y2) { distx = x1 - x2; disty = y1 - y2; return(Math.sqrt((distx * distx) + (disty * disty))); }; magnitude = function (v1) { return(distance(0, 0, v1.x, v1.y)); }; dot = function (v1, v2) { return((v1.x * v2.x) + (v1.y * v2.y)); }; normalize = function (v1) { var _local1 = 1 / magnitude(v1); return({x:v1.x * _local1, y:v1.y * _local1}); }; adds = function (v1, v2) { tempVector = new Object(); tempVector.x = v1.x + v2.x; tempVector.y = v1.y + v2.y; return(tempVector); }; subtract = function (v1, v2) { tempVector = new Object(); tempVector.x = v1.x - v2.x; tempVector.y = v1.y - v2.y; return(tempVector); }; multiply = function (s, v) { tempVector = new Object(); tempVector.x = v.x * s; tempVector.y = v.y * s; return(tempVector); }; resetCollisions = function () { myCollisions = new Array(); myColliders = []; }; findAngle = function (xdist, ydist) { a = Math.atan(ydist / xdist) * rad; if ((xdist > 0) and (ydist < 0)) { a = -a; } if (xdist < 0) { a = 180 - a; } if ((xdist > 0) and (ydist > 0)) { a = 360 - a; } return(a); }; getSlope = function (x1, y1, x2, y2) { return((y1 - y2) / (x1 - x2)); }; getIntercept = function (x1, y1, slope) { return(y1 - (x1 * slope)); }; getIntersection = function (x1, y1, x2, y2, x3, y3, x4, y4) { m1 = getSlope(x1, y1, x2, y2); m2 = getSlope(x3, y3, x4, y4); b1 = getIntercept(x1, y1, m1); b2 = getIntercept(x3, y3, m2); tempPoint = new Object(); tempPoint.x = (b2 - b1) / (m1 - m2); tempPoint.y = (m1 * tempPoint.x) + b1; return(tempPoint); }; boxTest = function (which) { clip = _parent.boxList[which]; if (hitter.hitTest(clip)) { for (var _local8 in gNodeList) { var _local3 = {x:gNodeList[_local8].x, y:gNodeList[_local8].y}; this._parent.localToGlobal(_local3); if (clip.hitTest(_local3.x, _local3.y, true)) { bumpness = 0.5; var _local4 = {x:(this.speed.x * bumpness) + gNodeList[_local8].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local8].diff.y}; for (var _local7 in clip.hitterList) { myDist = distance(gNodeList[_local8].x, gNodeList[_local8].y, clip._x - (clip.hitterList[_local7].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local7].collisionNormal.y * 10000000)); futureDist = distance(gNodeList[_local8].x + _local4.x, gNodeList[_local8].y + _local4.y, clip._x - (clip.hitterList[_local7].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local7].collisionNormal.y * 10000000)); if (clip.hitterList[_local7].hitTest(_local3.x, _local3.y, true) and (myDist > futureDist)) { collisionInfo = new Object(); collisionInfo.perpVector = {x:0, y:0}; collisionInfo.heft = heft * 1E16; collisionInfo.normal = clip.hitterList[_local7].collisionNormal; collisionInfo.speed = {x:0, y:0}; collisionInfo.mySpeed = _local4; collisionInfo.mass = 1E18; collisionInfo.body = clip; if (nodeList[_local8]._x < 0) { collisionInfo.backwards = -1.4; } else { collisionInfo.backwards = 1; } myCollisions.push(collisionInfo); } } } } } }; bumperTest = function (which) { clip = currentBumperList[which]; if (clip.active) { if (hitter.hitTest(clip)) { for (var _local5 in gNodeList) { bumpness = 0.5; var _local2 = {x:(this.speed.x * bumpness) + gNodeList[_local5].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local5].diff.y}; myDist = distance(gNodeList[_local5].x, gNodeList[_local5].y, clip._x, clip._y); futureDist = distance(gNodeList[_local5].x + _local2.x, gNodeList[_local5].y + _local2.y, clip._x, clip._y); myDiff = myDist - clip.span; myCount++; if ((myDiff <= 0) and (myDist > futureDist)) { collisionInfo = new Object(); collisionInfo.collider = clip._name; collisionInfo.perpVector = {x:0, y:0}; collisionInfo.heft = heft * 1000; collisionInfo.normal = findNormal(this, clip); collisionInfo.speed = {x:0, y:0}; collisionInfo.mySpeed = _local2; collisionInfo.mass = 100000000000000; myCollisions.push(collisionInfo); } } } } }; globalizeNodes = function (who) { who.gNodeList = []; for (var _local4 in who.nodeList) { who.gNodeList[_local4] = {x:nodeList[_local4]._x, y:nodeList[_local4]._y}; who.localToGlobal(who.gNodeList[_local4]); who.gNodeList[_local4].diff = {x:who.gNodeList[_local4].x - who.nodeList[_local4].oldPos.x, y:who.gNodeList[_local4].y - who.nodeList[_local4].oldPos.y}; who._parent.globalToLocal(who.gNodeList[_local4]); } }; saveNodePositions = function () { for (var _local5 in nodeList) { var _local2 = {x:nodeList[_local5]._x, y:nodeList[_local5]._y}; this.localToGlobal(_local2); nodeList[_local5].oldPos = {x:_local2.x, y:_local2.y}; } }; findNormal = function (me, him) { tempVector = new Object(); tempVector.x = him._x - me._x; tempVector.y = him._y - me._y; return(tempVector); }; unDaze = function () { clearInterval(dazeInterval); dazed = false; }; daze = function () { clearInterval(dazeInterval); if (this != _parent.ball) { dazeInterval = setInterval(unDaze, 100); } else { dazeInterval = setInterval(unDaze, 50); } dazed = true; }; getJ = function (mine, his, normal, hismass, hisHeft, hisPerp) { myr = (temp = new Object()); diff = new Object(); diff = subtract(mine, his); temp = multiply(-(1.05 + elastic), diff); top = dot(temp, normal); massnum = (1 / mass) + (1 / hismass); temp = multiply(massnum, normal); firstAdd = dot(perpVector, normal); firstAdd = firstAdd * firstAdd; firstAdd = firstAdd / heft; secondAdd = dot(hisPerp, normal); secondAdd = secondAdd * secondAdd; secondAdd = secondAdd / hisHeft; bottom = dot(normal, temp); bottom = bottom + (firstAdd + secondAdd); j = top / bottom; return(j); }; getCollisions = function () { var _local4 = 0; while (_local4 < currentBallList.length) { clip = currentBallList[_local4]; if (clip.id != id) { isCollider = false; for (var _local8 in myColliders) { if (myColliders[_local8] == clip) { isCollider = true; } } if (!isCollider) { if (hitter.hitTest(clip.hitter)) { for (_local4 in gNodeList) { bumpness = 0.5; var _local5 = {x:(this.speed.x * bumpness) + gNodeList[_local4].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local4].diff.y}; myDist = distance(this._x, this._y, clip._x, clip._y); futureDist = distance(this._x + speed.x, this._y + speed.y, clip._x + clip.speed.x, clip._y + clip.speed.y); var _local3 = {x:gNodeList[_local4].x, y:gNodeList[_local4].y}; this._parent.localToGlobal(_local3); if (clip.hitter.hitTest(_local3.x, _local3.y, true) and (myDist > futureDist)) { collisionInfo = new Object(); collisionInfo.perpVector = clip.perpVector; collisionInfo.normal = findNormal(clip, this); collisionInfo.speed = clip.speed; collisionInfo.mySpeed = speed; collisionInfo.rot = clip.rot; collisionInfo.mass = clip.mass; collisionInfo.heft = clip.heft; if (nodeList[_local4]._x < 0) { collisionInfo.backwards = -1.4; } else { collisionInfo.backwards = 1; } myCollisions.push(collisionInfo); collisionInfo2 = new Object(); collisionInfo2.perpVector = this.perpVector; collisionInfo2.normal = findNormal(this, clip); collisionInfo2.speed = this.speed; collisionInfo2.mySpeed = clip.speed; collisionInfo2.rot = this.rot; collisionInfo2.mass = this.mass; collisionInfo2.heft = this.heft; clip.globalToLocal(_local3); if (_local3.x < 0) { collisionInfo2.backwards = -1.4; } else { collisionInfo2.backwards = 1; } clip.myCollisions.push(collisionInfo2); clip.myColliders.push(this); } } } } } _local4++; } var _local9 = magnitude(speed); _local4 = 0; while (_local4 < _parent.cornerList.length) { cornerTest(_local4); _local4++; } _local4 = 0; while (_local4 < currentBumperList.length) { bumperTest(_local4); _local4++; } _local4 = 0; while (_local4 < _parent.boxList.length) { boxTest(_local4); _local4++; } return(myCollisions); }; applyFriction = function () { var _local3 = _parent.findAngle(speed.x, speed.y); var _local4 = Math.abs((this._rotation - _local3) % 90); _local4 = ((_local4 / 90) * 0.25) + 0.75; if (this == _parent.ball) { } velocity = preVelocity - (friction * _local4); velocity = Math.max(0, velocity); ratio = velocity / preVelocity; speed.x = speed.x * ratio; speed.y = speed.y * ratio; }; translate = function () { saveNodePositions(); oldPos = new Object(); oldPos.x = _x; oldPos.y = _y; preVelocity = distance(0, 0, speed.x, speed.y); spin = spin + preVelocity; frame = (int(spin * 0.1) % 35) + 1; _parent.display.hider.gotoAndStop(frame); if (maxVelocity > maxVelocity) { finalVel = finalVel * 0.8; } else { finalVel = maxVelocity; } finalVel = Math.max(finalVel, maxVelocity); if (preVelocity > finalVel) { ratio = finalVel / preVelocity; speed.x = speed.x * ratio; speed.y = speed.y * ratio; } _x = (_x + (speed.x / _parent.iterations)); _y = (_y + (speed.y / _parent.iterations)); _rotation = (_rotation + (rot * rad)); rot = rot * 0.85; perpVector.x = (-Math.sin(_rotation / rad)) * span; perpVector.y = Math.cos(_rotation / rad) * span; preVelocity = distance(0, 0, speed.x, speed.y); if (preVelocity > 0) { applyFriction(); } assignNodeSpeeds(); }; collisionDetection = function () { collisionList = new Array(); collisionList = getCollisions(); }; collisionResponse = function () { if (collisionList.length > 0) { speedTotal = new Object(); speedTotal.x = 0; speedTotal.y = 0; rotTotal = 0; i = 0; while (i < collisionList.length) { j = getJ(collisionList[i].mySpeed, collisionList[i].speed, collisionList[i].normal, collisionList[i].mass, collisionList[i].heft, collisionList[i].perpVector); temp = new Object(); temp = multiply(j / mass, collisionList[i].normal); speedTotal = adds(speedTotal, temp); jNormal = new Object(); jNormal = multiply(j, collisionList[i].normal); value = dot(jNormal, perpVector); rotTotal = rotTotal + ((value / heft) * collisionList[i].backwards); var _local3 = collisionList[i].body; i++; } _parent.determineSpecs(_local3._name); vol = int(magnitude(speedTotal) * 2); if (vol > 0) { daze(); } if (vol > 15) { var _local4 = determineSound(_local3); _root.sounds.instance[_local4].setVolume(vol); _root.sounds.volumes[_local4] = vol; _root.sounds.goals[_local4] = vol; if (_local4 == 1) { _root.sounds.bounce.start(); } else if (_local4 == 2) { _root.sounds.rim.start(); } else if (_local4 == 4) { _root.sounds.backboard.start(); } } speedTotal.x = speedTotal.x / collisionList.length; speedTotal.y = speedTotal.y / collisionList.length; speedTotal.x; speedTotal.y; rotTotal = rotTotal / collisionList.length; rot = rot + rotTotal; speed = adds(speed, speedTotal); _parent.checkBounces(); } }; stop(); myCount = 0; nodeList = [];
