Frame 1
stop();
_quality = "BEST";
Frame 5
_root.mute = false;
_root.mute_but.gotoAndStop(1);
_root.bg = new Sound();
_root.bg.attachSound("bg");
_root.gamebg = new Sound();
_root.aclr = new Sound();
_root.aclr.attachSound("acc");
_root.n2o = new Sound();
_root.n2o.attachSound("n2o");
gotoAndStop ("menu");
Frame 9
score = 0;
boost = 0;
_root.l1comp = false;
_root.l2comp = false;
_root.l3comp = false;
_root.l4comp = false;
_root.l5comp = false;
_root.l6comp = false;
_root.money = 0;
var ntimes = 1;
_root.car1 = false;
_root.car2 = false;
_root.car3 = false;
_root.car4 = false;
_root.car5 = false;
_root.bg.stop();
_root.bg.start(0, 99999);
_root.NextLevel = 1;
_root.initLevel = 1;
Instance of Symbol 137 MovieClip "mute_but" in Frame 9
on (release) {
_root.mute = !_root.mute;
if (_root.mute) {
_root.mute_but.gotoAndStop(2);
_root.gamebg.stop();
_root.bg.stop();
} else {
_root.mute_but.gotoAndStop(1);
if (_root._currentframe == 73) {
trace("ok");
_root.bg.stop();
_root.gamebg.start(0, 99999);
} else {
_root.bg.start(0, 99999);
}
}
}
Frame 24
score = 0;
boost = 0;
_root.flag = false;
_root.tyres = false;
_root.parts = false;
_root.engines = false;
_root.stickers = false;
_root.itemDone1 = [];
_root.itemDone2 = [];
_root.itemDone3 = [];
_root.itemDone4 = [];
_root.itemDone5 = [];
Frame 34
function chackValidation(id) {
if (_root.init == 1) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
eval ("_root.main_mc.sub_mc.b" + id)._visible = false;
eval (("_root.main_mc.sub_mc.sold" + id) + "_mc")._visible = true;
_root.tyres = true;
_root.itemDone1.push(id);
} else if (_root.init == 2) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
eval ("_root.main_mc.sub_mc.b" + id)._visible = false;
eval (("_root.main_mc.sub_mc.sold" + (id - 5)) + "_mc")._visible = true;
_root.flag = true;
_root.itemDone2.push(id);
} else if (_root.init == 3) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
eval ("_root.main_mc.sub_mc.b" + id)._visible = false;
eval (("_root.main_mc.sub_mc.sold" + (id - 10)) + "_mc")._visible = true;
_root.parts = true;
_root.itemDone3.push(id);
} else if (_root.init == 4) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
eval ("_root.main_mc.sub_mc.b" + id)._visible = false;
eval (("_root.main_mc.sub_mc.sold" + (id - 15)) + "_mc")._visible = true;
_root.engines = true;
_root.itemDone4.push(id);
} else if (_root.init == 5) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
eval ("_root.main_mc.sub_mc.b" + id)._visible = false;
eval (("_root.main_mc.sub_mc.sold" + (id - 20)) + "_mc")._visible = true;
_root.stickers = true;
_root.itemDone5.push(id);
}
}
function shopping(frameId, itemId) {
if (frameId == 1) {
if (itemId == 1) {
if (_root.totAmt >= tyre1) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - tyre1;
} else {
trace("Please check the Amount");
}
} else if (itemId == 2) {
if (_root.totAmt >= tyre2) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - tyre2;
} else {
trace("Please check the Amount");
}
} else if (itemId == 3) {
if (_root.totAmt >= tyre3) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - tyre3;
} else {
trace("Please check the Amount");
}
} else if (itemId == 4) {
if (_root.totAmt >= tyre4) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - tyre4;
} else {
trace("Please check the Amount");
}
} else if (itemId == 5) {
if (_root.totAmt >= tyre5) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - tyre5;
} else {
trace("Please check the Amount");
}
}
} else if (frameId == 2) {
if (itemId == 1) {
if (_root.totAmt >= img1) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - img1;
} else {
trace("Please check the Amount");
}
} else if (itemId == 2) {
if (_root.totAmt >= img2) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - img2;
} else {
trace("Please check the Amount");
}
} else if (itemId == 3) {
if (_root.totAmt >= img3) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - img3;
} else {
trace("Please check the Amount");
}
} else if (itemId == 4) {
if (_root.totAmt >= img4) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - img4;
} else {
trace("Please check the Amount");
}
} else if (itemId == 5) {
if (_root.totAmt >= img5) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - img5;
} else {
trace("Please check the Amount");
}
}
} else if (frameId == 3) {
if (itemId == 1) {
if (_root.totAmt >= part1) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - part1;
} else {
trace("Please check the Amount");
}
} else if (itemId == 2) {
if (_root.totAmt >= part2) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - part2;
} else {
trace("Please check the Amount");
}
} else if (itemId == 3) {
if (_root.totAmt >= part3) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - part3;
} else {
trace("Please check the Amount");
}
} else if (itemId == 4) {
if (_root.totAmt >= part4) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - part4;
} else {
trace("Please check the Amount");
}
} else if (itemId == 5) {
if (_root.totAmt >= part5) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - part5;
} else {
trace("Please check the Amount");
}
}
} else if (frameId == 4) {
if (itemId == 1) {
if (_root.totAmt >= engine1) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - engine1;
} else {
trace("Please check the Amount");
}
} else if (itemId == 2) {
if (_root.totAmt >= engine2) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - engine2;
} else {
trace("Please check the Amount");
}
} else if (itemId == 3) {
if (_root.totAmt >= engine3) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - engine3;
} else {
trace("Please check the Amount");
}
} else if (itemId == 4) {
if (_root.totAmt >= engine4) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - engine4;
} else {
trace("Please check the Amount");
}
} else if (itemId == 5) {
if (_root.totAmt >= engine5) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - engine5;
} else {
trace("Please check the Amount");
}
}
} else if (frameId == 5) {
if (itemId == 1) {
if (_root.totAmt >= extra1) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - extra1;
} else {
trace("Please check the Amount");
}
} else if (itemId == 2) {
if (_root.totAmt >= extra2) {
trace("Successfully Purchessed");
_root.totAmt = _root.totAmt - extra2;
} else {
trace("Please check the Amount");
}
}
}
_root.amt_txt.text = _root.totAmt;
}
score = 0;
boost = 0;
_root.enoughm._visible = false;
_root.nn._visible = false;
trace("_root.b1t" + _root.b1t);
if (_root.b1t == "$Sold") {
_root._root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b2t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b3t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b4t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b5t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
if (_root.b7t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b8t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b9t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b10t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b11t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
if (_root.b12t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b13t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b14t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b15t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b16t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
if (_root.b17t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b18t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b19t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b20t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b21t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
if (_root.b22t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b23t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b24t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b25t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b26t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
}
if (_root.ntimes == 2) {
}
if (_root.ntimes == 3) {
}
if (_root.ntimes == 4) {
}
if (_root.ntimes >= 5) {
} else {
_root.bt6 = 5000;
}
select = function (id) {
_root.choice = id;
};
_root.init = 1;
_root.totAmt = 5000;
_root.amt_txt.text = _root.totAmt;
var tyre1 = 1000;
var tyre2 = 2000;
var tyre3 = 3000;
var tyre4 = 4000;
var tyre5 = 5000;
var part1 = 1000;
var part2 = 2000;
var part3 = 3000;
var part4 = 4000;
var part5 = 5000;
var img1 = 1000;
var img2 = 2000;
var img3 = 3000;
var img4 = 4000;
var img5 = 5000;
var engine1 = 1000;
var engine2 = 2000;
var engine3 = 3000;
var engine4 = 4000;
var engine5 = 5000;
var extra1 = 1000;
var extra2 = 2000;
Frame 42
car.gotoAndStop(_parent.choice + 1);
if (_root.l1comp == true) {
_root.l2.gotoAndStop(2);
} else {
_root.l2.gotoAndStop(1);
}
if (_root.l2comp == true) {
_root.l3.gotoAndStop(2);
} else {
_root.l3.gotoAndStop(1);
}
if (_root.l3comp == true) {
_root.l4.gotoAndStop(2);
} else {
_root.l4.gotoAndStop(1);
}
if (_root.l4comp == true) {
_root.l5.gotoAndStop(2);
} else {
_root.l5.gotoAndStop(1);
}
if (_root.l5comp == true) {
_root.l6.gotoAndStop(2);
} else {
_root.l6.gotoAndStop(1);
}
trace(_root.NextLevel + "-----------_root.NextLevel");
if (_root.NextLevel == 1) {
_root.l1._visible = true;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.NextLevel == 2) {
_root.l1._visible = false;
_root.l2._visible = true;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.NextLevel == 3) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = true;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.NextLevel == 4) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = true;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 5) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = true;
_root.l6._visible = false;
}
if (_root.initLevel == 6) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = true;
}
_root.next_mc.onRelease = function () {
if (_root.initLevel < 6) {
_root.initLevel++;
}
if (_root.initLevel == 1) {
_root.l1._visible = true;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 2) {
_root.l1._visible = false;
_root.l2._visible = true;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 3) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = true;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 4) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = true;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 5) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = true;
_root.l6._visible = false;
}
if (_root.initLevel == 6) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = true;
}
};
_root.prev_mc.onRelease = function () {
if (_root.initLevel > 1) {
_root.initLevel--;
}
if (_root.initLevel == 1) {
_root.l1._visible = true;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 2) {
_root.l1._visible = false;
_root.l2._visible = true;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 3) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = true;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 4) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = true;
_root.l5._visible = false;
_root.l6._visible = false;
}
if (_root.initLevel == 5) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = true;
_root.l6._visible = false;
}
if (_root.initLevel == 6) {
_root.l1._visible = false;
_root.l2._visible = false;
_root.l3._visible = false;
_root.l4._visible = false;
_root.l5._visible = false;
_root.l6._visible = true;
}
};
Instance of Symbol 430 MovieClip "l1" in Frame 42
on (release) {
_root.LevelNum = 0;
_root.gotoAndStop("game");
}
Frame 73
function gasOver(param) {
if (getNextGas(param) == "specail_1") {
_root.nnn_1._visible = true;
_root.nnn._visible = false;
currentGas = _root.nnn_1;
currFrame = 1;
_root.ntimes = _root.ntimes - 1;
_root.game.car.maxSpeed = 30;
} else if (getNextGas(param) == "specail_2") {
_root.nnn_2._visible = true;
_root.nnn_1._visible = false;
_root.nnn._visible = false;
currentGas = _root.nnn_2;
currFrame = 1;
_root.game.car.maxSpeed = 30;
_root.ntimes = _root.ntimes - 1;
} else if (getNextGas(param) == "specail_3") {
_root.nnn_3._visible = true;
_root.nnn_2._visible = false;
_root.nnn_1._visible = false;
_root.nnn._visible = false;
currentGas = _root.nnn_3;
currFrame = 1;
_root.game.car.maxSpeed = 30;
_root.ntimes = _root.ntimes - 1;
} else if (getNextGas(param) == "specail_4") {
_root.nnn_4._visible = true;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn._visible = false;
currentGas = _root.nnn_4;
currFrame = 1;
_root.game.car.maxSpeed = 30;
_root.ntimes = _root.ntimes - 1;
} else if (getNextGas(param) == "specail_5") {
_root.nnn_5._visible = true;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
currentGas = _root.nnn_5;
currFrame = 1;
_root.game.car.maxSpeed = 32;
_root.ntimes = _root.ntimes - 1;
} else {
trace("noGas");
_root.ntimes = 0;
availbleGas = "noGas";
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 22;
}
}
function getNextGas(param) {
if (param == "normal") {
if (_root.specialGas1 == true) {
availbleGas = "specail_1";
} else if (_root.specialGas2 == true) {
availbleGas = "specail_2";
} else if (_root.specialGas3 == true) {
availbleGas = "specail_3";
} else if (_root.specialGas4 == true) {
availbleGas = "specail_4";
} else if (_root.specialGas5 == true) {
availbleGas = "specail_5";
} else {
availbleGas = "noGas";
}
return(availbleGas);
}
if (param == "special_1") {
if (_root.specialGas2 == true) {
availbleGas = "specail_2";
} else if (_root.specialGas3 == true) {
availbleGas = "specail_3";
} else if (_root.specialGas4 == true) {
availbleGas = "specail_4";
} else if (_root.specialGas5 == true) {
availbleGas = "specail_5";
} else {
availbleGas = "noGas";
}
return(availbleGas);
}
if (param == "special_2") {
if (_root.specialGas3 == true) {
availbleGas = "specail_3";
} else if (_root.specialGas4 == true) {
availbleGas = "specail_4";
} else if (_root.specialGas5 == true) {
availbleGas = "specail_5";
} else {
availbleGas = "noGas";
}
return(availbleGas);
}
if (param == "special_3") {
if (_root.specialGas4 == true) {
availbleGas = "specail_4";
} else if (_root.specialGas5 == true) {
availbleGas = "specail_5";
} else {
availbleGas = "noGas";
}
return(availbleGas);
}
if (param == "special_4") {
if (_root.specialGas5 == true) {
availbleGas = "specail_5";
} else {
availbleGas = "noGas";
}
return(availbleGas);
}
if (param == "special_5") {
availbleGas = "noGas";
return(availbleGas);
}
}
stopAllSounds();
_root.nit._visible = false;
_root.rk = true;
_root.rkk = true;
trace("_root.ntimes" + _root.ntimes);
if (_root.LevelNum == 0) {
lll.text = 1;
}
if (_root.LevelNum == 1) {
lll.text = 2;
}
if (_root.LevelNum == 2) {
lll.text = 3;
}
if (_root.LevelNum == 3) {
lll.text = 4;
}
if (_root.LevelNum == 4) {
lll.text = 5;
}
if (_root.LevelNum == 5) {
lll.text = 6;
}
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 20;
}
var nitro = 1;
var currFrame = 1;
_root.pmc._visible = false;
_quality = "MEDIUM";
_root.nnn._xscale = 100;
_root.nnn1._visible = false;
var nnnper = _root.nnn._xscale;
_root.wrongway._visible = false;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
_root.game.car.nitromc._visible = false;
_root.game.dust_mc._visible = false;
_root.onEnterFrame = function () {
if (LevelNum == 0) {
}
if (LevelNum == 1) {
}
if (LevelNum == 2) {
if (_root.game.sampleL85.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample85_mc._visible = true;
} else {
_root.sample85_mc._visible = false;
}
if (_root.game.sampleL86.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample86_mc._visible = true;
} else {
_root.sample86_mc._visible = false;
}
if (_root.game.sampleL85e_mc.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample85e_mc._visible = true;
} else {
_root.sample85e_mc._visible = false;
}
if (_root.game.sampleL87.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample87_mc._visible = true;
} else {
_root.sample87_mc._visible = false;
}
if (_root.game.sampleL89e1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample89e1_mc._visible = true;
} else {
_root.sample89e1_mc._visible = false;
}
if (_root.game.sampleL90e1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample90e1_mc._visible = true;
} else {
_root.sample90e1_mc._visible = false;
}
}
if (LevelNum == 3) {
if (_root.game.sampleL32.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample2_mc._visible = true;
} else {
_root.sample2_mc._visible = false;
}
if (_root.game.sampleL33.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample33_mc._visible = true;
} else {
_root.sample33_mc._visible = false;
}
