STORY   LOOP   FURRY   PORN   GAMES
• C •   SERVICES [?] [R] RND   POPULAR
Archived flashes:
233194
/disc/ · /res/     /show/ · /fap/ · /gg/ · /swf/P0001 · P2641 · P5282

<div style="position:absolute;top:-99px;left:-99px;"><img src="https://tools.swfchan.com/stathit.asp?noj=FRM39365017-30DC&rnd=39365017" width="1" height="1"></div>

hair_mania.swf

This is the info page for
Flash #254404

(Click the ID number above for more basic data on this flash file.)


Text
BR

TestCode

colse

trace

Lock & unlock Tools

unlock customer (level) to

Reset All Data

High scores here

DAY BUTTON DOwn

Week BUTTON down

month BUTTON down

BACK

TERUG

RETOUR

ZURÜCK

ATRÁS

ANTERIOR

RETROCEDER

INDIETRO

BAKÅT

POWRÓT

НАЗАД

GERİ

KEMBALI

UNDUR

戻る

<p align="center"><font face="_sans" size="14" color="#000000" letterSpacing="0.000000" kerning="1"><b>返回</b></font></p>

<p align="center"><font face="_sans" size="14" color="#000000" letterSpacing="0.000000" kerning="1">0%</font></p>

© www.spilgames.com

© www.spilgames.com

Loading...

下载中…

Laden…

Chargement...

Wird geladen…

Ładowanie…

Laddar …

Caricamento…

Cargando...

A carregar...

Carregando…

Загрузка…

Pengisian…

More crazy games at:

更多疯狂游戏:

Meer gekke spelletjes op:

Plus de jeux délirants sur :

Mehr verrückte Spiele auf:

Más juegos alocados en:

Mais jogos malucos em:

Più giochi pazzi su:

Fler galna spel på:

Więcej zwariowanych gier na:

Другие бредовые игры на

Permainan gila-gilaan lainnya di:

もっとクレイジーゲームで遊ぶ

第一帧要加载的声音

Click on tools from the bar below and
drag them to the client.

点击下面工具栏上的工具,然后拖拽到顾客
头上。

Klik op het gereedschap in de balk
hieronder en sleep ze naar de klant.

Clique sur les outils dans la barre ci-
dessous pour les déplacer vers le
client.

Klicke auf Gegenstände in der Leiste
unten  und ziehe sie auf den Kunden.

Haz clic en los utensilios de la barra
inferior y arrástralos hasta el cliente.

Clique nos instrumentos da barra
abaixo e arraste-os até o cliente.

Clica nas ferramentas da barra abaixo
e arrasta-as para o cliente.

Clicca sugli utensili della barra in
basso e trascinali verso il cliente.

Klicka på verktygen på listen nedan
och dra dem till kunden.

Klikaj na akcesoria na panelu poniżej i
przeciągnij je na klienta.

Щелкай по инструментам на панели
внизу и перетягивай их на клиента.

Klik pada peralatan-peralatan di
bagian bawah dan tariklah peralatan
tersebut kepada tamu.

道具リストの中から必要な物を選んで、マ
ウスを思いきり早く動かして!

Apply vigorously to fill the powerbar
for maximum pouf!

努力填满力度槽,可以获得最好的效果!

Breng grote hoeveelheden aan voor
extra veel volume!

Applique vigoureusement afin de
remplir la barre de puissance pour un
maximum d'effet.

Gehe energisch vor, um den
Energiebalken für den maximalen
Haaralptraum zu füllen!

¡Aplica vigorosamente para llenar la
barra y conseguir un ahuecado
máximo!

Aplique com vontade para preencher
a barra de progresso e obter o
máximo efeito pufe.

Aplica vigorosamente para encheres a
barra de potência e obteres o máximo
de volume!

Impegnati vigorosamente per riempire
la barra di potenza ed avere il
massimo delle acconciature pouf!

Använd massor för att fylla
kraftmätaren och få maximal volym!

Nakładaj energicznie, aby wypełnić
wskaźnik mocy do maksimum!

Действуй решительно, чтобы
заполнить шкалу мощности для
создания максимального объема!

Aplikasikan sekuat tenaga untuk
memenuhi palang kekuatan untuk
taburan maksimal!

Apply vigorously to fill the power bar
for maximum pouf!

レベルクリア:目標のラインまでヘアを大
きくさせること!

The bigger the hair, the badder the stylist: in this salon it's always the 80s!

做爆炸头越大越好,这个发廊总是流行80年代风格!

Hoe groter 't kapsel, hoe beter de kapster! De jaren '80
herleven in deze kapsalon!

Plus la coiffure est haute, plus le styliste est génial : dans ce salon nous en
sommes restés aux années 80 !

Je dicker die Haare, desto besser der Frisör: In diesem Salon erlebt man
eine Zeitreise in die 80er Jahre!

Cuanto más voluminoso es el pelo, mejor es el estilista: ¡en este salón
siempre son los 80!

Quanto maior o cabelo, melhor a cabeleireira: neste salão, os anos 80
vieram para ficar!

Quanto maior o cabelo, melhor a estilista: neste salão,
estamos sempre nos anos 80!

Più voluminosi sono i capelli, migliore sarà il parrucchiere: in questo salone
sono sempre gli anni 80!

Ju större hår, desto bättre frisör. 80-talet lever kvar i den här salongen!

Im wyższa fryzura, tym lepszy stylista: w tym salonie niezmiennie panują lata 80!

Чем больше прическа, тем круче стилист: в этом салоне всегда 80-е!

Makin kembang rambutnya, makin bagus tatanan rambutnya: dalam salon
yang selalu bergaya era 80 an ini!

The bigger the hair, the better the stylist: this salon is stuck in the '80s!

できるだけお客様のヘアを巨大にしてください。

HOW TO PLAY

游戏说明

SPELREGELS

INSTRUCTIONS

ANLEITUNG

CÓMO JUGAR

COMO JOGAR

COME GIOCARE

SPELREGLER

JAK GRAĆ

КАК ИГРАТЬ

CARA BERMAIN

遊び方

If any customers lose their nerve and try to leave, you have several
ways to tempt/force them to stay.

如果任何顾客失去耐心想离开,你就要诱惑或者武力迫使他们留下。

Er zijn meerdere manieren om ongeduldige klanten binnen te houden.

Si des clients perdent patience et essaient de partir, tu as plusieurs
façons de les inciter/forcer à rester.

Wenn irgendein Kunde die Nerven verliert und gehen möchte, hast du
mehrere Möglichkeiten, ihn zum Bleiben zu bewegen/zwingen.

Si un cliente pierde los nervios y trata de marcharse, dispones de
medios para tentarlo/forzarlo a que se quede.

Se o freguês perder a paciência e tentar ir embora, há várias maneiras
de tentá-los ou forçá-los a ficar.

Se algum cliente perder a coragem e tentar sair, tens várias maneiras
de os convencer/obrigar a ficar.

Se qualche cliente si perde d'animo e cerca di andarsene, hai diversi
modi per invogliarlo/forzarlo a restare.

Om en kund ångrar sig och försöker gå har du flera möjligheter att
locka/tvinga dem att stanna kvar.

Jeśli któryś z klientów straci cierpliwość i będzie chciał wyjść, masz
do dyspozycji kilka sposobów, aby skłonić/zmusić go do pozostania.

Если у кого-то из посетителей закончится терпение и он попытается уйти, в
твоем распоряжении есть несколько способов убедить/заставить его остаться.

Jika para tamu kehilangan keberanian dan mencoba untuk pergi, maka anda
mempunyai beberapa cara untuk menggoda mereka agar tetap tinggal.

If any clients lose their nerve and try to leave, you have several ways
of temping/forcing them to stay.

もしもお客様が帰りたがったら、椅子に座らせておくために、彼らにちょっとし
た小道具を使うことができます。

Hold down the
button and move
the mouse
quickly right and
left.

Hold down the
button and move
the mouse
quickly up and
down.

Hold down the
button and
quickly move
the mouse over
the hair.

Hold down the
button and
quickly make
circles with the
mouse.

Drag and drop
the item onto
the hair and
then hit Space
as rapidly as
possible to fill
the powerbar.

看住鼠标,快速的
左右移动。

按住鼠标,快速的
上下移动。

按住鼠标,在头发
上快速移动。

按住鼠标,在头发
上快速的画圈。

拖拽工具到顾客
头发上,然后快
速的按空格,使
力度条填满。

Houd de
muisknop
ingedrukt en
beweeg de muis
krachtig en snel
naar links en
rechts.

Houd de
muisknop
ingedrukt en
beweeg de muis
krachtig en snel
naar boven en
beneden.

Houd de
muisknop
ingedrukt en
beweeg de muis
snel over het
haar.

Houd de
muisknop
ingedrukt en
maak snelle
rondjes met de
muis.

Sleep het
haarmiddel naar
het kapsel en
laat los. Druk
dan zo snel
mogelijk achter
elkaar op de
spatiebalk om
de balk te
vullen.

En maintenant le
bouton appuyé,
déplace la
souris
rapidement vers
la gauche et la
droite.

En maintenant le
bouton appuyé,
déplace la
souris
rapidement vers
le haut et le bas.

En maintenant
le bouton
appuyé,
déplace la
souris
rapidement au-
dessus des
cheveux.

En maintenant
le bouton
appuyé, fais
des cercles
rapides à
l'aide de ta
souris.

Déplace et
lâche le
produit sur les
cheveux puis
appuie sur la
barre d'espace
le plus
rapidement
possible pour
remplir la barre
de puissance.

Halte die Taste
gedrückt und
bewege die
Maus schnell
nach rechts und
links.

Halte die Taste
gedrückt und
bewege die
Maus schnell
nach oben und
unten.

Halte die Taste
gedrückt und
bewege die
Maus schnell
über die Haare.

Halte die Taste
gedrückt und
ziehe schnelle
Kreise mit der
Maus.

Ziehe den
Gegenstand auf
die Haare, lasse
die Maustaste
los und drücke
die Leertaste so
schnell wie
möglich, um den
Energiebalken
zu füllen.

Mantén pulsado
el botón y
mueve el ratón
rápidamente a
derecha e
izquierda.

Mantén pulsado
el botón y
mueve el ratón
rápidamente
arriba y abajo.

Mantén pulsado
el botón y
mueve el ratón
rápidamente por
encima del pelo.

Mantén pulsado
el botón y
mueve el ratón
rápidamente en
círculos.

Arrastra y suelta
el objeto sobre
el pelo y pulsa
Espacio lo más
rápido posible
para llenar la
barra.

Mantenha o
botão do mouse
pressionado e
mova o mouse
rapidamente da
direita para a
esquerda.

Mantenha o
botão do mouse
pressionado e
mova o mouse
rapidamente de
cima para baixo.

Mantenha o
botão do mouse
pressionado e
mova o mouse
rapidamente
sobre o cabelo.

Mantenha o
botão do mouse
pressionado e
faça círculos
rápidos com o
mouse.

Arraste e solte o
item no cabelo e
pressione barra
de espaço o
mais rápido
possível para
preencher a
barra de
progresso.

Mantém o botão
do rato premido
e move o rato
rapidamente
para a esquerda
e direita.

Mantém o botão
do rato premido
e move o rato
rapidamente
para cima e para
baixo.

Mantém o
botão do rato
premido e move
o rato
rapidamente
sobre o cabelo.

Mantém o botão
do rato premido
e faz círculos
rapidamente
com o rato.

Arrasta e larga
o objecto para
o cabelo e
depois prime a
Barra de
espaços o mais
rapidamente
possível para
encheres a
barra de
potência.

Tieni premuto il
tasto e muovi
velocemente il
mouse a destra
e a sinistra.

Tieni premuto il
tasto e muovi
velocemente il
mouse su e giù.

Tieni premuto il
tasto e muovi
velocemente il
mouse sui
capelli.

Tieni premuto il
tasto e fai
velocemente
dei cerchi con
il mouse.

Trascina e fai
cadere l'oggetto
sopra i capelli e
poi premi la
barra
spaziatrice il più
rapidamente
possibile per
riempire la barra
di potenza.

Håll ned
knappen och för
musen snabbt åt
höger och
vänster.

Håll ned
knappen och för
musen snabbt
uppåt och nedåt.

Håll ned
knappen och för
musen snabbt
över håret.

Håll ned
knappen och för
musen snabbt i
cirklar.

Dra och släpp
föremål på
håret och tryck
sedan på
mellanslag så
snabbt du kan
för att fylla
kraftmätaren.

Przytrzymaj
przycisk i
szybko poruszaj
myszką w prawo
i w lewo.

Przytrzymaj
przycisk i
szybko poruszaj
myszką w górę i
w dół.

Przytrzymaj
przycisk i
szybko
przesuwaj
myszkę nad
fryzurą.

Przytrzymaj
przycisk i
szybko
zataczaj
myszką koła.

Przeciągnij i
upuść narzędzie
na fryzurę, a
następnie jak
najszybciej
naciskaj spację,
aby zapełnić
wskaźnik mocy.

Удерживая
кнопку, быстро
двигай мышку
влево-вправо.

Удерживая
кнопку, быстро
двигай мышку
вверх-вниз.

Удерживая
кнопку, быстро
двигай мышку
вверх-вниз по
прическе.

Удерживая
кнопку, быстро
описывай
мышкой круги
над
прической.

Перетащи
элемент на
прическу, а
затем как
можно быстрее
щелкай
пробелом,
чтобы
заполнить
шкалу
мощности.

Tahan tombol
dan gerakkan
mouse ke kanan
dan kiri dengan
cepat.

Tahan tombol
dan gerakkan
mouse ke atas
dan bawah
dengan cepat.

Tahan tombol
dan gerakkan
mouse pada
bagian rambut
dengan cepat.

Tahan tombol
dan buatlah
lingkaran
dengan mouse
dengan cepat.

Tarik dan
letakkan benda
pada rambut dan
kemudian tekan
Spasi dengan
cepat untuk
memenuhi
palang
kekuatan.