Symbol 585 MovieClip Frame 1
ballList = [ball, ball1, ball2, ball3, ball4, ball5]; for (var i in ballList) { ballList[i].gotoAndStop(Number(i) + 1); } ball.swapDepths(100); onEnterFrame = function () { for (var _local2 in ballList) { ballList[_local2]._x = _parent._parent.game.ballList[_local2]._x; ballList[_local2]._y = _parent._parent.game.ballList[_local2]._y; } };
Symbol 599 MovieClip Frame 6
stop();
Symbol 600 MovieClip Frame 1
stop();
Symbol 600 MovieClip Frame 2
gfx.bonus.play(); gotoAndPlay (3);
Symbol 601 MovieClip Frame 1
car.gotoAndStop(_parent.choice + 1);
Symbol 608 Button
on (press) { _parent.sounds.press.start(); _parent.fade("location"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 611 Button
on (press) { _parent.sounds.press.start(); _parent.fade("question"); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 617 MovieClip Frame 1
var my_nc = new NetConnection(); my_nc.connect(null); my_ns = new NetStream(my_nc); my_ns.onStatus = function (infoObject) { }; continueOn = function () { }; playpause.btnPause.onPress = function () { my_ns.pause(); playpause.gotoAndStop(((playpause._currentframe == 1) ? 2 : 1)); }; mySound = new Sound(); my_video.attachVideo(my_ns); mySound.attachSound(my_ns); my_ns.setBufferTime(5); var duration; my_ns.onMetaData = function (obj) { trace(obj.duration); duration = obj.duration; trace(obj.videodatarate); trace(audiodatarate); }; dist = hook1._x - hook0._x; var initx = video_progress_bar._x; var inity = video_progress_bar._y; var perc; my_ns.play("flv/trailer.flv"); var vidInt = setInterval(this, "checkDownload", 1000, [my_ns]); video_progress_bar.cacheAsBitmap = true; video_progress_bar.btnDrag.onPress = function () { dragging = true; startDrag (video_progress_bar, false, hook0._x, inity, hook1._x, inity); }; video_progress_bar.btnDrag.onRelease = (video_progress_bar.btnDrag.onReleaseOutside = function () { dragging = false; stopDrag(); }); onEnterFrame = function () { if (!dragging) { perc = Math.floor((my_ns.time / duration) * 100); video_progress_bar._x = initx + (dist * (my_ns.time / duration)); } else { perc = (video_progress_bar._x - initx) / dist; my_ns.seek(duration * perc); trace(duration * perc); } }; checkDownload = function (_ns) { var _local3 = _ns[0].bytesLoaded; var _local1 = _ns[0].bytesTotal; var _local2 = _local1 / 30; var _local4 = _local2 / _local3; my_ns.setBufferTime(5 * _local4); trace(my_ns.bufferTime); clearInterval(vidInt); }; closeVid = function (_ns) { trace("close vid"); my_ns.close(); clearInterval(closeInt); };
Symbol 618 MovieClip Frame 1
car.gotoAndStop(_parent.choice + 1);
Symbol 635 MovieClip Frame 9
stop();
Symbol 635 MovieClip Frame 19
stop();
Symbol 635 MovieClip Frame 30
stop();
Symbol 638 MovieClip Frame 9
stop();
Symbol 638 MovieClip Frame 19
stop();
Symbol 638 MovieClip Frame 30
stop();
Symbol 642 Button
on (press) { _parent.fade("title"); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 645 Button
on (press) { _parent.fade("send"); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 647 MovieClip Frame 1
SendAnother.buttonLabel = "SEND ANOTHER"; Done.buttonLabel = "DONE"; SendAnother.ReleaseCallBack = function () { _parent.fade("send"); }; Done.ReleaseCallBack = function () { _parent.fade("title"); }; _parent.sentAlready = true; _parent.send_ft.track();
Symbol 651 Button
on (press) { _parent.fade("title"); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 654 Button
on (press) { _parent.fade("highscores"); } on (press) { _parent.sounds.press.start(); } on (rollOver) { _parent.sounds.roll.start(); }
Symbol 680 MovieClip Frame 3
stop();
Symbol 680 MovieClip Frame 6
stop();
Symbol 680 MovieClip Frame 9
stop();
Symbol 680 MovieClip Frame 12
stop();
Symbol 680 MovieClip Frame 15
stop();
Symbol 680 MovieClip Frame 18
stop();
Symbol 685 MovieClip Frame 1
Back.buttonLabel = "BACK"; Highscores.buttonLabel = "HIGHSCORES"; Back.ReleaseCallBack = function () { _parent.fade("gameType"); }; Highscores.ReleaseCallBack = function () { _parent.fade("highscores"); }; stop();
Symbol 687 MovieClip Frame 1
Back.buttonLabel = "BACK"; Back.ReleaseCallBack = function () { _parent.fade("gameType"); }; stop();
Instance of Symbol 125 MovieClip [DataGrid] "my_dg" in Symbol 687 MovieClip Frame 1
//component parameters onClipEvent (construct) { editable = false; multipleSelection = false; rowHeight = 20; }

Library Items

Symbol 11 GraphicUsed by:12
Symbol 12 MovieClip [BoundingBox]Uses:11Used by:34 38 53 57 116 117 118 119 120 121 125
Symbol 13 GraphicUsed by:14
Symbol 14 MovieClip [DataHeaderBackGnd]Uses:13Used by:25
Symbol 15 GraphicUsed by:16
Symbol 16 MovieClip [DataHeaderOverlay]Uses:15Used by:25
Symbol 17 GraphicUsed by:18
Symbol 18 MovieClip [DataHeaderSeperator]Uses:17Used by:25
Symbol 19 GraphicUsed by:20
Symbol 20 MovieClip [DataSortArrow]Uses:19Used by:25
Symbol 21 GraphicUsed by:22
Symbol 22 MovieClip [DataStretchBar]Uses:21Used by:25
Symbol 23 GraphicUsed by:24
Symbol 24 MovieClip [cursorStretch]Uses:23Used by:25
Symbol 25 MovieClip [DataGridAssets]Uses:14 16 18 20 22 24Used by:125
Symbol 26 MovieClip [DataGridColumn]Used by:125
Symbol 27 MovieClip [Defaults]Used by:29
Symbol 28 MovieClip [UIObjectExtensions]Used by:29
Symbol 29 MovieClip [UIObject]Uses:27 28Used by:35 37 54
Symbol 30 GraphicUsed by:32
Symbol 31 GraphicUsed by:32
Symbol 32 ButtonUses:30 31Used by:35
Symbol 33 MovieClipUsed by:35
Symbol 34 MovieClip [FocusRect]Uses:12Used by:35
Symbol 35 MovieClip [FocusManager]Uses:32 33 34 29Used by:37
Symbol 36 MovieClip [UIComponentExtensions]Used by:37
Symbol 37 MovieClip [UIComponent]Uses:29 35 36Used by:38 53 118 124
Symbol 38 MovieClip [SelectableRow]Uses:37 12Used by:39 120
Symbol 39 MovieClip [DataGridRow]Uses:38Used by:125
Symbol 40 MovieClip [DataProvider]Used by:120
Symbol 41 MovieClip [DataSelector]Used by:120
Symbol 42 GraphicUsed by:43
Symbol 43 MovieClip [BrdrShdw]Uses:42Used by:46 51 52
Symbol 44 GraphicUsed by:45
Symbol 45 MovieClip [BrdrFace]Uses:44Used by:46 51 52
Symbol 46 MovieClip [SimpleButtonDown]Uses:43 45Used by:53
Symbol 47 GraphicUsed by:48
Symbol 48 MovieClip [BrdrBlk]Uses:47Used by:51 52
Symbol 49 GraphicUsed by:50
Symbol 50 MovieClip [BrdrHilght]Uses:49Used by:51 52
Symbol 51 MovieClip [SimpleButtonIn]Uses:48 50 43 45Used by:53
Symbol 52 MovieClip [SimpleButtonUp]Uses:48 45 43 50Used by:53
Symbol 53 MovieClip [SimpleButton]Uses:12 46 51 52 37Used by:57 116 117
Symbol 54 MovieClip [Border]Uses:29Used by:55 57
Symbol 55 MovieClip [RectBorder]Uses:54Used by:57 118 124
Symbol 56 MovieClip [ButtonSkin]Used by:57
Symbol 57 MovieClip [Button]Uses:12 53 54 55 56Used by:116 117
Symbol 58 MovieClip [CustomBorder]Used by:116 117
Symbol 59 GraphicUsed by:61 97 98 99 102 103 108
Symbol 60 GraphicUsed by:61 97 98 102 103 108
Symbol 61 MovieClip [ScrollTrack]Uses:59 60Used by:68 73 74 75 109 110 111 112 113 114
Symbol 62 GraphicUsed by:68 73 74 75 109 110 111 112
Symbol 63 GraphicUsed by:68 73 74 75 109 110 111 112
Symbol 64 GraphicUsed by:68 73 74 75 109 110 111 112
Symbol 65 GraphicUsed by:68 73 74 75 109 110 111 112
Symbol 66 GraphicUsed by:68 73 74 75 109 110 111 112
Symbol 67 GraphicUsed by:68 73 74 75
Symbol 68 MovieClip [ScrollDownArrowDisabled]Uses:61 62 63 64 65 66 67Used by:115
Symbol 69 GraphicUsed by:70
Symbol 70 MovieClip [ScrollThemeColor1]Uses:69Used by:73 74 110 111
Symbol 71 GraphicUsed by:72
Symbol 72 MovieClip [ScrollThemeColor2]Uses:71Used by:73 110
Symbol 73 MovieClip [ScrollDownArrowDown]Uses:61 62 70 63 64 65 66 72 67Used by:115
Symbol 74 MovieClip [ScrollDownArrowOver]Uses:61 62 70 63 64 65 66 67Used by:115
Symbol 75 MovieClip [ScrollDownArrowUp]Uses:61 62 63 64 65 66 67Used by:115
Symbol 76 GraphicUsed by:81 86 87 88 104 105 106 107
Symbol 77 GraphicUsed by:81 86 87 88 104 105 106 107
Symbol 78 GraphicUsed by:81 86 87 88 104 105 106 107
Symbol 79 GraphicUsed by:81 86 87 88 104 105 106 107
Symbol 80 GraphicUsed by:81 86 87 88 104 105 106 107
Symbol 81 MovieClip [ScrollThumbBottomDisabled]Uses:76 77 78 79 80Used by:115
Symbol 82 GraphicUsed by:83
Symbol 83 MovieClip [ThumbThemeColor1]Uses:82Used by:86 87 105 106
Symbol 84 GraphicUsed by:85
Symbol 85 MovieClip [ThumbThemeColor3]Uses:84Used by:86 105