if (_root.game.sampleL34.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample34_mc._visible = true;
} else {
_root.sample34_mc._visible = false;
}
if (_root.game.sampleL35.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample35_mc._visible = true;
} else {
_root.sample35_mc._visible = false;
}
if (_root.game.sampleL36.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample36_mc._visible = true;
} else {
_root.sample36_mc._visible = false;
}
if (_root.game.sampleL37.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample37_mc._visible = true;
} else {
_root.sample37_mc._visible = false;
}
if (_root.game.sampleL38.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample38_mc._visible = true;
} else {
_root.sample38_mc._visible = false;
}
}
if (LevelNum == 3) {
if (_root.game.sampleL32.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample2_mc._visible = true;
} else {
_root.sample2_mc._visible = false;
}
if (_root.game.sampleL33.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample33_mc._visible = true;
} else {
_root.sample33_mc._visible = false;
}
}
if (LevelNum == 4) {
if (_root.game.sampleL41.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample41_mc._visible = true;
} else {
_root.sample41_mc._visible = false;
}
if (_root.game.sampleL42.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample2_mc._visible = true;
} else {
_root.sample2_mc._visible = false;
}
if (_root.game.sampleL43.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample43_mc._visible = true;
} else {
_root.sample43_mc._visible = false;
}
if (_root.game.sampleL45.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample45_mc._visible = true;
} else {
_root.sample45_mc._visible = false;
}
if (_root.game.sampleL46.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample3_mc._visible = true;
} else {
_root.sample3_mc._visible = false;
}
if (_root.game.sampleL47.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample47_mc._visible = true;
} else {
_root.sample47_mc._visible = false;
}
}
if (LevelNum == 5) {
if (_root.game.sampleL51.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample51_mc._visible = true;
} else {
_root.sample51_mc._visible = false;
}
if (_root.game.sampleL52.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample52_mc._visible = true;
} else {
_root.sample52_mc._visible = false;
}
if (_root.game.sampleL54.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
_root.sample35_mc._visible = true;
} else {
_root.sample35_mc._visible = false;
}
}
if (LevelNum == 3) {
if (_root.game.pathFinder1_2.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -120) && (Math.round(game.car._rotation) < 0)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder1_3.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -40) && (Math.round(game.car._rotation) < 50)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder1_4.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -130) && (Math.round(game.car._rotation) < -30)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder1_5.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -130) || (Math.round(game.car._rotation) > 110)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder1_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -130) && (Math.round(game.car._rotation) < 20)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder1_7.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -130) || (Math.round(game.car._rotation) > 110)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
}
if (LevelNum == 4) {
if (_root.game.pathFinder2_1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > 30) && (Math.round(game.car._rotation) < 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_2.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -50) && (Math.round(game.car._rotation) < 50)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_3.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -130) && (Math.round(game.car._rotation) < -40)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_4.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -140) || (Math.round(game.car._rotation) > 80)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_5.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -110) && (Math.round(game.car._rotation) < -10)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -140) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -140) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -140) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -140) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder2_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -140) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
}
if (LevelNum == 5) {
if (_root.game.pathFinder3_1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < 160) && (Math.round(game.car._rotation) > 20)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_2.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > 160) && (Math.round(game.car._rotation) < 20)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_3.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -160) && (Math.round(game.car._rotation) < -20)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_4.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -60) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_5.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -120) && (Math.round(game.car._rotation) < 10)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -40) && (Math.round(game.car._rotation) < 70)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_7.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -90) && (Math.round(game.car._rotation) < 90)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_8.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -20) && (Math.round(game.car._rotation) > -170)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_9.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -100) || (Math.round(game.car._rotation) > 110)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_10.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -110) && (Math.round(game.car._rotation) < 30)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder3_11.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -110) || (Math.round(game.car._rotation) > 110)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
}
if (LevelNum == 0) {
if (_root.game.pathFinder4_1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > 20) && (Math.round(game.car._rotation) < 160)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder4_2.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < 70) && (Math.round(game.car._rotation) > -70)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder4_3.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -120) && (Math.round(game.car._rotation) < -20)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder4_4.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -120) || (Math.round(game.car._rotation) > 110)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
}
if (LevelNum == 1) {
if (_root.game.pathFinder5_1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > 20) && (Math.round(game.car._rotation) < 150)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_2.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -50) && (Math.round(game.car._rotation) < 120)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_3.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -130) && (Math.round(game.car._rotation) < -50)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_4.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -90) || (Math.round(game.car._rotation) > 130)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_5.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -20) && (Math.round(game.car._rotation) > -160)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_6.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -40) && (Math.round(game.car._rotation) < 60)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_7.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > -130) && (Math.round(game.car._rotation) < -50)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder5_8.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -120) || (Math.round(game.car._rotation) > 120)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
}
if (LevelNum == 2) {
if (_root.game.pathFinder6_1.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < 110) && (Math.round(game.car._rotation) > 40)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder6_2.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < 120) && (Math.round(game.car._rotation) > -60)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder6_3.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) < -30) && (Math.round(game.car._rotation) > -160)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (_root.game.pathFinder6_4.hitTest(_root.game._x + _root.game.car._x, _root.game._y + _root.game.car._y, true)) {
if ((Math.round(game.car._rotation) > 90) || (Math.round(game.car._rotation) < -110)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
}
_root.n2o.onSoundComplete = function () {
trace(_root.rkk + " hello ");
_root.rkk = true;
};
if (Key.isDown(78)) {
if (_root.ntimes == 0) {
_root.game.car.nitromc._visible = false;
_root.game.car.maxSpeed = 20;
_root.game.car.nitromc.gotoAndStop(1);
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
}
if (availbleGas != "noGas") {
if (_root.game.car.nitromc._visible == true) {
if ((_root.rk == true) && (_root.rkk == true)) {
trace(_root.rk + " hello ");
_root.n2o.start();
_root.rkk = false;
_root.rk = false;
} else {
_root.rk = true;
}
}
_root.game.car.nitromc.gotoAndStop(2);
currFrame++;
trace("currFrame" + currFrame);
currentGas.gotoAndStop(currFrame);
if (availbleGas == "normal") {
_root.game.car.maxSpeed = 28;
}
if (_root.nnn_1._visible == true) {
_root.game.car.maxSpeed = 28;
}
if (_root.nnn_2._visible == true) {
_root.game.car.maxSpeed = 28;
}
if (_root.nnn_3._visible == true) {
_root.game.car.maxSpeed = 28;
}
if (_root.nnn_4._visible == true) {
_root.game.car.maxSpeed = 28;
}
if (_root.nnn_5._visible == true) {
_root.game.car.maxSpeed = 28;
}
} else if (availbleGas == "noGas") {
_root.nnn._visible = false;
_root.game.car.nitromc.gotoAndStop(1);
_root.game.car.maxSpeed = 22;
}
} else {
_root.game.car.nitromc.gotoAndStop(1);
_root.game.car.maxSpeed = 20;
}
};
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn_5._visible = false;
var availbleGas = "normal";
var currentGas = _root.nnn;
Frame 81
function randRange(min, max) {
var _local1 = Math.floor(Math.random() * ((max - min) + 1)) + min;
return(_local1);
}
boost = 0;
_root.gamebg.stop();
if (!_root.mute) {
_root.bg.start(0, 999);
} else {
_root.bg.stop();
}
if (_root.LevelNum == 0) {
if (_root.displayPlace == "1st") {
_root.money = randRange(2000, 2200);
_root.l1comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(100, 150);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(80, 85);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(70, 75);
}
}
if (_root.LevelNum == 1) {
if ((((!_root.l3comp) && (!_root.l4comp)) && (!_root.l5comp)) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(4000, 4500);
_root.l2comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(180, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(100, 120);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(80, 110);
}
}
if ((((_root.l3comp == true) || (_root.l4comp == true)) || (_root.l5comp == true)) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(4000, 4500);
_root.l2comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(180, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(100, 120);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(80, 110);
}
}
}
if (_root.LevelNum == 2) {
if (((!_root.l4comp) && (!_root.l5comp)) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(6000, 7000);
_root.l3comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(200, 210);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(150, 180);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(120, 140);
}
}
if (((_root.l4comp == true) || (_root.l5comp == true)) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(8000, 8500);
_root.l3comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(200, 210);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(1500, 180);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(120, 140);
}
}
}
if (_root.LevelNum == 3) {
if ((!_root.l5comp) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(12000, 12500);
_root.l4comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(100, 120);
}
}
if ((_root.l5comp == true) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(12000, 12500);
_root.l4comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(100, 120);
}
}
}
if (_root.LevelNum == 4) {
if (!_root.l6comp) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(14000, 14500);
_root.l5comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(100, 120);
}
}
if (_root.l6comp == true) {
if (_root.displayPlace == "1st") {
_root.money = randRange(14000, 14500);
_root.l5comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(100, 120);
}
}
}
if (_root.LevelNum == 5) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(15000, 15500);
_root.l6comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(400, 500);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(200, 250);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(150, 200);
}
}
Frame 87
function randRange(min, max) {
var _local1 = Math.floor(Math.random() * ((max - min) + 1)) + min;
return(_local1);
}
returnTo = "results";
_root.gamebg.stop();
if (!_root.mute) {
_root.gover.start();
_root.bg.start(0, 999);
} else {
_root.gover.stop();
_root.bg.stop();
}
if (_root.LevelNum == 0) {
if (_root.displayPlace == "1st") {
_root.money = randRange(2000, 2200);
_root.l1comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(100, 150);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(80, 85);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(70, 75);
}
}
if (_root.LevelNum == 1) {
if ((((!_root.l3comp) && (!_root.l4comp)) && (!_root.l5comp)) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(4000, 4500);
_root.l2comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(180, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(100, 120);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(80, 110);
}
}
if ((((_root.l3comp == true) || (_root.l4comp == true)) || (_root.l5comp == true)) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(4000, 4500);
_root.l2comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(180, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(100, 120);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(80, 110);
}
}
}
if (_root.LevelNum == 2) {
if (((!_root.l4comp) && (!_root.l5comp)) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(6000, 7000);
_root.l3comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(200, 210);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(150, 180);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(120, 140);
}
}
if (((_root.l4comp == true) || (_root.l5comp == true)) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(8000, 8500);
_root.l3comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(200, 210);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(1500, 180);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(120, 140);
}
}
}
if (_root.LevelNum == 3) {
if ((!_root.l5comp) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(12000, 12500);
_root.l4comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(100, 120);
}
}
if ((_root.l5comp == true) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(12000, 12500);
_root.l4comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(100, 120);
}
}
}
if (_root.LevelNum == 4) {
if (!_root.l6comp) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(14000, 14500);
_root.l5comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(100, 120);
}
}
if (_root.l6comp == true) {
if (_root.displayPlace == "1st") {
_root.money = randRange(14000, 14500);
_root.l5comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(100, 120);
}
}
}
if (_root.LevelNum == 5) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(15000, 15500);
_root.l6comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(400, 500);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(200, 250);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(150, 200);