Hold the mouse
button down and
move the mouse
quickly left and
right.

Hold down the
mouse button
and move the
mouse quickly
up and down.

Hold down the
mouse button
and move the
mouse quickly
over the hair.

Hold down the
mouse button
and make
circles quickly
with the
mouse.

Drag and drop
the item onto
the hair and
then hit the
spacebar as
quickly as you
can to fill the
power bar.

クリックしてドラッ
グ、そしてマウスを
左から右に向かって
動かします

クリックしてドラッ
グ、そしてマウスを
上下に動かします

クリックしてド
ラッグ、マウスを
ヘアの上に持って
いきます

クリックしてド
ラッグ、マウスを
ヘアの周りをぐる
ぐる円を描くよう
に動かします

クリックしてド
ラッグ、そして落
とします

Drop

拖拽

Laat los

Lâche

Maustaste
loslassen

Suelta

Soltar

Largar

Fai cadere

Släpp

Upuść

Отпусти

Letakkan

落とす

TARGET:

目标:

DOEL:

CIBLE :

ZIEL:

OBJETIVO:

INSTRUMENTOS:

OBJECTIVO:

OBIETTIVO:

MÅL:

CEL:

ЦЕЛЬ:

目標:

USED:

使用过的道具:

GEBRUIKT:

UTILISÉ :

GENUTZT:

USADOS:

USADAS:

USATI:

ANVÄNT:

UŻYTO:

ИСПОЛЬЗОВАНО:

MEMPERGUNAKAN:

使用済みの道具:

00:00

10/20

10/20

MAIN MENU

主菜单

HOOFDMENU

MENU PRINCIPAL

HAUPTMENÜ

MENÚ PRINCIPAL

MENU PRINCIPALE

HUVUDMENY

MENU GŁÓWNE

ГЛАВНОЕ МЕНЮ

MENU UTAMA

メインメニュー

1

2

3

4

5

6

7

8

9

10

11

12

Big Hair Award

爆炸头奖杯

Groot kapsel

Prix de la coiffure haute

Dickes Haar-
Auszeichnung

Premio Pelo
Voluminoso

Prêmio Cabelo
Grande

Prémio Cabelo
Grande

Premio capelli
voluminosi

Stort hår-pokal

Puchar Dużej Fryzury

Награда за большую
прическу

Penghargaan Rambut
Kembang

ビッグヘアバッジ

Huge Hair Award

巨大爆炸头奖杯

Enorm kapsel

Prix de la
coiffure énorme

Massiges Haar-
Auszeichnung

Premio Pelo Enorme

Prêmio Cabelo
Enorme

Prémio Cabelo
Enorme

Premio capelli
gonfissimi

Större hår-pokal

Puchar Wielkiej
Fryzury

Награда за
огромную прическу

Penghargaan Rambut
Lebat

スーパービッグヘアバッジ

Ginormous Hair
Award

特大爆炸头奖杯

Gigantisch kapsel

Prix de la coiffure
gigantesque

Gigantisches Haar-
Auszeichnung

Premio Pelo
Gigantesco

Prêmio Cabelo
Gigante

Prémio Cabelo
Gigantesco

Premio capelli
vaporosissimi

Enormt hår-pokal

Puchar Ogromniastej
Fryzury

Награда за гигантскую
прическу

Penghargaan Rambut
Super Kembang

超スーパービッグヘアバッジ

Blow Dry Specialist

吹干专家

Föhntastisch

Spécialiste du sèche-
cheveux

Föhnspezialist

Maestro del secador

Especialista em
Secador

Especialista de
Secagem

Specialista
dell'asciugacapelli

Fönspecialist

Specjalista od
suszenia

Специалист по
сушке феном

Ahli Blow

ドライヤースペシャリスト

Mousse Master

摩丝硕士

Schuimsmarcheerder

Maître de la mousse

Schaummeister

Maestro de la
espuma

Mestre do Musse

Mestre da Mousse

Maestro della spuma

Moussemästare

Mistrz pianki

Мастер
использования мусса

Ahli Pengeras
Rambut

ヘアムースマスター

Peanut Buttercup

奶油花生

Pindakaasmeester

Pot de beurre de
cacahuète

Erdnussbuttercup

Mantequilla de
cacahuete

Pote de Ouro

Flor de Amendoim

Coppa di crema di
arachidi

Jordnötssmörare

Krem orzechowy

Кубок арахисового
масла

Botol krim kacang

お子様カップ

Wallpaper Warrior

壁纸勇士

Behangen militair

Guerrier du papier peint

Tapetenkrieger

Guerrero del
empapelado

Ás do Papel de
Parede

Guerreira do Papel de
Parede

Guerriero della
tappezzeria

Tapetklistrare

Tapetowy wojownik

Боец обойного
фронта

Kertas Dinding hebat

壁紙戦士

Crafty Curler

狡猾夹

Krullenkoningin

Bigoudi malin

Cleverer Wickler

Hábil rizador

Mensageiro
Engenhoso

Encaracoladora

Arricciatore esperto

Lockmästare

Chytry krętacz

Коварные бигуди

Gulungan Licik

ずる賢いカーラー

Allergic Reaction

过敏反应

Allergische Reactie

Réaction allergique

Allergische Reaktion

Reacción alérgica

Reação Alérgica

Reacção Alérgica

Reazione allergica

Allergisk reaktion

Reakcja alergiczna

Аллергизмо

Reaksi Alergi

アレルギー反応

Unlawful Arrest

非法逮捕

Goed Geboeid

Arrestation illégale

Ungesetzliche
Festnahme

Arresto ilegal

Prisão Ilegal

Prisão Indevida

Arresto illegale

Olovligt gripande

Bezprawne
aresztowanie

Противозаконный
арест

Borgol Tak Syah

不法な逮捕劇

Hair Eggtacy

鸡蛋专家

Haareiforie

Oeuforisme

Haar-Eiphorie

Huevo de oro

Escova de Ovo

Êxtase Capilar

Capelli melanzanati

Äggfantasi

Jajeczna ekstaza

Экстатическая
яйцеприческа

Telur Berkhasiat

たまご専門職

Toxins-R-Us

毒药-R

Venijn & Dooddoener

Toxines-R-Us

Giftmischer

Toxinas-R-Us

Toxinitas

Capelli intossinati

Giftfixare

Groźne toksyny

Отравитель

Pil Toksin

毒物‐R指定

Hypnotizing Hairstylist

催眠专家

Haarhypnose

Coiffeur fascinant

Hypnotisierender
Haarspezialist

Estilista hipnotizador

Cabeleireira
Hipnotizadora

Cabeleireira
Hipnotizante

Parrucchiere
ipnotizzante

Hypnosstylist

Stylista-hipnotyzer

Гипнотическая
укладка

Hipnotis Penata
Rambut

Hypnotising Hairstylist

催眠術スタイリスト

My Hair Mania:

我的理发:

Mijn knipbeurt:

Mon expérience Hair Mania :

Mein Haar-Wahnsinn:

Mi pelomanía:

Meu Hair Mania:

A Minha Mania de Penteados:

La mia mania con i capelli:

Mitt Hair Mania:

Moja Hair Mania:

Моя игра "Hair Mania":

Keranjingan Rambut Saya:

私のマニアックヘアスタイル:

Enter text here:

Enter your name here:

START

游戏开始

SPEL STARTEN

JOUER

SPIEL STARTEN

INICIAR PARTIDA

COMEÇAR

INICIAR JOGO

AVVIA PARTITA

STARTA SPEL

НАЧАТЬ ИГРУ

MEMULAI PERMAINAN

START GAME

スタート

BACK

返回

TERUG

RETOUR

ZURÜCK

ATRÁS

ANTERIOR

VOLTAR

INDIETRO

BAKÅT

POWRÓT

ОБРАТНО

KEMBALI

戻る

GAME PAUSED

游戏暂停

SPEL GEPAUZEERD

JEU EN PAUSE

SPIEL ANGEHALTEN

JUEGO EN PAUSA

JOGO PAUSADO

JOGO EM PAUSA

GIOCO IN PAUSA

SPEL PAUSAT

PAUZA

ПАУЗА

PERMAINAN DIBERHENTIKAN
SEBENTAR

ゲーム中断中

3/4 tools

The hair target is in sight!

头发的目标已经确定!

Haardoel bijna bereikt!

La coiffure cible est presque atteinte !

Das Haarziel ist fast geschafft!

¡Objetivo a la vista!

O alvo está preparado para o cabelão!

O cabelo-alvo está à vista!

L'obiettivo dei capelli è in vista!

Hårmålet är inom räckhåll!

Docelowa wysokość jest w zasięgu wzroku!

Необходимая прическа определена!

Sasarang rambut berada dalam jangkauan!

さぁ、今回のお客様がお見えになったわよ!

This level you need to use

这关你要使用的工具

In dit level moet je

Dans ce niveau tu as besoin de

Nutze in diesem Level

En este nivel tienes que usar

Neste nível, você precisa usar

Neste nível tens de usar

In questo livello devi usare

På den här nivån måste du använda

Na tym poziomie musisz użyć

На этом уровне необходимо использовать

Dalam level ini, anda harus mempergunakan

In this level you have to use

このレベルで使用する道具は

3

2

1

GO MAKE BIG HAIR!

来吧!做爆炸头!

MAAK ER 'N MOOIE
BOS HAAR VAN!

RÉALISE UNE
GRANDE COIFFURE !

AUF AN DIE
HAARIGE ARBEIT!

¡DALE VOLUMEN!

VÁ FAZER O CABELÃO!

VAI FAZER CABELOS
GRANDES!

VAI A FARE DELLE
ACCONCIATURE VOLUMINOSE!

GÖR HÅRET STORT!

STWÓRZ COŚ
WIELKIEGO!

Приступай к созданию
большой прически!

AYO BUATLAH RAMBUT
KEMBANG!

さぁビッグなヘアスタイ
ルを作ろう!

GAME COMPLETED!
Congratulations!

游戏完成!恭喜你!

UITGESPEELD!
Gefeliciteerd!

JEU RÉUSSI !
Félicitations !

SPIEL BEENDET!
Glückwunsch!

¡JUEGO COMPLETADO!
¡Felicidades!

JOGO CONCLUÍDO!
Parabéns!

GIOCO COMPLETO!
Congratulazioni!

SPEL KLARAT!
Gratulerar!

GRA UKOŃCZONA!
Gratulacje!

ИГРА ПРОЙДЕНА!
Прими поздравления!

PERMAINAN SELESAI!
Selamat!

GAME COMPLETED!
Congratulations!

ゲームクリア!
おめでとう!

显示解锁过程

SUBMIT SCORE

提交分数

SCORE VERZENDEN

ENREGISTRER LE SCORE

PUNKTE EINTRAGEN

ENVIAR PUNTUACIÓN

ENVIAR PONTUAÇÃO

INVIA PUNTEGGIO

SKICKA POÄNG

ZAPISZ WYNIK

СОХРАНИТЬ РЕЗУЛЬТАТ

KUMPULKAN SKOR

スコアを送信する

HAIR OF FAME

理发奖杯

BEKROONDE KAPSELS

COIFFURES CÉLÈBRES

HAARE DES RUHMS

PELÓN DE LA FAMA

CABELO DA FAMA

RECORDES CAPILARES

CAPELLI FAMOSI

HÅRTROFÈER

SALON SŁAWY

ВЫДАЮЩИЕСЯ ПРИЧЕСКИ

POPULARITAS RAMBUT

ヘアーアワード

SEND TO FRIEND

发给好友

STUUR NAAR EEN VRIEND

ENVOYER À UN(E) AMI(E)

AN EINEN FREUND SCHICKEN

ENVIAR A UN AMIGO

ENVIAR A UM AMIGO

ENVIAR PARA UM AMIGO

INVIA AD UN AMICO

SKICKA TILL VÄN

WYŚLIJ DO PRZYJACIELA

ОТПРАВИТЬ ДРУГУ

KIRIM KE TEMAN

SEND TO A FRIEND

友達に送る

GAME COMPLETED!

游戏完成!

SPEL VOLTOOID!

JEU RÉUSSI !

SPIEL BEENDET!

¡JUEGO COMPLETADO!

JOGO CONCLUÍDO!

GIOCO COMPLETO!

SPEL KLARAT!

GRA UKOŃCZONA!

ИГРА ПРОЙДЕНА!

PERMAINAN SELESAI!

ゲームクリア!

TRY AGAIN

再玩一次

NOGMAALS PROBEREN

ESSAYER DE NOUVEAU

NOCHMAL PROBIEREN

VOLVER A INTENTAR

TENTAR DE NOVO

TENTAR NOVAMENTE

RIPROVA

FÖRSÖKA IGEN

SPRÓBUJ PONOWNIE

ЕЩЕ РАЗ

COBA LAGI

もう一度トライする

YAY, well done!! You have made the biggest
hairdo ever!!

吔!很好!你做了从来没有过的最大的爆炸头!

Jaaa, goed werk! Je hebt 't grootste kapsel
ooit gemaakt!

CHOUETTE, bien joué !! Tu as réalisé la plus
grande coiffure de tous les temps !!

TOLL, gut gemacht! Du hast die dickste
Haarfrisur aller Zeiten geschaffen!

¡Bien hecho! ¡Has creado el peinado más
voluminoso de todos los tiempos!

Oba! Muito bem! Você fez o maior cabelão de
todos os tempos!

VIVA, bom trabalho!! Fizeste o maior
penteado de sempre!!

Urrà, ben fatto!! Hai creato l'acconciatura più
voluminosa che ci sia!

JA, bra jobbat! Du har gjort den största
frisyren någonsin!

JUPI, dobra robota! To najwyższa fryzura
wszechczasów!

УХ ТЫ! Молодец! Тебе удалось сделать
самую большую прическу всех времен!!

YAY, kerja bagus! Anda telah membuat
tatanan rambut yang terkembang!

YES! well done!! You have made the biggest
hairdo ever!!

イェーイ!よくやったわ!いまだかつてないほどの
大きなヘアスタイルを作り上げたわ!