Symbol 86 MovieClip [ScrollThumbBottomDown]Uses:76 83 77 78 79 85 80Used by:115
Symbol 87 MovieClip [ScrollThumbBottomOver]Uses:76 83 77 78 79 80Used by:115
Symbol 88 MovieClip [ScrollThumbBottomUp]Uses:76 77 78 79 80Used by:115
Symbol 89 GraphicUsed by:90 93 94 95
Symbol 90 MovieClip [ScrollThumbGripDisabled]Uses:89Used by:115
Symbol 91 GraphicUsed by:92
Symbol 92 MovieClip [ThumbThemeColor2]Uses:91Used by:93 94 97 98 102
Symbol 93 MovieClip [ScrollThumbGripDown]Uses:92 89Used by:115
Symbol 94 MovieClip [ScrollThumbGripOver]Uses:92 89Used by:115
Symbol 95 MovieClip [ScrollThumbGripUp]Uses:89Used by:115
Symbol 96 GraphicUsed by:97 98 102 103
Symbol 97 MovieClip [ScrollThumbMiddleDisabled]Uses:59 96 92 60Used by:115
Symbol 98 MovieClip [ScrollThumbMiddleDown]Uses:59 92 96 60Used by:115
Symbol 99 MovieClipUses:59Used by:102
Symbol 100 GraphicUsed by:101 109 110 111 112
Symbol 101 MovieClipUses:100Used by:102
Symbol 102 MovieClip [ScrollThumbMiddleOver]Uses:59 92 96 99 101 60Used by:115
Symbol 103 MovieClip [ScrollThumbMiddleUp]Uses:59 96 60Used by:115
Symbol 104 MovieClip [ScrollThumbTopDisabled]Uses:76 77 78 79 80Used by:115
Symbol 105 MovieClip [ScrollThumbTopDown]Uses:76 83 77 78 79 85 80Used by:115
Symbol 106 MovieClip [ScrollThumbTopOver]Uses:76 83 77 78 79 80Used by:115
Symbol 107 MovieClip [ScrollThumbTopUp]Uses:76 77 78 79 80Used by:115
Symbol 108 MovieClip [ScrollTrackDisabled]Uses:59 60Used by:115
Symbol 109 MovieClip [ScrollUpArrowDisabled]Uses:61 62 63 64 65 66 100Used by:115
Symbol 110 MovieClip [ScrollUpArrowDown]Uses:61 62 70 63 64 65 66 72 100Used by:115
Symbol 111 MovieClip [ScrollUpArrowOver]Uses:61 62 70 63 64 100 65 66Used by:115
Symbol 112 MovieClip [ScrollUpArrowUp]Uses:61 62 63 64 65 66 100Used by:115
Symbol 113 MovieClip [BtnDownArrow]Uses:61Used by:115
Symbol 114 MovieClip [BtnUpArrow]Uses:61Used by:115
Symbol 115 MovieClip [ScrollBarAssets]Uses:68 73 74 75 81 86 87 88 90 93 94 95 97 98 102 103 104 105 106 107 108 109 110 111 112 113 114Used by:116 117
Symbol 116 MovieClip [HScrollBar]Uses:12 57 53 58 115Used by:119
Symbol 117 MovieClip [VScrollBar]Uses:12 57 53 58 115Used by:119
Symbol 118 MovieClip [View]Uses:12 37 55Used by:119
Symbol 119 MovieClip [ScrollView]Uses:12 116 117 118Used by:120
Symbol 120 MovieClip [ScrollSelectList]Uses:12 40 41 38 119Used by:121
Symbol 121 MovieClip [List]Uses:12 120Used by:125
Symbol 122 FontUsed by:123
Symbol 123 EditableTextUses:122Used by:124
Symbol 124 MovieClip [TextInput]Uses:123 55 37Used by:125
Symbol 125 MovieClip [DataGrid]Uses:12 25 26 39 121 124Used by:687
Symbol 158 GraphicUsed by:Timeline
Symbol 159 GraphicUsed by:162
Symbol 160 GraphicUsed by:161
Symbol 161 MovieClipUses:160Used by:162
Symbol 162 MovieClipUses:159 161Used by:Timeline
Symbol 163 FontUsed by:164 241 242 244 245 248 249 251 262 263 268 269 271 281 282 283 284 305 306 307 310 311 313 314 322 323 324 328 329 330 339 340 343 344 346 358 362 363 375 376 377 380 381 387 388 391 392 406 407 408 415 418 419 421 422 424 425 558 564 565 566 587 606 607 609 610 612 613 614 615 616 626 633 634 636 637 639 640 641 643 644 649 650 652 653 681 682 683
Symbol 164 TextUses:163Used by:Timeline
Symbol 165 GraphicUsed by:255  Timeline
Symbol 166 BitmapUsed by:167
Symbol 167 GraphicUses:166Used by:255  Timeline
Symbol 168 GraphicUsed by:169
Symbol 169 MovieClipUses:168Used by:Timeline
Symbol 688 MovieClip [__Packages.mx.remoting.debug.NetDebug]
Symbol 689 MovieClip [__Packages.mx.remoting.debug.NetDebugConfig]
Symbol 690 MovieClip [__Packages.mx.remoting.debug.GlobalLocalConnection]
Symbol 691 MovieClip [__Packages.mx.remoting.debug.events.NetDebug]
Symbol 692 MovieClip [__Packages.mx.remoting.debug.events.NetDebugNetConnection]
Symbol 693 MovieClip [__Packages.mx.remoting.debug.events.NetDebugDuplicateNCDError]
Symbol 694 MovieClip [__Packages.mx.remoting.debug.commands.Local]
Symbol 695 MovieClip [__Packages.mx.remoting.debug.commands.GetConfig]
Symbol 696 MovieClip [__Packages.mx.remoting.NetServices]
Symbol 697 MovieClip [__Packages.mx.services.Log]
Symbol 698 MovieClip [__Packages.mx.remoting.Connection]
Symbol 699 MovieClip [__Packages.mx.remoting.NetServiceProxy]
Symbol 700 MovieClip [__Packages.mx.remoting.NetServiceProxyResponder]
Symbol 701 MovieClip [__Packages.mx.data.PageableData]
Symbol 702 MovieClip [__Packages.mx.data.DataRange]
Symbol 703 MovieClip [__Packages.mx.data.PageableList]
Symbol 704 MovieClip [__Packages.mx.remoting.RecordSet]
Symbol 6 MovieClip [__Packages.mx.events.EventDispatcher]
Symbol 705 MovieClip [__Packages.mx.utils.Iterator]
Symbol 706 MovieClip [__Packages.mx.remoting.RecordSetIterator]
Symbol 707 MovieClip [__Packages.mx.remoting.RsDataFetcher]
Symbol 708 MovieClip [__Packages.mx.remoting.RsDataRange]
Symbol 709 MovieClip [__Packages.mx.remoting.debug.events.NetDebugFailedSendError]
Symbol 710 MovieClip [__Packages.mx.utils.ObjectCopy]
Symbol 711 MovieClip [__Packages.mx.remoting.debug.events.NetDebugStatus]
Symbol 712 MovieClip [__Packages.mx.remoting.debug.events.NetDebugError]
Symbol 713 MovieClip [__Packages.mx.remoting.debug.ConnectionMixin]
Symbol 714 MovieClip [__Packages.mx.remoting.debug.events.NetDebugConnect]
Symbol 715 MovieClip [__Packages.mx.remoting.debug.commands.StartRTMPTrace]
Symbol 716 MovieClip [__Packages.mx.remoting.RTMPClientIDResponse]
Symbol 717 MovieClip [__Packages.mx.remoting.debug.commands.AddRTMPClient]
Symbol 718 MovieClip [__Packages.mx.remoting.debug.events.NetDebugCall]
Symbol 719 MovieClip [__Packages.mx.remoting.debug.NetDebugResponseProxy]
Symbol 720 MovieClip [__Packages.mx.remoting.debug.events.NetDebugResult]
Symbol 721 MovieClip [__Packages.mx.remoting.debug.events.NetDebugReceiveCall]
Symbol 722 MovieClip [__Packages.mx.remoting.debug.events.NetDebugClose]
Symbol 723 MovieClip [__Packages.mx.remoting.debug.commands.StopRTMPTrace]
Symbol 724 MovieClip [__Packages.mx.remoting.debug.events.NetDebugAddHeader]
Symbol 725 MovieClip [__Packages.mx.remoting.debug.events.NetDebugTrace]
Symbol 726 MovieClip [__Packages.mx.remoting.debug.events.NetDebugTraceNetServices]
Symbol 727 MovieClip [__Packages.mattel.utils.EmailServices]
Symbol 728 MovieClip [__Packages.mattel.utils.Logger]
Symbol 729 MovieClip [__Packages.mattel.data.StringExtensions]
Symbol 730 MovieClip [__Packages.mattel.system.ApplicationSettings]
Symbol 1 MovieClip [__Packages.mx.core.UIObject]
Symbol 2 MovieClip [__Packages.mx.core.UIComponent]
Symbol 3 MovieClip [__Packages.mx.core.View]
Symbol 4 MovieClip [__Packages.mx.core.ScrollView]
Symbol 5 MovieClip [__Packages.mx.controls.listclasses.DataSelector]
Symbol 7 MovieClip [__Packages.mx.controls.listclasses.DataProvider]
Symbol 8 MovieClip [__Packages.mx.controls.listclasses.ScrollSelectList]
Symbol 9 MovieClip [__Packages.mx.controls.List]
Symbol 10 MovieClip [__Packages.mx.controls.DataGrid]
Symbol 126 MovieClip [__Packages.mx.skins.SkinElement]
Symbol 127 MovieClip [__Packages.mx.styles.CSSTextStyles]
Symbol 128 MovieClip [__Packages.mx.styles.StyleManager]
Symbol 129 MovieClip [__Packages.mx.styles.CSSStyleDeclaration]
Symbol 130 MovieClip [__Packages.mx.skins.Border]
Symbol 131 MovieClip [__Packages.mx.skins.RectBorder]
Symbol 132 MovieClip [__Packages.mx.managers.DepthManager]
Symbol 133 MovieClip [__Packages.mx.events.UIEventDispatcher]
Symbol 134 MovieClip [__Packages.mx.core.ExternalContent]
Symbol 135 MovieClip [__Packages.mx.skins.CustomBorder]
Symbol 136 MovieClip [__Packages.mx.controls.scrollClasses.ScrollThumb]
Symbol 137 MovieClip [__Packages.mx.controls.SimpleButton]
Symbol 138 MovieClip [__Packages.mx.controls.scrollClasses.ScrollBar]
Symbol 139 MovieClip [__Packages.mx.effects.Tween]
Symbol 140 MovieClip [__Packages.mx.controls.gridclasses.DataGridColumn]
Symbol 141 MovieClip [__Packages.mx.controls.listclasses.SelectableRow]
Symbol 142 MovieClip [__Packages.mx.controls.gridclasses.DataGridRow]
Symbol 143 MovieClip [__Packages.mx.controls.TextInput]
Symbol 144 MovieClip [__Packages.mx.skins.ColoredSkinElement]
Symbol 145 MovieClip [__Packages.mx.core.ext.UIObjectExtensions]
Symbol 146 MovieClip [__Packages.mx.skins.halo.Defaults]
Symbol 147 MovieClip [__Packages.mx.managers.SystemManager]
Symbol 148 MovieClip [__Packages.mx.managers.FocusManager]
Symbol 149 MovieClip [__Packages.mx.skins.halo.FocusRect]
Symbol 150 MovieClip [__Packages.mx.managers.OverlappedWindows]
Symbol 151 MovieClip [__Packages.mx.styles.CSSSetStyle]
Symbol 152 MovieClip [__Packages.mx.core.ext.UIComponentExtensions]
Symbol 153 MovieClip [__Packages.mx.controls.HScrollBar]
Symbol 154 MovieClip [__Packages.mx.controls.Button]
Symbol 155 MovieClip [__Packages.mx.skins.halo.RectBorder]
Symbol 156 MovieClip [__Packages.mx.skins.halo.ButtonSkin]
Symbol 157 MovieClip [__Packages.mx.controls.VScrollBar]
Symbol 170 GraphicUsed by:172 177
Symbol 171 SoundUsed by:172
Symbol 172 MovieClipUses:170 171Used by:204
Symbol 173 GraphicUsed by:175 179 180 182 190 192 195
Symbol 174 SoundUsed by:175
Symbol 175 MovieClipUses:173 174Used by:204
Symbol 176 SoundUsed by:177
Symbol 177 MovieClipUses:170 176Used by:204
Symbol 178 SoundUsed by:179 180
Symbol 179 MovieClipUses:173 178Used by:204
Symbol 180 MovieClipUses:173 178Used by:204
Symbol 181 SoundUsed by:182