}
}
Frame 93
function randRange(min, max) {
var _local1 = Math.floor(Math.random() * ((max - min) + 1)) + min;
return(_local1);
}
boost = 0;
_root.gamebg.stop();
if (!_root.mute) {
_root.bg.start(0, 999);
} else {
_root.bg.stop();
}
if (_root.LevelNum == 0) {
if (_root.displayPlace == "1st") {
_root.money = randRange(2000, 2200);
_root.l1comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(100, 150);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(80, 85);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(70, 75);
}
}
if (_root.LevelNum == 1) {
if ((((!_root.l3comp) && (!_root.l4comp)) && (!_root.l5comp)) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(4000, 4500);
_root.l2comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(180, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(100, 120);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(80, 110);
}
}
if ((((_root.l3comp == true) || (_root.l4comp == true)) || (_root.l5comp == true)) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(4000, 4500);
_root.l2comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(180, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(100, 120);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(80, 110);
}
}
}
if (_root.LevelNum == 2) {
if (((!_root.l4comp) && (!_root.l5comp)) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(6000, 7000);
_root.l3comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(200, 210);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(150, 180);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(120, 140);
}
}
if (((_root.l4comp == true) || (_root.l5comp == true)) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(8000, 8500);
_root.l3comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(200, 210);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(1500, 180);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(120, 140);
}
}
}
if (_root.LevelNum == 3) {
if ((!_root.l5comp) && (!_root.l6comp)) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(12000, 12500);
_root.l4comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(100, 120);
}
}
if ((_root.l5comp == true) || (_root.l6comp == true)) {
if (_root.displayPlace == "1st") {
_root.money = randRange(12000, 12500);
_root.l4comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(100, 120);
}
}
}
if (_root.LevelNum == 4) {
if (!_root.l6comp) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(14000, 14500);
_root.l5comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(100, 120);
}
}
if (_root.l6comp == true) {
if (_root.displayPlace == "1st") {
_root.money = randRange(14000, 14500);
_root.l5comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = randRange(250, 200);
}
if (_root.displayPlace == "3rd") {
_root.money = randRange(180, 150);
}
if (_root.displayPlace == "4th") {
_root.money = randRange(100, 120);
}
}
}
if (_root.LevelNum == 5) {
if (_root.displayPlace == "1st") {
_root.money = _root.money + randRange(15000, 15500);
_root.l6comp = true;
}
if (_root.displayPlace == "2nd") {
_root.money = _root.money + randRange(400, 500);
}
if (_root.displayPlace == "3rd") {
_root.money = _root.money + randRange(200, 250);
}
if (_root.displayPlace == "4th") {
_root.money = _root.money + randRange(150, 200);
}
}
Symbol 66 MovieClip Frame 88
stop();
Symbol 77 Button
on (release) {
getURL ("http://www.startonlinegames.com/", "_blank");
}
Symbol 84 Button
on (release) {
gotoAndPlay ("anim");
}
Symbol 85 MovieClip Frame 1
stop();
this.onEnterFrame = function () {
var _local3 = Math.round((_root.getBytesLoaded() / _root.getBytesTotal()) * 100);
bar._width = _local3 * 3.54;
per.text = _local3;
if (_local3 == 100) {
gotoAndStop ("loaded");
delete this.onEnterFrame;
}
};
Symbol 85 MovieClip Frame 2
stop();
Symbol 85 MovieClip Frame 56
_root.play();
Symbol 85 MovieClip Frame 69
Symbol 119 Button
on (release) {
getURL ("http://www.startonlinegames.com", "_blank");
}
Symbol 127 MovieClip Frame 1
stop();
Symbol 128 Button
on (release) {
getURL ("http://www.startonlinegames.com", "_blank");
}
Symbol 129 Button
on (press) {
_root.gotoAndStop("help");
}
Symbol 130 Button
on (press) {
_root.gotoAndStop("help");
}
Symbol 131 MovieClip Frame 53
stop();
Symbol 137 MovieClip Frame 1
stop();
Symbol 137 MovieClip Frame 2
stop();
Symbol 157 Button
on (release) {
_root.controlMode = 0;
_root.gotoAndStop("choose");
}
Symbol 168 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 172 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(3);
}
Symbol 176 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(4);
}
Symbol 180 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(5);
}
Symbol 184 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(6);
}
Symbol 190 Button
on (release) {
if (_root.money >= 500) {
_root.select(1);
_root.boost = 1.5;
_root.money = Math.abs(500 - _root.money);
_root.car1 = true;
trace("welcoee");
if (_root.car1 == true) {
_root.b1t = "$Sold";
_root.b1._visible = false;
trace("this " + this);
_root.main_mc.sub_mc.b1._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 191 Button
on (release) {
if (_root.money >= 1000) {
_root.select(1);
_root.boost = 0.4;
_root.money = Math.abs(1000 - _root.money);
_root.car2 = true;
if (_root.car2 == true) {
_root.b2t = "$Sold";
_root.main_mc.sub_mc.b2._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(3);
}
Symbol 192 Button
on (release) {
if (_root.money >= 1500) {
_root.select(1);
_root.boost = 1;
_root.money = Math.abs(1500 - _root.money);
_root.car3 = true;
if (_root.car3 == true) {
_root.b3t = "$Sold";
_root.main_mc.sub_mc.b3._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(4);
}
Symbol 193 Button
on (release) {
if (_root.money >= 2000) {
_root.select(1);
_root.boost = 1;
_root.money = Math.abs(2000 - _root.money);
_root.car4 = true;
if (_root.car4 == true) {
_root.b4t = "$Sold";
_root._root.main_mc.sub_mc.b4._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(5);
}
Symbol 194 Button
on (release) {
if (_root.money >= 2500) {
_root.select(1);
_root.boost = 1;
_root.money = Math.abs(2500 - _root.money);
_root.car5 = true;
if (_root.car5 == true) {
_root.b5t = "$Sold";
_root._root.main_mc.sub_mc.b5._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(6);
}
Symbol 201 MovieClip Frame 1
stop();
Symbol 201 MovieClip Frame 2
stop();
Symbol 201 MovieClip Frame 3
stop();
Symbol 201 MovieClip Frame 4
stop();
Symbol 201 MovieClip Frame 5
stop();
Symbol 201 MovieClip Frame 6
stop();
Symbol 214 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 219 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(3);
}
Symbol 223 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(4);
}
Symbol 227 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(5);
}
Symbol 240 MovieClip Frame 1
stop();
Symbol 240 MovieClip Frame 2
stop();
Symbol 240 MovieClip Frame 3
stop();
Symbol 240 MovieClip Frame 4
stop();
Symbol 240 MovieClip Frame 5
stop();
Symbol 240 MovieClip Frame 6
stop();
Symbol 243 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(6);
}
Symbol 247 Button
on (release) {
if (_root.money >= 100) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(100 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b7t = "$Sold";
_root._root.main_mc.sub_mc.b1._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 248 Button
on (release) {
if (_root.money >= 200) {
_root.select(3);
_root.boost = 1.5;
_root.money = Math.abs(200 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b8t = "$Sold";
_root._root.main_mc.sub_mc.b2._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 249 Button
on (release) {
if (_root.money >= 300) {
_root.select(4);
_root.boost = 1.5;
_root.money = Math.abs(300 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b9t = "$Sold";
_root._root.main_mc.sub_mc.b3._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(4);
}
Symbol 250 Button
on (release) {
if (_root.money >= 400) {
_root.select(5);
_root.boost = 1.5;
_root.money = Math.abs(400 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b10t = "$Sold";
_root._root.main_mc.sub_mc.b4._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(5);
}
Symbol 251 Button
on (release) {
if (_root.money >= 500) {
_root.select(6);
_root.boost = 1.5;
_root.money = Math.abs(500 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b11t = "$Sold";
_root._root.main_mc.sub_mc.b5._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(6);
}
Symbol 258 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 262 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(3);
}
Symbol 266 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(4);
}
Symbol 270 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(5);
}
Symbol 274 Button
on (release) {
_root.main_mc.sub_mc.cardetails.gotoAndStop(6);
}
Symbol 281 MovieClip Frame 1
stop();
Symbol 281 MovieClip Frame 2
stop();
Symbol 281 MovieClip Frame 3
stop();
Symbol 281 MovieClip Frame 4
stop();
Symbol 281 MovieClip Frame 5
stop();
Symbol 281 MovieClip Frame 6
stop();
Symbol 283 Button
on (release) {
if (_root.money >= 1000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(1000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b12t = "$Sold";
_root.main_mc.sub_mc.b1._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 284 Button
on (release) {
if (_root.money >= 2000) {
_root.select(3);
_root.boost = 1.5;
_root.money = Math.abs(2000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b13t = "$Sold";
_root.main_mc.sub_mc.b2._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 285 Button
on (release) {
if (_root.money >= 3000) {
_root.select(4);
_root.boost = 1.5;
_root.money = Math.abs(3000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b14t = "$Sold";
_root.main_mc.sub_mc.b3._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 286 Button
on (release) {
if (_root.money >= 4000) {
_root.select(5);
_root.boost = 1.5;
_root.money = Math.abs(4000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b15t = "$Sold";
_root.main_mc.sub_mc.b4._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 287 Button
on (release) {
if (_root.money >= 5000) {
_root.select(6);
_root.boost = 1.5;
_root.money = Math.abs(5000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b16t = "$Sold";
_root.main_mc.sub_mc.b5._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 315 Button
on (release) {
if (_root.money >= 2000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(2000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b17t = "$Sold";
_root.main_mc.sub_mc.b1._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 316 Button
on (release) {
if (_root.money >= 4000) {
_root.select(3);
_root.boost = 1.5;
_root.money = Math.abs(4000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b18t = "$Sold";
_root.main_mc.sub_mc.b2._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 317 Button
on (release) {
if (_root.money >= 6000) {
_root.select(4);
_root.boost = 1.5;
_root.money = Math.abs(6000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b19t = "$Sold";
_root.main_mc.sub_mc.b3._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 318 Button
on (release) {
if (_root.money >= 10000) {
_root.select(6);
_root.boost = 1.5;
_root.money = Math.abs(10000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b21t = "$Sold";
_root.main_mc.sub_mc.b5._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 319 Button
on (release) {
if (_root.money >= 8000) {
_root.select(5);
_root.boost = 1.5;
_root.money = Math.abs(8000 - _root.money);
_root.car1 = true;
if (_root.car1 == true) {
_root.b20t = "$Sold";
_root.main_mc.sub_mc.b4._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.main_mc.sub_mc.cardetails.gotoAndStop(2);
}
Symbol 340 Button
on (release) {
if (_root.money >= _root.b22t) {
_root.ntimes = _root.ntimes + 1;
trace(_root.ntimes);
if (_root.money >= 4000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(4000 - _root.money);
_root.car1 = true;
_root.specialGas1 = true;
if (_root.car1 == true) {
_root.b22t = "$Sold";
_root.main_mc.sub_mc.b1._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.cardetails.gotoAndStop(2);
}
}
Symbol 341 Button
on (release) {
if (_root.money >= _root.b23t) {
_root.ntimes = _root.ntimes + 1;
if (_root.money >= 6000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(6000 - _root.money);
_root.car1 = true;
_root.specialGas2 = true;
if (_root.car1 == true) {
_root.b23t = "$Sold";
_root.main_mc.sub_mc.b2._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.cardetails.gotoAndStop(2);
}
}
Symbol 342 Button
on (release) {
if (_root.money >= _root.b24t) {
_root.ntimes = _root.ntimes + 1;
if (_root.money >= 8000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(8000 - _root.money);
_root.car1 = true;
_root.specialGas3 = true;
if (_root.car1 == true) {
_root.b24t = "$Sold";
_root.main_mc.sub_mc.b3._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.cardetails.gotoAndStop(2);
}
}
Symbol 343 Button
on (release) {
if (_root.money >= _root.b25t) {
_root.ntimes = _root.ntimes + 1;
if (_root.money >= 10000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(10000 - _root.money);
_root.car1 = true;
_root.specialGas4 = true;
if (_root.car1 == true) {
_root.b25t = "$Sold";
_root.main_mc.sub_mc.b4._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.cardetails.gotoAndStop(2);
}
}
Symbol 344 Button
on (release) {
if (_root.money >= _root.b26t) {
_root.ntimes = _root.ntimes + 1;
if (_root.money >= 12000) {
_root.select(2);
_root.boost = 1.5;
_root.money = Math.abs(12000 - _root.money);
_root.car1 = true;
_root.specialGas5 = true;
if (_root.car1 == true) {
_root.b26t = "$Sold";
_root.main_mc.sub_mc.b5._visible = false;
}
} else {
_root.nn._visible = false;
_root.enoughm._visible = true;
_root.enoughm.cc.gotoAndPlay(2);
}
_root.cardetails.gotoAndStop(2);
}
}
Symbol 345 MovieClip Frame 1
if (_root.tyres == true) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
var i = 0;
while (i < _root.itemDone1.length) {
eval ("_root.main_mc.sub_mc.b" + _root.itemDone1[i])._visible = false;
eval (("_root.main_mc.sub_mc.sold" + _root.itemDone1[i]) + "_mc")._visible = true;
i++;
}
} else {
_root.main_mc.sub_mc.b1.enabled = true;
_root.main_mc.sub_mc.b2.enabled = true;
_root.main_mc.sub_mc.b3.enabled = true;
_root.main_mc.sub_mc.b4.enabled = true;
_root.main_mc.sub_mc.b5.enabled = true;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
}
_root.id = 1;
if (_root.b1t == "$Sold") {
_root._root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b2t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b3t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b4t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b5t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
stop();
Symbol 345 MovieClip Frame 2
if (_root.flag == true) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
var i = 0;
while (i < _root.itemDone2.length) {
eval ("_root.main_mc.sub_mc.b" + Number(_root.itemDone2[i] - 5))._visible = false;
eval (("_root.main_mc.sub_mc.sold" + Number(_root.itemDone2[i] - 5)) + "_mc")._visible = true;
i++;
}
} else {
_root.main_mc.sub_mc.b1.enabled = true;
_root.main_mc.sub_mc.b2.enabled = true;
_root.main_mc.sub_mc.b3.enabled = true;
_root.main_mc.sub_mc.b4.enabled = true;
_root.main_mc.sub_mc.b5.enabled = true;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
}
if (_root.b7t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b8t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b9t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b10t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b11t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
Symbol 345 MovieClip Frame 3
if (_root.parts == true) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
trace("_root.itemDone3 :" + _root.itemDone3);
var i = 0;
while (i < _root.itemDone3.length) {
eval ("_root.main_mc.sub_mc.b" + Number(_root.itemDone3[i] - 10))._visible = false;
eval (("_root.main_mc.sub_mc.sold" + Number(_root.itemDone3[i] - 10)) + "_mc")._visible = true;
i++;
}
} else {
_root.main_mc.sub_mc.b1.enabled = true;
_root.main_mc.sub_mc.b2.enabled = true;
_root.main_mc.sub_mc.b3.enabled = true;
_root.main_mc.sub_mc.b4.enabled = true;
_root.main_mc.sub_mc.b5.enabled = true;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
}
if (_root.b12t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b13t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b14t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b15t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b16t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