FINAL SCORE:

最终分数:

TOTAALSCORE:

SCORE FINAL :

ENDERGEBNIS:

PUNTUACIÓN FINAL:

PONTUAÇÃO FINAL:

PUNTEGGIO FINALE:

SLUTPOÄNG:

WYNIK KOŃCOWY:

КОНЕЧНЫЙ СЧЕТ:

SKOR AKHIR:

FINAL SCORE:

ファイナルスコア:

player

0

YOUR NAME:

您的名字:

JE NAAM:

TON NOM :

DEIN NAME:

TU NOMBRE:

SEU NOME:

O TEU NOME:

TUO NOME:

DITT NAMN:

TWOJE IMIĘ:

ВАШЕ ИМЯ:

NAMA ANDA:

名前:

LEVEL FAILED!

关卡失败!

LEVEL MISLUKT!

NIVEAU ÉCHOUÉ !

LEVEL NICHT GESCHAFFT!

¡NIVEL NO COMPLETADO!

NÍVEL PERDIDO!

FALHASTE!

LIVELLO FALLITO!

NIVÅ EJ KLARAD!

POZIOM NIE ZOSTAŁ
UKOŃCZONY!

УРОВЕНЬ НЕ ПРОЙДЕН!

LEVEL GAGAL!

レベルクリア失敗…

GAME OVER...YOU LOSE!!

游戏结束…你输了!

GAME OVER. JE HEBT VERLOREN!

GAME OVER… TU AS PERDU !!

GAME OVER…DU HAST VERLOREN!

FIN DE PARTIDA... ¡HAS PERDIDO!

ACABOU... VOCÊ PERDEU!

FIM DO JOGO...PERDESTE!!

GIOCO FINITO…HAI PERSO!!

GAME OVER... DU FÖRLORADE!

KONIEC GRY... PRZEGRAŁEŚ!

КОНЕЦ ИГРЫ... ТЫ ПРОИГРАЛ!

PERMAINAN BERAKHIR…ANDA KALAH!

ゲームオーバー、残念でした!

Maybe you need to read the
instructions again…

或许你需要再读一次帮助文档…

Misschien moet je de spelregels nog
eens lezen...

Tu devrais peut-être relire les
instructions…

Vielleicht solltest du dir noch einmal
die Anweisungen ansehen…

A lo mejor necesitas volver a leerte
las instrucciones...

Talvez você precise ler as instruções
novamente...

Talvez precises de ler as instruções
outra vez...

Forse devi rileggere le istruzioni…

Du behöver kanske läsa spelreglerna igen...

Może warto jeszcze raz przeczytać
instrukcję...

Может, нужно прочитать
инструкцию еще раз...

Mungkin anda harus membaca
instruksinya lagi…

もう一度遊び方を読んでみたらいかが?

I asked for a Great Dane, and you gave me a
Chihuahua.

我想要只大丹狗,你却给我了只吉娃娃.

Ik vroeg om 'n Deense Dog en jij maakt er 'n
chihuahua van...!

J'ai demandé un Danois et voici un Chihuahua !

Ich habe dich um eine deutsche Dogge gebeten,
und du gibst mir einen Chihuahua.

He pedido un gran danés y me has dado un
chihuahua.

Eu pedi um dogue alemão e você me veio com um
chihuahua!

Eu pedi um Grand Danois e deste-me um
Chihuahua.

Ho chiesto di avere un Danese, e mi ritrovo con
un Chihuahua.

Jag bad om en grand danois och du gav mig en
chihuahua.

Miał być dog niemiecki, a jest chihuahua.

Тебя просили сделать дога, а получили
чихуахуа.

Saya meminta gaya rambut Julia Perez, dan anda
memberikan saya Chihuahua.

I asked for a Great Dane and you gave me a
Chihuahua.

グレードダンにたのんだからもういいわ、
アタクシにチワワを返したかしら。

HAHAHAHAHA! Oh, you weren’t pathetic on
purpose?

哈哈哈哈哈!继续努力别那么失落!?

HAHAHA! Oh, ik dacht dat je expres zo slecht
bezig was...

HAHAHAHAHA ! Oh, tu n'as tout de même pas fait
exprès d'être aussi minable, non ?

HAHAHAHAHA! Oh, Du warst nicht absichtlich so
miserabel?

¡JAJAJAJAJA! Ah, ¿que no estabas siendo
patético adrede?

HAHAHAHAHA! Como? Você não está brincando?

HAHAHAHAHA! Oh, não foste terrível de
propósito?

HAHAHAHAHA! Oh, non l'hai fatto apposta ad
essere patetico?

HAHAHAHAHA! Åh, du var inte kass på skoj?

HAHAHAHAHA! Czy ten żałosny efekt to wynik
celowego działania?

ХА-ХА-ХА-ХА-ХА! Ты что, нарочно вызываешь
жалость?

HAHAHAHAHA! Oh, anda tidak
sedih dengan tujuan?

おほほほほほ!まさかわざとめちゃくちゃに 
しなかったわけじゃないわよね?

Do you know the meaning of the word BIGGER?
This is not exactly rocket science.

你知道更大的意思吗?这可不是那么难的火箭科学。

Weet je wel wat ENORM betekent? Zo moeilijk is
't niet! Gewoon flinke bewegingen maken!

Tu sais ce que veut dire PLUS GRAND ? Ce n'est
tout de même pas compliqué à comprendre !

Kennst du die Bedeutung des Wortes DICKER?
Das ist eigentlich nicht sehr kompliziert…

¿Conoces el significado de la palabra VOLUMEN?
No es que haya que estudiar una carrera.

Você sabe o significado da palavra GRANDE? Ou
quer que eu desenhe?

Sabes o que quer dizer a palavra MAIOR? Isto não
é propriamente uma operação ao cérebro.

Ma conosci il significato della parola
VOLUMINOSO? Non ci vuole la laurea per saperlo!

Vet du vad ordet STÖRRE betyder? Man behöver
inte precis vara hjärnkirurg.

Czy wiesz, co oznacza słowo WIĘKSZY? Przecież
to nie jest termin z fizyki jądrowej!

Ты понимаешь, что значит слово БОЛЬШЕ? Это
же ежу понятно!

Apakah anda tahu akan arti dari kata LEBIH
KEMBANG? Ini sama sekali bukanlah gaya roket.

大きいって言葉知ってらして?うーん、これは頭の切れる人
の仕事じゃないわね。

Is your mouse disconnected, or does your hand
just not work?

是你的鼠标断了,还是你的手没干活?

Doet je muis 't niet meer of ben je zelf zo slecht?

Ta souris est-elle déconnectée ou bien est-ce ta
main qui ne fonctionne plus ?

Ist deine Maus deaktiviert, oder funktioniert
deine Hand nicht richtig?

¿Se te ha desconectado el ratón o es que no te
funciona la mano?

Será que o seu mouse está quebrado... ou é a sua
mão que não funciona?

O teu rato está desligado ou é a tua mão que não
funciona?

Ma il tuo mouse è disconnesso o è la tua mano
che non lavora?

Är din mus urkopplad eller har du somnat?

Czy twoja myszka się odłączyła? A może po
prostu to twoja ręka nie działa?

У тебя отключена мышка или
что-то не то с рукой?

Apakah mouse anda terlepas, atau tangan anda
yang tidak berfungsi?

あら、マウスがちゃぁんと接続されていないんじゃない?それ
とも、まさかあなたの手が動かなかったってことかしら?

FINAL SCORE:

最终分数:

TOTAALSCORE:

SCORE FINAL :

ENDERGEBNIS:

PUNTUACIÓN FINAL:

PONTUAÇÃO FINAL:

PUNTEGGIO FINALE:

SLUTPOÄNG:

WYNIK KOŃCOWY:

КОНЕЧНЫЙ СЧЕТ:

SKOR AKHIR:

FINAL SCORE:

ファイナルスコア:

Mustang Unibrow

Link

连 接

Lien

Enlace

Ligação

Länk

Ссылка

Sambungan

リンク

Pick a picture first!

选择一个图片先!

Kies eerst een foto!

Commence par sélectionner une image !

Wähle zuerst ein Bild!

¡Primero elige una foto!

Escolha uma foto primeiro!

Primeiro escolhe uma imagem!

Scegli prima una foto!

Välj en bild först!

Najpierw wybierz obrazek!

Сначала выбери картинку!

Pilih sebuah gambar terlebih dahulu!

まず画像をえらんで!

"Copy this code by clicking the "Copy" button above (or using ctrl + c) and paste
thecode (ctrl + v ) in an email or IM window to share your 'do with your friends!"

点击“复制”按钮(或按下 ctrl+c)和粘贴(ctrl+v)在邮件或者聊天软件中推荐给你的朋友!

Kopieer deze code door op de knop "kopiëren" hierboven te klikken (of  met Ctrl-C) en
plak de code (Ctrl-V) in een e-mail of chatbericht om je kapsel met vrienden te delen!

Copie ce code en cliquant sur le bouton "Copier" ci-dessus (ou bien utilise Ctrl + c) et colle-
le (Ctrl + v) dans un e-mail ou une fenêtre IM pour montrer tes coiffures à tes ami(e)s !

Kopiere diesen Code, indem du auf die "Kopieren"-Taste oben (oder ctrl + c) drückst, und
füge den Code (ctrl + v ) in eine E-Mail oder ein IM-Fenster ein, um deinen Freunden deine
Arbeit zu zeigen!

Copia este código haciendo clic en el botón "Copiar" de arriba (o usando Ctrl + C)
y pégalo (Ctrl + V) en un correo electrónico o en una ventana de mensajería
instantánea y comparte tu peinado con tus amigos.

Para copiar este código, clique no botão "Copiar" acima (ou use ctrl + c) e cole o código
(ctrl + v) em um email ou janela de bate-papo para compartilhar o seu penteado com
seus amigos!

Copia este código clicando no botão "Copiar" acima (ou usa ctrl + c) e cola-o no código
(ctrl + v) num email ou janela de IM para partilhares o penteado com os teus amigos!

Copia questo codice cliccando su "Copia (o usa Ctrl + C) ed incollalo (Ctrl + V) in
un'e-mail od in una finestra di IM per mostrare la tua acconciatura ai tuoi amici!

Kopiera den här koden genom att klicka på knappen ''Kopiera'' ovan (eller Ctrl+C) och
klistra in koden (Ctrl+V) i ett mejl eller chattfönster och skicka frisyren till en vän!

Skopiuj ten kod, klikając na przycisk "Kopiuj" powyżej (lub za pomocą ctrl + c) i
wklej kod (ctrl + v) w mailu lub w okienku komunikatora, aby pokazać swoją
fryzurę przyjaciołom!

Скопируй этот код, нажав кнопку "Копировать" вверху (или при помощи ctrl + c)
и вставь код (ctrl + v ) в электронное письмо или аську, чтобы показать свое
творение друзьям!

Salinlah kode ini dengan mengklik tombol "Salin" diatas (atau pergunakan ctrl +
c) dan cantumkan kode tersebut (ctrl + v) di email atau jendela IM untuk berbagi
dengan teman-teman anda!

Click the "Copy" button above (or use Ctrt+C) to copy this code and paste it
(Ctrl+V) into an email or IM window to share your hairdo with your friends!

このコードをコピーボタンまたはctrl+cボタンでコピーして、イーメールやチャットウィン
ドウに貼り付け(ctrl+v)、お友達と一緒に楽しみましょう!

Enter text here:

Enter your name here:

COPY

复制链接

KOPIËREN

COPIER

KOPIEREN

COPIAR

COPIA

KOPIERA

KOPIUJ

КОПИРОВАТЬ

SALIN

コピー

CONTINUE

继 续

DOORGAAN

CONTINUER

WEITER

CONTINUAR

CONTINUA

FORTSÄTT

KONTYNUUJ

ПРОДОЛЖАТЬ

MELANJUTKAN

ゲームを続ける

LEVEL COMPLETED!

关卡成功!

LEVEL VOLTOOID!

NIVEAU RÉUSSI !

LEVEL BEENDET!

¡NIVEL COMPLETADO!

NÍVEL CONCLUÍDO

NÍVEL COMPLETO!

LIVELLO COMPLETATO!

NIVÅ KLARAD!

POZIOM UKOŃCZONY!

УРОВЕНЬ ЗАВЕРШЕН!

LEVEL SELESAI!

レベルクリア!

The hair is taking over! NICE!

头发任务结束!漂亮!

Het haar wint terrein! MOOI ZO!

Les cheveux prennent le dessus ! SUPER !

Das Haar übernimmt die Macht! TOLL!

¡Pelo y más pelo! ¡BIEN!

O cabelão está dominando! QUE ÓTIMO!

O cabelo está a ganhar! BOA!

I capelli stanno vincendo! BENE!

Håret svämmar över! SNYGGT!

Robisz postępy! DOBRZE!

Прическа приобретает объем! ЧУДЕСНО!

Rambutnya mengambil alih! BAGUS!

こんなにでっかいヘアスタイルが完成したわ!ナイス!

I haven’t seen hair that inhuman since
Frankenstein’s wedding day. Shockingly
good!

自从弗兰肯斯坦的婚礼之后,我再也没见哪个人有这样的
爆炸头。令人震惊的好!

Zo'n kapsel zie je alleen bij Frankenstein!
Stuitend goed!

Je n'ai plus vu de coiffure aussi inhumaine
depuis le mariage de Frankenstein. Délirant !

Ich habe seit Frankensteins Hochzeit nicht
mehr so unmenschliche Haare gesehen.
Erschreckend gut!

No he visto pelo más inhumano desde la boda
de Frankenstein. ¡Terriblemente bueno!

Nunca vi um cabelo tão esquisito desde o dia
do casamento do Frankenstein. Você é
incrível!

Não vejo cabelo assim desde o casamento do
Frankenstein. Muito bom!

Non ho visto dei capelli così inumani dal
giorno del matrimonio di Frankenstein.
Scandalosamente bravo!

Jag har inte sett en så omänsklig frisyr sedan
Frankensteins bröllop. Chockerande bra!