Symbol 182 MovieClipUses:173 181Used by:204
Symbol 183 GraphicUsed by:188
Symbol 184 GraphicUsed by:188 197
Symbol 185 SoundUsed by:188
Symbol 186 SoundUsed by:188
Symbol 187 SoundUsed by:188
Symbol 188 MovieClipUses:183 184 185 186 187Used by:204
Symbol 189 SoundUsed by:190 197
Symbol 190 MovieClipUses:173 189Used by:204
Symbol 191 SoundUsed by:192
Symbol 192 MovieClipUses:173 191Used by:204
Symbol 193 SoundUsed by:195
Symbol 194 SoundUsed by:195
Symbol 195 MovieClipUses:173 193 194Used by:204
Symbol 196 SoundUsed by:197
Symbol 197 MovieClipUses:184 196 189 SS1Used by:204
Symbol 198 GraphicUsed by:201
Symbol 199 GraphicUsed by:200
Symbol 200 MovieClipUses:199Used by:201
Symbol 201 MovieClipUses:198 200Used by:204
Symbol 202 GraphicUsed by:203
Symbol 203 ButtonUses:202Used by:204
Symbol 204 MovieClipUses:172 175 177 179 180 182 188 190 192 195 197 201 203Used by:Timeline
Symbol 205 SoundUsed by:Timeline
Symbol 206 BitmapUsed by:207
Symbol 207 GraphicUses:206Used by:Timeline
Symbol 208 BitmapUsed by:209
Symbol 209 GraphicUses:208Used by:210
Symbol 210 MovieClipUses:209Used by:255
Symbol 211 BitmapUsed by:212
Symbol 212 GraphicUses:211Used by:213
Symbol 213 MovieClipUses:212Used by:238
Symbol 214 GraphicUsed by:215
Symbol 215 MovieClipUses:214Used by:238
Symbol 216 GraphicUsed by:217
Symbol 217 MovieClipUses:216Used by:238
Symbol 218 ShapeTweeningUsed by:238
Symbol 219 GraphicUsed by:220
Symbol 220 MovieClipUses:219Used by:238
Symbol 221 GraphicUsed by:238
Symbol 222 GraphicUsed by:223
Symbol 223 MovieClipUses:222Used by:238
Symbol 224 GraphicUsed by:238
Symbol 225 GraphicUsed by:238
Symbol 226 ShapeTweeningUsed by:235
Symbol 227 GraphicUsed by:235
Symbol 228 BitmapUsed by:229
Symbol 229 GraphicUses:228Used by:230
Symbol 230 MovieClipUses:229Used by:235
Symbol 231 ShapeTweeningUsed by:235
Symbol 232 ShapeTweeningUsed by:235
Symbol 233 ShapeTweeningUsed by:235
Symbol 234 GraphicUsed by:235
Symbol 235 MovieClipUses:226 227 230 231 232 233 234Used by:238
Symbol 236 GraphicUsed by:237
Symbol 237 MovieClipUses:236Used by:238
Symbol 238 MovieClipUses:213 215 217 218 220 221 223 224 225 235 237Used by:255
Symbol 239 BitmapUsed by:240 247
Symbol 240 GraphicUses:239Used by:243 246 253 270 312 315 378 379 393 608 611 635 638 642 645 651 654
Symbol 241 TextUses:163Used by:243 253
Symbol 242 TextUses:163Used by:243 253
Symbol 243 ButtonUses:240 241 242Used by:255
Symbol 244 TextUses:163Used by:246
Symbol 245 TextUses:163Used by:246
Symbol 246 ButtonUses:240 244 245Used by:255 618
Symbol 247 GraphicUses:239Used by:252 254 285 409 426
Symbol 248 TextUses:163Used by:252 254
Symbol 249 TextUses:163Used by:252 254
Symbol 250 GraphicUsed by:252 254
Symbol 251 TextUses:163Used by:252 254
Symbol 252 ButtonUses:247 248 249 250 251Used by:255 280
Symbol 253 ButtonUses:240 241 242Used by:255
Symbol 254 ButtonUses:247 248 249 250 251Used by:255
Symbol 255 MovieClipUses:165 167 210 238 243 246 252 253 254Used by:Timeline
Symbol 256 BitmapUsed by:257
Symbol 257 GraphicUses:256Used by:Timeline
Symbol 258 BitmapUsed by:259
Symbol 259 GraphicUses:258Used by:Timeline
Symbol 260 BitmapUsed by:261
Symbol 261 GraphicUses:260Used by:Timeline
Symbol 262 TextUses:163Used by:280
Symbol 263 TextUses:163Used by:280
Symbol 264 FontUsed by:265 266 267
Symbol 265 TextUses:264Used by:280
Symbol 266 TextUses:264Used by:280
Symbol 267 TextUses:264Used by:280
Symbol 268 TextUses:163Used by:270 379
Symbol 269 TextUses:163Used by:270 379
Symbol 270 ButtonUses:240 268 269Used by:280 390
Symbol 271 TextUses:163Used by:280 383
Symbol 272 GraphicUsed by:276
Symbol 273 BitmapUsed by:275
Symbol 274 BitmapUsed by:275
Symbol 275 GraphicUses:273 274Used by:276
Symbol 276 MovieClipUses:272 275Used by:280
Symbol 277 BitmapUsed by:278 316
Symbol 278 GraphicUses:277Used by:279
Symbol 279 MovieClipUses:278Used by:280
Symbol 280 MovieClipUses:252 262 263 265 266 267 270 271 276 279Used by:Timeline
Symbol 281 TextUses:163Used by:290
Symbol 282 TextUses:163Used by:290
Symbol 283 TextUses:163Used by:285 426
Symbol 284 TextUses:163Used by:285 426
Symbol 285 ButtonUses:247 283 284Used by:290
Symbol 286 BitmapUsed by:289 309 325 331
Symbol 287 BitmapUsed by:289
Symbol 288 BitmapUsed by:289
Symbol 289 GraphicUses:286 287 288Used by:290
Symbol 290 MovieClipUses:281 282 285 289Used by:Timeline
Symbol 291 BitmapUsed by:292
Symbol 292 GraphicUses:291Used by:332
Symbol 293 BitmapUsed by:294
Symbol 294 GraphicUses:293Used by:332 368 369
Symbol 295 FontUsed by:296 297 298 299
Symbol 296 TextUses:295Used by:332
Symbol 297 TextUses:295Used by:332
Symbol 298 TextUses:295Used by:332
Symbol 299 TextUses:295Used by:332
Symbol 300 FontUsed by:301 302 303 304
Symbol 301 EditableTextUses:300Used by:332
Symbol 302 EditableTextUses:300Used by:332
Symbol 303 EditableTextUses:300Used by:332
Symbol 304 EditableTextUses:300Used by:332
Symbol 305 EditableTextUses:163Used by:332
Symbol 306 TextUses:163Used by:332
Symbol 307 TextUses:163Used by:332
Symbol 308 BitmapUsed by:309 325 331
Symbol 309 GraphicUses:286 308Used by:332
Symbol 310 TextUses:163Used by:312
Symbol 311 TextUses:163Used by:312
Symbol 312 ButtonUses:240 310 311Used by:332
Symbol 313 TextUses:163Used by:315
Symbol 314 TextUses:163Used by:315
Symbol 315 ButtonUses:240 313 314Used by:332
Symbol 316 GraphicUses:277Used by:317
Symbol 317 MovieClipUses:316Used by:332
Symbol 318 GraphicUsed by:319
Symbol 319 ButtonUses:318Used by:332
Symbol 320 BitmapUsed by:321
Symbol 321 GraphicUses:320Used by:332 370 371
Symbol 322 EditableTextUses:163Used by:332
Symbol 323 TextUses:163Used by:332
Symbol 324 TextUses:163Used by:332
Symbol 325 GraphicUses:286 308Used by:332
Symbol 326 BitmapUsed by:327
Symbol 327 GraphicUses:326Used by:332 372 373
Symbol 328 EditableTextUses:163Used by:332
Symbol 329 TextUses:163Used by:332
Symbol 330 TextUses:163Used by:332
Symbol 331 GraphicUses:286 308Used by:332
Symbol 332 MovieClipUses:292 294 296 297 298 299 301 302 303 304 305 306 307 309 312 315 317 319 321 322 323 324 325 327 328 329 330 331Used by:355
Symbol 333 GraphicUsed by:334
Symbol 334 MovieClipUses:333Used by:355
Symbol 335 FontUsed by:336
Symbol 336 TextUses:335Used by:355
Symbol 337 BitmapUsed by:338
Symbol 338 GraphicUses:337Used by:355
Symbol 339 TextUses:163Used by:342
Symbol 340 TextUses:163Used by:342
Symbol 341 GraphicUsed by:342 345
Symbol 342 ButtonUses:339 340 341Used by:355
Symbol 343 TextUses:163Used by:345
Symbol 344 TextUses:163Used by:345
Symbol 345 ButtonUses:343 344 341Used by:355
Symbol 346 EditableTextUses:163Used by:355
Symbol 347 BitmapUsed by:348
Symbol 348 GraphicUses:347Used by:355
Symbol 349 GraphicUsed by:353
Symbol 350 FontUsed by:351 352
Symbol 351 TextUses:350Used by:353
Symbol 352 TextUses:350Used by:353
Symbol 353 MovieClipUses:349 351 352Used by:355
Symbol 354 MovieClipUsed by:355
Symbol 355 MovieClipUses:332 334 336 338 342 345 346 348 353 354Used by:Timeline
Symbol 356 BitmapUsed by:357
Symbol 357 GraphicUses:356Used by:390
Symbol 358 TextUses:163Used by:390
Symbol 359 BitmapUsed by:360
Symbol 360 GraphicUses:359Used by:361 402
Symbol 361 MovieClipUses:360Used by:390
Symbol 362 TextUses:163Used by:365
Symbol 363 TextUses:163Used by:365
Symbol 364 GraphicUsed by:365 389
Symbol 365 ButtonUses:362 363 364Used by:390
Symbol 366 BitmapUsed by:367
Symbol 367 GraphicUses:366Used by:374
Symbol 368 MovieClipUses:294Used by:369
Symbol 369 MovieClipUses:294 368Used by:374 586
Symbol 370 MovieClipUses:321Used by:371
Symbol 371 MovieClipUses:321 370Used by:374 586
Symbol 372 MovieClipUses:327Used by:373
Symbol 373 MovieClipUses:327 372Used by:374 586
Symbol 374 MovieClipUses:367 369 371 373Used by:390
Symbol 375 TextUses:163Used by:390
Symbol 376 TextUses:163Used by:378
Symbol 377 TextUses:163Used by:378
Symbol 378 ButtonUses:240 376 377Used by:390
Symbol 379 ButtonUses:240 268 269Used by:390
Symbol 380 TextUses:163Used by:383
Symbol 381 TextUses:163Used by:383
Symbol 382 GraphicUsed by:383
Symbol 383 ButtonUses:380 381 382 271Used by:390
Symbol 384 GraphicUsed by:385
Symbol 385 MovieClipUses:384Used by:390
Symbol 386 GraphicUsed by:390
Symbol 387 TextUses:163Used by:389
Symbol 388 TextUses:163Used by:389
Symbol 389 ButtonUses:387 388 364Used by:390
Symbol 390 MovieClipUses:357 358 361 365 374 375 378 270 379 383 385 386 389Used by:Timeline
Symbol 391 TextUses:163Used by:393
Symbol 392 TextUses:163Used by:393
Symbol 393 ButtonUses:240 391 392Used by:Timeline
Symbol 394 BitmapUsed by:395
Symbol 395 GraphicUses:394Used by:412 617
Symbol 396 GraphicUsed by:397
Symbol 397 MovieClipUses:396Used by:402
Symbol 398 GraphicUsed by:399 411
Symbol 399 ButtonUses:398Used by:402 405
Symbol 400 GraphicUsed by:401
Symbol 401 MovieClipUses:400Used by:402
Symbol 402 MovieClipUses:360 397 399 401Used by:412 617
Symbol 403 GraphicUsed by:404
Symbol 404 MovieClipUses:403Used by:405
Symbol 405 MovieClipUses:399 404Used by:412 617
Symbol 406 TextUses:163Used by:412
Symbol 407 TextUses:163Used by:409
Symbol 408 TextUses:163Used by:409
Symbol 409 ButtonUses:247 407 408Used by:412
Symbol 410 VideoUsed by:412 617
Symbol 411 MovieClipUses:398Used by:412 617
Symbol 412 MovieClipUses:395 402 405 406 409 410 411Used by:Timeline
Symbol 413 BitmapUsed by:414
Symbol 414 GraphicUses:413Used by:Timeline
Symbol 415 EditableTextUses:163Used by:423