Symbol 345 MovieClip Frame 4
if (_root.engines == true) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
var i = 0;
while (i < _root.itemDone4.length) {
eval ("_root.main_mc.sub_mc.b" + Number(_root.itemDone4[i] - 15))._visible = false;
eval (("_root.main_mc.sub_mc.sold" + Number(_root.itemDone4[i] - 15)) + "_mc")._visible = true;
i++;
}
} else {
_root.main_mc.sub_mc.b1.enabled = true;
_root.main_mc.sub_mc.b2.enabled = true;
_root.main_mc.sub_mc.b3.enabled = true;
_root.main_mc.sub_mc.b4.enabled = true;
_root.main_mc.sub_mc.b5.enabled = true;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
}
if (_root.b17t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b18t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b19t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b20t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b21t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
Symbol 345 MovieClip Frame 5
if (_root.stickers == true) {
_root.main_mc.sub_mc.b1.enabled = false;
_root.main_mc.sub_mc.b2.enabled = false;
_root.main_mc.sub_mc.b3.enabled = false;
_root.main_mc.sub_mc.b4.enabled = false;
_root.main_mc.sub_mc.b5.enabled = false;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
var i = 0;
while (i < _root.itemDone5.length) {
eval ("_root.main_mc.sub_mc.b" + Number(_root.itemDone5[i] - 20))._visible = false;
eval (("_root.main_mc.sub_mc.sold" + Number(_root.itemDone5[i] - 20)) + "_mc")._visible = true;
i++;
}
} else {
_root.main_mc.sub_mc.b1.enabled = true;
_root.main_mc.sub_mc.b2.enabled = true;
_root.main_mc.sub_mc.b3.enabled = true;
_root.main_mc.sub_mc.b4.enabled = true;
_root.main_mc.sub_mc.b5.enabled = true;
_root.main_mc.sub_mc.sold1_mc._visible = false;
_root.main_mc.sub_mc.sold2_mc._visible = false;
_root.main_mc.sub_mc.sold3_mc._visible = false;
_root.main_mc.sub_mc.sold4_mc._visible = false;
_root.main_mc.sub_mc.sold5_mc._visible = false;
}
if (_root.b22t == "$Sold") {
_root.main_mc.sub_mc.b1._visible = false;
}
if (_root.b23t == "$Sold") {
_root.main_mc.sub_mc.b2._visible = false;
}
if (_root.b24t == "$Sold") {
_root.main_mc.sub_mc.b3._visible = false;
}
if (_root.b25t == "$Sold") {
_root.main_mc.sub_mc.b4._visible = false;
}
if (_root.b26t == "$Sold") {
_root.main_mc.sub_mc.b5._visible = false;
}
Symbol 351 Button
on (release) {
_root.init--;
if (_root.init <= 1) {
_root.init = 1;
}
_root.main_mc.sub_mc.gotoAndStop(_root.init);
}
Symbol 354 Button
on (release) {
_root.main_mc.sub_mc.gotoAndStop(2);
}
on (rollOver) {
sbtn2._alpha = 80;
}
on (rollOut) {
sbtn2._alpha = 100;
}
Symbol 356 Button
on (release) {
_root.main_mc.sub_mc.gotoAndStop(3);
}
on (rollOver) {
sbtn3._alpha = 80;
}
on (rollOut) {
sbtn3._alpha = 100;
}
Symbol 358 Button
on (release) {
_root.main_mc.sub_mc.gotoAndStop(4);
}
on (rollOver) {
sbtn4._alpha = 80;
}
on (rollOut) {
sbtn4._alpha = 100;
}
Symbol 360 Button
on (release) {
_root.main_mc.sub_mc.gotoAndStop(5);
}
on (rollOver) {
sbtn5._alpha = 80;
}
on (rollOut) {
sbtn5._alpha = 100;
}
Symbol 363 Button
on (release) {
_root.main_mc.sub_mc.gotoAndStop(1);
}
on (rollOver) {
sbtn1._alpha = 80;
}
on (rollOut) {
sbtn1._alpha = 100;
}
Symbol 364 Button
on (release) {
_root.init++;
if (_root.init >= 5) {
_root.init = 5;
}
_root.main_mc.sub_mc.gotoAndStop(_root.init);
}
Symbol 367 MovieClip Frame 39
_parent._parent.enoughm._visible = false;
Symbol 368 MovieClip Frame 1
stop();
Symbol 374 MovieClip Frame 39
_parent.nn._visible = false;
Symbol 377 MovieClip Frame 6
stop();
Symbol 378 Button
on (release) {
if ((_root.choice == undefined) && (_root.choice == null)) {
if (_root.car_sticker == undefined) {
_root.car_sticker = 1;
}
_root.choice = _root.car_sticker;
_root.gotoAndStop("levelpage");
} else if ((_root.choice != undefined) && (_root.choice != null)) {
_root.gotoAndStop("levelpage");
}
}
Symbol 390 Button
on (release) {
_root.LevelNum = 1;
_root.gotoAndStop("game");
}
Symbol 395 MovieClip Frame 1
stop();
Symbol 395 MovieClip Frame 2
stop();
Symbol 398 Button
on (release) {
_root.LevelNum = 2;
_root.gotoAndStop("game");
}
Symbol 403 MovieClip Frame 1
stop();
Symbol 403 MovieClip Frame 2
stop();
Symbol 406 Button
on (release) {
_root.LevelNum = 5;
_root.gotoAndStop("game");
}
Symbol 411 MovieClip Frame 1
stop();
Symbol 411 MovieClip Frame 2
stop();
Symbol 414 Button
on (release) {
_root.LevelNum = 4;
_root.gotoAndStop("game");
}
Symbol 419 MovieClip Frame 1
stop();
Symbol 419 MovieClip Frame 2
stop();
Symbol 422 Button
on (release) {
_root.LevelNum = 3;
_root.gotoAndStop("game");
}
Symbol 424 MovieClip Frame 1
stop();
Symbol 424 MovieClip Frame 2
stop();
Symbol 430 MovieClip Frame 1
stop();
Symbol 437 Button
on (release) {
_root.gotoAndStop("choose");
}
Symbol 464 MovieClip Frame 1
_visible = false;
Symbol 465 MovieClip Frame 1
hitterList = [hitter0];
hitterList[0].nodeList = [node0, node1];
var n = [];
for (var j in hitterList) {
for (var i in hitterList[j].nodeList) {
n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y};
hitterList[j].localToGlobal(n[i]);
}
var distx = (n[0].x - n[1].x);
var disty = (n[0].y - n[1].y);
hitterList[j].collisionNormal = {x:-disty, y:distx};
}
_parent.borderList.push(this);
_visible = _parent.showObjects;
Symbol 480 MovieClip Frame 1
nodeList = [node0, node1];
hitterList = [hitter0, hitter1, hitter2, hitter3];
hitterList[0].nodeList = [node0, node1];
hitterList[1].nodeList = [node1, node2];
hitterList[2].nodeList = [node2, node3];
hitterList[3].nodeList = [node3, node4];
var n = [];
for (var j in hitterList) {
for (var i in hitterList[j].nodeList) {
n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y};
hitterList[j].localToGlobal(n[i]);
}
var distx = (n[0].x - n[1].x);
var disty = (n[0].y - n[1].y);
hitterList[j].collisionNormal = {x:-disty, y:distx};
}
_parent.borderList.push(this);
_visible = _parent.showObjects;
Symbol 489 MovieClip Frame 1
nodeList = [node0, node1];
hitterList = [hitter0, hitter1, hitter2, hitter3];
hitterList[0].nodeList = [node0, node1];
hitterList[1].nodeList = [node1, node2];
hitterList[2].nodeList = [node2, node3];
hitterList[3].nodeList = [node3, node4];
var n = [];
for (var j in hitterList) {
for (var i in hitterList[j].nodeList) {
n[i] = {x:hitterList[j].nodeList[i]._x, y:hitterList[j].nodeList[i]._y};
hitterList[j].localToGlobal(n[i]);
}
var distx = (n[0].x - n[1].x);
var disty = (n[0].y - n[1].y);
hitterList[j].collisionNormal = {x:-disty, y:distx};
}
_parent.borderList.push(this);
_visible = _parent.showObjects;
Symbol 492 MovieClip Frame 1
stop();
Symbol 499 MovieClip Frame 1
stop();
Symbol 517 MovieClip Frame 1
_visible = false;
Symbol 519 MovieClip Frame 1
gotoAndStop(_parent._parent._parent.choice);
trace("_parent._parent._parent.choice + 1:" + _parent._parent._parent.choice);
Symbol 520 MovieClip Frame 1
_parent.nodeList.push(this);
this._visible = false;
Symbol 531 MovieClip Frame 1
SpaceDiff = function (x1, y1, x2, y2) {
distx = x1 - x2;
disty = y1 - y2;
return(Math.sqrt((distx * distx) + (disty * disty)));
};
CCapacity = function (v1) {
return(SpaceDiff(0, 0, v1.x, v1.y));
};
dot = function (v1, v2) {
return((v1.x * v2.x) + (v1.y * v2.y));
};
Regulate = function (v1) {
var _local1 = 1 / CCapacity(v1);
return({x:v1.x * _local1, y:v1.y * _local1});
};
adds = function (v1, v2) {
tempVector = new Object();
tempVector.x = v1.x + v2.x;
tempVector.y = v1.y + v2.y;
return(tempVector);
};
subtract = function (v1, v2) {
tempVector = new Object();
tempVector.x = v1.x - v2.x;
tempVector.y = v1.y - v2.y;
return(tempVector);
};
multiply = function (s, v) {
tempVector = new Object();
tempVector.x = v.x * s;
tempVector.y = v.y * s;
return(tempVector);
};
resetCollisions = function () {
myCollisions = new Array();
myColliders = [];
};
SetAngle = function (xdist, ydist) {
a = Math.atan(ydist / xdist) * rad;
if ((xdist > 0) && (ydist < 0)) {
a = -a;
}
if (xdist < 0) {
a = 180 - a;
}
if ((xdist > 0) && (ydist > 0)) {
a = 360 - a;
}
return(a);
};
getSlope = function (x1, y1, x2, y2) {
return((y1 - y2) / (x1 - x2));
};
getIntercept = function (x1, y1, slope) {
return(y1 - (x1 * slope));
};
getIntersection = function (x1, y1, x2, y2, x3, y3, x4, y4) {
m1 = getSlope(x1, y1, x2, y2);
m2 = getSlope(x3, y3, x4, y4);
b1 = getIntercept(x1, y1, m1);
b2 = getIntercept(x3, y3, m2);
tempPoint = new Object();
tempPoint.x = (b2 - b1) / (m1 - m2);
tempPoint.y = (m1 * tempPoint.x) + b1;
return(tempPoint);
};
borderTest = function (which) {
clip = _parent.borderList[which];
if (hitter.hitTest(clip)) {
for (var _local9 in gNodeList) {
if (this._name == "car") {
_root.hittst = true;
}
var _local4 = {x:gNodeList[_local9].x, y:gNodeList[_local9].y};
this._parent.localToGlobal(_local4);
if (clip.hitTest(_local4.x, _local4.y, true)) {
bumpness = 0.5;
var _local5 = {x:(this.speed.x * bumpness) + gNodeList[_local9].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local9].diff.y};
for (var _local8 in clip.hitterList) {
myDist = SpaceDiff(gNodeList[_local9].x, gNodeList[_local9].y, clip._x - (clip.hitterList[_local8].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local8].collisionNormal.y * 10000000));
futureDist = SpaceDiff(gNodeList[_local9].x + _local5.x, gNodeList[_local9].y + _local5.y, clip._x - (clip.hitterList[_local8].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local8].collisionNormal.y * 10000000));
if (clip.hitterList[_local8].hitTest(_local4.x, _local4.y, true) && (myDist > futureDist)) {
collisionInfo = new Object();
collisionInfo.perpVector = {x:0, y:0};
collisionInfo.where = _local4;
collisionInfo.heft = heft * 1E16;
collisionInfo.normal = clip.hitterList[_local8].collisionNormal;
collisionInfo.speed = {x:0, y:0};
collisionInfo.mySpeed = _local5;
collisionInfo.mass = 1E18;
collisionInfo.body = clip;
if (nodeList[_local9]._x < 0) {
collisionInfo.backwards = -1.4;
} else {
collisionInfo.backwards = 1;
}
myCollisions.push(collisionInfo);
}
}
}
}
}
};
bumperTest = function (which) {
clip = currentBumperList[which];
if (clip.active) {
if (hitter.hitTest(clip)) {
for (var _local5 in gNodeList) {
bumpness = 0.5;
var _local2 = {x:(this.speed.x * bumpness) + gNodeList[_local5].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local5].diff.y};
myDist = SpaceDiff(gNodeList[_local5].x, gNodeList[_local5].y, clip._x, clip._y);
futureDist = SpaceDiff(gNodeList[_local5].x + _local2.x, gNodeList[_local5].y + _local2.y, clip._x, clip._y);
myDiff = myDist - clip.span;
myCount++;
if ((myDiff <= 0) && (myDist > futureDist)) {
collisionInfo = new Object();
collisionInfo.collider = clip._name;
collisionInfo.perpVector = {x:0, y:0};
collisionInfo.heft = heft * 1000;
collisionInfo.normal = SetNormal(this, clip);
collisionInfo.speed = {x:0, y:0};
collisionInfo.mySpeed = _local2;
collisionInfo.mass = 100000000000000;
myCollisions.push(collisionInfo);
}
}
}
}
};
globalizeNodes = function (carname) {
carname.gNodeList = [];
for (var _local4 in carname.nodeList) {
carname.gNodeList[_local4] = {x:nodeList[_local4]._x, y:nodeList[_local4]._y};
carname.localToGlobal(carname.gNodeList[_local4]);
carname.gNodeList[_local4].diff = {x:carname.gNodeList[_local4].x - carname.nodeList[_local4].oldPos.x, y:carname.gNodeList[_local4].y - carname.nodeList[_local4].oldPos.y};
carname._parent.globalToLocal(carname.gNodeList[_local4]);
}
};
saveNodePositions = function () {
for (var _local5 in nodeList) {
var _local2 = {x:nodeList[_local5]._x, y:nodeList[_local5]._y};
this.localToGlobal(_local2);
nodeList[_local5].oldPos = {x:_local2.x, y:_local2.y};
}
};
SetNormal = function (me, him) {
tempVector = new Object();
tempVector.x = him._x - me._x;
tempVector.y = him._y - me._y;
return(tempVector);
};
unDaze = function () {
clearInterval(dazeInterval);
dazed = false;
};
daze = function () {
clearInterval(dazeInterval);
if (this != _parent.car) {
dazeInterval = setInterval(unDaze, 200);
} else {
dazeInterval = setInterval(unDaze, 100);
}
dazed = true;
};
getJ = function (mine, his, normal, hismass, hisHeft, hisPerp) {
myr = (temp = new Object());
diff = new Object();
diff = subtract(mine, his);
temp = multiply(-(1.05 + elastic), diff);
top = dot(temp, normal);
massnum = (1 / mass) + (1 / hismass);
temp = multiply(massnum, normal);
firstAdd = dot(perpVector, normal);
firstAdd = firstAdd * firstAdd;
firstAdd = firstAdd / heft;
secondAdd = dot(hisPerp, normal);
secondAdd = secondAdd * secondAdd;
secondAdd = secondAdd / hisHeft;
bottom = dot(normal, temp);
bottom = bottom + (firstAdd + secondAdd);
j = top / bottom;
return(j);
};
getCollisions = function () {
var _local4 = 0;
while (_local4 < currentcarList.length) {
clip = currentcarList[_local4];
if (clip.id != id) {
isCollider = false;
for (var _local8 in myColliders) {
if (myColliders[_local8] == clip) {
isCollider = true;
}
}
if (!isCollider) {
if (hitter.hitTest(clip.hitter)) {
for (_local4 in gNodeList) {
bumpness = 0.5;
var _local5 = {x:(this.speed.x * bumpness) + gNodeList[_local4].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local4].diff.y};
myDist = SpaceDiff(this._x, this._y, clip._x, clip._y);
futureDist = SpaceDiff(this._x + speed.x, this._y + speed.y, clip._x + clip.speed.x, clip._y + clip.speed.y);
var _local3 = {x:gNodeList[_local4].x, y:gNodeList[_local4].y};
this._parent.localToGlobal(_local3);
if (clip.hitter.hitTest(_local3.x, _local3.y, true) && (myDist > futureDist)) {
collisionInfo = new Object();
collisionInfo.where = _local3;
collisionInfo.perpVector = clip.perpVector;
collisionInfo.normal = SetNormal(clip, this);
if (this == _parent.car) {
_parent.wallHit(_local3, Regulate(collisionInfo.normal));
}
collisionInfo.speed = clip.speed;
collisionInfo.mySpeed = speed;
collisionInfo.rot = clip.rot;
collisionInfo.mass = clip.mass;
collisionInfo.heft = clip.heft;
if (nodeList[_local4]._x < 0) {
collisionInfo.backwards = -1.4;
} else {
collisionInfo.backwards = 1;
}
myCollisions.push(collisionInfo);
collisionInfo2 = new Object();
collisionInfo2.perpVector = this.perpVector;
collisionInfo2.normal = SetNormal(this, clip);
collisionInfo2.speed = this.speed;
collisionInfo2.mySpeed = clip.speed;
collisionInfo2.rot = this.rot;
collisionInfo2.mass = this.mass;
collisionInfo2.heft = this.heft;
clip.globalToLocal(_local3);
if (_local3.x < 0) {
collisionInfo2.backwards = -1.4;
} else {
collisionInfo2.backwards = 1;
}
clip.myCollisions.push(collisionInfo2);
clip.myColliders.push(this);
}
}
}
}
}
_local4++;
}
var _local9 = CCapacity(speed);
_local4 = 0;
while (_local4 < _parent.cornerList.length) {
cornerTest(_local4);
_local4++;
}
_local4 = 0;
while (_local4 < currentBumperList.length) {
bumperTest(_local4);
_local4++;
}
_local4 = 0;
while (_local4 < _parent.borderList.length) {
borderTest(_local4);
_local4++;
}
return(myCollisions);
};
SetFriction = function () {
var _local4 = _parent.SetAngle(speed.x, speed.y);
var _local3 = Math.abs((this._rotation - _local4) % 90);
_local3 = ((_local3 / 90) * 0.22) + 0.55;
if (this == _parent.car) {
}
if (this._name == "car") {
}
velocity = preVelocity - (friction * _local3);
velocity = Math.max(0, velocity);
ratio = velocity / preVelocity;
speed.x = speed.x * ratio;
speed.y = speed.y * ratio;
};
translate = function () {
saveNodePositions();
oldPos = new Object();
oldPos.x = _x;
oldPos.y = _y;
preVelocity = SpaceDiff(0, 0, speed.x, speed.y);
spin = spin + preVelocity;
frame = (int(spin * 0.1) % 30) + 1;
_parent.display.hider.gotoAndStop(frame);
if (maxVelocity > maxVelocity) {
finalVel = finalVel * 0.6;
} else {
finalVel = maxVelocity;
}
finalVel = Math.max(finalVel, maxVelocity);
if (preVelocity > finalVel) {
ratio = finalVel / preVelocity;
speed.x = speed.x * ratio;
speed.y = speed.y * ratio;
}
_x = (_x + (speed.x / _parent.iterations));
_y = (_y + (speed.y / _parent.iterations));
_rotation = (_rotation + (rot * rad));
rot = rot * 0.65;
perpVector.x = (-Math.sin(_rotation / rad)) * span;
perpVector.y = Math.cos(_rotation / rad) * span;
preVelocity = SpaceDiff(0, 0, speed.x, speed.y);
if (preVelocity > 0) {
SetFriction();
}
assignNodeSpeeds();
};
collisionDetection = function () {
collisionList = new Array();
collisionList = getCollisions();
};
collisionResponse = function () {
if (collisionList.length > 0) {
speedTotal = new Object();
speedTotal.x = 0;
speedTotal.y = 0;
rotTotal = 0;
i = 0;
while (i < collisionList.length) {
j = getJ(collisionList[i].mySpeed, collisionList[i].speed, collisionList[i].normal, collisionList[i].mass, collisionList[i].heft, collisionList[i].perpVector);
temp = new Object();