Nie widziałam takiej nieziemskiej fryzury od
dnia ślubu Frankensteina. Szokująco dobre!

Не припоминаю такой бесчеловечности со
времен свадьбы Франкенштейна.
Потрясающе хорошо!

Saya tidak pernah melihat rambut yang
melampaui sifat manusia sejak hari
pernikahan Usil. Sangat mengejutkan!

こんなヘアスタイルにお目にかかれたのは、フランケンシュ
タインの結婚式以来だわ!倒れそうなほどス・テ・キ!

v

Your styling skills are right up there with
electrical sockets and lightning!

您风驰电掣的的造型技非常的棒!

Stopcontacten en bliksemflitsen zijn niks
vergeleken met jouw kapperskunsten!

Tu as le don de la coiffure au pétard !

Mithilfe von etwas Elektrik sind deine Styling-
Fähigkeiten ausgezeichnet!

Tu estilismo está a salvo allá donde haya
enchufe y electricidad.

Suas habilidades como cabeleireira são tão
boas que parece que os seus fregueses
levaram um choque!

Os teus dotes de cabeleireira estão a par das
tomadas eléctricas e relâmpagos!

Il tuo talento con le acconciature è là in cima
con le prese elettriche e l'illuminazione!

Din styling ger lika bra effekt som elstötar
och blixtnedslag!

Jako stylista inspirujesz się działaniem prądu
elektrycznego i pioruna!

Твои навыки укладки сравнятся разве что
с электрической розеткой и молнией!

Kepandaian anda menata rambut sangatlah
menakjubkan dan sedang bersinar!

あなたのスタイリングスキルは電気ソケットとラ
イトでますます磨きがかかってきたわね。

Your client’s really going to hate that.
Awesome!

你的顾客真的讨厌这样的头发!棒极了!

Goed zo! Hier wordt je klant
helemaal niet blij van!

Ton client va vraiment détester ça.
Incroyable !

Dein Kunde wird das wirklich hassen.
Sehr schön!

Tu cliente lo va a odiar a base de bien.
¡Impresionante!

O freguês vai odiar o resultado. É isso aí!

O teu cliente vai detestar isso. Incrível!

Il tuo cliente li odierà davvero. Meraviglioso!

Din kund kommer att hata sin frisyr. Kanon!

Twój klient z pewnością znienawidzi
tę fryzurę. Ekstra!

Клиенты будут вне себя. Фантастика!

Tamu anda benar-benar akan membenci itu.
Menakjubkan!

お客様はいよいよ気に入らなくなってきたわ、な
んて最高なの!

Perfect—I think a bird’s mistaken this ‘do for
a nest already.

完美!我想小鸟都会误以为可以在这里做巢。

Perfect! Die vogel dacht al dat je 'n vogelnest
had gemaakt!

Parfait—je pense qu'un oiseau a déjà
confondu cette coiffure avec un nid.

Perfekt - ich glaube, ein Vogel könnte diese
Frisur glatt mit seinem Nest verwechseln.

Perfecto. Creo que un pájaro ya ha
confundido este peinado con un nido.

Perfeito! Acho até que já tem um passarinho
fazendo ninho nesse cabelão.

Perfeito—acho que já tens um pássaro que
confundiu o cabelo com o ninho.

Perfetto—Penso che un uccello li abbia già
scambiati per un nido.

Perfekt. En fågel verkar redan tro att det är
ett fågelbo.

Idealnie - myślę, że każdy ptak pomyli to
uczesanie ze swoim gniazdem.

Безупречно – птицы уже наверняка
перепутали эту прическу с гнездом.

Sempurna- Saya merasa bahwa burung-burung
akan berpikir bahwa ini ialah sarang mereka.

Perfect! I think a bird has already mistaken
this hairdo for a nest.

完璧だわ、きっと鳥たちが自分たちの巣だと勘違
いするんじゃないかしら。

Fast work for a look that’s sloppy, huge, and
looking ratty—everything big hair styling
should be.

快速完成一个草率的,巨大的,破烂的爆炸头。
就应该是这样的。

Dat enorme, slordige kapsel heb je snel voor
elkaar! Ga zo door!

Un travail rapide pour un résultat négligé,
énorme et miteux—tout ce que doit être une
grande coiffure.

Schnelle Arbeit für einen Look, der
schlampig, wuschig und schäbig aussieht - so
sollte eine Frisur sein!

Un trabajo rápido para un aspecto
descuidado, enorme y raído. Justo lo que ha
de ser todo un estilismo de gran volumen.

Você foi rápido para criar esse estilo
bagunçado, gigante e que parece um ninho
de mafagafinhos! É assim que tem que ser!

Trabalho rápido para um look que é
desajeitado, enorme e desmazelado—tudo o
que os penteados grandes devem ser.

Un lavoro veloce per un look trascurato,
maestoso e allo stesso tempo sudicio—un
qualcosa che tutte le acconciature di capelli
voluminosi dovrebbero sempre avere.

Snabbt jobbat att få till en slarvig, enorm och
ful frisyr. Allt vad ett stort hår ska vara.

Trochę pracy i mamy niechlujną, wielką i
potarganą fryzurę - wszystko, co powinno
mieć wysokie uczesanie.

Быстро же тебе удалось добиться таких
огромных размеров и неряшливого вида,
будто эта прическа кишит крысами – как
раз того, что нужно для большой прически!

Kerja yang cepat untuk tatanan yang buruk,
kembang dan kelihatan seperti tikus- segala
gaya model rambut kembang yang
seharusnya ada.

Fast work for a look that’s sloppy, huge and
looking ratty; everything big hair styling should be.

素早い仕事、雑で巨大、そしてネズミみたいな外見…
あぁ、全てのビッグヘアスタイルはこうあるべきだわ。

0

0

0

HAIR SCORE:

头发分数:

HAARSCORE:

SCORE DE COIFFURE :

HAARERGEBNIS:

PUNTUACIÓN PELUDA:

PONTUAÇÃO DO CABELO:

PONTUAÇÃO CAPILAR:

PUNTEGGIO CAPELLI:

HÅRPOÄNG:

PUNKTY ZA FRYZURĘ:

РЕЗУЛЬТАТ ЗА ПРИЧЕСКУ:

SKOR RAMBUT:

ヘアスタイルスコア:

BONUS POINTS:

奖励点数:

BONUSPUNTEN:

POINTS DE BONUS :

BONUSPUNKTE:

PUNTOS DE BONIFICACIÓN:

PONTOS DE BÔNUS:

PONTOS DE BÓNUS:

PUNTI BONUS:

BONUSPOÄNG:

PUNKTY BONUSOWE:

БОНУСНЫЕ БАЛЛЫ:

POIN BONUS:

ボーナスポイント:

TOTAL SCORE:

总分数:

TOTAALSCORE:

SCORE TOTAL :

GESAMTPUNKTE:

PUNTUACIÓN TOTAL:

PONTUAÇÃO TOTAL:

PUNTEGGIO TOTALE:

POÄNG TOTALT:

ŁĄCZNY WYNIK:

ОБЩИЙ РЕЗУЛЬТАТ:

TOTAL SKOR:

TOTAL SCORE:

トータルスコア:

© www.spilgames.com

© www.spilgames.com

v.1.0

HIGH SCORES

排行榜

TOPSCORES

MEILLEURS SCORES

HIGHSCORES

PUNTUACIONES MÁXIMAS

RECORDES

PUNTEGGI PIÙ ALTI

TOPPOÄNG

RANKING

РЕКОРДЫ

NILAI TERTINGGI

HIGH SCORES

ハイスコア

BIG HAIR

爆炸头

GROOT KAPSEL

COIFFURE HAUTE

DICKES HAAR

PELO VOLUMINOSO

CABELO GRANDE

CAPELLI VOLUMINOSI

STORT HÅR

DUŻA FRYZURA

БОЛЬШАЯ ПРИЧЕСКА

RAMBUT KEMBANG

ビッグヘア

HUGE HAIR

巨大爆炸头

ENORM KAPSEL

COIFFURE ÉNORME

MASSIGES HAAR

PELO ENORME

CABELO ENORME

CAPELLI GONFISSIMI

STÖRRE HÅR

WIELKA FRYZURA

ОГРОМНАЯ ПРИЧЕСКА

RAMBUT LEBAT

スーパービッグヘア

GINORMOUS HAIR

特大爆炸头

GIGANTISCH KAPSEL

COIFFURE GIGANTESQUE

GIGANTISCHES HAAR

PELO GIGANTESCO

CABELO GIGANTE

CABELO GIGANTESCO

CAPELLI VAPOROSISSIMI

ENORMT HÅR

OGROMNIASTA FRYZURA

ГИГАНТСКАЯ ПРИЧЕСКА

RAMBUT SUPER KEMBANG

超スーパービッグヘア

LEVEL TARGET

关卡目标

DOEL

CIBLE DU NIVEAU

LEVELZIEL

OBJETIVO DE NIVEL

ALVO DO NÍVEL

NÍVEL-OBJECTIVO

OBIETTIVO DEL LIVELLO

NIVÅMÅL

CEL POZIOMU

ЦЕЛЬ УРОВНЯ

TARGET LEVEL

目標

Customer:

Tools to use:

Time:

Hair target:

顾客:

使用工具数量:

时间:

头发目标:

Klant:

Gereedschappen:

Tijd:

Haardoel:

Client :

Outils à utiliser :

Temps :

Coiffure cible :

Kunde:

Zu verwendende Gegenstände:

Zeit:

Haarziel:

Cliente:

Utensilios que usar:

Tiempo:

Objetivo de altura:

Freguês:

Instrumentos a serem usados:

Tempo:

Altura do cabelo:

Ferramentas a usar:

Tempo:

Cabelo-alvo:

Utensili da usare:

Obiettivo capelli:

Kund:

Verktyg som krävs:

Tid:

Hårmål:

Klient:

Narzędzia do użycia:

Czas:

Wysokość docelowa:

Посетитель:

Инструменты для использования:

Время:

Необходимая прическа:

Tamu:

Alat untuk dipergunakan:

Waktu:

Target rambut:

Client:

Tools you have to use:

Time:

Hair target:

お客様:

使用した道具:

タイム:

ボリューム目標ライン:

WARNING

DON'T TRY THIS
AT HOME

警 告

不要在家中尝试游戏
中的危险操作!

WAARSCHUWING

DOE DIT THUIS
NIET NA

ATTENTION

NE PAS ESSAYER
À LA MAISON

WARNUNG

NICHT ZUHAUSE
NACHMACHEN

ADVERTENCIA

NO INTENTES HACER
ESTO EN CASA

AVISO

NÃO TENTE
ISTO EM CASA

ATENÇÃO

NÃO EXPERIMENTES
ISTO EM CASA

AVVERTIMENTO

NON PROVARCI A CASA

VARNING

FÖRSÖK INTE
DETTA HEMMA

OSTRZEŻENIE

NIE PRÓBUJ
TEGO W DOMU

ПРЕДОСТЕРЕЖЕНИЕ

НЕ ПРОБУЙТЕ
ПОВТОРИТЬ ЭТО ДОМА

PERINGATAN

JANGAN MENCOBA
INI DI RUMAH

このゲームは決してお
家ではやらないこと!

welldone

LEVEL FAILED!

关卡失败!

LEVEL MISLUKT!

NIVEAU ÉCHOUÉ !

LEVEL NICHT
GESCHAFFT!

¡NIVEL NO COMPLETADO!

NÍVEL PERDIDO!

FALHASTE!

LIVELLO FALLITO!

NIVÅ EJ KLARAD!

POZIOM NIE ZOSTAŁ
UKOŃCZONY!

УРОВЕНЬ НЕ ПРОЙДЕН!

LEVEL GAGAL!

レベルクリア失敗…

0
0

SPACEBAR

空格

SPATIEBALK

BARRE D'ESPACE

LEERTASTE

BARRA ESPACIADORA

BARRA DE ESPAÇO

BARRA DE ESPAÇOS

SPAZIO

MELLANSLAG

SPACJA

ПРОБЕЛ

SPASI

スペースキーを押して!

GREAT

很好!

GEWELDIG

SUPER

GROSSARTIG

GENIAL

EXCELENTE

ÓPTIMO

OTTIMO

BRA JOBBAT

WSPANIALE

ВЕЛИКОЛЕПНО

HEBAT

素晴らしい!

Whoops, this is
a flat-hair tool!

哎呀,这是一个
让头发扁平的工具!

Oeps, hiermee
maak je steil haar!

Zut, ça, c'est un outil
pour cheveux plats !

Ups, dieser Gegenstand
macht die Haare dünner!

¡Ups! ¡Es un utensilio
para aplanar el pelo!

Ah, não! É um instrumento
de alisar cabelo!

Ops, isto é uma ferramenta
de cabelos planos!

Ops, questo è un utensile per
appiattire i capelli!

Aj då, det här verktyget
plattar till håret!

Ups, to jest
prostownica!

Опачки, это инструмент для
выравнивания волос!

Whoops, ini ialah
peralatan rambut kempes!

Whoops, this is
a flat hair tool!

違うんじゃない?!

This tool creates the
opposite of big hair…

这个工具不是
用来做爆炸头的…

Hier maak je juist
geen enorme kapsels mee...

Cet outil n'est pas fait pour
les grandes coiffures !

Dieser Gegenstand bewirkt das
Gegenteil von dicken Haaren…

Este utensilio crea lo contrario de un
pelo voluminoso...

Este instrumento não
serve para fazer cabelão...

Esta ferramenta cria
o oposto de cabelo grande...

Quest'utensile crea
l'effetto contrario dei capelli
voluminosi...

Det här verktyget ger
håret mindre volym...

To narzędzie nie stworzy wysokiej
fryzury, wręcz przeciwnie...

Этот инструмент создает не большую
прическу, а обратный эффект...

Peralatan ini menciptakan gaya rambut
yang berlawanan dengan gaya rambut
kembang….

This tool creates the
opposite of big hair…

こりゃだめだ!