Symbol 416 GraphicUsed by:417
Symbol 417 ButtonUses:416Used by:420
Symbol 418 EditableTextUses:163Used by:420
Symbol 419 EditableTextUses:163Used by:420
Symbol 420 MovieClipUses:417 418 419Used by:423
Symbol 421 TextUses:163Used by:423
Symbol 422 TextUses:163Used by:423
Symbol 423 MovieClipUses:415 420 421 422Used by:Timeline
Symbol 424 EditableTextUses:163Used by:427
Symbol 425 EditableTextUses:163Used by:427
Symbol 426 ButtonUses:247 283 284Used by:427
Symbol 427 MovieClipUses:424 425 426Used by:Timeline
Symbol 428 BitmapUsed by:429
Symbol 429 GraphicUses:428Used by:430
Symbol 430 MovieClipUses:429Used by:555
Symbol 431 GraphicUsed by:432
Symbol 432 MovieClipUses:431Used by:441
Symbol 433 GraphicUsed by:434
Symbol 434 MovieClipUses:433Used by:441
Symbol 435 GraphicUsed by:436
Symbol 436 MovieClipUses:435Used by:441
Symbol 437 GraphicUsed by:438
Symbol 438 MovieClipUses:437Used by:441
Symbol 439 GraphicUsed by:440 466
Symbol 440 MovieClipUses:439Used by:441 444 453 554
Symbol 441 MovieClipUses:432 434 436 438 440Used by:555
Symbol 442 GraphicUsed by:443
Symbol 443 MovieClipUses:442Used by:444
Symbol 444 MovieClipUses:443 440Used by:555
Symbol 445 GraphicUsed by:446
Symbol 446 MovieClipUses:445Used by:453
Symbol 447 GraphicUsed by:448
Symbol 448 MovieClipUses:447Used by:453
Symbol 449 GraphicUsed by:450
Symbol 450 MovieClipUses:449Used by:453
Symbol 451 GraphicUsed by:452
Symbol 452 MovieClipUses:451Used by:453
Symbol 453 MovieClipUses:446 448 450 452 440Used by:555
Symbol 454 BitmapUsed by:455
Symbol 455 GraphicUses:454Used by:456
Symbol 456 MovieClipUses:455Used by:555
Symbol 457 GraphicUsed by:458
Symbol 458 MovieClipUses:457Used by:555
Symbol 459 BitmapUsed by:460
Symbol 460 GraphicUses:459Used by:465
Symbol 461 BitmapUsed by:462
Symbol 462 GraphicUses:461Used by:465
Symbol 463 BitmapUsed by:464
Symbol 464 GraphicUses:463Used by:465
Symbol 465 MovieClipUses:460 462 464Used by:482
Symbol 466 MovieClipUses:439Used by:482
Symbol 467 BitmapUsed by:468
Symbol 468 GraphicUses:467Used by:469
Symbol 469 MovieClipUses:468Used by:482
Symbol 470 BitmapUsed by:471
Symbol 471 GraphicUses:470Used by:472
Symbol 472 MovieClipUses:471Used by:482
Symbol 473 BitmapUsed by:474
Symbol 474 GraphicUses:473Used by:475
Symbol 475 MovieClipUses:474Used by:482
Symbol 476 BitmapUsed by:477
Symbol 477 GraphicUses:476Used by:478
Symbol 478 MovieClipUses:477Used by:482
Symbol 479 BitmapUsed by:480
Symbol 480 GraphicUses:479Used by:481
Symbol 481 MovieClipUses:480Used by:482
Symbol 482 MovieClipUses:465 466 469 472 475 478 481Used by:555
Symbol 483 GraphicUsed by:484
Symbol 484 MovieClipUses:483Used by:555
Symbol 485 GraphicUsed by:486
Symbol 486 MovieClipUses:485Used by:555
Symbol 487 GraphicUsed by:488
Symbol 488 MovieClipUses:487Used by:489
Symbol 489 MovieClipUses:488Used by:555
Symbol 490 BitmapUsed by:491
Symbol 491 GraphicUses:490Used by:496
Symbol 492 BitmapUsed by:493
Symbol 493 GraphicUses:492Used by:496
Symbol 494 BitmapUsed by:495
Symbol 495 GraphicUses:494Used by:496
Symbol 496 MovieClipUses:491 493 495Used by:555
Symbol 497 BitmapUsed by:498
Symbol 498 GraphicUses:497Used by:528
Symbol 499 BitmapUsed by:500
Symbol 500 GraphicUses:499Used by:528
Symbol 501 BitmapUsed by:502
Symbol 502 GraphicUses:501Used by:528
Symbol 503 BitmapUsed by:504
Symbol 504 GraphicUses:503Used by:528
Symbol 505 BitmapUsed by:506
Symbol 506 GraphicUses:505Used by:528
Symbol 507 BitmapUsed by:508
Symbol 508 GraphicUses:507Used by:528
Symbol 509 BitmapUsed by:510
Symbol 510 GraphicUses:509Used by:528
Symbol 511 BitmapUsed by:512
Symbol 512 GraphicUses:511Used by:528
Symbol 513 BitmapUsed by:514
Symbol 514 GraphicUses:513Used by:515
Symbol 515 MovieClipUses:514Used by:528
Symbol 516 BitmapUsed by:517
Symbol 517 GraphicUses:516Used by:518
Symbol 518 MovieClipUses:517Used by:528
Symbol 519 BitmapUsed by:520
Symbol 520 GraphicUses:519Used by:521
Symbol 521 MovieClipUses:520Used by:528
Symbol 522 BitmapUsed by:523
Symbol 523 GraphicUses:522Used by:524
Symbol 524 MovieClipUses:523Used by:528
Symbol 525 BitmapUsed by:526
Symbol 526 GraphicUses:525Used by:527
Symbol 527 MovieClipUses:526Used by:528
Symbol 528 MovieClipUses:498 500 502 504 506 508 510 512 515 518 521 524 527Used by:555
Symbol 529 BitmapUsed by:530
Symbol 530 GraphicUses:529Used by:545
Symbol 531 BitmapUsed by:532
Symbol 532 GraphicUses:531Used by:545
Symbol 533 BitmapUsed by:534
Symbol 534 GraphicUses:533Used by:545
Symbol 535 BitmapUsed by:536
Symbol 536 GraphicUses:535Used by:545
Symbol 537 BitmapUsed by:538
Symbol 538 GraphicUses:537Used by:545
Symbol 539 BitmapUsed by:540
Symbol 540 GraphicUses:539Used by:545
Symbol 541 BitmapUsed by:542
Symbol 542 GraphicUses:541Used by:545
Symbol 543 BitmapUsed by:544
Symbol 544 GraphicUses:543Used by:545
Symbol 545 MovieClipUses:530 532 534 536 538 540 542 544Used by:555
Symbol 546 GraphicUsed by:547
Symbol 547 MovieClipUses:546Used by:554
Symbol 548 GraphicUsed by:549
Symbol 549 MovieClipUses:548Used by:554
Symbol 550 GraphicUsed by:551
Symbol 551 MovieClipUses:550Used by:554
Symbol 552 GraphicUsed by:553
Symbol 553 MovieClipUses:552Used by:554
Symbol 554 MovieClipUses:547 549 551 553 440Used by:555
Symbol 555 MovieClipUses:430 441 444 453 456 458 482 484 486 489 496 528 545 554Used by:Timeline
Symbol 556 BitmapUsed by:557
Symbol 557 GraphicUses:556Used by:601
Symbol 558 TextUses:163Used by:562
Symbol 559 FontUsed by:560 561 619 620 621 628 646 648 684 686
Symbol 560 TextUses:559Used by:562
Symbol 561 TextUses:559Used by:562
Symbol 562 MovieClipUses:558 560 561Used by:563
Symbol 563 MovieClipUses:562Used by:601
Symbol 564 EditableTextUses:163Used by:601
Symbol 565 TextUses:163Used by:601
Symbol 566 EditableTextUses:163Used by:601
Symbol 567 GraphicUsed by:568
Symbol 568 MovieClipUses:567Used by:585
Symbol 569 GraphicUsed by:585
Symbol 570 GraphicUsed by:571
Symbol 571 MovieClipUses:570Used by:584
Symbol 572 GraphicUsed by:584
Symbol 573 GraphicUsed by:574
Symbol 574 MovieClipUses:573Used by:584
Symbol 575 GraphicUsed by:584
Symbol 576 GraphicUsed by:577
Symbol 577 MovieClipUses:576Used by:584
Symbol 578 GraphicUsed by:579
Symbol 579 MovieClipUses:578Used by:584
Symbol 580 GraphicUsed by:581
Symbol 581 MovieClipUses:580Used by:584
Symbol 582 GraphicUsed by:583
Symbol 583 MovieClipUses:582Used by:584
Symbol 584 MovieClipUses:571 572 574 575 577 579 581 583Used by:585
Symbol 585 MovieClipUses:568 569 584Used by:601
Symbol 586 MovieClipUses:369 371 373Used by:601
Symbol 587 EditableTextUses:163Used by:588
Symbol 588 MovieClipUses:587Used by:600
Symbol 589 GraphicUsed by:599
Symbol 590 BitmapUsed by:591
Symbol 591 GraphicUses:590Used by:599
Symbol 592 GraphicUsed by:593
Symbol 593 MovieClipUses:592Used by:599
Symbol 594 GraphicUsed by:599
Symbol 595 GraphicUsed by:599
Symbol 596 GraphicUsed by:599
Symbol 597 GraphicUsed by:599
Symbol 598 GraphicUsed by:599
Symbol 599 MovieClipUses:589 591 593 594 595 596 597 598Used by:600
Symbol 600 MovieClipUses:588 599Used by:601
Symbol 601 MovieClipUses:557 563 564 565 566 585 586 600Used by:Timeline
Symbol 602 BitmapUsed by:603
Symbol 603 GraphicUses:602Used by:Timeline
Symbol 604 BitmapUsed by:605
Symbol 605 GraphicUses:604Used by:Timeline
Symbol 606 TextUses:163Used by:608
Symbol 607 TextUses:163Used by:608
Symbol 608 ButtonUses:240 606 607Used by:618
Symbol 609 TextUses:163Used by:611
Symbol 610 TextUses:163Used by:611
Symbol 611 ButtonUses:240 609 610Used by:618
Symbol 612 EditableTextUses:163Used by:618
Symbol 613 TextUses:163Used by:618
Symbol 614 EditableTextUses:163Used by:618
Symbol 615 TextUses:163Used by:618
Symbol 616 TextUses:163Used by:618
Symbol 617 MovieClipUses:395 402 405 410 411Used by:618
Symbol 618 MovieClipUses:608 246 611 612 613 614 615 616 617Used by:Timeline
Symbol 619 TextUses:559Used by:Timeline
Symbol 620 TextUses:559Used by:Timeline
Symbol 621 TextUses:559Used by:Timeline
Symbol 622 FontUsed by:623 624 625
Symbol 623 EditableTextUses:622Used by:Timeline
Symbol 624 EditableTextUses:622Used by:Timeline
Symbol 625 EditableTextUses:622Used by:Timeline
Symbol 626 EditableTextUses:163Used by:627
Symbol 627 MovieClipUses:626Used by:Timeline
Symbol 628 TextUses:559Used by:629
Symbol 629 MovieClipUses:628Used by:Timeline
Symbol 630 FontUsed by:631
Symbol 631 TextUses:630Used by:632
Symbol 632 MovieClipUses:631Used by:Timeline
Symbol 633 TextUses:163Used by:635
Symbol 634 TextUses:163Used by:635
Symbol 635 MovieClipUses:240 633 634Used by:Timeline
Symbol 636 TextUses:163Used by:638
Symbol 637 TextUses:163Used by:638
Symbol 638 MovieClipUses:240 636 637Used by:Timeline
Symbol 639 TextUses:163Used by:Timeline
Symbol 640 TextUses:163Used by:642
Symbol 641 TextUses:163Used by:642
Symbol 642 ButtonUses:240 640 641Used by:647
Symbol 643 TextUses:163Used by:645
Symbol 644 TextUses:163Used by:645
Symbol 645 ButtonUses:240 643 644Used by:647
Symbol 646 TextUses:559Used by:647
Symbol 647 MovieClipUses:642 645 646Used by:Timeline
Symbol 648 TextUses:559Used by:Timeline
Symbol 649 TextUses:163Used by:651
Symbol 650 TextUses:163Used by:651
Symbol 651 ButtonUses:240 649 650Used by:685 687
Symbol 652 TextUses:163Used by:654
Symbol 653 TextUses:163Used by:654
Symbol 654 ButtonUses:240 652 653Used by:685
Symbol 655 GraphicUsed by:656