temp = multiply(j / mass, collisionList[i].normal);
speedTotal = adds(speedTotal, temp);
jNormal = new Object();
jNormal = multiply(j, collisionList[i].normal);
value = dot(jNormal, perpVector);
rotTotal = rotTotal + ((value / heft) * collisionList[i].backwards);
var _local3 = collisionList[i].body;
if ((this == _parent.car) && (collisionList[i].where != undefined)) {
_parent.wallHit(collisionList[i].where, Regulate(collisionList[i].normal));
}
i++;
}
_parent.determineSpecs(_local3._name);
vol = int(CCapacity(speedTotal) * 2);
if (vol > 0) {
daze();
}
if ((vol > 4) && (this == _parent.car)) {
}
speedTotal.x = speedTotal.x / collisionList.length;
speedTotal.y = speedTotal.y / collisionList.length;
speedTotal.x;
speedTotal.y;
rotTotal = rotTotal / collisionList.length;
rot = rot + rotTotal;
speed = adds(speed, speedTotal);
_parent.checkBounces();
}
};
stop();
myCount = 0;
nodeList = [];
Symbol 532 MovieClip Frame 1
_visible = false;
Symbol 534 MovieClip Frame 1
_visible = false;
Symbol 620 MovieClip Frame 1
function goToTarget(carname) {
if (!carname.dazed) {
if (SpaceDiff(carname._x, carname._y, carname.path._x, carname.path._y) < carname.reaction) {
carname.nextPath++;
if (carname.nextPath == pathList.length) {
carname.nextPath = 0;
}
carname.path = pathList[carname.nextPath];
}
var _local6 = (carname.path._x - carname._x) + carname.xOff;
var _local4 = (carname.path._y - carname._y) + carname.yOff;
var _local5 = Math.min(0.1 * carname.preVelocity, 0.02) + 0.002;
var _local7 = SetDirection(carname._rotation, 360 - carname.SetAngle(_local6, _local4));
carname.rot = carname.rot + (_local5 * _local7);
carname.speed.x = carname.speed.x + (Math.cos(carname._rotation / carname.rad) * carname.accel);
carname.speed.y = carname.speed.y + (Math.sin(carname._rotation / carname.rad) * carname.accel);
var _local3 = SpaceDiff(0, 0, carname.speed.x, carname.speed.y);
if (_local3 > carname.maxSpeed) {
var _local2 = carname.maxSpeed / _local3;
carname.speed.x = carname.speed.x * _local2;
carname.speed.y = carname.speed.y * _local2;
}
}
}
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
var isFirst_left = false;
var isFirst_right = false;
var rotatedScore = 0;
Setcar = function (carname) {
if (carname.owner.picture == undefined) {
carCount++;
duplicateMovieClip ("carKing", "car" + carCount, carCount + 300);
var b = eval ("car" + carCount);
b._x = carname._x;
b._y = carname._y;
b._xscale = carname._width;
b._yscale = carname._height;
carname.alpha = 0;
carname.kid = b;
var r = random(3);
b.gotoAndStop(r + 1);
}
};
movecar = function (carname) {
carname.speed.x = carname.speed.x + (Math.cos(carname._rotation / carname.rad) * 0.6);
carname.speed.y = carname.speed.y + (Math.sin(carname._rotation / carname.rad) * 0.6);
var _local3 = SpaceDiff(0, 0, carname.speed.x, carname.speed.y);
if (_local3 > (maxSpeed - 2)) {
var _local2 = (maxSpeed - 2) / _local3;
carname.speed.x = carname.speed.x * _local2;
carname.speed.y = carname.speed.y * _local2;
}
};
treadcount = 1;
KeyboardKeys = function () {
if ((!gameOver) && (gameplay == true)) {
if (Key.isDown(38) && (!car.dazed)) {
if (_root.panel.needle._rotation >= 0) {
var1 = int(_root.panel.needle._rotation / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation + 1;
} else if (_root.panel.needle._rotation < -5) {
var1 = int((_root.panel.needle._rotation + 360) / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation + 1;
}
_root.game.car.hitter.leftwheel.leftwheel_1.play();
_root.game.car.hitter.leftwheel_back.leftwheel_1.play();
_root.game.car.hitter.rightwheel.leftwheel_1.play();
_root.game.car.hitter.rightwheel_back.leftwheel_1.play();
_root.game.dust_mc._rotation = _root.game.car._rotation;
_root.game.dust_mc._x = _root.game.car.hitter.leftwheel_back.leftwheel_1._x;
_root.game.dust_mc._y = _root.game.car.hitter.rightwheel_back.leftwheel_1._y;
if (pp == true) {
pp = false;
_root.aclr.start(0, 999);
}
if (!pressed38) {
}
pressed38 = true;
_root.game.dust_mc._visible = true;
car.speed.x = car.speed.x + (Math.cos(car._rotation / car.rad) * accel);
car.speed.y = car.speed.y + (Math.sin(car._rotation / car.rad) * accel);
var _local4 = SpaceDiff(0, 0, car.speed.x, car.speed.y);
if (_root.hittst == false) {
} else if (_root.hittst == true) {
}
if (nitro == true) {
_root.nnn._xscale = _root.nnn._xscale - 1;
nn = true;
if (nn == true) {
if (_root.game.car.nitromc._visible == true) {
if (qq == true) {
qq = false;
}
}
}
if (_root.nnn._xscale == 0) {
nclose = true;
car.maxSpeed = 20;
_root.nnn._xscale = 100;
nitro = false;
qq = true;
_root.nnn1._visible = false;
}
}
if (_local4 > car.maxSpeed) {
var _local3 = car.maxSpeed / _local4;
car.speed.x = car.speed.x * _local3;
car.speed.y = car.speed.y * _local3;
}
if (!gameStarted) {
clearInterval(thing1Interval);
clearInterval(thing2Interval);
setSpans();
startTime = getTimer();
gameStarted = true;
}
}
if (!Key.isDown(38)) {
if (pp == false) {
pp = true;
ppp = true;
}
pressed38 = false;
_root.game.dust_mc._visible = false;
_root.isCarMoving = false;
nn = false;
}
if (Key.isDown(40)) {
_root.hittst = false;
if (_root.panel.needle._rotation > 10) {
var1 = int(_root.panel.needle._rotation / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation - 2;
} else if (_root.panel.needle._rotation < 0) {
var1 = int((_root.panel.needle._rotation + 360) / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation - 2;
}
car.speed.x = 0;
car.speed.y = 0;
}
if (Key.isDown(37)) {
if (turnFactor > 0) {
turnFactor = 0;
}
turnFactor = turnFactor - 3;
turnFactor = Math.min(handling, turnFactor);
car._rotation = car._rotation - handling;
_root.hittst = false;
_root.panel.needle1._rotation = _root.panel.needle1._rotation + 2;
_root.isCarMoving = true;
treadcount++;
duplicateMovieClip (_root.game.dustClip_mc, "htreada" + treadcount, treadcount);
treadcheck = 0;
if (treadcount >= 1000) {
treadcount = 1;
}
isRightkeyUp = false;
isFirst_left = true;
rotatedScore = rotatedScore + 6;
_root.game.car.hitter.leftwheel._rotation = _root.game.car.hitter.leftwheel._rotation - 3;
_root.game.car.hitter.rightwheel._rotation = _root.game.car.hitter.rightwheel._rotation - 3;
if (_root.game.car.hitter.rightwheel._rotation < 60) {
_root.game.car.hitter.leftwheel._rotation = 60;
_root.game.car.hitter.rightwheel._rotation = 60;
rotatedScore = 60;
}
} else {
if (isLeftkeyUp) {
_root.panel.needle1._rotation = 0;
_root.game.car.hitter.leftwheel._rotation = 90;
_root.game.car.hitter.rightwheel._rotation = 90;
if (isFirst_left) {
_root.score_flying(rotatedScore);
isFirst_left = false;
rotatedScore = 0;
}
}
isRightkeyUp = true;
}
if (Key.isDown(39)) {
if (turnFactor < 0) {
turnFactor = 0;
}
turnFactor = turnFactor + 3;
turnFactor = Math.min(handling, turnFactor);
car._rotation = car._rotation + handling;
_root.hittst = false;
_root.panel.needle1._rotation = _root.panel.needle1._rotation + 2;
_root.isCarMoving = true;
treadcount++;
duplicateMovieClip (_root.game.dustClip_mc, "htreada" + treadcount, treadcount);
treadcheck = 0;
if (treadcount >= 1000) {
treadcount = 1;
}
isLeftkeyUp = false;
isFirst_right = true;
_root.game.car.hitter.leftwheel._rotation = _root.game.car.hitter.leftwheel._rotation + 3;
_root.game.car.hitter.rightwheel._rotation = _root.game.car.hitter.rightwheel._rotation + 3;
rotatedScore = rotatedScore + 5;
if (_root.game.car.hitter.rightwheel._rotation > 120) {
_root.game.car.hitter.leftwheel._rotation = 120;
_root.game.car.hitter.rightwheel._rotation = 120;
rotatedScore = 60;
}
} else {
if (isRightkeyUp) {
_root.panel.needle1._rotation = 0;
_root.game.car.hitter.leftwheel._rotation = 90;
_root.game.car.hitter.rightwheel._rotation = 90;
if (isFirst_right) {
_root.score_flying(rotatedScore);
isFirst_right = false;
rotatedScore = 0;
}
}
isLeftkeyUp = true;
}
if ((!Key.isDown(40)) && (!Key.isDown(38))) {
_root.hittst = false;
if (_root.panel.needle._rotation > 10) {
var1 = int(_root.panel.needle._rotation / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation - 10;
} else if (_root.panel.needle._rotation < 0) {
var1 = int((_root.panel.needle._rotation + 360) / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation - 10;
} else if ((_root.panel.needle._rotation != 0) && (_root.panel.needle._rotation < 0)) {
var1 = int((_root.panel.needle._rotation + 360) / 3);
_root.panel.needle._rotation = _root.panel.needle._rotation - 5;
if (_root.panel.needle._rotation >= 0) {
_root.panel.needle._rotation = 0;
}
}
}
carx = Math.round(car._x);
cary = Math.round(car._y);
if (_parent.LevelNum == 3) {
if (((cary < -40) && (cary > -280)) && ((carx > -190) && (carx < 90))) {
if (Math.round(car._rotation) > Math.round(car._rotation / 2)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (((cary > -2320) && (cary < -450)) && ((carx > -1050) && (carx < 80))) {
if ((Math.round(car._rotation) > 10) && (Math.round(car._rotation) < 80)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (((cary > -2320) && (cary < -820)) && ((carx < -1150) && (carx > -2800))) {
if ((Math.round(car._rotation) > -100) && (Math.round(car._rotation) < -20)) {
_root.wrongway._visible = true;
_root.sample_mc._visible = false;
_root.sample2_mc._visible = false;
_root.sample3_mc._visible = false;
_root.sample4_mc._visible = false;
_root.sample5_mc._visible = false;
_root.sample6_mc._visible = false;
_root.sample7_mc._visible = false;
_root.sample22_mc._visible = false;
_root.sample25_mc._visible = false;
_root.sample26_mc._visible = false;
_root.sample33_mc._visible = false;
_root.sample81_mc._visible = false;
_root.sample83_mc._visible = false;
_root.sample84_mc._visible = false;
_root.sample85_mc._visible = false;
_root.sample86_mc._visible = false;
_root.sample87_mc._visible = false;
_root.sample34_mc._visible = false;
_root.sample35_mc._visible = false;
_root.sample36_mc._visible = false;
_root.sample37_mc._visible = false;
_root.sample38_mc._visible = false;
_root.sample41_mc._visible = false;
_root.sample43_mc._visible = false;
_root.sample44_mc._visible = false;
_root.sample47_mc._visible = false;
_root.sample45_mc._visible = false;
_root.sample52_mc._visible = false;
_root.sample51_mc._visible = false;
_root.sample54_mc._visible = false;
_root.sample85e_mc._visible = false;
_root.sample89e1_mc._visible = false;
_root.sample90e1_mc._visible = false;
} else {
_root.wrongway._visible = false;
}
}
if (((cary < -500) && (cary > -780)) && ((carx > -2450) && (carx < -1480))) {
}
if (((cary < -100) && (cary > -250)) && ((carx > -1320) && (carx < -320))) {
}
}
}
};
rotate = function (n) {
var _local2 = n.parent._x - n._x;
n._rotation = _local2 * 1.95;
};
SpaceDiff = function (x1, y1, x2, y2) {
distx = x1 - x2;
disty = y1 - y2;
return(Math.sqrt((distx * distx) + (disty * disty)));
};
tempTime = function () {
if ((!gameOver) && (gameplay == true)) {
var _local2 = getTimer() - startTime;
time = Math.round(_local2 * 0.01) * 0.1;
time = int(time * 10) * 0.1;
displayTime = time;
var _local1 = time % 60;
var _local3 = int(time / 60);
if (_local1 < 10) {
_local1 = "0" + _local1;
}
if (int(time) == time) {
_local1 = _local1 + ".0";
}
_local1 = _local1 + "";
_local1 = _local1.substr(0, 4);
displayTime = (_local3 + ":") + _local1;
}
};
SpaceDiff = function (x1, y1, x2, y2) {
distx = x1 - x2;
disty = y1 - y2;
return(Math.sqrt((distx * distx) + (disty * disty)));
};
tempTime = function () {
if ((!gameOver) && (gameplay == true)) {
var _local2 = getTimer() - startTime;
time = Math.round(_local2 * 0.01) * 0.1;
time = int(time * 10) * 0.1;
displayTime = time;
var _local1 = time % 60;
var _local3 = int(time / 60);
if (_local1 < 10) {
_local1 = "0" + _local1;
}
if (int(time) == time) {
_local1 = _local1 + ".0";
}
_local1 = _local1 + "";
_local1 = _local1.substr(0, 4);
displayTime = (_local3 + ":") + _local1;
}
};
aligncars = function () {
for (var _local1 in bumperList) {
bumperList[_local1].kid._x = bumperList[_local1]._x;
bumperList[_local1].kid._y = bumperList[_local1]._y;
bumperList[_local1].kid._rotation = bumperList[_local1]._rotation;
}
};
setSpans = function (carname) {
carSpan = carname.hitter._width / 2;
for (var _local1 in bumperList) {
bumperList[_local1].carSpan = (bumperList[_local1]._width / 2) + carSpan;
}
for (var _local1 in carList) {
carList[_local1].carSpan = (carList[_local1]._width / 2) + carSpan;
}
};
setCurrentBumperList = function (carname) {
setSpans(carname);
carname.currentBumperList = [];
for (var _local4 in bumperList) {
var _local3 = Math.abs(carname._x - bumperList[_local4]._x);
if (_local3 < bumperList[_local4].carSpan) {
var _local2 = Math.abs(carname._y - bumperList[_local4]._y);
if (_local2 <= bumperList[_local4].carSpan) {
carname.currentBumperList.push(bumperList[_local4]);
}
}
}
carname.disp = carname.currentBumperList.length;
};
SetClosestPath = function (carname) {
closest = 10000;
for (var _local4 in pathList) {
var _local1 = SpaceDiff(carname._x, carname._y, pathList[_local4]._x, pathList[_local4]._y);
if (_local1 < closest) {
var _local3 = pathList[_local4];
winnerNum = _local4;
closest = _local1;
}
}
return(winnerNum);
};
CameraPosition = function () {
var _local7 = car._x - carStartx;
var _local6 = car._y - carStarty;
var _local3 = startx - _local7;
var _local2 = starty - _local6;
var _local9 = Math.cos(car._rotation / car.rad) * 50;
var _local8 = Math.sin(car._rotation / car.rad) * 50;
_local3 = _local3 - (((((_local9 + oldSpeed.x) + reallyOldSpeed.x) + reallyOldSpeed1.x) + reallyOldSpeed2.x) + reallyOldSpeed3.x);
_local2 = _local2 - (((((_local8 + oldSpeed.y) + reallyOldSpeed.y) + reallyOldSpeed1.y) + reallyOldSpeed2.y) + reallyOldSpeed3.y);
reallyOldSpeed3 = reallyOldSpeed2;
reallyOldSpeed2 = reallyOldSpeed1;
reallyOldSpeed1 = reallyOldSpeed;
reallyOldSpeed = oldSpeed;
oldSpeed = car.speed;
var _local4 = SpaceDiff(this._x, this._y, _local3, _local2) / 4;
if (camSpeed < _local4) {
camSpeed = camSpeed + 4;
}
camSpeed = Math.min(camMax, camSpeed);
camSpeed = Math.min(camSpeed, _local4);
var _local5 = camSpeed / _local4;
this._x = this._x + int(((_local3 - this._x) / 4) * _local5);
this._y = this._y + int(((_local2 - this._y) / 4) * _local5);
this._y = Math.max(-2435, this._y);
};
CameraTurn = function () {
var _local5 = car._x - carStartx;
var _local4 = car._y - carStarty;
var _local3 = startx - _local5;
var _local2 = starty - _local4;
this._x = _local3;
this._y = _local2;
};
SetSides = function (carname) {
var _local12 = SetClosestPath(carname);
var _local8 = _local12.normal;
var _local9 = 4;
var _local4 = {x:0, y:0};
_local4.x = _local4.x + ((-_local8.y) * _local9);
_local4.y = _local4.y + (_local8.x * _local9);
var _local5 = {x:0, y:0};
_local5.x = _local5.x + (_local8.y * _local9);
_local5.y = _local5.y + ((-_local8.x) * _local9);
var _local7 = false;
attempts = 0;
while ((!_local7) && (attempts < 200)) {
attempts++;
var _local2 = {x:carname._x + (_local4.x * attempts), y:carname._y + (_local4.y * attempts)};
this.localToGlobal(_local2);
if (hitter.hitTest(_local2.x, _local2.y, true)) {
_local7 = true;
}
}
var _local2 = {x:carname._x + (_local4.x * attempts), y:carname._y + (_local4.y * attempts)};
rider0._x = _local2.x;
rider0._y = _local2.y;
var _local6 = false;
leftDist = attempts;
attempts = 0;
while ((!_local6) && (attempts < 200)) {
attempts++;
_local2 = {x:carname._x + (_local5.x * attempts), y:carname._y + (_local5.y * attempts)};
this.localToGlobal(_local2);
if (hitter.hitTest(_local2.x, _local2.y, true)) {
_local6 = true;
}
}
_local2 = {x:carname._x + (_local5.x * attempts), y:carname._y + (_local5.y * attempts)};
rider1._x = _local2.x;
rider1._y = _local2.y;
rightDist = attempts;
var _local10 = rightDist + leftDist;
var _local11 = (leftDist / _local10) - 0.5;
carname._rotation = carname._rotation + (_local11 * carname.CCapacity(carname.speed));
};
SetDirection = function (a1, a2) {
a1 = a1 + 1000;
a2 = a2 + 1000;
if (a1 < 0) {
a1 = a1 + 360;
}
if ((a1 - a2) > 180) {
a2 = a2 + 360;
}
if ((a2 - a1) > 180) {
a1 = a1 + 360;
}
if (Math.abs(a1 - a2) < 4) {
return(0);
}
if (a1 < a2) {
return(1);
}
return(-1);
};
setCurrentcarList = function (carname) {
carname.currentcarList = [];
for (var _local4 in carList) {
if (carList[_local4] != carname) {
var _local3 = Math.abs(carname._x - carList[_local4]._x);
if (_local3 < carList[_local4].carSpan) {
var _local2 = Math.abs(carname._y - carList[_local4]._y);
if (_local2 <= carList[_local4].carSpan) {
carname.currentcarList.push(carList[_local4]);
}
}
}
}
};
SetAngle = function (dx, dy) {
var _local1 = (Math.atan2(dy, dx) * 180) / 3.141593;
return(_local1);
};
CCapacity = function (v1) {