声音

PLAY FOR HIGH SCORES ON:

I haven’t seen hair that inhuman since Frankenstein’s
wedding day. Shockingly good!

Your styling skills are right up there with electrical
sockets and lighting!

Your client’s really going to hate that. Awesome!

Perfect, I think a bird’s mistaken this ‘do for a nest already.

Fast work for a look that’s sloppy, huge, and looking
ratty—everything big hair styling should be.

HAIR
MANIA

DON'T TRY THIS

AT HOME

LEVEL

Customer: Mustang Unibrow

Tool to use: 2/4

Time: 2:00'

Hair Target: 4"

new tools!

NEXT PAGE

OK

You unlocked

ActionScript [AS3]

Section 1
//CampaignInfo (com.google.analytics.campaign.CampaignInfo) package com.google.analytics.campaign { import com.google.analytics.utils.*; public class CampaignInfo { private var _new:Boolean; private var _empty:Boolean; public function CampaignInfo(_arg1:Boolean=true, _arg2:Boolean=false){ _empty = _arg1; _new = _arg2; } public function isEmpty():Boolean{ return (_empty); } public function toURLString():String{ var _local1:Variables; _local1 = toVariables(); return (_local1.toString()); } public function toVariables():Variables{ var _local1:Variables; _local1 = new Variables(); _local1.URIencode = true; if (((!(isEmpty())) && (isNew()))){ _local1.utmcn = utmcn; }; if (((!(isEmpty())) && (!(isNew())))){ _local1.utmcr = utmcr; }; return (_local1); } public function isNew():Boolean{ return (_new); } public function get utmcn():String{ return ("1"); } public function get utmcr():String{ return ("1"); } } }//package com.google.analytics.campaign
Section 2
//CampaignKey (com.google.analytics.campaign.CampaignKey) package com.google.analytics.campaign { public class CampaignKey { public var UCMD:String;// = "utm_medium" public var UCID:String;// = "utm_id" public var UCTR:String;// = "utm_term" public var UCSR:String;// = "utm_source" public var UCNO:String;// = "utm_nooverride" public var UCCN:String;// = "utm_campaign" public var UGCLID:String;// = "gclid" public var UCCT:String;// = "utm_content" } }//package com.google.analytics.campaign
Section 3
//CampaignManager (com.google.analytics.campaign.CampaignManager) package com.google.analytics.campaign { import com.google.analytics.core.*; import com.google.analytics.v4.*; import com.google.analytics.debug.*; import com.google.analytics.utils.*; public class CampaignManager { private var _config:Configuration; private var _domainHash:Number; private var _debug:DebugConfiguration; private var _timeStamp:Number; private var _referrer:String; private var _buffer:Buffer; public static const trackingDelimiter:String = "|"; public function CampaignManager(_arg1:Configuration, _arg2:DebugConfiguration, _arg3:Buffer, _arg4:Number, _arg5:String, _arg6:Number){ _config = _arg1; _debug = _arg2; _buffer = _arg3; _domainHash = _arg4; _referrer = _arg5; _timeStamp = _arg6; } public function hasNoOverride(_arg1:String):Boolean{ var _local2:CampaignKey; var _local3:Variables; var _local4:String; _local2 = _config.campaignKey; if (_arg1 == ""){ return (false); }; _local3 = new Variables(_arg1); _local4 = ""; if (_local3.hasOwnProperty(_local2.UCNO)){ _local4 = _local3[_local2.UCNO]; switch (_local4){ case "1": return (true); case "": case "0": default: return (false); }; }; return (false); } public function getCampaignInformation(_arg1:String, _arg2:Boolean):CampaignInfo{ var _local3:CampaignInfo; var _local4:CampaignTracker; var _local5:Boolean; var _local6:Boolean; var _local7:int; var _local8:CampaignTracker; var _local9:int; _local3 = new CampaignInfo(); _local5 = false; _local6 = false; _local7 = 0; if (((_config.allowLinker) && (_buffer.isGenuine()))){ if (!_buffer.hasUTMZ()){ return (_local3); }; }; _local4 = getTrackerFromSearchString(_arg1); if (isValid(_local4)){ _local6 = hasNoOverride(_arg1); if (((_local6) && (!(_buffer.hasUTMZ())))){ return (_local3); }; }; if (!isValid(_local4)){ _local4 = getOrganicCampaign(); if (((!(_buffer.hasUTMZ())) && (isIgnoredKeyword(_local4)))){ return (_local3); }; }; if (((!(isValid(_local4))) && (_arg2))){ _local4 = getReferrerCampaign(); if (((!(_buffer.hasUTMZ())) && (isIgnoredReferral(_local4)))){ return (_local3); }; }; if (!isValid(_local4)){ if (((!(_buffer.hasUTMZ())) && (_arg2))){ _local4 = getDirectCampaign(); }; }; if (!isValid(_local4)){ return (_local3); }; if (((_buffer.hasUTMZ()) && (!(_buffer.utmz.isEmpty())))){ _local8 = new CampaignTracker(); _local8.fromTrackerString(_buffer.utmz.campaignTracking); _local5 = (_local8.toTrackerString() == _local4.toTrackerString()); _local7 = _buffer.utmz.responseCount; }; if (((!(_local5)) || (_arg2))){ _local9 = _buffer.utma.sessionCount; _local7++; if (_local9 == 0){ _local9 = 1; }; _buffer.utmz.domainHash = _domainHash; _buffer.utmz.campaignCreation = _timeStamp; _buffer.utmz.campaignSessions = _local9; _buffer.utmz.responseCount = _local7; _buffer.utmz.campaignTracking = _local4.toTrackerString(); _debug.info(_buffer.utmz.toString(), VisualDebugMode.geek); _local3 = new CampaignInfo(false, true); } else { _local3 = new CampaignInfo(false, false); }; return (_local3); } public function isValid(_arg1:CampaignTracker):Boolean{ if (((_arg1) && (_arg1.isValid()))){ return (true); }; return (false); } public function getTrackerFromSearchString(_arg1:String):CampaignTracker{ var _local2:CampaignTracker; var _local3:CampaignTracker; var _local4:CampaignKey; var _local5:Variables; _local2 = getOrganicCampaign(); _local3 = new CampaignTracker(); _local4 = _config.campaignKey; if (_arg1 == ""){ return (_local3); }; _local5 = new Variables(_arg1); if (_local5.hasOwnProperty(_local4.UCID)){ _local3.id = _local5[_local4.UCID]; }; if (_local5.hasOwnProperty(_local4.UCSR)){ _local3.source = _local5[_local4.UCSR]; }; if (_local5.hasOwnProperty(_local4.UGCLID)){ _local3.clickId = _local5[_local4.UGCLID]; }; if (_local5.hasOwnProperty(_local4.UCCN)){ _local3.name = _local5[_local4.UCCN]; } else { _local3.name = "(not set)"; }; if (_local5.hasOwnProperty(_local4.UCMD)){ _local3.medium = _local5[_local4.UCMD]; } else { _local3.medium = "(not set)"; }; if (_local5.hasOwnProperty(_local4.UCTR)){ _local3.term = _local5[_local4.UCTR]; } else { if (((_local2) && (!((_local2.term == ""))))){ _local3.term = _local2.term; }; }; if (_local5.hasOwnProperty(_local4.UCCT)){ _local3.content = _local5[_local4.UCCT]; }; return (_local3); } public function getOrganicCampaign():CampaignTracker{ var _local1:CampaignTracker; var _local2:URL; var _local3:String; var _local4:Array; var _local5:OrganicReferrer; var _local6:String; if (((isInvalidReferrer(_referrer)) || (isFromGoogleCSE(_referrer, _config)))){ return (_local1); }; _local2 = new URL(_referrer); _local3 = ""; if (_local2.hostName != ""){ if (_local2.hostName.indexOf(".") > -1){ _local4 = _local2.hostName.split("."); switch (_local4.length){ case 2: _local3 = _local4[0]; break; case 3: _local3 = _local4[1]; break; }; }; }; if (_config.organic.match(_local3)){ _local5 = _config.organic.getReferrerByName(_local3); _local6 = _config.organic.getKeywordValue(_local5, _local2.search); _local1 = new CampaignTracker(); _local1.source = _local5.engine; _local1.name = "(organic)"; _local1.medium = "organic"; _local1.term = _local6; }; return (_local1); } public function isIgnoredReferral(_arg1:CampaignTracker):Boolean{ if (((_arg1) && ((_arg1.medium == "referral")))){ return (_config.organic.isIgnoredReferral(_arg1.source)); }; return (false); } public function getDirectCampaign():CampaignTracker{ var _local1:CampaignTracker; _local1 = new CampaignTracker(); _local1.source = "(direct)"; _local1.name = "(direct)"; _local1.medium = "(none)"; return (_local1); } public function isIgnoredKeyword(_arg1:CampaignTracker):Boolean{ if (((_arg1) && ((_arg1.medium == "organic")))){ return (_config.organic.isIgnoredKeyword(_arg1.term)); }; return (false); } public function getReferrerCampaign():CampaignTracker{ var _local1:CampaignTracker; var _local2:URL; var _local3:String; var _local4:String; if (((isInvalidReferrer(_referrer)) || (isFromGoogleCSE(_referrer, _config)))){ return (_local1); }; _local2 = new URL(_referrer); _local3 = _local2.hostName; _local4 = _local2.path; if (_local3.indexOf("www.") == 0){ _local3 = _local3.substr(4); }; _local1 = new CampaignTracker(); _local1.source = _local3; _local1.name = "(referral)"; _local1.medium = "referral"; _local1.content = _local4; return (_local1); } public static function isInvalidReferrer(_arg1:String):Boolean{ var _local2:URL; if ((((((_arg1 == "")) || ((_arg1 == "-")))) || ((_arg1 == "0")))){ return (true); }; if (_arg1.indexOf("://") > -1){ _local2 = new URL(_arg1); if ((((_local2.protocol == Protocols.file)) || ((_local2.protocol == Protocols.none)))){ return (true); }; }; return (false); } public static function isFromGoogleCSE(_arg1:String, _arg2:Configuration):Boolean{ var _local3:URL; _local3 = new URL(_arg1); if (_local3.hostName.indexOf(_arg2.google) > -1){ if (_local3.search.indexOf((_arg2.googleSearchParam + "=")) > -1){ if (_local3.path == ("/" + _arg2.googleCsePath)){ return (true); }; }; }; return (false); } } }//package com.google.analytics.campaign
Section 4
//CampaignTracker (com.google.analytics.campaign.CampaignTracker) package com.google.analytics.campaign { import com.google.analytics.utils.*; public class CampaignTracker { public var content:String; public var source:String; public var clickId:String; public var name:String; public var term:String; public var medium:String; public var id:String; public function CampaignTracker(_arg1:String="", _arg2:String="", _arg3:String="", _arg4:String="", _arg5:String="", _arg6:String="", _arg7:String=""){ this.id = _arg1; this.source = _arg2; this.clickId = _arg3; this.name = _arg4; this.medium = _arg5; this.term = _arg6; this.content = _arg7; } public function isValid():Boolean{ if (((((!((id == ""))) || (!((source == ""))))) || (!((clickId == ""))))){ return (true); }; return (false); } public function toTrackerString():String{ var _local1:Array = []; _addIfNotEmpty(_local1, "utmcsr=", source); _addIfNotEmpty(_local1, "utmccn=", name); _addIfNotEmpty(_local1, "utmcmd=", medium); _addIfNotEmpty(_local1, "utmctr=", term); _addIfNotEmpty(_local1, "utmcct=", content); _addIfNotEmpty(_local1, "utmcid=", id); _addIfNotEmpty(_local1, "utmgclid=", clickId); return (_local1.join(CampaignManager.trackingDelimiter)); } private function _addIfNotEmpty(_arg1:Array, _arg2:String, _arg3:String):void{ if (_arg3 != ""){ _arg3 = _arg3.split("+").join("%20"); _arg3 = _arg3.split(" ").join("%20"); _arg1.push((_arg2 + _arg3)); }; } public function fromTrackerString(_arg1:String):void{ var _local2:String = _arg1.split(CampaignManager.trackingDelimiter).join("&"); var _local3:Variables = new Variables(_local2); if (_local3.hasOwnProperty("utmcid")){ this.id = _local3["utmcid"]; }; if (_local3.hasOwnProperty("utmcsr")){ this.source = _local3["utmcsr"]; }; if (_local3.hasOwnProperty("utmccn")){ this.name = _local3["utmccn"]; }; if (_local3.hasOwnProperty("utmcmd")){ this.medium = _local3["utmcmd"]; }; if (_local3.hasOwnProperty("utmctr")){ this.term = _local3["utmctr"]; }; if (_local3.hasOwnProperty("utmcct")){ this.content = _local3["utmcct"]; }; if (_local3.hasOwnProperty("utmgclid")){ this.clickId = _local3["utmgclid"]; }; } } }//package com.google.analytics.campaign
Section 5