Symbol 656 MovieClipUses:655Used by:680
Symbol 657 BitmapUsed by:658
Symbol 658 GraphicUses:657Used by:680
Symbol 659 GraphicUsed by:660
Symbol 660 MovieClipUses:659Used by:680
Symbol 661 BitmapUsed by:662
Symbol 662 GraphicUses:661Used by:680
Symbol 663 GraphicUsed by:664
Symbol 664 MovieClipUses:663Used by:680
Symbol 665 BitmapUsed by:666
Symbol 666 GraphicUses:665Used by:680
Symbol 667 GraphicUsed by:668
Symbol 668 MovieClipUses:667Used by:680
Symbol 669 BitmapUsed by:670
Symbol 670 GraphicUses:669Used by:680
Symbol 671 GraphicUsed by:672
Symbol 672 MovieClipUses:671Used by:680
Symbol 673 BitmapUsed by:674
Symbol 674 GraphicUses:673Used by:680
Symbol 675 GraphicUsed by:679
Symbol 676 GraphicUsed by:679
Symbol 677 GraphicUsed by:679
Symbol 678 GraphicUsed by:679
Symbol 679 MovieClipUses:675 676 677 678Used by:680
Symbol 680 MovieClipUses:656 658 660 662 664 666 668 670 672 674 679Used by:685
Symbol 681 EditableTextUses:163Used by:685
Symbol 682 TextUses:163Used by:685
Symbol 683 TextUses:163Used by:685
Symbol 684 TextUses:559Used by:685
Symbol 685 MovieClipUses:651 654 680 681 682 683 684Used by:Timeline
Symbol 686 TextUses:559Used by:687
Symbol 687 MovieClipUses:651 686 125Used by:Timeline
Streaming Sound 1Used by:Symbol 197 MovieClip

Instance Names

"fader"Frame 1Symbol 169 MovieClip
"fx"Frame 5Symbol 204 MovieClip
"chooserCars"Frame 34Symbol 355 MovieClip
"game"Frame 73Symbol 555 MovieClip
"hud"Frame 73Symbol 601 MovieClip
"friends_email"Frame 94Symbol 623 EditableText
"your_name"Frame 94Symbol 624 EditableText
"friend_name"Frame 94Symbol 625 EditableText
"problem_sending"Frame 94Symbol 627 MovieClip
"invalid_email"Frame 94Symbol 629 MovieClip
"invalid_friend_name"Frame 94Symbol 632 MovieClip
"invalid_your_name"Frame 94Symbol 632 MovieClip
"cancel_btn"Frame 94Symbol 635 MovieClip
"send_btn"Frame 94Symbol 638 MovieClip
"boundingBox_mc"Symbol 34 MovieClip [FocusRect] Frame 1Symbol 12 MovieClip [BoundingBox]
"tabCapture"Symbol 35 MovieClip [FocusManager] Frame 1Symbol 32 Button
"b"Symbol 46 MovieClip [SimpleButtonDown] Frame 1Symbol 43 MovieClip [BrdrShdw]
"face"Symbol 46 MovieClip [SimpleButtonDown] Frame 1Symbol 45 MovieClip [BrdrFace]
"b"Symbol 51 MovieClip [SimpleButtonIn] Frame 1Symbol 48 MovieClip [BrdrBlk]
"it"Symbol 51 MovieClip [SimpleButtonIn] Frame 1Symbol 50 MovieClip [BrdrHilght]
"g"Symbol 51 MovieClip [SimpleButtonIn] Frame 1Symbol 43 MovieClip [BrdrShdw]
"face"Symbol 51 MovieClip [SimpleButtonIn] Frame 1Symbol 45 MovieClip [BrdrFace]
"ob"Symbol 52 MovieClip [SimpleButtonUp] Frame 1Symbol 48 MovieClip [BrdrBlk]
"ol"Symbol 52 MovieClip [SimpleButtonUp] Frame 1Symbol 45 MovieClip [BrdrFace]
"ib"Symbol 52 MovieClip [SimpleButtonUp] Frame 1Symbol 43 MovieClip [BrdrShdw]
"il"Symbol 52 MovieClip [SimpleButtonUp] Frame 1Symbol 50 MovieClip [BrdrHilght]
"face"Symbol 52 MovieClip [SimpleButtonUp] Frame 1Symbol 45 MovieClip [BrdrFace]
"boundingBox_mc"Symbol 53 MovieClip [SimpleButton] Frame 1Symbol 12 MovieClip [BoundingBox]
"boundingBox_mc"Symbol 57 MovieClip [Button] Frame 1Symbol 12 MovieClip [BoundingBox]
"dfs"Symbol 113 MovieClip [BtnDownArrow] Frame 1Symbol 61 MovieClip [ScrollTrack]
"dfs"Symbol 114 MovieClip [BtnUpArrow] Frame 1Symbol 61 MovieClip [ScrollTrack]
"boundingBox_mc"Symbol 116 MovieClip [HScrollBar] Frame 1Symbol 12 MovieClip [BoundingBox]
"boundingBox_mc"Symbol 117 MovieClip [VScrollBar] Frame 1Symbol 12 MovieClip [BoundingBox]
"boundingBox_mc"Symbol 118 MovieClip [View] Frame 1Symbol 12 MovieClip [BoundingBox]
"boundingBox_mc"Symbol 119 MovieClip [ScrollView] Frame 1Symbol 12 MovieClip [BoundingBox]
"boundingBox_mc"Symbol 121 MovieClip [List] Frame 1Symbol 12 MovieClip [BoundingBox]
"label"Symbol 124 MovieClip [TextInput] Frame 1Symbol 123 EditableText
"boundingBox_mc"Symbol 125 MovieClip [DataGrid] Frame 1Symbol 12 MovieClip [BoundingBox]
"bar"Symbol 162 MovieClip Frame 1Symbol 161 MovieClip
"idle"Symbol 204 MovieClip Frame 1Symbol 172 MovieClip
"roll"Symbol 204 MovieClip Frame 1Symbol 175 MovieClip
"music"Symbol 204 MovieClip Frame 1Symbol 177 MovieClip
"buzzerShort"Symbol 204 MovieClip Frame 1Symbol 179 MovieClip
"buzzerLong"Symbol 204 MovieClip Frame 1Symbol 180 MovieClip
"crowd"Symbol 204 MovieClip Frame 1Symbol 182 MovieClip
"crash"Symbol 204 MovieClip Frame 1Symbol 188 MovieClip
"vroom"Symbol 204 MovieClip Frame 1Symbol 190 MovieClip
"victory"Symbol 204 MovieClip Frame 1Symbol 192 MovieClip
"bonus"Symbol 204 MovieClip Frame 1Symbol 195 MovieClip
"accel"Symbol 204 MovieClip Frame 1Symbol 197 MovieClip
"speaker"Symbol 204 MovieClip Frame 1Symbol 201 MovieClip
"agame_btn"Symbol 255 MovieClip Frame 1Symbol 210 MovieClip
"moregames_btn"Symbol 255 MovieClip Frame 1Symbol 238 MovieClip
"current"Symbol 355 MovieClip Frame 1Symbol 332 MovieClip
"center"Symbol 355 MovieClip Frame 1Symbol 334 MovieClip
"left"Symbol 355 MovieClip Frame 1Symbol 334 MovieClip
"right"Symbol 355 MovieClip Frame 1Symbol 334 MovieClip
"coming"Symbol 355 MovieClip Frame 1Symbol 332 MovieClip
"overlay"Symbol 355 MovieClip Frame 1Symbol 353 MovieClip
"mc_print"Symbol 355 MovieClip Frame 1Symbol 354 MovieClip
"inside"Symbol 374 MovieClip Frame 1Symbol 369 MovieClip
"inside"Symbol 374 MovieClip Frame 2Symbol 371 MovieClip
"inside"Symbol 374 MovieClip Frame 3Symbol 373 MovieClip
"car"Symbol 390 MovieClip Frame 1Symbol 374 MovieClip
"btnPause"Symbol 402 MovieClip Frame 1Symbol 399 Button
"btnDrag"Symbol 405 MovieClip Frame 1Symbol 399 Button
"playpause"Symbol 412 MovieClip Frame 1Symbol 402 MovieClip
"video_progress_bar"Symbol 412 MovieClip Frame 1Symbol 405 MovieClip
"my_video"Symbol 412 MovieClip Frame 1Symbol 410 Video
"hook0"Symbol 412 MovieClip Frame 1Symbol 411 MovieClip
"hook1"Symbol 412 MovieClip Frame 1Symbol 411 MovieClip
"choice3"Symbol 423 MovieClip Frame 1Symbol 420 MovieClip
"choice2"Symbol 423 MovieClip Frame 1Symbol 420 MovieClip
"choice1"Symbol 423 MovieClip Frame 1Symbol 420 MovieClip
"choice0"Symbol 423 MovieClip Frame 1Symbol 420 MovieClip
"hitter0"Symbol 441 MovieClip Frame 1Symbol 432 MovieClip
"hitter1"Symbol 441 MovieClip Frame 1Symbol 434 MovieClip
"hitter2"Symbol 441 MovieClip Frame 1Symbol 436 MovieClip
"hitter3"Symbol 441 MovieClip Frame 1Symbol 438 MovieClip
"node1"Symbol 441 MovieClip Frame 1Symbol 440 MovieClip
"node2"Symbol 441 MovieClip Frame 1Symbol 440 MovieClip
"node3"Symbol 441 MovieClip Frame 1Symbol 440 MovieClip
"node0"Symbol 441 MovieClip Frame 1Symbol 440 MovieClip
"node4"Symbol 441 MovieClip Frame 1Symbol 440 MovieClip
"hitter0"Symbol 444 MovieClip Frame 1Symbol 443 MovieClip
"node0"Symbol 444 MovieClip Frame 1Symbol 440 MovieClip
"node1"Symbol 444 MovieClip Frame 1Symbol 440 MovieClip
"hitter3"Symbol 453 MovieClip Frame 1Symbol 446 MovieClip
"hitter2"Symbol 453 MovieClip Frame 1Symbol 448 MovieClip
"hitter1"Symbol 453 MovieClip Frame 1Symbol 450 MovieClip
"hitter0"Symbol 453 MovieClip Frame 1Symbol 452 MovieClip
"node3"Symbol 453 MovieClip Frame 1Symbol 440 MovieClip
"node2"Symbol 453 MovieClip Frame 1Symbol 440 MovieClip
"node1"Symbol 453 MovieClip Frame 1Symbol 440 MovieClip
"node4"Symbol 453 MovieClip Frame 1Symbol 440 MovieClip
"node0"Symbol 453 MovieClip Frame 1Symbol 440 MovieClip
"hitter"Symbol 482 MovieClip Frame 1Symbol 465 MovieClip
"hitter"Symbol 482 MovieClip Frame 2Symbol 469 MovieClip
"hitter"Symbol 482 MovieClip Frame 3Symbol 472 MovieClip
"hitter"Symbol 482 MovieClip Frame 4Symbol 475 MovieClip
"hitter"Symbol 482 MovieClip Frame 5Symbol 478 MovieClip
"hitter"Symbol 482 MovieClip Frame 6Symbol 481 MovieClip
"hitter1"Symbol 554 MovieClip Frame 1Symbol 547 MovieClip
"hitter2"Symbol 554 MovieClip Frame 1Symbol 549 MovieClip
"hitter3"Symbol 554 MovieClip Frame 1Symbol 551 MovieClip
"hitter0"Symbol 554 MovieClip Frame 1Symbol 553 MovieClip
"node0"Symbol 554 MovieClip Frame 1Symbol 440 MovieClip
"node1"Symbol 554 MovieClip Frame 1Symbol 440 MovieClip
"node2"Symbol 554 MovieClip Frame 1Symbol 440 MovieClip
"node3"Symbol 554 MovieClip Frame 1Symbol 440 MovieClip
"ball"Symbol 555 MovieClip Frame 1Symbol 482 MovieClip
"ball2"Symbol 555 MovieClip Frame 1Symbol 482 MovieClip
"path0"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path1"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path2"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"ball3"Symbol 555 MovieClip Frame 1Symbol 482 MovieClip
"ball1"Symbol 555 MovieClip Frame 1Symbol 482 MovieClip
"path6"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path3"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path4"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path7"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path8"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path5"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path14"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path9"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path13"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path10"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path16"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path12"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path17"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path18"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"path11"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"ball5"Symbol 555 MovieClip Frame 1Symbol 482 MovieClip