return(SpaceDiff(0, 0, v1.x, v1.y));
};
Regulate = function (v1) {
var _local1 = 1 / CCapacity(v1);
var _local4 = v1.x * _local1;
var _local3 = v1.y * _local1;
var _local2 = {x:_local4, y:_local3};
return(_local2);
};
newcar = function (carname, mass, heft) {
carname.rad = 57.29578;
carname.span = carname.hitter._width / 2;
carname.active = false;
carname.rot = 0;
carname.preVelocity = 0;
carname.maxVelocity = 200;
carname.elastic = 0.7;
carname.bumpness = 0.3;
carname.heft = heft;
carname.speed = new Object();
carname.speed.y = 0;
carname.speed.x = 0;
carname.mass = mass;
carname.id = carList.length;
carname.growthRate = 1.1;
if (_parent.LevelNum == 0) {
carname.friction = 0.4;
} else {
carname.friction = 0.2;
}
if (_parent.choice == 4) {
carname.friction = 0.2;
}
carname.reaction = 180;
carname.nextPath = SetClosestPath(carname);
carname.path = pathList[carname.nextPath];
carname.hitSpaceDiff = new Array();
carname.wallSpaceDiff = new Array();
carname.bumperSpaceDiff = new Array();
carname.cornerSpaceDiff = new Array();
carname.perpVector = new Object();
carname.hitter._alpha = (showObjects ? 100 : 100);
carname.spin = 0;
carname.dazed = false;
carname.type = "car";
if (carname._name != "car") {
carname.maxSpeed = 20 + (0.4 * carList.length);
carname.accel = 5.7 + (random(50) * 0.016);
carname.wildness = random(100) + 50;
carname.xOff = random(carname.wildness * 2) - carname.wildness;
carname.yOff = random(carname.wildness * 2) - carname.wildness;
} else {
if (_parent.LevelNum == 0) {
carname.maxSpeed = 22;
}
if (_parent.choice == 0) {
carname.maxSpeed = 20 + _parent.boost;
} else {
carname.maxSpeed = 19;
}
if (_parent.choice > 0) {
accel = 6.3 + _parent.boost;
} else {
accel = 6.3;
}
if (_parent.choice == 5) {
accel = 9.3 + _parent.boost;
}
handling = 8;
if (_parent.choice == 4) {
handling = 9;
carname.friction = 0.2;
}
if (_parent.choice == 3) {
accel = 6.6 + _parent.boost;
handling = 8;
carname.friction = 0.3;
}
if (_parent.choice == 2) {
accel = 8.6 + _parent.boost;
handling = 8;
carname.friction = 0.26;
}
if (_parent.LevelNum == 0) {
if (_parent.choice >= 2) {
carname.maxSpeed = carname.maxSpeed + 1;
}
carname.friction = 0.36;
}
if (_parent.LevelNum == 1) {
if (_parent.choice >= 1) {
carname.maxSpeed = carname.maxSpeed + 1.8;
}
}
if (_parent.LevelNum == 2) {
if (_parent.choice >= 2) {
carname.maxSpeed = carname.maxSpeed + 1.8;
}
}
if (_parent.LevelNum == 3) {
if (_parent.choice >= 3) {
carname.maxSpeed = carname.maxSpeed + 1.8;
}
}
if (_parent.LevelNum == 4) {
if (_parent.choice >= 4) {
carname.maxSpeed = carname.maxSpeed + 1.8;
}
}
if (_parent.LevelNum == 5) {
if (_parent.choice >= 4) {
carname.maxSpeed = carname.maxSpeed + 1.8;
}
}
}
carList.push(carname);
carname.gotoAndStop(carList.length);
};
RaceOver = function () {
clearInterval(leaveInterval);
_parent.time = time;
_global.totalScore = time;
_parent.displayTime = displayTime;
if (((((_parent.LevelNum == 0) || (_parent.LevelNum == 1)) || (_parent.LevelNum == 2)) || (_parent.LevelNum == 3)) || (_parent.LevelNum == 4)) {
if (_parent.displayPlace == "1st") {
_root.gotoAndStop("results");
}
if (_parent.displayPlace != "1st") {
_root.gotoAndStop("gover");
}
}
if (_parent.LevelNum == 5) {
if (_parent.displayPlace == "1st") {
_root.gotoAndStop("gwin");
}
if (_parent.displayPlace != "1st") {
_root.gotoAndStop("gover");
}
}
};
wallHit = function (where, dir) {
sparkCount++;
if ((_parent.choice == 2) || (_parent.choice == 5)) {
this.globalToLocal(where);
temp6._x = where.x;
temp6._y = where.y;
var _local3 = car.SetAngle(dir.x, dir.y);
_local3 = _local3 + (random(40) + 20);
var _local5 = new Object();
_local5.x = Math.cos(_local3 / car.rad) * 16;
_local5.y = Math.sin(_local3 / car.rad) * 16;
temp6.speed = {x:_local5.x, y:_local5.y};
}
if ((_parent.choice == 0) || (_parent.choice == 3)) {
this.globalToLocal(where);
temp6._x = where.x;
temp6._y = where.y;
temp6._rotation = random(360);
temp6._xscale = random(100) + 50;
temp6._yscale = temp6._xscale;
}
if ((_parent.choice == 1) || (_parent.choice == 4)) {
this.globalToLocal(where);
temp6._x = where.x;
temp6._y = where.y;
var _local3 = car.SetAngle(dir.x, dir.y);
_local3 = _local3 + (random(40) + 20);
temp6._rotation = _local3;
var _local7 = random(4);
if (_local7 == 0) {
sparkCount++;
temp6._x = where.x;
temp6._y = where.y;
_local3 = car.SetAngle(dir.x, dir.y);
_local3 = _local3 + (random(40) + 20);
temp6._rotation = _local3;
}
}
};
carsLaps = function (carname) {
var _local3 = currentCheckPoint[carname.id];
var _local4 = checkPoint[_local3];
if (_local4.hitTest(carname)) {
currentCheckPoint[carname.id]++;
if (currentLap1 == 1) {
if (currentCheckPoint[carname.id] == 0) {
f1++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f1;
}
if (carname.id == 1) {
_parent.game.rank1 = f1;
}
if (carname.id == 2) {
_parent.game.rank2 = f1;
}
if (carname.id == 3) {
_parent.game.rank3 = f1;
}
if (carname.id == 4) {
_parent.game.rank4 = f1;
}
}
if (currentCheckPoint[carname.id] == 1) {
f2++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f2;
}
if (carname.id == 1) {
_parent.game.rank1 = f2;
}
if (carname.id == 2) {
_parent.game.rank2 = f2;
}
if (carname.id == 3) {
_parent.game.rank3 = f2;
}
if (carname.id == 4) {
_parent.game.rank4 = f2;
}
}
if (currentCheckPoint[carname.id] == 2) {
f3++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f3;
}
if (carname.id == 1) {
_parent.game.rank1 = f3;
}
if (carname.id == 2) {
_parent.game.rank2 = f3;
}
if (carname.id == 3) {
_parent.game.rank3 = f3;
}
if (carname.id == 4) {
_parent.game.rank4 = f3;
}
}
if (currentCheckPoint[carname.id] == 3) {
f4++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f4;
}
if (carname.id == 1) {
_parent.game.rank1 = f4;
}
if (carname.id == 2) {
_parent.game.rank2 = f4;
}
if (carname.id == 3) {
_parent.game.rank3 = f4;
}
if (carname.id == 4) {
_parent.game.rank4 = f4;
}
}
if (currentCheckPoint[carname.id] == 4) {
f5++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f5;
}
if (carname.id == 1) {
_parent.game.rank1 = f5;
}
if (carname.id == 2) {
_parent.game.rank2 = f5;
}
if (carname.id == 3) {
_parent.game.rank3 = f5;
}
if (carname.id == 4) {
_parent.game.rank4 = f5;
}
}
if (currentCheckPoint[carname.id] == 5) {
f6++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f6;
}
if (carname.id == 1) {
_parent.game.rank1 = f6;
}
if (carname.id == 2) {
_parent.game.rank2 = f6;
}
if (carname.id == 3) {
_parent.game.rank3 = f6;
}
if (carname.id == 4) {
_parent.game.rank4 = f6;
}
}
if (currentCheckPoint[carname.id] == 6) {
f7++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f7;
}
if (carname.id == 1) {
_parent.game.rank1 = f7;
}
if (carname.id == 2) {
_parent.game.rank2 = f7;
}
if (carname.id == 3) {
_parent.game.rank3 = f7;
}
if (carname.id == 4) {
_parent.game.rank4 = f7;
}
}
if (currentCheckPoint[carname.id] == 7) {
f8++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f8;
}
if (carname.id == 1) {
_parent.game.rank1 = f8;
}
if (carname.id == 2) {
_parent.game.rank2 = f8;
}
if (carname.id == 3) {
_parent.game.rank3 = f8;
}
if (carname.id == 4) {
_parent.game.rank4 = f8;
}
}
if (currentCheckPoint[carname.id] == 8) {
f9++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f9;
}
if (carname.id == 1) {
_parent.game.rank1 = f9;
}
if (carname.id == 2) {
_parent.game.rank2 = f9;
}
if (carname.id == 3) {
_parent.game.rank3 = f9;
}
if (carname.id == 4) {
_parent.game.rank4 = f9;
}
}
if (currentCheckPoint[carname.id] == 9) {
f10++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f10;
}
if (carname.id == 1) {
_parent.game.rank1 = f10;
}
if (carname.id == 2) {
_parent.game.rank2 = f10;
}
if (carname.id == 3) {
_parent.game.rank3 = f10;
}
if (carname.id == 4) {
_parent.game.rank4 = f10;
}
}
if (currentCheckPoint[carname.id] == 10) {
f11++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f11;
}
if (carname.id == 1) {
_parent.game.rank1 = f11;
}
if (carname.id == 2) {
_parent.game.rank2 = f11;
}
if (carname.id == 3) {
_parent.game.rank3 = f11;
}
if (carname.id == 4) {
_parent.game.rank4 = f11;
}
}
if (currentCheckPoint[carname.id] == 11) {
f13++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f13;
}
if (carname.id == 1) {
_parent.game.rank1 = f13;
}
if (carname.id == 2) {
_parent.game.rank2 = f13;
}
if (carname.id == 3) {
_parent.game.rank3 = f13;
}
if (carname.id == 4) {
_parent.game.rank4 = f13;
}
}
if (currentCheckPoint[carname.id] == 12) {
f14++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f14;
}
if (carname.id == 1) {
_parent.game.rank1 = f14;
}
if (carname.id == 2) {
_parent.game.rank2 = f14;
}
if (carname.id == 3) {
_parent.game.rank3 = f14;
}
if (carname.id == 4) {
_parent.game.rank4 = f14;
}
}
if (currentCheckPoint[carname.id] == 13) {
f15++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f15;
}
if (carname.id == 1) {
_parent.game.rank1 = f15;
}
if (carname.id == 2) {
_parent.game.rank2 = f15;
}
if (carname.id == 3) {
_parent.game.rank3 = f15;
}
if (carname.id == 4) {
_parent.game.rank4 = f15;
}
}
if (currentCheckPoint[carname.id] == 14) {
f16++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f16;
}
if (carname.id == 1) {
_parent.game.rank1 = f16;
}
if (carname.id == 2) {
_parent.game.rank2 = f16;
}
if (carname.id == 3) {
_parent.game.rank3 = f16;
}
if (carname.id == 4) {
_parent.game.rank4 = f16;
}
}
if (currentCheckPoint[carname.id] == 15) {
f17++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f17;
}
if (carname.id == 1) {
_parent.game.rank1 = f17;
}
if (carname.id == 2) {
_parent.game.rank2 = f17;
}
if (carname.id == 3) {
_parent.game.rank3 = f17;
}
if (carname.id == 4) {
_parent.game.rank4 = f17;
}
}
if (currentCheckPoint[carname.id] == 16) {
f18++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f18;
}
if (carname.id == 1) {
_parent.game.rank1 = f18;
}
if (carname.id == 2) {
_parent.game.rank2 = f18;
}
if (carname.id == 3) {
_parent.game.rank3 = f18;
}
if (carname.id == 4) {
_parent.game.rank4 = f18;
}
}
if (currentCheckPoint[carname.id] == 17) {
f19++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f19;
}
if (carname.id == 1) {
_parent.game.rank1 = f19;
}
if (carname.id == 2) {
_parent.game.rank2 = f19;
}
if (carname.id == 3) {
_parent.game.rank3 = f19;
}
if (carname.id == 4) {
_parent.game.rank4 = f19;
}
}
if (currentCheckPoint[carname.id] == 18) {
f20++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f20;
}
if (carname.id == 1) {
_parent.game.rank1 = f20;
}
if (carname.id == 2) {
_parent.game.rank2 = f20;
}
if (carname.id == 3) {
_parent.game.rank3 = f20;
}
if (carname.id == 4) {
_parent.game.rank4 = f20;
}
}
if (currentCheckPoint[carname.id] == 19) {
f21++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f21;
}
if (carname.id == 1) {
_parent.game.rank1 = f21;
}
if (carname.id == 2) {
_parent.game.rank2 = f21;
}
if (carname.id == 3) {
_parent.game.rank3 = f21;
}
if (carname.id == 4) {
_parent.game.rank4 = f21;
}
}
if (currentCheckPoint[carname.id] == 20) {
f22++;
if (((carname.id == 0) && (currentLap == 1)) && (finalround1 == true)) {
_parent.game.rank = f22;
}
if (carname.id == 1) {
_parent.game.rank1 = f22;
}
if (carname.id == 2) {
_parent.game.rank2 = f22;
}
if (carname.id == 3) {
_parent.game.rank3 = f22;
}
if (carname.id == 4) {
_parent.game.rank4 = f22;
}
}
}
if (currentLap1 == 2) {
if (currentCheckPoint[carname.id] == 0) {
g1++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g1;
}
if (carname.id == 1) {
_parent.game.rank1 = g1;
}
if (carname.id == 2) {
_parent.game.rank2 = g1;
}
if (carname.id == 3) {
_parent.game.rank3 = g1;
}
if (carname.id == 4) {
_parent.game.rank4 = g1;
}
}
if (currentCheckPoint[carname.id] == 1) {
g2++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g2;
}
if (carname.id == 1) {
_parent.game.rank1 = g2;
}
if (carname.id == 2) {
_parent.game.rank2 = g2;
}
if (carname.id == 3) {
_parent.game.rank3 = g2;
}
if (carname.id == 4) {
_parent.game.rank4 = g2;
}
}
if (currentCheckPoint[carname.id] == 2) {
g3++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g3;
}
if (carname.id == 1) {
_parent.game.rank1 = g3;
}
if (carname.id == 2) {
_parent.game.rank2 = g3;
}
if (carname.id == 3) {
_parent.game.rank3 = g3;
}
if (carname.id == 4) {
_parent.game.rank4 = g3;
}
}
if (currentCheckPoint[carname.id] == 3) {
g4++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g4;
}
if (carname.id == 1) {
_parent.game.rank1 = g4;
}
if (carname.id == 2) {
_parent.game.rank2 = g4;
}
if (carname.id == 3) {
_parent.game.rank3 = g4;
}
if (carname.id == 4) {
_parent.game.rank4 = g4;
}
}
if (currentCheckPoint[carname.id] == 4) {
g5++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g5;
}
if (carname.id == 1) {
_parent.game.rank1 = g5;
}
if (carname.id == 2) {
_parent.game.rank2 = g5;
}
if (carname.id == 3) {
_parent.game.rank3 = g5;
}
if (carname.id == 4) {
_parent.game.rank4 = g5;
}
}
if (currentCheckPoint[carname.id] == 5) {
g6++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g6;
}
if (carname.id == 1) {
_parent.game.rank1 = g6;
}
if (carname.id == 2) {
_parent.game.rank2 = g6;
}
if (carname.id == 3) {
_parent.game.rank3 = g6;
}
if (carname.id == 4) {
_parent.game.rank4 = g6;
}
}
if (currentCheckPoint[carname.id] == 6) {
g7++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g7;
}
if (carname.id == 1) {
_parent.game.rank1 = g7;
}
if (carname.id == 2) {
_parent.game.rank2 = g7;
}
if (carname.id == 3) {
_parent.game.rank3 = g7;
}
if (carname.id == 4) {
_parent.game.rank4 = g7;
}
}
if (currentCheckPoint[carname.id] == 7) {
g8++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g8;
}
if (carname.id == 1) {
_parent.game.rank1 = g8;
}
if (carname.id == 2) {
_parent.game.rank2 = g8;
}
if (carname.id == 3) {
_parent.game.rank3 = g8;
}
if (carname.id == 4) {
_parent.game.rank4 = g8;
}
}
if (currentCheckPoint[carname.id] == 8) {
g9++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g9;
}
if (carname.id == 1) {
_parent.game.rank1 = g9;
}
if (carname.id == 2) {
_parent.game.rank2 = g9;
}
if (carname.id == 3) {
_parent.game.rank3 = g9;
}
if (carname.id == 4) {
_parent.game.rank4 = g9;
}
}
if (currentCheckPoint[carname.id] == 9) {
g10++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g10;
}
if (carname.id == 1) {
_parent.game.rank1 = g10;
}
if (carname.id == 2) {
_parent.game.rank2 = g10;
}
if (carname.id == 3) {
_parent.game.rank3 = g10;
}
if (carname.id == 4) {
_parent.game.rank4 = g10;
}
}
if (currentCheckPoint[carname.id] == 10) {
g11++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g11;
}
if (carname.id == 1) {
_parent.game.rank1 = g11;
}
if (carname.id == 2) {
_parent.game.rank2 = g11;
}
if (carname.id == 3) {
_parent.game.rank3 = g11;
}
if (carname.id == 4) {
_parent.game.rank4 = g11;
}
}
if (currentCheckPoint[carname.id] == 11) {
g13++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g13;
}
if (carname.id == 1) {
_parent.game.rank1 = g13;
}
if (carname.id == 2) {
_parent.game.rank2 = g13;
}
if (carname.id == 3) {
_parent.game.rank3 = g13;
}
if (carname.id == 4) {
_parent.game.rank4 = g13;
}
}
if (currentCheckPoint[carname.id] == 12) {
g14++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g14;
}
if (carname.id == 1) {
_parent.game.rank1 = g14;
}
if (carname.id == 2) {
_parent.game.rank2 = g14;
}
if (carname.id == 3) {
_parent.game.rank3 = g14;
}
if (carname.id == 4) {
_parent.game.rank4 = g14;
}
}
if (currentCheckPoint[carname.id] == 13) {
g15++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g15;
}
if (carname.id == 1) {
_parent.game.rank1 = g15;
}
if (carname.id == 2) {
_parent.game.rank2 = g15;
}
if (carname.id == 3) {
_parent.game.rank3 = g15;
}
if (carname.id == 4) {
_parent.game.rank4 = g15;
}
}
if (currentCheckPoint[carname.id] == 14) {
g16++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g16;
}
if (carname.id == 1) {
_parent.game.rank1 = g16;
}
if (carname.id == 2) {
_parent.game.rank2 = g16;
}
if (carname.id == 3) {
_parent.game.rank3 = g16;
}
if (carname.id == 4) {
_parent.game.rank4 = g16;
}
}
if (currentCheckPoint[carname.id] == 15) {
g17++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g17;
}
if (carname.id == 1) {
_parent.game.rank1 = g17;
}
if (carname.id == 2) {
_parent.game.rank2 = g17;
}
if (carname.id == 3) {
_parent.game.rank3 = g17;
}
if (carname.id == 4) {
_parent.game.rank4 = g17;
}
}
if (currentCheckPoint[carname.id] == 16) {
g18++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g18;
}
if (carname.id == 1) {
_parent.game.rank1 = g18;
}
if (carname.id == 2) {
_parent.game.rank2 = g18;
}
if (carname.id == 3) {
_parent.game.rank3 = g18;
}
if (carname.id == 4) {
_parent.game.rank4 = g18;
}
}