//FlashTracker (com.google.analytics.components.FlashTracker) package com.google.analytics.components { import com.google.analytics.core.*; import com.google.analytics.v4.*; import com.google.analytics.debug.*; import flash.events.*; import flash.display.*; import com.google.analytics.utils.*; import com.google.analytics.external.*; import com.google.analytics.*; import flash.utils.*; import com.google.analytics.events.*; public class FlashTracker extends Sprite implements AnalyticsTracker { private var _adSense:AdSenseGlobals; private var _env:Environment; protected var _height:Number;// = 18 private var _idleTimer:IdleTimer; private var _config:Configuration; private var _mode:String;// = "AS3" private var _dom:HTMLDOM; private var _ready:Boolean;// = false protected var _width:Number;// = 18 private var _account:String;// = "" protected var _componentInspectorSetting:Boolean; private var _visualDebug:Boolean;// = false public var boundingBox_mc:DisplayObject; private var _debug:DebugConfiguration; private var _buffer:Buffer; private var _display:DisplayObject; protected var livePreviewHeight:Number; private var _jsproxy:JavascriptProxy; protected var isLivePreview:Boolean; protected var preview:MovieClip; private var _gifRequest:GIFRequest; protected var livePreviewWidth:Number; private var _tracker:GoogleAnalyticsAPI; public static var version:Version = API.version; public function FlashTracker(){ _ready = false; _account = ""; _mode = TrackerMode.AS3; _visualDebug = false; _width = 18; _height = 18; super(); _tracker = new TrackerCache(); isLivePreview = _checkLivePreview(); _componentInspectorSetting = false; if (boundingBox_mc){ boundingBox_mc.visible = false; removeChild(boundingBox_mc); boundingBox_mc = null; }; if (isLivePreview){ _createLivePreview(); }; addEventListener(Event.ENTER_FRAME, _factory); } public function trackEvent(_arg1:String, _arg2:String, _arg3:String=null, _arg4:Number=NaN):Boolean{ return (_tracker.trackEvent(_arg1, _arg2, _arg3, _arg4)); } public function trackTrans():void{ _tracker.trackTrans(); } private function _createLivePreview():void{ var _local1:Graphics; var _local2:Class; preview = new MovieClip(); _local1 = preview.graphics; _local1.beginFill(0xFFFFFF); _local1.moveTo(0, 0); _local1.lineTo(0, _width); _local1.lineTo(_width, _height); _local1.lineTo(_height, 0); _local1.lineTo(0, 0); _local1.endFill(); _local2 = (getDefinitionByName("com.google.analytics.components::Icon") as Class); preview.icon_mc = new (_local2); preview.icon_mc.name = "icon_mc"; preview.addChild(preview.icon_mc); addChild(preview); } public function trackPageview(_arg1:String=""):void{ _tracker.trackPageview(_arg1); } public function get account():String{ return (_account); } public function linkByPost(_arg1:Object, _arg2:Boolean=false):void{ _tracker.linkByPost(_arg1, _arg2); } public function getDetectTitle():Boolean{ return (_tracker.getDetectTitle()); } public function setCampNameKey(_arg1:String):void{ _tracker.setCampNameKey(_arg1); } public function resetSession():void{ _tracker.resetSession(); } public function set account(_arg1:String):void{ _account = _arg1; } public function get debug():DebugConfiguration{ if (!_debug){ _createDebugAndConfig(); }; return (_debug); } public function createEventTracker(_arg1:String):EventTracker{ return (_tracker.createEventTracker(_arg1)); } public function set config(_arg1:Configuration):void{ _config = _arg1; } public function addTrans(_arg1:String, _arg2:String, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:String, _arg7:String, _arg8:String):Object{ return (_tracker.addTrans(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7, _arg8)); } public function setLocalServerMode():void{ _tracker.setLocalServerMode(); } public function getLocalGifPath():String{ return (_tracker.getLocalGifPath()); } public function clearIgnoredRef():void{ _tracker.clearIgnoredRef(); } public function isReady():Boolean{ return (_ready); } public function set debug(_arg1:DebugConfiguration):void{ _debug = _arg1; } public function getVersion():String{ return (_tracker.getVersion()); } public function setLocalRemoteServerMode():void{ _tracker.setLocalRemoteServerMode(); } public function setCampNOKey(_arg1:String):void{ _tracker.setCampNOKey(_arg1); } public function addIgnoredOrganic(_arg1:String):void{ _tracker.addIgnoredOrganic(_arg1); } public function setCookiePath(_arg1:String):void{ _tracker.setCookiePath(_arg1); } public function setCampTermKey(_arg1:String):void{ _tracker.setCampTermKey(_arg1); } private function _trackerFactory():GoogleAnalyticsAPI{ debug.info(((("GATracker (AS3) v" + version) + "\naccount: ") + account)); _adSense = new AdSenseGlobals(debug); _dom = new HTMLDOM(debug); _dom.cacheProperties(); _env = new Environment("", "", "", debug, _dom); _buffer = new Buffer(config, debug, false); _gifRequest = new GIFRequest(config, debug, _buffer, _env); _idleTimer = new IdleTimer(config, debug, _display, _buffer); _env.url = _display.stage.loaderInfo.url; return (new Tracker(account, config, debug, _env, _buffer, _gifRequest, _adSense)); } public function setCampaignTrack(_arg1:Boolean):void{ _tracker.setCampaignTrack(_arg1); } public function getServiceMode():ServerOperationMode{ return (_tracker.getServiceMode()); } public function set componentInspectorSetting(_arg1:Boolean):void{ _componentInspectorSetting = _arg1; } public function setSessionTimeout(_arg1:int):void{ _tracker.setSessionTimeout(_arg1); } public function setRemoteServerMode():void{ _tracker.setRemoteServerMode(); } public function get visualDebug():Boolean{ return (_visualDebug); } public function addOrganic(_arg1:String, _arg2:String):void{ _tracker.addOrganic(_arg1, _arg2); } public function setCookieTimeout(_arg1:int):void{ _tracker.setCookieTimeout(_arg1); } public function getClientInfo():Boolean{ return (_tracker.getClientInfo()); } public function setAllowLinker(_arg1:Boolean):void{ _tracker.setAllowLinker(_arg1); } public function setClientInfo(_arg1:Boolean):void{ _tracker.setClientInfo(_arg1); } private function _bridgeFactory():GoogleAnalyticsAPI{ debug.info(((("GATracker (Bridge) v" + version) + "\naccount: ") + account)); return (new Bridge(account, _debug, _jsproxy)); } public function get config():Configuration{ if (!_config){ _createDebugAndConfig(); }; return (_config); } public function set mode(_arg1:String):void{ _mode = _arg1; } public function setDetectFlash(_arg1:Boolean):void{ _tracker.setDetectFlash(_arg1); } public function addItem(_arg1:String, _arg2:String, _arg3:String, _arg4:String, _arg5:Number, _arg6:int):void{ _tracker.addItem(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6); } public function setVar(_arg1:String):void{ _tracker.setVar(_arg1); } public function clearIgnoredOrganic():void{ _tracker.clearIgnoredOrganic(); } public function setDomainName(_arg1:String):void{ _tracker.setDomainName(_arg1); } private function _checkLivePreview():Boolean{ if (((!((parent == null))) && ((getQualifiedClassName(parent) == "fl.livepreview::LivePreviewParent")))){ return (true); }; return (false); } public function setCampSourceKey(_arg1:String):void{ _tracker.setCampSourceKey(_arg1); } public function setCampContentKey(_arg1:String):void{ _tracker.setCampContentKey(_arg1); } public function setSize(_arg1:Number, _arg2:Number):void{ } public function setAllowAnchor(_arg1:Boolean):void{ _tracker.setAllowAnchor(_arg1); } public function setLocalGifPath(_arg1:String):void{ _tracker.setLocalGifPath(_arg1); } public function get mode():String{ return (_mode); } public function setSampleRate(_arg1:Number):void{ _tracker.setSampleRate(_arg1); } public function setAllowHash(_arg1:Boolean):void{ _tracker.setAllowHash(_arg1); } public function setDetectTitle(_arg1:Boolean):void{ _tracker.setDetectTitle(_arg1); } public function cookiePathCopy(_arg1:String):void{ _tracker.cookiePathCopy(_arg1); } private function _factory(_arg1:Event):void{ var _local2:GoogleAnalyticsAPI; var _local3:TrackerCache; removeEventListener(Event.ENTER_FRAME, _factory); if (isLivePreview){ return; }; _display = this; _createDebugAndConfig(); if (visualDebug){ debug.layout = new Layout(debug, _display); debug.active = visualDebug; }; _jsproxy = new JavascriptProxy(debug); _local3 = (_tracker as TrackerCache); switch (mode){ case TrackerMode.BRIDGE: _local2 = _bridgeFactory(); break; case TrackerMode.AS3: default: _local2 = _trackerFactory(); }; if (!_local3.isEmpty()){ _local3.tracker = _local2; _local3.flush(); }; _tracker = _local2; _ready = true; dispatchEvent(new AnalyticsEvent(AnalyticsEvent.READY, this)); } public function getDetectFlash():Boolean{ return (_tracker.getDetectFlash()); } public function clearOrganic():void{ _tracker.clearOrganic(); } private function _createDebugAndConfig():void{ if (!_debug){ this.debug = new DebugConfiguration(); }; if (!_config){ this.config = new Configuration(debug); }; } public function addIgnoredRef(_arg1:String):void{ _tracker.addIgnoredRef(_arg1); } public function set visualDebug(_arg1:Boolean):void{ _visualDebug = _arg1; } public function setCampMediumKey(_arg1:String):void{ _tracker.setCampMediumKey(_arg1); } public function getAccount():String{ return (_tracker.getAccount()); } public function link(_arg1:String, _arg2:Boolean=false):void{ _tracker.link(_arg1, _arg2); } } var _local1:* = ServerOperationMode; return (_local1); }//package com.google.analytics.components
Section 6
//Icon (com.google.analytics.components.Icon) package com.google.analytics.components { import flash.display.*; public dynamic class Icon extends MovieClip { } }//package com.google.analytics.components
Section 7
//BrowserInfo (com.google.analytics.core.BrowserInfo) package com.google.analytics.core { import com.google.analytics.v4.*; import com.google.analytics.utils.*; public class BrowserInfo { private var _config:Configuration; private var _info:Environment; public function BrowserInfo(_arg1:Configuration, _arg2:Environment){ _config = _arg1; _info = _arg2; } public function get utmul():String{ return (_info.language.toLowerCase()); } public function get utmje():String{ return ("0"); } public function toURLString():String{ var _local1:Variables; _local1 = toVariables(); return (_local1.toString()); } public function get utmsr():String{ return (((_info.screenWidth + "x") + _info.screenHeight)); } public function get utmcs():String{ return (_info.languageEncoding); } public function get utmfl():String{ var _local1:Version; if (_config.detectFlash){ _local1 = _info.flashVersion; return (((((_local1.major + ".") + _local1.minor) + " r") + _local1.build)); }; return ("-"); } public function toVariables():Variables{ var _local1:Variables; _local1 = new Variables(); _local1.URIencode = true; _local1.utmcs = utmcs; _local1.utmsr = utmsr; _local1.utmsc = utmsc; _local1.utmul = utmul; _local1.utmje = utmje; _local1.utmfl = utmfl; return (_local1); } public function get utmsc():String{ return ((_info.screenColorDepth + "-bit")); } } }//package com.google.analytics.core
Section 8
//Buffer (com.google.analytics.core.Buffer) package com.google.analytics.core { import com.google.analytics.v4.*; import com.google.analytics.debug.*; import flash.net.*; import flash.events.*; import com.google.analytics.data.*; public dynamic class Buffer { private var _SO:SharedObject; private var _OBJ:Object; private var _utma:UTMA; private var _utmb:UTMB; private var _utmc:UTMC; private var _debug:DebugConfiguration; private var _utmk:UTMK; private var _config:Configuration; private var _utmv:UTMV; private var _utmz:UTMZ; private var _volatile:Boolean; public function Buffer(_arg1:Configuration, _arg2:DebugConfiguration, _arg3:Boolean=false, _arg4:Object=null){ var _local5:Boolean; var _local6:String; super(); _config = _arg1; _debug = _arg2; UTMB.defaultTimespan = _config.sessionTimeout; UTMZ.defaultTimespan = _config.conversionTimeout; if (!_arg3){ _SO = SharedObject.getLocal(_config.cookieName, _config.cookiePath); _local5 = false; if (_SO.data.utma){ if (!hasUTMA()){ _createUMTA(); }; _utma.fromSharedObject(_SO.data.utma); if (_debug.verbose){ _debug.info(("found: " + _utma.toString(true)), VisualDebugMode.geek); }; if (_utma.isExpired()){ if (_debug.verbose){ _debug.warning("UTMA has expired", VisualDebugMode.advanced); }; _clearUTMA(); _local5 = true; }; }; if (_SO.data.utmb){ if (!hasUTMB()){ _createUMTB(); }; _utmb.fromSharedObject(_SO.data.utmb); if (_debug.verbose){ _debug.info(("found: " + _utmb.toString(true)), VisualDebugMode.geek); }; if (_utmb.isExpired()){ if (_debug.verbose){ _debug.warning("UTMB has expired", VisualDebugMode.advanced); }; _clearUTMB(); _local5 = true; }; }; if (_SO.data.utmc){ delete _SO.data.utmc; _local5 = true; }; if (_SO.data.utmk){ if (!hasUTMK()){ _createUMTK(); }; _utmk.fromSharedObject(_SO.data.utmk); if (_debug.verbose){ _debug.info(("found: " + _utmk.toString()), VisualDebugMode.geek); }; }; if (_SO.data.utmv){ if (!hasUTMV()){ _createUMTV(); }; _utmv.fromSharedObject(_SO.data.utmv); if (_debug.verbose){ _debug.info(("found: " + _utmv.toString(true)), VisualDebugMode.geek); }; if (_utmv.isExpired()){ if (_debug.verbose){ _debug.warning("UTMV has expired", VisualDebugMode.advanced); }; _clearUTMV(); _local5 = true; }; }; if (_SO.data.utmz){ if (!hasUTMZ()){ _createUMTZ(); }; _utmz.fromSharedObject(_SO.data.utmz); if (_debug.verbose){ _debug.info(("found: " + _utmz.toString(true)), VisualDebugMode.geek); }; if (_utmz.isExpired()){ if (_debug.verbose){ _debug.warning("UTMZ has expired", VisualDebugMode.advanced); }; _clearUTMZ(); _local5 = true; }; }; if (_local5){ save(); }; } else { _OBJ = new Object(); if (_arg4){ for (_local6 in _arg4) { _OBJ[_local6] = _arg4[_local6]; }; }; }; _volatile = _arg3; } public function clearCookies():void{ utma.reset(); utmb.reset(); utmc.reset(); utmz.reset(); utmv.reset(); utmk.reset(); } public function save():void{ var flushStatus:String; if (!isVolatile()){ flushStatus = null; try { flushStatus = _SO.flush(); } catch(e:Error) { _debug.warning("Error...Could not write SharedObject to disk"); }; switch (flushStatus){ case SharedObjectFlushStatus.PENDING: _debug.info("Requesting permission to save object..."); _SO.addEventListener(NetStatusEvent.NET_STATUS, _onFlushStatus); break; case