"ball4"Symbol 555 MovieClip Frame 1Symbol 482 MovieClip
"checkPoint3"Symbol 555 MovieClip Frame 1Symbol 486 MovieClip
"checkPoint0"Symbol 555 MovieClip Frame 1Symbol 486 MovieClip
"checkPoint1"Symbol 555 MovieClip Frame 1Symbol 486 MovieClip
"checkPoint2"Symbol 555 MovieClip Frame 1Symbol 486 MovieClip
"path15"Symbol 555 MovieClip Frame 1Symbol 484 MovieClip
"sparkKing"Symbol 555 MovieClip Frame 1Symbol 489 MovieClip
"smokeKing"Symbol 555 MovieClip Frame 1Symbol 496 MovieClip
"puffKing"Symbol 555 MovieClip Frame 1Symbol 528 MovieClip
"explosionKing"Symbol 555 MovieClip Frame 1Symbol 545 MovieClip
"ball1"Symbol 555 MovieClip Frame 10Symbol 482 MovieClip
"path0"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path1"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path3"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path2"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path5"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path4"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path7"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path6"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path8"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path9"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path10"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path12"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path11"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path14"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path13"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path16"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path15"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"path17"Symbol 555 MovieClip Frame 10Symbol 484 MovieClip
"hitter"Symbol 584 MovieClip Frame 1Symbol 571 MovieClip
"hitter"Symbol 584 MovieClip Frame 2Symbol 574 MovieClip
"hitter"Symbol 584 MovieClip Frame 3Symbol 577 MovieClip
"hitter"Symbol 584 MovieClip Frame 4Symbol 579 MovieClip
"hitter"Symbol 584 MovieClip Frame 5Symbol 581 MovieClip
"hitter"Symbol 584 MovieClip Frame 6Symbol 583 MovieClip
"ball"Symbol 585 MovieClip Frame 1Symbol 584 MovieClip
"ball2"Symbol 585 MovieClip Frame 1Symbol 584 MovieClip
"ball3"Symbol 585 MovieClip Frame 1Symbol 584 MovieClip
"ball1"Symbol 585 MovieClip Frame 1Symbol 584 MovieClip
"ball5"Symbol 585 MovieClip Frame 1Symbol 584 MovieClip
"ball4"Symbol 585 MovieClip Frame 1Symbol 584 MovieClip
"inside"Symbol 586 MovieClip Frame 1Symbol 369 MovieClip
"inside"Symbol 586 MovieClip Frame 2Symbol 371 MovieClip
"inside"Symbol 586 MovieClip Frame 3Symbol 373 MovieClip
"setter"Symbol 601 MovieClip Frame 1Symbol 563 MovieClip
"game"Symbol 601 MovieClip Frame 1Symbol 585 MovieClip
"car"Symbol 601 MovieClip Frame 1Symbol 586 MovieClip
"slammer"Symbol 601 MovieClip Frame 1Symbol 600 MovieClip
"playpause"Symbol 617 MovieClip Frame 1Symbol 402 MovieClip
"video_progress_bar"Symbol 617 MovieClip Frame 1Symbol 405 MovieClip
"my_video"Symbol 617 MovieClip Frame 1Symbol 410 Video
"hook0"Symbol 617 MovieClip Frame 1Symbol 411 MovieClip
"hook1"Symbol 617 MovieClip Frame 1Symbol 411 MovieClip
"played_mc"Symbol 680 MovieClip Frame 16Symbol 679 MovieClip
"awards_mc"Symbol 685 MovieClip Frame 1Symbol 680 MovieClip
"score_txt"Symbol 685 MovieClip Frame 1Symbol 681 EditableText
"my_dg"Symbol 687 MovieClip Frame 1Symbol 125 MovieClip [DataGrid]

Special Tags

FileAttributes (69)Timeline Frame 1Access local files only, Metadata not present, AS1/AS2.
ExportAssets (56)Timeline Frame 1Symbol 12 as "BoundingBox"
ExportAssets (56)Timeline Frame 1Symbol 14 as "DataHeaderBackGnd"
ExportAssets (56)Timeline Frame 1Symbol 16 as "DataHeaderOverlay"
ExportAssets (56)Timeline Frame 1Symbol 18 as "DataHeaderSeperator"
ExportAssets (56)Timeline Frame 1Symbol 20 as "DataSortArrow"
ExportAssets (56)Timeline Frame 1Symbol 22 as "DataStretchBar"
ExportAssets (56)Timeline Frame 1Symbol 24 as "cursorStretch"
ExportAssets (56)Timeline Frame 1Symbol 25 as "DataGridAssets"
ExportAssets (56)Timeline Frame 1Symbol 26 as "DataGridColumn"
ExportAssets (56)Timeline Frame 1Symbol 27 as "Defaults"
ExportAssets (56)Timeline Frame 1Symbol 28 as "UIObjectExtensions"
ExportAssets (56)Timeline Frame 1Symbol 29 as "UIObject"
ExportAssets (56)Timeline Frame 1Symbol 34 as "FocusRect"
ExportAssets (56)Timeline Frame 1Symbol 35 as "FocusManager"
ExportAssets (56)Timeline Frame 1Symbol 36 as "UIComponentExtensions"
ExportAssets (56)Timeline Frame 1Symbol 37 as "UIComponent"
ExportAssets (56)Timeline Frame 1Symbol 38 as "SelectableRow"
ExportAssets (56)Timeline Frame 1Symbol 39 as "DataGridRow"
ExportAssets (56)Timeline Frame 1Symbol 40 as "DataProvider"
ExportAssets (56)Timeline Frame 1Symbol 41 as "DataSelector"
ExportAssets (56)Timeline Frame 1Symbol 43 as "BrdrShdw"
ExportAssets (56)Timeline Frame 1Symbol 45 as "BrdrFace"
ExportAssets (56)Timeline Frame 1Symbol 46 as "SimpleButtonDown"
ExportAssets (56)Timeline Frame 1Symbol 48 as "BrdrBlk"
ExportAssets (56)Timeline Frame 1Symbol 50 as "BrdrHilght"
ExportAssets (56)Timeline Frame 1Symbol 51 as "SimpleButtonIn"
ExportAssets (56)Timeline Frame 1Symbol 52 as "SimpleButtonUp"
ExportAssets (56)Timeline Frame 1Symbol 53 as "SimpleButton"
ExportAssets (56)Timeline Frame 1Symbol 54 as "Border"
ExportAssets (56)Timeline Frame 1Symbol 55 as "RectBorder"
ExportAssets (56)Timeline Frame 1Symbol 56 as "ButtonSkin"
ExportAssets (56)Timeline Frame 1Symbol 57 as "Button"
ExportAssets (56)Timeline Frame 1Symbol 58 as "CustomBorder"
ExportAssets (56)Timeline Frame 1Symbol 61 as "ScrollTrack"
ExportAssets (56)Timeline Frame 1Symbol 68 as "ScrollDownArrowDisabled"
ExportAssets (56)Timeline Frame 1Symbol 70 as "ScrollThemeColor1"
ExportAssets (56)Timeline Frame 1Symbol 72 as "ScrollThemeColor2"
ExportAssets (56)Timeline Frame 1Symbol 73 as "ScrollDownArrowDown"
ExportAssets (56)Timeline Frame 1Symbol 74 as "ScrollDownArrowOver"
ExportAssets (56)Timeline Frame 1Symbol 75 as "ScrollDownArrowUp"
ExportAssets (56)Timeline Frame 1Symbol 81 as "ScrollThumbBottomDisabled"
ExportAssets (56)Timeline Frame 1Symbol 83 as "ThumbThemeColor1"
ExportAssets (56)Timeline Frame 1Symbol 85 as "ThumbThemeColor3"
ExportAssets (56)Timeline Frame 1Symbol 86 as "ScrollThumbBottomDown"
ExportAssets (56)Timeline Frame 1Symbol 87 as "ScrollThumbBottomOver"
ExportAssets (56)Timeline Frame 1Symbol 88 as "ScrollThumbBottomUp"
ExportAssets (56)Timeline Frame 1Symbol 90 as "ScrollThumbGripDisabled"
ExportAssets (56)Timeline Frame 1Symbol 92 as "ThumbThemeColor2"
ExportAssets (56)Timeline Frame 1Symbol 93 as "ScrollThumbGripDown"
ExportAssets (56)Timeline Frame 1Symbol 94 as "ScrollThumbGripOver"
ExportAssets (56)Timeline Frame 1Symbol 95 as "ScrollThumbGripUp"
ExportAssets (56)Timeline Frame 1Symbol 97 as "ScrollThumbMiddleDisabled"
ExportAssets (56)Timeline Frame 1Symbol 98 as "ScrollThumbMiddleDown"
ExportAssets (56)Timeline Frame 1Symbol 102 as "ScrollThumbMiddleOver"
ExportAssets (56)Timeline Frame 1Symbol 103 as "ScrollThumbMiddleUp"
ExportAssets (56)Timeline Frame 1Symbol 104 as "ScrollThumbTopDisabled"
ExportAssets (56)Timeline Frame 1Symbol 105 as "ScrollThumbTopDown"
ExportAssets (56)Timeline Frame 1Symbol 106 as "ScrollThumbTopOver"
ExportAssets (56)Timeline Frame 1Symbol 107 as "ScrollThumbTopUp"
ExportAssets (56)Timeline Frame 1Symbol 108 as "ScrollTrackDisabled"
ExportAssets (56)Timeline Frame 1Symbol 109 as "ScrollUpArrowDisabled"
ExportAssets (56)Timeline Frame 1Symbol 110 as "ScrollUpArrowDown"
ExportAssets (56)Timeline Frame 1Symbol 111 as "ScrollUpArrowOver"
ExportAssets (56)Timeline Frame 1Symbol 112 as "ScrollUpArrowUp"
ExportAssets (56)Timeline Frame 1Symbol 113 as "BtnDownArrow"
ExportAssets (56)Timeline Frame 1Symbol 114 as "BtnUpArrow"
ExportAssets (56)Timeline Frame 1Symbol 115 as "ScrollBarAssets"
ExportAssets (56)Timeline Frame 1Symbol 116 as "HScrollBar"
ExportAssets (56)Timeline Frame 1Symbol 117 as "VScrollBar"
ExportAssets (56)Timeline Frame 1Symbol 118 as "View"
ExportAssets (56)Timeline Frame 1Symbol 119 as "ScrollView"
ExportAssets (56)Timeline Frame 1Symbol 120 as "ScrollSelectList"
ExportAssets (56)Timeline Frame 1Symbol 121 as "List"
ExportAssets (56)Timeline Frame 1Symbol 124 as "TextInput"
ExportAssets (56)Timeline Frame 1Symbol 125 as "DataGrid"
ExportAssets (56)Timeline Frame 1Symbol 688 as "__Packages.mx.remoting.debug.NetDebug"
ExportAssets (56)Timeline Frame 1Symbol 689 as "__Packages.mx.remoting.debug.NetDebugConfig"
ExportAssets (56)Timeline Frame 1Symbol 690 as "__Packages.mx.remoting.debug.GlobalLocalConnection"
ExportAssets (56)Timeline Frame 1Symbol 691 as "__Packages.mx.remoting.debug.events.NetDebug"
ExportAssets (56)Timeline Frame 1Symbol 692 as "__Packages.mx.remoting.debug.events.NetDebugNetConnection"
ExportAssets (56)Timeline Frame 1Symbol 693 as "__Packages.mx.remoting.debug.events.NetDebugDuplicateNCDError"
ExportAssets (56)Timeline Frame 1Symbol 694 as "__Packages.mx.remoting.debug.commands.Local"
ExportAssets (56)Timeline Frame 1Symbol 695 as "__Packages.mx.remoting.debug.commands.GetConfig"
ExportAssets (56)Timeline Frame 1Symbol 696 as "__Packages.mx.remoting.NetServices"
ExportAssets (56)Timeline Frame 1Symbol 697 as "__Packages.mx.services.Log"