if (currentCheckPoint[carname.id] == 17) {
g19++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g19;
}
if (carname.id == 1) {
_parent.game.rank1 = g19;
}
if (carname.id == 2) {
_parent.game.rank2 = g19;
}
if (carname.id == 3) {
_parent.game.rank3 = g19;
}
if (carname.id == 4) {
_parent.game.rank4 = g19;
}
}
if (currentCheckPoint[carname.id] == 18) {
g20++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g20;
}
if (carname.id == 1) {
_parent.game.rank1 = g20;
}
if (carname.id == 2) {
_parent.game.rank2 = g20;
}
if (carname.id == 3) {
_parent.game.rank3 = g20;
}
if (carname.id == 4) {
_parent.game.rank4 = g20;
}
}
if (currentCheckPoint[carname.id] == 19) {
g21++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g21;
}
if (carname.id == 1) {
_parent.game.rank1 = g21;
}
if (carname.id == 2) {
_parent.game.rank2 = g21;
}
if (carname.id == 3) {
_parent.game.rank3 = g21;
}
if (carname.id == 4) {
_parent.game.rank4 = g21;
}
}
if (currentCheckPoint[carname.id] == 20) {
g22++;
if (((carname.id == 0) && (currentLap == 2)) && (finalround2 == true)) {
_parent.game.rank = g22;
}
if (carname.id == 1) {
_parent.game.rank1 = g22;
}
if (carname.id == 2) {
_parent.game.rank2 = g22;
}
if (carname.id == 3) {
_parent.game.rank3 = g22;
}
if (carname.id == 4) {
_parent.game.rank4 = g22;
}
}
}
if (currentLap1 == 3) {
if (currentCheckPoint[carname.id] == 0) {
h1++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h1;
}
if (carname.id == 1) {
_parent.game.rank1 = h1;
}
if (carname.id == 2) {
_parent.game.rank2 = h1;
}
if (carname.id == 3) {
_parent.game.rank3 = h1;
}
if (carname.id == 4) {
_parent.game.rank4 = h1;
}
}
if (currentCheckPoint[carname.id] == 1) {
h2++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h2;
}
if (carname.id == 1) {
_parent.game.rank1 = h2;
}
if (carname.id == 2) {
_parent.game.rank2 = h2;
}
if (carname.id == 3) {
_parent.game.rank3 = h2;
}
if (carname.id == 4) {
_parent.game.rank4 = h2;
}
}
if (currentCheckPoint[carname.id] == 2) {
h3++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h3;
}
if (carname.id == 1) {
_parent.game.rank1 = h3;
}
if (carname.id == 2) {
_parent.game.rank2 = h3;
}
if (carname.id == 3) {
_parent.game.rank3 = h3;
}
if (carname.id == 4) {
_parent.game.rank4 = h3;
}
}
if (currentCheckPoint[carname.id] == 3) {
h4++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h4;
}
if (carname.id == 1) {
_parent.game.rank1 = h4;
}
if (carname.id == 2) {
_parent.game.rank2 = h4;
}
if (carname.id == 3) {
_parent.game.rank3 = h4;
}
if (carname.id == 4) {
_parent.game.rank4 = h4;
}
}
if (currentCheckPoint[carname.id] == 4) {
h5++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h5;
}
if (carname.id == 1) {
_parent.game.rank1 = h5;
}
if (carname.id == 2) {
_parent.game.rank2 = h5;
}
if (carname.id == 3) {
_parent.game.rank3 = h5;
}
if (carname.id == 4) {
_parent.game.rank4 = h5;
}
}
if (currentCheckPoint[carname.id] == 5) {
h6++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h6;
}
if (carname.id == 1) {
_parent.game.rank1 = h6;
}
if (carname.id == 2) {
_parent.game.rank2 = h6;
}
if (carname.id == 3) {
_parent.game.rank3 = h6;
}
if (carname.id == 4) {
_parent.game.rank4 = h6;
}
}
if (currentCheckPoint[carname.id] == 6) {
h7++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h7;
}
if (carname.id == 1) {
_parent.game.rank1 = h7;
}
if (carname.id == 2) {
_parent.game.rank2 = h7;
}
if (carname.id == 3) {
_parent.game.rank3 = h7;
}
if (carname.id == 4) {
_parent.game.rank4 = h7;
}
}
if (currentCheckPoint[carname.id] == 7) {
h8++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h8;
}
if (carname.id == 1) {
_parent.game.rank1 = h8;
}
if (carname.id == 2) {
_parent.game.rank2 = h8;
}
if (carname.id == 3) {
_parent.game.rank3 = h8;
}
if (carname.id == 4) {
_parent.game.rank4 = h8;
}
}
if (currentCheckPoint[carname.id] == 8) {
h9++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h9;
}
if (carname.id == 1) {
_parent.game.rank1 = h9;
}
if (carname.id == 2) {
_parent.game.rank2 = h9;
}
if (carname.id == 3) {
_parent.game.rank3 = h9;
}
if (carname.id == 4) {
_parent.game.rank4 = h9;
}
}
if (currentCheckPoint[carname.id] == 9) {
h10++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h10;
}
if (carname.id == 1) {
_parent.game.rank1 = h10;
}
if (carname.id == 2) {
_parent.game.rank2 = h10;
}
if (carname.id == 3) {
_parent.game.rank3 = h10;
}
if (carname.id == 4) {
_parent.game.rank4 = h10;
}
}
if (currentCheckPoint[carname.id] == 10) {
h11++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h11;
}
if (carname.id == 1) {
_parent.game.rank1 = h11;
}
if (carname.id == 2) {
_parent.game.rank2 = h11;
}
if (carname.id == 3) {
_parent.game.rank3 = h11;
}
if (carname.id == 4) {
_parent.game.rank4 = h11;
}
}
if (currentCheckPoint[carname.id] == 11) {
h13++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h13;
}
if (carname.id == 1) {
_parent.game.rank1 = h13;
}
if (carname.id == 2) {
_parent.game.rank2 = h13;
}
if (carname.id == 3) {
_parent.game.rank3 = h13;
}
if (carname.id == 4) {
_parent.game.rank4 = h13;
}
}
if (currentCheckPoint[carname.id] == 12) {
h14++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h14;
}
if (carname.id == 1) {
_parent.game.rank1 = h14;
}
if (carname.id == 2) {
_parent.game.rank2 = h14;
}
if (carname.id == 3) {
_parent.game.rank3 = h14;
}
if (carname.id == 4) {
_parent.game.rank4 = h14;
}
}
if (currentCheckPoint[carname.id] == 13) {
h15++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h15;
}
if (carname.id == 1) {
_parent.game.rank1 = h15;
}
if (carname.id == 2) {
_parent.game.rank2 = h15;
}
if (carname.id == 3) {
_parent.game.rank3 = h15;
}
if (carname.id == 4) {
_parent.game.rank4 = h15;
}
}
if (currentCheckPoint[carname.id] == 14) {
h16++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h16;
}
if (carname.id == 1) {
_parent.game.rank1 = h16;
}
if (carname.id == 2) {
_parent.game.rank2 = h16;
}
if (carname.id == 3) {
_parent.game.rank3 = h16;
}
if (carname.id == 4) {
_parent.game.rank4 = h16;
}
}
if (currentCheckPoint[carname.id] == 15) {
h17++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h17;
}
if (carname.id == 1) {
_parent.game.rank1 = h17;
}
if (carname.id == 2) {
_parent.game.rank2 = h17;
}
if (carname.id == 3) {
_parent.game.rank3 = h17;
}
if (carname.id == 4) {
_parent.game.rank4 = h17;
}
}
if (currentCheckPoint[carname.id] == 16) {
h18++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h18;
}
if (carname.id == 1) {
_parent.game.rank1 = h18;
}
if (carname.id == 2) {
_parent.game.rank2 = h18;
}
if (carname.id == 3) {
_parent.game.rank3 = h18;
}
if (carname.id == 4) {
_parent.game.rank4 = h18;
}
}
if (currentCheckPoint[carname.id] == 17) {
h19++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h19;
}
if (carname.id == 1) {
_parent.game.rank1 = h19;
}
if (carname.id == 2) {
_parent.game.rank2 = h19;
}
if (carname.id == 3) {
_parent.game.rank3 = h19;
}
if (carname.id == 4) {
_parent.game.rank4 = h19;
}
}
if (currentCheckPoint[carname.id] == 18) {
h20++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h20;
}
if (carname.id == 1) {
_parent.game.rank1 = h20;
}
if (carname.id == 2) {
_parent.game.rank2 = h20;
}
if (carname.id == 3) {
_parent.game.rank3 = h20;
}
if (carname.id == 4) {
_parent.game.rank4 = h20;
}
}
if (currentCheckPoint[carname.id] == 19) {
h21++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h21;
}
if (carname.id == 1) {
_parent.game.rank1 = h21;
}
if (carname.id == 2) {
_parent.game.rank2 = h21;
}
if (carname.id == 3) {
_parent.game.rank3 = h21;
}
if (carname.id == 4) {
_parent.game.rank4 = h21;
}
}
if (currentCheckPoint[carname.id] == 20) {
h22++;
if (((carname.id == 0) && (currentLap == 3)) && (finalround3 == true)) {
_parent.game.rank = h22;
}
if (carname.id == 1) {
_parent.game.rank1 = h22;
}
if (carname.id == 2) {
_parent.game.rank2 = h22;
}
if (carname.id == 3) {
_parent.game.rank3 = h22;
}
if (carname.id == 4) {
_parent.game.rank4 = h22;
}
}
}
if (currentCheckPoint[carname.id] >= checkPoint.length) {
laps[carname.id]++;
if (laps[carname.id] == 1) {
finalround1 = false;
f12++;
if (carname.id == 0) {
_parent.game.rank = f12;
}
if (carname.id == 1) {
_parent.game.rank1 = f12;
}
if (carname.id == 2) {
_parent.game.rank2 = f12;
}
if (carname.id == 3) {
_parent.game.rank3 = f12;
}
if (carname.id == 4) {
_parent.game.rank4 = f12;
}
}
if (laps[carname.id] == 2) {
finalround2 = false;
g12++;
if (carname.id == 0) {
_parent.game.rank = g12;
}
if (carname.id == 1) {
_parent.game.rank1 = g12;
}
if (carname.id == 2) {
_parent.game.rank2 = g12;
}
if (carname.id == 3) {
_parent.game.rank3 = g12;
}
if (carname.id == 4) {
_parent.game.rank4 = g12;
}
}
if (laps[carname.id] == 3) {
finalround3 = false;
h12++;
if (carname.id == 0) {
_parent.game.rank = h12;
}
if (carname.id == 1) {
_parent.game.rank1 = h12;
}
if (carname.id == 2) {
_parent.game.rank2 = h12;
}
if (carname.id == 3) {
_parent.game.rank3 = h12;
}
if (carname.id == 4) {
_parent.game.rank4 = h12;
}
}
if ((carname == car) && (laps[carname.id] != totalLaps)) {
_parent.panel.slammer.play();
}
currentCheckPoint[carname.id] = 0;
if (laps[carname.id] == totalLaps) {
finished++;
if (carname == car1) {
car1.maxSpeed = 0;
car1.accel = 0;
car1.wildness = 0;
car1.xOff = 0;
car1.yOff = 0;
}
if (carname == car2) {
car2.maxSpeed = 0;
car2.accel = 0;
car2.wildness = 0;
car2.xOff = 0;
car2.yOff = 0;
}
if (carname == car3) {
car3.maxSpeed = 0;
car3.accel = 0;
car3.wildness = 0;
car3.xOff = 0;
car3.yOff = 0;
}
if (carname == car5) {
}
if (carname == car) {
gameOver = true;
displayPlaceList = ["1st", "2nd", "3rd", "4th"];
_parent.place = finished;
_parent.displayPlace = displayPlaceList[finished - 1];
leaveInterval = setInterval(RaceOver, 1000);
}
}
}
}
if (carname == car1) {
currentLap1 = Math.min(totalLaps, laps[carname.id] + 1);
}
if (carname == car2) {
currentLap1 = Math.min(totalLaps, laps[carname.id] + 1);
}
if (carname == car3) {
currentLap1 = Math.min(totalLaps, laps[carname.id] + 1);
}
if (carname == car) {
currentLap = Math.min(totalLaps, laps[carname.id] + 1);
displayLaps = (("LAP " + currentLap) + " OF ") + totalLaps;
}
};
startgame = function () {
startTime = getTimer();
if (!_root.mute) {
_root.gamebg.start(0, 999);
}
gameStarted = true;
};
onEnterFrame = function () {
if (gameStarted && (gameplay == true)) {
KeyboardKeys();
var _local2 = 1;
while (_local2 < carList.length) {
goToTarget(carList[_local2]);
_local2++;
}
_local2 = 0;
while (_local2 < iterations) {
for (var _local3 in carList) {
carList[_local3].globalizeNodes(carList[_local3]);
carList[_local3].resetCollisions();
}
for (var _local3 in carList) {
setCurrentBumperList(carList[_local3]);
setCurrentcarList(carList[_local3]);
carList[_local3].collisionDetection();
}
for (var _local3 in carList) {
carList[_local3].collisionResponse();
}
for (var _local3 in carList) {
carList[_local3].translate();
carsLaps(carList[_local3]);
}
_local2++;
}
if (ppp == true) {
ppp = false;
_root.rkk = true;
_root.aclr.stop();
if (!_root.mute) {
_root.gamebg.start(0, 999);
}
}
_root.panel.mc_stopwatch.startstoptimer();
}
CameraPosition();
tempTime();
aligncars();
};
init = function () {
oldSpeed = {x:0, y:0};
reallyOldSpeed = {x:0, y:0};
reallyOldSpeed1 = {x:0, y:0};
reallyOldSpeed2 = {x:0, y:0};
reallyOldSpeed3 = {x:0, y:0};
sparkCount = 0;
i = 0;
while (i < pathList.length) {
var _local5 = pathList[i];
if (i < (pathList.length - 1)) {
var _local4 = pathList[i + 1];
} else {
var _local4 = pathList[0];
}
var _local8 = _local5._x - _local4._x;
var _local7 = _local5._y - _local4._y;
var _local6 = {x:-_local8, y:-_local7};
pathList[i].normal = Regulate(_local6);
pathList[i].clear();
pathList[i].lineStyle(2, 16742314, 100);
pathList[i].moveTo(0, 0);
pathList[i].lineTo(pathList[i].normal.x * 50, pathList[i].normal.y * 50);
i++;
}
_parent.game.rank3 = 1;
_parent.game.rank2 = 2;
_parent.game.rank1 = 3;
_parent.game.rank = 4;
_root.game.car1.nitromc._visible = false;
_root.game.car2.nitromc._visible = false;
_root.game.car3.nitromc._visible = false;
_root.game.car4.nitromc._visible = false;
turnFactor = 0;
finished = 0;
finalround3 = true;
finalround1 = true;
finalround2 = true;
hittst = false;
f1 = 0;
f2 = 0;
f3 = 0;
f4 = 0;
f5 = 0;
f6 = 0;
f7 = 0;
f8 = 0;
f9 = 0;
f10 = 0;
f11 = 0;
f12 = 0;
f13 = 0;
f14 = 0;
f15 = 0;
f16 = 0;
f17 = 0;
f18 = 0;
f19 = 0;
f20 = 0;
f21 = 0;
f22 = 0;
f23 = 0;
f24 = 0;
f25 = 0;
g1 = 0;
g2 = 0;
g3 = 0;
g4 = 0;
g5 = 0;
g6 = 0;
g7 = 0;
g8 = 0;
g9 = 0;
g10 = 0;
g11 = 0;
g12 = 0;
g13 = 0;
g14 = 0;
g15 = 0;
g16 = 0;
g17 = 0;
g18 = 0;
g19 = 0;
g20 = 0;
g21 = 0;
g22 = 0;
g23 = 0;
g24 = 0;
g25 = 0;
h1 = 0;
h2 = 0;
h3 = 0;
h4 = 0;
h5 = 0;
h6 = 0;
h7 = 0;
h8 = 0;
h9 = 0;
h10 = 0;
h11 = 0;
h12 = 0;
h13 = 0;
h14 = 0;
h15 = 0;
h16 = 0;
h17 = 0;
h18 = 0;
h19 = 0;
h20 = 0;
h21 = 0;
h22 = 0;
h23 = 0;
h24 = 0;
h25 = 0;
canLap = false;
laps = [0, 0, 0, 0, 0];
totalLaps = 3;
checkPoint = [checkPoint0, checkPoint1, checkPoint2, checkPoint3, checkPoint4, checkPoint5, checkPoint6, checkPoint7, checkPoint8, checkPoint9, checkPoint10, checkPoint11, checkPoint12, checkPoint13, checkPoint14, checkPoint15, checkPoint16, checkPoint17, checkPoint18, checkPoint19, checkPoint20];
currentCheckPoint = [0, 0, 0, 0, 0];
showObjects = false;
thing1Interval = setInterval(sayThing1, 500);
thing2Interval = setInterval(sayThing2, 3250);
wally = _parent.wally.dude;
gravity = 2.5;
cars = 2;
maxSpring = 30;
maxSpeed = 15;
iterations = 3;
display.startx = display.slider._x;
display.starty = display.slider._y;
camSpeed = 0;
camMax = 40;
dudeDist = 30;
startx = this._x;
starty = this._y;
carStartx = car._x;
carStarty = car._y;
bumperList = [];
cornerList = [];
borderList = [];
wallList = [];
carProperties();
timeChoices = [90, 80, 70];
totalTime = timeChoices[_parent.choice];
gameStarted = false;
gameOver = false;
gameplay = true;
objectsEaten = 0;
bumped = 0;
carCount = 0;
clocked = false;
overlay.swapDepths(1000);
display.swapDepths(900);
state = "idle";
display.pusher.dude.gotoAndStop("idle");
doWally("intro");
setSpans();
toldSmallStuff = false;
toldDoingGreat = false;
carList = [];
newcar(car, 50, 400000);
newcar(car1, 20, 100000);
newcar(car2, 20, 100000);
newcar(car3, 20, 100000);
var1 = 0;
nitro = false;
nn = false;
qq = false;
nclose = true;
pp = true;
ppp = false;
_root.wrongway._visible = false;
_parent.panel.setter.gotoAndPlay(2);
};
var keyListener = new Object();
keyListener.onKeyDown = function () {
if ((Key.getCode() == 80) || (Key.getCode() == 112)) {
if (gameplay == true) {
_root.pmc._visible = true;
gameplay = false;
} else {
_root.pmc._visible = false;
gameplay = true;
}
}
};
Key.addListener(keyListener);
gotoAndStop("Level" + _parent.LevelNum);
Instance of Symbol 442 MovieClip "dustClip_mc" in Symbol 620 MovieClip Frame 1
onClipEvent (load) {
pl = 1;
this._alpha = 100;
this._rotation = 0;
this._x = _root.game.car._x + 30;
this._y = _root.game.car._y + 30;
timer = 1;
}
onClipEvent (enterFrame) {
timer++;
_y = (_y + 1);
if (timer > 10) {
_alpha = (_alpha - 2);
}
if (timer > 50) {
_visible = 0;
removeMovieClip(this);
}
}
Symbol 620 MovieClip Frame 5
pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18];
init();
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
Instance of Symbol 531 MovieClip "car" in Symbol 620 MovieClip Frame 5
onClipEvent (load) {
this.swapDepths(20000);
}
Symbol 620 MovieClip Frame 13
pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18];
init();
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
Symbol 620 MovieClip Frame 20
pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18];
init();
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
Symbol 620 MovieClip Frame 30
pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18, path19, path20, path21, path22, path23, path24, path25, path26];
init();
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
Symbol 620 MovieClip Frame 40
pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18, path19, path20, path21, path22, path23, path24, path25];
init();
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
Symbol 620 MovieClip Frame 50
pathList = [path0, path1, path2, path3, path4, path5, path6, path7, path8, path9, path10, path11, path12, path13, path14, path15, path16, path17, path18, path19, path20, path21, path22, path23, path24, path25];
init();
for (var j in this) {
this[j].cacheAsBitmap = !this[j].cacheAsBitmap;
}
Symbol 622 Button
on (release) {
_root.gotoAndStop("menu");
}
Symbol 627 MovieClip Frame 1
stop();
Symbol 627 MovieClip Frame 89
_root.gasOver("special_5");
_root.initNo = 1;
Symbol 629 MovieClip Frame 1