SharedObjectFlushStatus.FLUSHED: _debug.info("Value flushed to disk."); break; }; }; } public function get utmv():UTMV{ if (!hasUTMV()){ _createUMTV(); }; return (_utmv); } public function get utmz():UTMZ{ if (!hasUTMZ()){ _createUMTZ(); }; return (_utmz); } public function hasUTMA():Boolean{ if (_utma){ return (true); }; return (false); } public function hasUTMB():Boolean{ if (_utmb){ return (true); }; return (false); } public function hasUTMC():Boolean{ if (_utmc){ return (true); }; return (false); } public function isGenuine():Boolean{ if (!hasUTMK()){ return (true); }; return ((utmk.hash == generateCookiesHash())); } public function resetCurrentSession():void{ _clearUTMB(); _clearUTMC(); save(); } public function hasUTMK():Boolean{ if (_utmk){ return (true); }; return (false); } public function generateCookiesHash():Number{ var _local1 = ""; _local1 = (_local1 + utma.valueOf()); _local1 = (_local1 + utmb.valueOf()); _local1 = (_local1 + utmc.valueOf()); _local1 = (_local1 + utmz.valueOf()); _local1 = (_local1 + utmv.valueOf()); return (Utils.generateHash(_local1)); } private function _createUMTB():void{ _utmb = new UTMB(); _utmb.proxy = this; } private function _createUMTC():void{ _utmc = new UTMC(); } private function _createUMTA():void{ _utma = new UTMA(); _utma.proxy = this; } public function hasUTMV():Boolean{ if (_utmv){ return (true); }; return (false); } private function _createUMTK():void{ _utmk = new UTMK(); _utmk.proxy = this; } public function hasUTMZ():Boolean{ if (_utmz){ return (true); }; return (false); } private function _createUMTV():void{ _utmv = new UTMV(); _utmv.proxy = this; } private function _onFlushStatus(_arg1:NetStatusEvent):void{ _debug.info("User closed permission dialog..."); switch (_arg1.info.code){ case "SharedObject.Flush.Success": _debug.info("User granted permission -- value saved."); break; case "SharedObject.Flush.Failed": _debug.info("User denied permission -- value not saved."); break; }; _SO.removeEventListener(NetStatusEvent.NET_STATUS, _onFlushStatus); } private function _createUMTZ():void{ _utmz = new UTMZ(); _utmz.proxy = this; } public function updateUTMA(_arg1:Number):void{ if (_debug.verbose){ _debug.info((("updateUTMA( " + _arg1) + " )"), VisualDebugMode.advanced); }; if (!utma.isEmpty()){ if (isNaN(utma.sessionCount)){ utma.sessionCount = 1; } else { utma.sessionCount = (utma.sessionCount + 1); }; utma.lastTime = utma.currentTime; utma.currentTime = _arg1; }; } private function _clearUTMA():void{ _utma = null; if (!isVolatile()){ _SO.data.utma = null; delete _SO.data.utma; }; } private function _clearUTMC():void{ _utmc = null; } private function _clearUTMB():void{ _utmb = null; if (!isVolatile()){ _SO.data.utmb = null; delete _SO.data.utmb; }; } public function update(_arg1:String, _arg2):void{ if (isVolatile()){ _OBJ[_arg1] = _arg2; } else { _SO.data[_arg1] = _arg2; }; } private function _clearUTMZ():void{ _utmz = null; if (!isVolatile()){ _SO.data.utmz = null; delete _SO.data.utmz; }; } private function _clearUTMV():void{ _utmv = null; if (!isVolatile()){ _SO.data.utmv = null; delete _SO.data.utmv; }; } public function isVolatile():Boolean{ return (_volatile); } public function get utma():UTMA{ if (!hasUTMA()){ _createUMTA(); }; return (_utma); } public function get utmb():UTMB{ if (!hasUTMB()){ _createUMTB(); }; return (_utmb); } public function get utmc():UTMC{ if (!hasUTMC()){ _createUMTC(); }; return (_utmc); } public function get utmk():UTMK{ if (!hasUTMK()){ _createUMTK(); }; return (_utmk); } } }//package com.google.analytics.core
Section 9
//DocumentInfo (com.google.analytics.core.DocumentInfo) package com.google.analytics.core { import com.google.analytics.v4.*; import com.google.analytics.utils.*; import com.google.analytics.external.*; public class DocumentInfo { private var _config:Configuration; private var _utmr:String; private var _adSense:AdSenseGlobals; private var _info:Environment; private var _pageURL:String; public function DocumentInfo(_arg1:Configuration, _arg2:Environment, _arg3:String, _arg4:String=null, _arg5:AdSenseGlobals=null){ _config = _arg1; _info = _arg2; _utmr = _arg3; _pageURL = _arg4; _adSense = _arg5; } public function get utmr():String{ if (!_utmr){ return ("-"); }; return (_utmr); } public function toURLString():String{ var _local1:Variables; _local1 = toVariables(); return (_local1.toString()); } private function _renderPageURL(_arg1:String=""):String{ var _local2:String; var _local3:String; _local2 = _info.locationPath; _local3 = _info.locationSearch; if (((!(_arg1)) || ((_arg1 == "")))){ _arg1 = (_local2 + unescape(_local3)); }; return (_arg1); } public function get utmp():String{ return (_renderPageURL(_pageURL)); } private function _generateHitId():Number{ var _local1:Number; if (((_adSense.hid) && (!((_adSense.hid == ""))))){ _local1 = Number(_adSense.hid); } else { _local1 = Math.round((Math.random() * 2147483647)); _adSense.hid = String(_local1); }; return (_local1); } public function get utmhid():String{ return (String(_generateHitId())); } public function toVariables():Variables{ var _local1:Variables; _local1 = new Variables(); _local1.URIencode = true; if (((_config.detectTitle) && (!((utmdt == ""))))){ _local1.utmdt = utmdt; }; _local1.utmhid = utmhid; _local1.utmr = utmr; _local1.utmp = utmp; return (_local1); } public function get utmdt():String{ return (_info.documentTitle); } } }//package com.google.analytics.core
Section 10
//Domain (com.google.analytics.core.Domain) package com.google.analytics.core { import com.google.analytics.debug.*; public class Domain { private var _mode:DomainNameMode; private var _debug:DebugConfiguration; private var _name:String; public function Domain(_arg1:DomainNameMode=null, _arg2:String="", _arg3:DebugConfiguration=null){ _debug = _arg3; if (_arg1 == null){ _arg1 = DomainNameMode.auto; }; _mode = _arg1; if (_arg1 == DomainNameMode.custom){ this.name = _arg2; } else { _name = _arg2; }; } public function get mode():DomainNameMode{ return (_mode); } public function set mode(_arg1:DomainNameMode):void{ _mode = _arg1; if (_mode == DomainNameMode.none){ _name = ""; }; } public function get name():String{ return (_name); } public function set name(_arg1:String):void{ if (((!((_arg1.charAt(0) == "."))) && (_debug))){ _debug.warning(("missing leading period \".\", cookie will only be accessible on " + _arg1), VisualDebugMode.geek); }; _name = _arg1; } } }//package com.google.analytics.core
Section 11
//DomainNameMode (com.google.analytics.core.DomainNameMode) package com.google.analytics.core { public class DomainNameMode { private var _value:int; private var _name:String; public static const custom:DomainNameMode = new DomainNameMode(2, "custom"); ; public static const none:DomainNameMode = new DomainNameMode(0, "none"); ; public static const auto:DomainNameMode = new DomainNameMode(1, "auto"); ; public function DomainNameMode(_arg1:int=0, _arg2:String=""){ _value = _arg1; _name = _arg2; } public function valueOf():int{ return (_value); } public function toString():String{ return (_name); } } }//package com.google.analytics.core
Section 12
//EventInfo (com.google.analytics.core.EventInfo) package com.google.analytics.core { import com.google.analytics.data.*; import com.google.analytics.utils.*; public class EventInfo { private var _isEventHit:Boolean; private var _ext10:X10; private var _x10:X10; public function EventInfo(_arg1:Boolean, _arg2:X10, _arg3:X10=null){ _isEventHit = _arg1; _x10 = _arg2; _ext10 = _arg3; } public function toURLString():String{ var _local1:Variables; _local1 = toVariables(); return (_local1.toString()); } public function get utmt():String{ return ("event"); } public function get utme():String{ return (_x10.renderMergedUrlString(_ext10)); } public function toVariables():Variables{ var _local1:Variables; _local1 = new Variables(); _local1.URIencode = true; if (_isEventHit){ _local1.utmt = utmt; }; _local1.utme = utme; return (_local1); } } }//package com.google.analytics.core
Section 13
//EventTracker (com.google.analytics.core.EventTracker) package com.google.analytics.core { import com.google.analytics.v4.*; public class EventTracker { private var _parent:GoogleAnalyticsAPI; public var name:String; public function EventTracker(_arg1:String, _arg2:GoogleAnalyticsAPI){ this.name = _arg1; _parent = _arg2; } public function trackEvent(_arg1:String, _arg2:String=null, _arg3:Number=NaN):Boolean{ return (_parent.trackEvent(name, _arg1, _arg2, _arg3)); } } }//package com.google.analytics.core
Section 14
//ga_internal (com.google.analytics.core.ga_internal) package com.google.analytics.core { public namespace ga_internal; }//package com.google.analytics.core
Section 15
//GIFRequest (com.google.analytics.core.GIFRequest) package com.google.analytics.core { import com.google.analytics.v4.*; import com.google.analytics.debug.*; import flash.net.*; import flash.events.*; import flash.display.*; import com.google.analytics.utils.*; import flash.system.*; public class GIFRequest { private var _info:Environment; private var _count:int; private var _utmac:String; private var _alertcount:int; private var _debug:DebugConfiguration; private var _lastRequest:URLRequest; private var _buffer:Buffer; private var _config:Configuration; private var _requests:Array; public function GIFRequest(_arg1:Configuration, _arg2:DebugConfiguration, _arg3:Buffer, _arg4:Environment){ _config = _arg1; _debug = _arg2; _buffer = _arg3; _info = _arg4; _count = 0; _alertcount = 0; _requests = []; } public function get utmn():String{ return ((Utils.generate32bitRandom() as String)); } public function onIOError(_arg1:IOErrorEvent):void{ var _local2:String = _lastRequest.url; var _local3:String = String((_requests.length - 1)); var _local4 = (("Gif Request #" + _local3) + " failed"); if (_debug.GIFRequests){ if (!_debug.verbose){ if (_local2.indexOf("?") > -1){ _local2 = _local2.split("?")[0]; }; _local2 = _shortenURL(_local2); }; if (int(_debug.mode) > int(VisualDebugMode.basic)){ _local4 = (_local4 + ((" \"" + _local2) + "\" does not exists or is unreachable")); }; _debug.failure(_local4); } else { _debug.warning(_local4); }; _removeListeners(_arg1.target); } public function send(_arg1:String, _arg2:Variables=null, _arg3:Boolean=false, _arg4:Boolean=false):void{ var _local5:String; var _local6:URLRequest; var _local7:URLRequest; _utmac = _arg1; if (!_arg2){ _arg2 = new Variables(); }; _arg2.URIencode = false; _arg2.pre = ["utmwv", "utmn", "utmhn", "utmt", "utme", "utmcs", "utmsr", "utmsc", "utmul", "utmje", "utmfl", "utmdt", "utmhid", "utmr", "utmp"]; _arg2.post = ["utmcc"]; if (_debug.verbose){ _debug.info(((("tracking: " + _buffer.utmb.trackCount) + "/") + _config.trackingLimitPerSession), VisualDebugMode.geek); }; if ((((_buffer.utmb.trackCount < _config.trackingLimitPerSession)) || (_arg3))){ if (_arg4){ updateToken(); }; if (((((_arg3) || (!(_arg4)))) || ((_buffer.utmb.token >= 1)))){ if (((!