ExportAssets (56)Timeline Frame 1Symbol 698 as "__Packages.mx.remoting.Connection"
ExportAssets (56)Timeline Frame 1Symbol 699 as "__Packages.mx.remoting.NetServiceProxy"
ExportAssets (56)Timeline Frame 1Symbol 700 as "__Packages.mx.remoting.NetServiceProxyResponder"
ExportAssets (56)Timeline Frame 1Symbol 701 as "__Packages.mx.data.PageableData"
ExportAssets (56)Timeline Frame 1Symbol 702 as "__Packages.mx.data.DataRange"
ExportAssets (56)Timeline Frame 1Symbol 703 as "__Packages.mx.data.PageableList"
ExportAssets (56)Timeline Frame 1Symbol 704 as "__Packages.mx.remoting.RecordSet"
ExportAssets (56)Timeline Frame 1Symbol 6 as "__Packages.mx.events.EventDispatcher"
ExportAssets (56)Timeline Frame 1Symbol 705 as "__Packages.mx.utils.Iterator"
ExportAssets (56)Timeline Frame 1Symbol 706 as "__Packages.mx.remoting.RecordSetIterator"
ExportAssets (56)Timeline Frame 1Symbol 707 as "__Packages.mx.remoting.RsDataFetcher"
ExportAssets (56)Timeline Frame 1Symbol 708 as "__Packages.mx.remoting.RsDataRange"
ExportAssets (56)Timeline Frame 1Symbol 709 as "__Packages.mx.remoting.debug.events.NetDebugFailedSendError"
ExportAssets (56)Timeline Frame 1Symbol 710 as "__Packages.mx.utils.ObjectCopy"
ExportAssets (56)Timeline Frame 1Symbol 711 as "__Packages.mx.remoting.debug.events.NetDebugStatus"
ExportAssets (56)Timeline Frame 1Symbol 712 as "__Packages.mx.remoting.debug.events.NetDebugError"
ExportAssets (56)Timeline Frame 1Symbol 713 as "__Packages.mx.remoting.debug.ConnectionMixin"
ExportAssets (56)Timeline Frame 1Symbol 714 as "__Packages.mx.remoting.debug.events.NetDebugConnect"
ExportAssets (56)Timeline Frame 1Symbol 715 as "__Packages.mx.remoting.debug.commands.StartRTMPTrace"
ExportAssets (56)Timeline Frame 1Symbol 716 as "__Packages.mx.remoting.RTMPClientIDResponse"
ExportAssets (56)Timeline Frame 1Symbol 717 as "__Packages.mx.remoting.debug.commands.AddRTMPClient"
ExportAssets (56)Timeline Frame 1Symbol 718 as "__Packages.mx.remoting.debug.events.NetDebugCall"
ExportAssets (56)Timeline Frame 1Symbol 719 as "__Packages.mx.remoting.debug.NetDebugResponseProxy"
ExportAssets (56)Timeline Frame 1Symbol 720 as "__Packages.mx.remoting.debug.events.NetDebugResult"
ExportAssets (56)Timeline Frame 1Symbol 721 as "__Packages.mx.remoting.debug.events.NetDebugReceiveCall"
ExportAssets (56)Timeline Frame 1Symbol 722 as "__Packages.mx.remoting.debug.events.NetDebugClose"
ExportAssets (56)Timeline Frame 1Symbol 723 as "__Packages.mx.remoting.debug.commands.StopRTMPTrace"
ExportAssets (56)Timeline Frame 1Symbol 724 as "__Packages.mx.remoting.debug.events.NetDebugAddHeader"
ExportAssets (56)Timeline Frame 1Symbol 725 as "__Packages.mx.remoting.debug.events.NetDebugTrace"
ExportAssets (56)Timeline Frame 1Symbol 726 as "__Packages.mx.remoting.debug.events.NetDebugTraceNetServices"
ExportAssets (56)Timeline Frame 1Symbol 727 as "__Packages.mattel.utils.EmailServices"
ExportAssets (56)Timeline Frame 1Symbol 728 as "__Packages.mattel.utils.Logger"
ExportAssets (56)Timeline Frame 1Symbol 729 as "__Packages.mattel.data.StringExtensions"
ExportAssets (56)Timeline Frame 1Symbol 730 as "__Packages.mattel.system.ApplicationSettings"
ExportAssets (56)Timeline Frame 1Symbol 1 as "__Packages.mx.core.UIObject"
ExportAssets (56)Timeline Frame 1Symbol 2 as "__Packages.mx.core.UIComponent"
ExportAssets (56)Timeline Frame 1Symbol 3 as "__Packages.mx.core.View"
ExportAssets (56)Timeline Frame 1Symbol 4 as "__Packages.mx.core.ScrollView"
ExportAssets (56)Timeline Frame 1Symbol 5 as "__Packages.mx.controls.listclasses.DataSelector"
ExportAssets (56)Timeline Frame 1Symbol 7 as "__Packages.mx.controls.listclasses.DataProvider"
ExportAssets (56)Timeline Frame 1Symbol 8 as "__Packages.mx.controls.listclasses.ScrollSelectList"
ExportAssets (56)Timeline Frame 1Symbol 9 as "__Packages.mx.controls.List"
ExportAssets (56)Timeline Frame 1Symbol 10 as "__Packages.mx.controls.DataGrid"
ExportAssets (56)Timeline Frame 1Symbol 126 as "__Packages.mx.skins.SkinElement"
ExportAssets (56)Timeline Frame 1Symbol 127 as "__Packages.mx.styles.CSSTextStyles"
ExportAssets (56)Timeline Frame 1Symbol 128 as "__Packages.mx.styles.StyleManager"
ExportAssets (56)Timeline Frame 1Symbol 129 as "__Packages.mx.styles.CSSStyleDeclaration"
ExportAssets (56)Timeline Frame 1Symbol 130 as "__Packages.mx.skins.Border"
ExportAssets (56)Timeline Frame 1Symbol 131 as "__Packages.mx.skins.RectBorder"
ExportAssets (56)Timeline Frame 1Symbol 132 as "__Packages.mx.managers.DepthManager"
ExportAssets (56)Timeline Frame 1Symbol 133 as "__Packages.mx.events.UIEventDispatcher"
ExportAssets (56)Timeline Frame 1Symbol 134 as "__Packages.mx.core.ExternalContent"
ExportAssets (56)Timeline Frame 1Symbol 135 as "__Packages.mx.skins.CustomBorder"
ExportAssets (56)Timeline Frame 1Symbol 136 as "__Packages.mx.controls.scrollClasses.ScrollThumb"
ExportAssets (56)Timeline Frame 1Symbol 137 as "__Packages.mx.controls.SimpleButton"
ExportAssets (56)Timeline Frame 1Symbol 138 as "__Packages.mx.controls.scrollClasses.ScrollBar"
ExportAssets (56)Timeline Frame 1Symbol 139 as "__Packages.mx.effects.Tween"
ExportAssets (56)Timeline Frame 1Symbol 140 as "__Packages.mx.controls.gridclasses.DataGridColumn"
ExportAssets (56)Timeline Frame 1Symbol 141 as "__Packages.mx.controls.listclasses.SelectableRow"
ExportAssets (56)Timeline Frame 1Symbol 142 as "__Packages.mx.controls.gridclasses.DataGridRow"
ExportAssets (56)Timeline Frame 1Symbol 143 as "__Packages.mx.controls.TextInput"
ExportAssets (56)Timeline Frame 1Symbol 144 as "__Packages.mx.skins.ColoredSkinElement"
ExportAssets (56)Timeline Frame 1Symbol 145 as "__Packages.mx.core.ext.UIObjectExtensions"
ExportAssets (56)Timeline Frame 1Symbol 146 as "__Packages.mx.skins.halo.Defaults"
ExportAssets (56)Timeline Frame 1Symbol 147 as "__Packages.mx.managers.SystemManager"
ExportAssets (56)Timeline Frame 1Symbol 148 as "__Packages.mx.managers.FocusManager"
ExportAssets (56)Timeline Frame 1Symbol 149 as "__Packages.mx.skins.halo.FocusRect"
ExportAssets (56)Timeline Frame 1Symbol 150 as "__Packages.mx.managers.OverlappedWindows"
ExportAssets (56)Timeline Frame 1Symbol 151 as "__Packages.mx.styles.CSSSetStyle"
ExportAssets (56)Timeline Frame 1Symbol 152 as "__Packages.mx.core.ext.UIComponentExtensions"
ExportAssets (56)Timeline Frame 1Symbol 153 as "__Packages.mx.controls.HScrollBar"
ExportAssets (56)Timeline Frame 1Symbol 154 as "__Packages.mx.controls.Button"
ExportAssets (56)Timeline Frame 1Symbol 155 as "__Packages.mx.skins.halo.RectBorder"
ExportAssets (56)Timeline Frame 1Symbol 156 as "__Packages.mx.skins.halo.ButtonSkin"
ExportAssets (56)Timeline Frame 1Symbol 157 as "__Packages.mx.controls.VScrollBar"

Labels

"pre"Frame 5
"title"Frame 9
"inter"Frame 16
"instructions"Frame 24
"choose"Frame 34
"location"Frame 42
"video"Frame 50
"question"Frame 58
"answer"Frame 66
"game"Frame 73
"results"Frame 81
"send"Frame 94
"sentmail"Frame 99
"checkScore"Frame 108
"submitScore"Frame 118
"highscores"Frame 128
"enter"Symbol 172 MovieClip Frame 2
"on"Symbol 172 MovieClip Frame 7
"exit"Symbol 172 MovieClip Frame 16
"enter"Symbol 177 MovieClip Frame 2
"on"Symbol 177 MovieClip Frame 7
"exit"Symbol 177 MovieClip Frame 16
"step0"Symbol 188 MovieClip Frame 12
"step1"Symbol 188 MovieClip Frame 22
"step2"Symbol 188 MovieClip Frame 33
"step0"Symbol 197 MovieClip Frame 12
"step1"Symbol 197 MovieClip Frame 22
"step2"Symbol 197 MovieClip Frame 33
"_unclicked"Symbol 238 MovieClip Frame 1
"_over"Symbol 238 MovieClip Frame 11
"_up"Symbol 238 MovieClip Frame 18
"_up"Symbol 635 MovieClip Frame 1
"_over"Symbol 635 MovieClip Frame 10
"_down"Symbol 635 MovieClip Frame 20
"_up"Symbol 638 MovieClip Frame 1
"_over"Symbol 638 MovieClip Frame 10
"_down"Symbol 638 MovieClip Frame 20
"hwcup"Symbol 680 MovieClip Frame 1
"gold"Symbol 680 MovieClip Frame 4
"silver"Symbol 680 MovieClip Frame 7
"bronze"Symbol 680 MovieClip Frame 10
"key"Symbol 680 MovieClip Frame 13
"played"Symbol 680 MovieClip Frame 16

Dynamic Text Variables

bornSymbol 301 EditableText"1999"
specialtySymbol 302 EditableText"A blast from the past, At-A-Tude was built for breaking speed records. The massive engine sits INSIDE the cabin, right behind the driver’s seat!"
birthPlaceSymbol 303 EditableText"El Segundo, CA, USA"
designerSymbol 304 EditableText"Hot Wheels®"
seriesSymbol 305 EditableText"13 OF 24"
seriesSymbol 322 EditableText"13 OF 4"
seriesSymbol 328 EditableText"13 OF 4"
carNumSymbol 346 EditableText"145"
questionSymbol 415 EditableText"asdfasdf"
choiceSymbol 418 EditableText"SEND TO A FRIEND"
choiceSymbol 419 EditableText"SEND TO A FRIEND"
headingSymbol 424 EditableText"asdfasdf"
bodySymbol 425 EditableText"You have unlocked a speed boost for this race. The speed boost will allow you car to achieve a higher top speed."
_parent.game.displayTimeSymbol 564 EditableText"00:00.0"
_parent.game.displayLapsSymbol 566 EditableText"LAP 1 OF 3"
_parent._parent._parent.game.displayLapsSymbol 587 EditableText"LAP 1 OF 3"
_parent.displayTimeSymbol 612 EditableText"00:00.0"
_parent.displayPlaceSymbol 614 EditableText"00:00.0"




http://swfchan.com/22/109214/info.shtml
Created: 14/3 -2019 15:52:33 Last modified: 14/3 -2019 15:52:33 Server time: 22/07 -2019 21:19:15