stop();
Symbol 629 MovieClip Frame 89
_root.gasOver("special_4");
_root.initNo = 1;
Symbol 631 MovieClip Frame 1
stop();
Symbol 631 MovieClip Frame 89
_root.gasOver("special_3");
Symbol 633 MovieClip Frame 1
stop();
Symbol 633 MovieClip Frame 89
_root.gasOver("special_2");
_root.initNo = 1;
Symbol 635 MovieClip Frame 1
stop();
Symbol 635 MovieClip Frame 89
_root.gasOver("special_1");
_root.initNo = 1;
Symbol 636 MovieClip Frame 1
stop();
Symbol 636 MovieClip Frame 89
_root.initNo = 1;
_root.gasOver("normal");
Symbol 658 MovieClip [startGame] Frame 1
stop();
Symbol 658 MovieClip [startGame] Frame 2
play();
Symbol 658 MovieClip [startGame] Frame 30
play();
Symbol 658 MovieClip [startGame] Frame 60
play();
Symbol 658 MovieClip [startGame] Frame 90
play();
Symbol 658 MovieClip [startGame] Frame 101
_parent._parent.game.startgame();
Symbol 668 MovieClip Frame 1
function startstoptimer() {
if (!stopwatch) {
if (paused) {
startTime = getTimer() - elapsedTime;
} else {
startTime = getTimer();
}
paused = false;
stopwatch = true;
}
}
function stopstopwatchtimer() {
stopwatch = false;
paused = false;
stopwatch_txt = "00:00:00:00";
}
var stopwatch = false;
var paused = false;
var remaining;
var elapsedTime;
var elapsedHours;
var elapsedM;
var elapsedS;
var elapsedH;
var startTime;
var remaining;
var hours;
var minutes;
var seconds;
var hundredths;
pause_btn.onPress = function () {
if (stopwatch) {
stopwatch = false;
paused = true;
} else {
stopwatch = true;
paused = false;
}
};
onEnterFrame = function () {
if ((stopwatch && (_root.game.gameplay == true)) && (!_root.game.gameOver)) {
elapsedTime = getTimer() - startTime;
elapsedHours = Math.floor(elapsedTime / 3600000);
remaining = elapsedTime - (elapsedHours * 3600000);
elapsedM = Math.floor(remaining / 60000);
remaining = remaining - (elapsedM * 60000);
elapsedS = Math.floor(remaining / 1000);
remaining = remaining - (elapsedS * 1000);
elapsedH = Math.floor(remaining / 10);
if (elapsedHours < 10) {
hours = "0" + elapsedHours.toString();
} else {
hours = elapsedHours.toString();
}
if (elapsedM < 10) {
minutes = "0" + elapsedM.toString();
} else {
minutes = elapsedM.toString();
}
if (elapsedS < 10) {
seconds = "0" + elapsedS.toString();
} else {
seconds = elapsedS.toString();
}
if (elapsedH < 10) {
hundredths = "0" + elapsedH.toString();
} else {
hundredths = elapsedH.toString();
}
_root.FinalTime = (stopwatch_txt = (((((hours + ":") + minutes) + ":") + seconds) + ":") + hundredths);
stopwatch_minutes_txt = minutes;
stopwatch_seconds_txt = seconds;
stopwatch_hundredths_txt = hundredths;
} else {
startTime = getTimer() - elapsedTime;
}
};
Symbol 680 MovieClip Frame 1
stop();
Symbol 680 MovieClip Frame 2
stop();
Symbol 680 MovieClip Frame 3
stop();
Symbol 680 MovieClip Frame 4
stop();
Symbol 680 MovieClip Frame 5
stop();
Symbol 680 MovieClip Frame 6
stop();
Symbol 696 MovieClip Frame 1
SpaceDiff = function (x1, y1, x2, y2) {
distx = x1 - x2;
disty = y1 - y2;
return(Math.sqrt((distx * distx) + (disty * disty)));
};
CCapacity = function (v1) {
return(SpaceDiff(0, 0, v1.x, v1.y));
};
dot = function (v1, v2) {
return((v1.x * v2.x) + (v1.y * v2.y));
};
Regulate = function (v1) {
var _local1 = 1 / CCapacity(v1);
return({x:v1.x * _local1, y:v1.y * _local1});
};
adds = function (v1, v2) {
tempVector = new Object();
tempVector.x = v1.x + v2.x;
tempVector.y = v1.y + v2.y;
return(tempVector);
};
subtract = function (v1, v2) {
tempVector = new Object();
tempVector.x = v1.x - v2.x;
tempVector.y = v1.y - v2.y;
return(tempVector);
};
multiply = function (s, v) {
tempVector = new Object();
tempVector.x = v.x * s;
tempVector.y = v.y * s;
return(tempVector);
};
resetCollisions = function () {
myCollisions = new Array();
myColliders = [];
};
SetAngle = function (xdist, ydist) {
a = Math.atan(ydist / xdist) * rad;
if ((xdist > 0) && (ydist < 0)) {
a = -a;
}
if (xdist < 0) {
a = 180 - a;
}
if ((xdist > 0) && (ydist > 0)) {
a = 360 - a;
}
return(a);
};
getSlope = function (x1, y1, x2, y2) {
return((y1 - y2) / (x1 - x2));
};
getIntercept = function (x1, y1, slope) {
return(y1 - (x1 * slope));
};
getIntersection = function (x1, y1, x2, y2, x3, y3, x4, y4) {
m1 = getSlope(x1, y1, x2, y2);
m2 = getSlope(x3, y3, x4, y4);
b1 = getIntercept(x1, y1, m1);
b2 = getIntercept(x3, y3, m2);
tempPoint = new Object();
tempPoint.x = (b2 - b1) / (m1 - m2);
tempPoint.y = (m1 * tempPoint.x) + b1;
return(tempPoint);
};
borderTest = function (which) {
clip = _parent.borderList[which];
if (hitter.hitTest(clip)) {
for (var _local8 in gNodeList) {
var _local3 = {x:gNodeList[_local8].x, y:gNodeList[_local8].y};
this._parent.localToGlobal(_local3);
if (clip.hitTest(_local3.x, _local3.y, true)) {
bumpness = 0.5;
var _local4 = {x:(this.speed.x * bumpness) + gNodeList[_local8].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local8].diff.y};
for (var _local7 in clip.hitterList) {
myDist = SpaceDiff(gNodeList[_local8].x, gNodeList[_local8].y, clip._x - (clip.hitterList[_local7].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local7].collisionNormal.y * 10000000));
futureDist = SpaceDiff(gNodeList[_local8].x + _local4.x, gNodeList[_local8].y + _local4.y, clip._x - (clip.hitterList[_local7].collisionNormal.x * 10000000), clip._y - (clip.hitterList[_local7].collisionNormal.y * 10000000));
if (clip.hitterList[_local7].hitTest(_local3.x, _local3.y, true) && (myDist > futureDist)) {
collisionInfo = new Object();
collisionInfo.perpVector = {x:0, y:0};
collisionInfo.heft = heft * 1E16;
collisionInfo.normal = clip.hitterList[_local7].collisionNormal;
collisionInfo.speed = {x:0, y:0};
collisionInfo.mySpeed = _local4;
collisionInfo.mass = 1E18;
collisionInfo.body = clip;
if (nodeList[_local8]._x < 0) {
collisionInfo.backwards = -1.4;
} else {
collisionInfo.backwards = 1;
}
myCollisions.push(collisionInfo);
}
}
}
}
}
};
bumperTest = function (which) {
clip = currentBumperList[which];
if (clip.active) {
if (hitter.hitTest(clip)) {
for (var _local5 in gNodeList) {
bumpness = 0.5;
var _local2 = {x:(this.speed.x * bumpness) + gNodeList[_local5].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local5].diff.y};
myDist = SpaceDiff(gNodeList[_local5].x, gNodeList[_local5].y, clip._x, clip._y);
futureDist = SpaceDiff(gNodeList[_local5].x + _local2.x, gNodeList[_local5].y + _local2.y, clip._x, clip._y);
myDiff = myDist - clip.span;
myCount++;
if ((myDiff <= 0) && (myDist > futureDist)) {
collisionInfo = new Object();
collisionInfo.collider = clip._name;
collisionInfo.perpVector = {x:0, y:0};
collisionInfo.heft = heft * 1000;
collisionInfo.normal = SetNormal(this, clip);
collisionInfo.speed = {x:0, y:0};
collisionInfo.mySpeed = _local2;
collisionInfo.mass = 100000000000000;
myCollisions.push(collisionInfo);
}
}
}
}
};
globalizeNodes = function (carname) {
carname.gNodeList = [];
for (var _local4 in carname.nodeList) {
carname.gNodeList[_local4] = {x:nodeList[_local4]._x, y:nodeList[_local4]._y};
carname.localToGlobal(carname.gNodeList[_local4]);
carname.gNodeList[_local4].diff = {x:carname.gNodeList[_local4].x - carname.nodeList[_local4].oldPos.x, y:carname.gNodeList[_local4].y - carname.nodeList[_local4].oldPos.y};
carname._parent.globalToLocal(carname.gNodeList[_local4]);
}
};
saveNodePositions = function () {
for (var _local5 in nodeList) {
var _local2 = {x:nodeList[_local5]._x, y:nodeList[_local5]._y};
this.localToGlobal(_local2);
nodeList[_local5].oldPos = {x:_local2.x, y:_local2.y};
}
};
SetNormal = function (me, him) {
tempVector = new Object();
tempVector.x = him._x - me._x;
tempVector.y = him._y - me._y;
return(tempVector);
};
unDaze = function () {
clearInterval(dazeInterval);
dazed = false;
};
daze = function () {
clearInterval(dazeInterval);
if (this != _parent.car) {
dazeInterval = setInterval(unDaze, 100);
} else {
dazeInterval = setInterval(unDaze, 50);
}
dazed = true;
};
getJ = function (mine, his, normal, hismass, hisHeft, hisPerp) {
myr = (temp = new Object());
diff = new Object();
diff = subtract(mine, his);
temp = multiply(-(1.05 + elastic), diff);
top = dot(temp, normal);
massnum = (1 / mass) + (1 / hismass);
temp = multiply(massnum, normal);
firstAdd = dot(perpVector, normal);
firstAdd = firstAdd * firstAdd;
firstAdd = firstAdd / heft;
secondAdd = dot(hisPerp, normal);
secondAdd = secondAdd * secondAdd;
secondAdd = secondAdd / hisHeft;
bottom = dot(normal, temp);
bottom = bottom + (firstAdd + secondAdd);
j = top / bottom;
return(j);
};
getCollisions = function () {
var _local4 = 0;
while (_local4 < currentcarList.length) {
clip = currentcarList[_local4];
if (clip.id != id) {
isCollider = false;
for (var _local8 in myColliders) {
if (myColliders[_local8] == clip) {
isCollider = true;
}
}
if (!isCollider) {
if (hitter.hitTest(clip.hitter)) {
for (_local4 in gNodeList) {
bumpness = 0.5;
var _local5 = {x:(this.speed.x * bumpness) + gNodeList[_local4].diff.x, y:(this.speed.y * bumpness) + gNodeList[_local4].diff.y};
myDist = SpaceDiff(this._x, this._y, clip._x, clip._y);
futureDist = SpaceDiff(this._x + speed.x, this._y + speed.y, clip._x + clip.speed.x, clip._y + clip.speed.y);
var _local3 = {x:gNodeList[_local4].x, y:gNodeList[_local4].y};
this._parent.localToGlobal(_local3);
if (clip.hitter.hitTest(_local3.x, _local3.y, true) && (myDist > futureDist)) {
collisionInfo = new Object();
collisionInfo.perpVector = clip.perpVector;
collisionInfo.normal = SetNormal(clip, this);
collisionInfo.speed = clip.speed;
collisionInfo.mySpeed = speed;
collisionInfo.rot = clip.rot;
collisionInfo.mass = clip.mass;
collisionInfo.heft = clip.heft;
if (nodeList[_local4]._x < 0) {
collisionInfo.backwards = -1.4;
} else {
collisionInfo.backwards = 1;
}
myCollisions.push(collisionInfo);
collisionInfo2 = new Object();
collisionInfo2.perpVector = this.perpVector;
collisionInfo2.normal = SetNormal(this, clip);
collisionInfo2.speed = this.speed;
collisionInfo2.mySpeed = clip.speed;
collisionInfo2.rot = this.rot;
collisionInfo2.mass = this.mass;
collisionInfo2.heft = this.heft;
clip.globalToLocal(_local3);
if (_local3.x < 0) {
collisionInfo2.backwards = -1.4;
} else {
collisionInfo2.backwards = 1;
}
clip.myCollisions.push(collisionInfo2);
clip.myColliders.push(this);
}
}
}
}
}
_local4++;
}
var _local9 = CCapacity(speed);
_local4 = 0;
while (_local4 < _parent.cornerList.length) {
cornerTest(_local4);
_local4++;
}
_local4 = 0;
while (_local4 < currentBumperList.length) {
bumperTest(_local4);
_local4++;
}
_local4 = 0;
while (_local4 < _parent.borderList.length) {
borderTest(_local4);
_local4++;
}
return(myCollisions);
};
SetFriction = function () {
var _local4 = _parent.SetAngle(speed.x, speed.y);
var _local3 = Math.abs((this._rotation - _local4) % 90);
_local3 = ((_local3 / 90) * 0.25) + 0.75;
if (this == _parent.car) {
}
velocity = preVelocity - (friction * _local3);
velocity = Math.max(0, velocity);
ratio = velocity / preVelocity;
speed.x = speed.x * ratio;
speed.y = speed.y * ratio;
};
translate = function () {
saveNodePositions();
oldPos = new Object();
oldPos.x = _x;
oldPos.y = _y;
preVelocity = SpaceDiff(0, 0, speed.x, speed.y);
spin = spin + preVelocity;
frame = (int(spin * 0.1) % 35) + 1;
_parent.display.hider.gotoAndStop(frame);
if (maxVelocity > maxVelocity) {
finalVel = finalVel * 0.8;
} else {
finalVel = maxVelocity;
}
finalVel = Math.max(finalVel, maxVelocity);
if (preVelocity > finalVel) {
ratio = finalVel / preVelocity;
speed.x = speed.x * ratio;
speed.y = speed.y * ratio;
}
_x = (_x + (speed.x / _parent.iterations));
_y = (_y + (speed.y / _parent.iterations));
_rotation = (_rotation + (rot * rad));
rot = rot * 0.85;
perpVector.x = (-Math.sin(_rotation / rad)) * span;
perpVector.y = Math.cos(_rotation / rad) * span;
preVelocity = SpaceDiff(0, 0, speed.x, speed.y);
if (preVelocity > 0) {
SetFriction();
}
assignNodeSpeeds();
};
collisionDetection = function () {
collisionList = new Array();
collisionList = getCollisions();
};
collisionResponse = function () {
if (collisionList.length > 0) {
speedTotal = new Object();
speedTotal.x = 0;
speedTotal.y = 0;
rotTotal = 0;
i = 0;
while (i < collisionList.length) {
j = getJ(collisionList[i].mySpeed, collisionList[i].speed, collisionList[i].normal, collisionList[i].mass, collisionList[i].heft, collisionList[i].perpVector);
temp = new Object();
temp = multiply(j / mass, collisionList[i].normal);
speedTotal = adds(speedTotal, temp);
jNormal = new Object();
jNormal = multiply(j, collisionList[i].normal);
value = dot(jNormal, perpVector);
rotTotal = rotTotal + ((value / heft) * collisionList[i].backwards);
var _local3 = collisionList[i].body;
i++;
}
_parent.determineSpecs(_local3._name);
vol = int(CCapacity(speedTotal) * 2);
if (vol > 0) {
daze();
}
if (vol > 15) {
var _local4 = determineSound(_local3);
_root.sounds.instance[_local4].setVolume(vol);
_root.sounds.volumes[_local4] = vol;
_root.sounds.goals[_local4] = vol;
if (_local4 == 1) {
_root.sounds.bounce.start();
} else if (_local4 == 2) {
_root.sounds.rim.start();
} else if (_local4 == 4) {
_root.sounds.backboard.start();
}
}
speedTotal.x = speedTotal.x / collisionList.length;
speedTotal.y = speedTotal.y / collisionList.length;
speedTotal.x;
speedTotal.y;
rotTotal = rotTotal / collisionList.length;
rot = rot + rotTotal;
speed = adds(speed, speedTotal);
_parent.checkBounces();
}
};
stop();
myCount = 0;
nodeList = [];
Symbol 697 MovieClip Frame 1
carList = [car, car1, car2, car3];
for (var i in carList) {
carList[i].gotoAndStop(Number(i) + 1);
}
car.swapDepths(100);
onEnterFrame = function () {
for (var _local2 in carList) {
carList[_local2]._x = _parent._parent.game.carList[_local2]._x;
carList[_local2]._y = _parent._parent.game.carList[_local2]._y;
}
};
Symbol 698 MovieClip Frame 1
stop();
Symbol 699 MovieClip Frame 1
car.gotoAndStop(_parent.choice + 1);
game.track.gotoAndStop(_parent.LevelNum + 1);
Symbol 733 Button
on (press) {
_root.gotoAndStop("choose");
_root.NextLevel++;
_root.initLevel++;
}
Symbol 752 Button
on (press) {
_root.NextLevel++;
_root.initLevel++;
if (_root.l1comp == true) {
_root.LevelNum = 1;
_root.gotoAndStop("game");
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 20;
}
}
if (_root.l2comp == true) {
_root.LevelNum = 2;
_root.gotoAndStop("game");
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 20;
}
}
if (_root.l3comp == true) {
_root.LevelNum = 3;
_root.gotoAndStop("game");
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 20;
}
}
if (_root.l4comp == true) {
_root.LevelNum = 4;
_root.gotoAndStop("game");
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 20;
}
}
if (_root.l5comp == true) {
_root.LevelNum = 5;
_root.gotoAndStop("game");
if (_root.ntimes == 0) {
_root.nnn_5._visible = false;
_root.nnn_1._visible = false;
_root.nnn_2._visible = false;
_root.nnn_3._visible = false;
_root.nnn_4._visible = false;
_root.nnn._visible = false;
_root.game.car.maxSpeed = 20;
}
}
}
Symbol 762 Button
on (press) {
_root.gotoAndStop("levelpage");
}
Symbol 767 Button
on (press) {
_root.l1comp = false;
_root.l2comp = false;
_root.l3comp = false;
_root.l4comp = false;
_root.l5comp = false;
_root.l6comp = false;
_root.money = 0;
ntimes = 1;
_root.b1t = 1000;
_root.b2t = 2000;
_root.b3t = 3000;
_root.b4t = 4000;
_root.b5t = 5000;
_root.b6t = 5000;
_root.car1 = false;
_root.car2 = false;
_root.car3 = false;
_root.car4 = false;
_root.car5 = false;
_root.gotoAndStop("menu");
}
Symbol 780 Button
on (release) {
getURL ("http://www.startonlinegames.com/play.php?id=4215", "_blank");
}
Symbol 784 Button
on (release) {
getURL ("http://www.startonlinegames.com/play.php?id=4106", "_blank");
}
Symbol 788 Button
on (release) {
getURL ("http://www.startonlinegames.com/play.php?id=4195", "_blank");
}
Symbol 792 Button
on (release) {
getURL ("http://www.startonlinegames.com/play.php?id=4132", "_blank");
}
Symbol 794 Button
on (press) {
_root.gotoAndStop("choose");
}
Symbol 798 Button
on (release) {
getURL ("http://www.gamebusted.com", "_blank");
}
on (rollOver) {
curmcccc.gotoAndPlay(2);
}
on (rollOut) {
curmcccc.gotoAndPlay(13);
}
Symbol 802 MovieClip Frame 1
stop();
Symbol 802 MovieClip Frame 12
gotoAndPlay (8);
Symbol 802 MovieClip Frame 16
stop();
Symbol 807 Button
on (press) {
_root.l1comp = false;
_root.l2comp = false;
_root.l3comp = false;
_root.l4comp = false;
_root.l5comp = false;
_root.l6comp = false;
_root.money = 0;
ntimes = 1;
_root.b1t = 1000;
_root.b2t = 2000;
_root.b3t = 3000;
_root.b4t = 4000;
_root.b5t = 5000;
_root.b6t = 5000;
_root.car1 = false;
_root.car2 = false;
_root.car3 = false;
_root.car4 = false;
_root.car5 = false;
_root.gotoAndStop("menu");
}