(_arg3)) && (_arg4))){ _buffer.utmb.token = (_buffer.utmb.token - 1); }; _buffer.utmb.trackCount = (_buffer.utmb.trackCount + 1); if (_debug.verbose){ _debug.info(_buffer.utmb.toString(), VisualDebugMode.geek); }; _arg2.utmwv = utmwv; _arg2.utmn = Utils.generate32bitRandom(); if (_info.domainName != ""){ _arg2.utmhn = _info.domainName; }; if (_config.sampleRate < 1){ _arg2.utmsp = (_config.sampleRate * 100); }; if ((((_config.serverMode == ServerOperationMode.local)) || ((_config.serverMode == ServerOperationMode.both)))){ _local5 = _info.locationSWFPath; if (_local5.lastIndexOf("/") > 0){ _local5 = _local5.substring(0, _local5.lastIndexOf("/")); }; _local6 = new URLRequest(); if (_config.localGIFpath.indexOf("http") == 0){ _local6.url = _config.localGIFpath; } else { _local6.url = (_local5 + _config.localGIFpath); }; _local6.url = (_local6.url + ("?" + _arg2.toString())); if (((_debug.active) && (_debug.GIFRequests))){ _debugSend(_local6); } else { sendRequest(_local6); }; }; if ((((_config.serverMode == ServerOperationMode.remote)) || ((_config.serverMode == ServerOperationMode.both)))){ _local7 = new URLRequest(); if (_info.protocol == Protocols.HTTPS){ _local7.url = _config.secureRemoteGIFpath; } else { if (_info.protocol == Protocols.HTTP){ _local7.url = _config.remoteGIFpath; } else { _local7.url = _config.remoteGIFpath; }; }; _arg2.utmac = utmac; _arg2.utmcc = encodeURIComponent(utmcc); _local7.url = (_local7.url + ("?" + _arg2.toString())); if (((_debug.active) && (_debug.GIFRequests))){ _debugSend(_local7); } else { sendRequest(_local7); }; }; }; }; } public function onSecurityError(_arg1:SecurityErrorEvent):void{ if (_debug.GIFRequests){ _debug.failure(_arg1.text); }; } public function get utmsp():String{ return (((_config.sampleRate * 100) as String)); } public function get utmcc():String{ var _local1:Array = []; if (_buffer.hasUTMA()){ _local1.push((_buffer.utma.toURLString() + ";")); }; if (_buffer.hasUTMZ()){ _local1.push((_buffer.utmz.toURLString() + ";")); }; if (_buffer.hasUTMV()){ _local1.push((_buffer.utmv.toURLString() + ";")); }; return (_local1.join("+")); } public function get utmac():String{ return (_utmac); } public function get utmwv():String{ return (_config.version); } public function sendRequest(_arg1:URLRequest):void{ var request = _arg1; var loader:Loader = new Loader(); loader.name = String(_count++); var context:LoaderContext = new LoaderContext(false); loader.contentLoaderInfo.addEventListener(IOErrorEvent.IO_ERROR, onIOError); loader.contentLoaderInfo.addEventListener(Event.COMPLETE, onComplete); _lastRequest = request; _requests[loader.name] = new RequestObject(request); try { loader.load(request, context); } catch(e:Error) { _debug.failure("\"Loader.load()\" could not instanciate Gif Request"); }; } private function _removeListeners(_arg1:Object):void{ _arg1.removeEventListener(IOErrorEvent.IO_ERROR, onIOError); _arg1.removeEventListener(Event.COMPLETE, onComplete); } public function updateToken():void{ var _local2:Number; var _local1:Number = new Date().getTime(); _local2 = ((_local1 - _buffer.utmb.lastTime) * (_config.tokenRate / 1000)); if (_debug.verbose){ _debug.info(("tokenDelta: " + _local2), VisualDebugMode.geek); }; if (_local2 >= 1){ _buffer.utmb.token = Math.min(Math.floor((_buffer.utmb.token + _local2)), _config.bucketCapacity); _buffer.utmb.lastTime = _local1; if (_debug.verbose){ _debug.info(_buffer.utmb.toString(), VisualDebugMode.geek); }; }; } public function get utmhn():String{ return (_info.domainName); } private function _shortenURL(_arg1:String):String{ var _local2:Array; if (_arg1.length > 60){ _local2 = _arg1.split("/"); while (_arg1.length > 60) { _local2.shift(); _arg1 = ("../" + _local2.join("/")); }; }; return (_arg1); } private function _debugSend(_arg1:URLRequest):void{ var _local3:String; var _local2 = ""; switch (_debug.mode){ case VisualDebugMode.geek: _local2 = ((("Gif Request #" + _alertcount) + ":\n") + _arg1.url); break; case VisualDebugMode.advanced: _local3 = _arg1.url; if (_local3.indexOf("?") > -1){ _local3 = _local3.split("?")[0]; }; _local3 = _shortenURL(_local3); _local2 = (((("Send Gif Request #" + _alertcount) + ":\n") + _local3) + " ?"); break; case VisualDebugMode.basic: default: _local2 = (((("Send " + _config.serverMode.toString()) + " Gif Request #") + _alertcount) + " ?"); }; _debug.alertGifRequest(_local2, _arg1, this); _alertcount++; } public function onComplete(_arg1:Event):void{ var _local2:String = _arg1.target.loader.name; _requests[_local2].complete(); var _local3 = (("Gif Request #" + _local2) + " sent"); var _local4:String = _requests[_local2].request.url; if (_debug.GIFRequests){ if (!_debug.verbose){ if (_local4.indexOf("?") > -1){ _local4 = _local4.split("?")[0]; }; _local4 = _shortenURL(_local4); }; if (int(_debug.mode) > int(VisualDebugMode.basic)){ _local3 = (_local3 + ((" to \"" + _local4) + "\"")); }; _debug.success(_local3); } else { _debug.info(_local3); }; _removeListeners(_arg1.target); } } }//package com.google.analytics.core
Section 16
//IdleTimer (com.google.analytics.core.IdleTimer) package com.google.analytics.core { import com.google.analytics.v4.*; import com.google.analytics.debug.*; import flash.events.*; import flash.display.*; import flash.utils.*; public class IdleTimer { private var _loop:Timer; private var _stage:Stage; private var _lastMove:int; private var _debug:DebugConfiguration; private var _session:Timer; private var _inactivity:Number; private var _buffer:Buffer; public function IdleTimer(_arg1:Configuration, _arg2:DebugConfiguration, _arg3:DisplayObject, _arg4:Buffer){ var _local5:Number; var _local6:Number; var _local7:Number; super(); _local5 = _arg1.idleLoop; _local6 = _arg1.idleTimeout; _local7 = _arg1.sessionTimeout; _loop = new Timer((_local5 * 1000)); _session = new Timer((_local7 * 1000), 1); _debug = _arg2; _stage = _arg3.stage; _buffer = _arg4; _lastMove = getTimer(); _inactivity = (_local6 * 1000); _loop.addEventListener(TimerEvent.TIMER, checkForIdle); _session.addEventListener(TimerEvent.TIMER_COMPLETE, endSession); _stage.addEventListener(MouseEvent.MOUSE_MOVE, onMouseMove); _debug.info(((((("delay: " + _local5) + "sec , inactivity: ") + _local6) + "sec, sessionTimeout: ") + _local7), VisualDebugMode.geek); _loop.start(); } private function onMouseMove(_arg1:MouseEvent):void{ _lastMove = getTimer(); if (_session.running){ _debug.info("session timer reset", VisualDebugMode.geek); _session.reset(); }; } public function endSession(_arg1:TimerEvent):void{ _session.removeEventListener(TimerEvent.TIMER_COMPLETE, endSession); _debug.info("session timer end session", VisualDebugMode.geek); _session.reset(); _buffer.resetCurrentSession(); _debug.info(_buffer.utmb.toString(), VisualDebugMode.geek); _debug.info(_buffer.utmc.toString(), VisualDebugMode.geek); _session.addEventListener(TimerEvent.TIMER_COMPLETE, endSession); } public function checkForIdle(_arg1:TimerEvent):void{ var _local2:int; _local2 = getTimer(); if ((_local2 - _lastMove) >= _inactivity){ if (!_session.running){ _debug.info("session timer start", VisualDebugMode.geek); _session.start(); }; }; } } }//package com.google.analytics.core
Section 17
//Organic (com.google.analytics.core.Organic) package com.google.analytics.core { import com.google.analytics.utils.*; public class Organic { private var _sourcesCache:Array; private var _sourcesEngine:Array; private var _ignoredKeywords:Array; private var _ignoredReferralsCache:Object; private var _ignoredReferrals:Array; private var _ignoredKeywordsCache:Object; private var _sources:Array; public static var throwErrors:Boolean = false; public function Organic(){ _sources = []; _sourcesCache = []; _sourcesEngine = []; _ignoredReferrals = []; _ignoredReferralsCache = {}; _ignoredKeywords = []; _ignoredKeywordsCache = {}; } public function getKeywordValue(_arg1:OrganicReferrer, _arg2:String):String{ var _local3:String; _local3 = _arg1.keyword; return (getKeywordValueFromPath(_local3, _arg2)); } public function isIgnoredKeyword(_arg1:String):Boolean{ if (_ignoredKeywordsCache.hasOwnProperty(_arg1)){ return (true); }; return (false); } public function isIgnoredReferral(_arg1:String):Boolean{ if (_ignoredReferralsCache.hasOwnProperty(_arg1)){ return (true); }; return (false); } public function clear():void{ clearEngines(); clearIgnoredReferrals(); clearIgnoredKeywords(); } public function get ignoredKeywordsCount():int{ return (_ignoredKeywords.length); } public function match(_arg1:String):Boolean{ if (_arg1 == ""){ return (false); }; _arg1 = _arg1.toLowerCase(); if (_sourcesEngine[_arg1] != undefined){ return (true); }; return (false); } public function get count():int{ return (_sources.length); } public function addSource(_arg1:String, _arg2:String):void{ var _local3:OrganicReferrer; _local3 = new OrganicReferrer(_arg1, _arg2); if (_sourcesCache[_local3.toString()] == undefined){ _sources.push(_local3); _sourcesCache[_local3.toString()] = (_sources.length - 1); if (_sourcesEngine[_local3.engine] == undefined){ _sourcesEngine[_local3.engine] = [(_sources.length - 1)]; } else { _sourcesEngine[_local3.engine].push((_sources.length - 1)); }; } else { if (throwErrors){ throw (new Error((_local3.toString() + " already exists, we don't add it."))); }; }; } public function clearIgnoredKeywords():void{ _ignoredKeywords = []; _ignoredKeywordsCache = {}; } public function clearEngines():void{ _sources = []; _sourcesCache = []; _sourcesEngine = []; } public function get ignoredReferralsCount():int{ return (_ignoredReferrals.length); } public function addIgnoredReferral(_arg1:String):void{ if (_ignoredReferralsCache[_arg1] == undefined){ _ignoredReferrals.push(_arg1); _ignoredReferralsCache[_arg1] = (_ignoredReferrals.length - 1); } else { if (throwErrors){ throw (new Error((("\"" + _arg1) + "\" already exists, we don't add it."))); }; }; } public function clearIgnoredReferrals():void{ _ignoredReferrals = []; _ignoredReferralsCache = {}; } public function getReferrerByName(_arg1:String):OrganicReferrer{ var _local2:int; if (match(_arg1)){ _local2 = _sourcesEngine[_arg1][0]; return (_sources[_local2]); }; return (null); } public function addIgnoredKeyword(_arg1:String):void{ if (_ignoredKeywordsCache[_arg1] == undefined){ _ignoredKeywords.push(_arg1); _ignoredKeywordsCache[_arg1] = (_ignoredKeywords.length - 1); } else { if (throwErrors){ throw (new Error((("\"" + _arg1) + "\" already exists, we don't add it."))); }; }; } public function get sources():Array{ return (_sources); } public static function getKeywordValueFromPath(_arg1:String, _arg2:String):String{ var _local3:String; var _local4:Variables; if (_arg2.indexOf((_arg1 + "=")) > -1){ if (_arg2.charAt(0) == "?"){ _arg2 = _arg2.substr(1); }; _arg2 = _arg2.split("+").join("%20"); _local4 = new Variables(_arg2); _local3 = _local4[_arg1]; }; return (_local3); } } }//package com.google.analytics.core
Section 18
//OrganicReferrer (com.google.analytics.core.OrganicReferrer) package com.google.analytics.core { public class OrganicReferrer { private var _engine:String; private var _keyword:String; public function OrganicReferrer(_arg1:String, _arg2:String){ this.engine = _arg1; this.keyword = _arg2; } public function set engine(_arg1:String):void{ _engine = _arg1.toLowerCase(); } public function get keyword():String{ return (_keyword); } public function toString():String{ return (((engine + "?") + keyword)); } public function get engine():String{ return (_engine); } public function set keyword(_arg1:String):void{ _keyword = _arg1.toLowerCase(); } } }//package com.google.analytics.core
Section 19
//RequestObject (com.google.analytics.core.RequestObject) package com.google.analytics.core { import flash.net.*; import flash.utils.*; public class RequestObject { public var start:int; public var request:URLRequest; public var end:int; public function RequestObject(_arg1:URLRequest){ start = getTimer(); this.request = _arg1; } public function toString():String{ var _local1:Array; _local1 = []; _local1.push((("duration: " + duration) + "ms")); _local1.push(("url: " + request.url)); return ((("{ " + _local1.join(", ")) + " }")); } public function get duration():int{ if (!hasCompleted()){ return (0); }; return ((end - start)); } public function hasCompleted():Boolean{ return ((end > 0)); } public function complete():void{ end = getTimer(); } } }//package com.google.analytics.core
Section 20
//ServerOperationMode (com.google.analytics.core.ServerOperationMode) package com.google.analytics.core { public class ServerOperationMode { private var _value:int; private var _name:String; public static const both:ServerOperationMode = new ServerOperationMode(2, "both"); ; public static const remote:ServerOperationMode = new ServerOperationMode(1, "remote"); ; public static const local:ServerOperationMode = new ServerOperationMode(0, "local"); ; public function ServerOperationMode(_arg1:int=0, _arg2:String=""){ _value = _arg1; _name = _arg2; } public function valueOf():int{ return (_value); } public function toString():String{ return (_name); } } }//package com.google.analytics.core
Section 21
//TrackerCache (com.google.analytics.core.TrackerCache) package com.google.analytics.core { import com.google.analytics.v4.*; import flash.errors.*; public class TrackerCache implements GoogleAnalyticsAPI { public var tracker:GoogleAnalyticsAPI; private var _ar:Array; public static var CACHE_THROW_ERROR:Boolean; public function TrackerCache(_arg1:GoogleAnalyticsAPI=null){ this.tracker = _arg1; _ar = []; } public function size():uint{ return (_ar.length); } public function flush():void{ var _local1:Object; var _local2:String; var _local3:Array; var _local4:int; var _local5:int; if (tracker == null){ return; }; if (size() > 0){ _local4 = _ar.length; while (_local5 < _local4) { _local1 = _ar.shift(); _local2 = (_local1.name as String); _local3 = (_local1.args as Array); if (((!((_local2 == null))) && ((_local2 in tracker)))){ (tracker[_local2] as Function).apply(tracker, _local3); }; _local5++; }; }; } public function enqueue(_arg1:String, ... _args):Boolean{ if (_arg1 == null){ return (false); }; _ar.push({name:_arg1, args:_args}); return (true); } public function link(_arg1:String, _arg2:Boolean=false):void{ enqueue("link", _arg1, _arg2); } public function addOrganic(_arg1:String, _arg2:String):void{ enqueue("addOrganic", _arg1, _arg2); } public function setAllowLinker(_arg1:Boolean):void{ enqueue("setAllowLinker", _arg1); } public function trackEvent(_arg1:String, _arg2:String, _arg3:String=null, _arg4:Number=NaN):Boolean{ enqueue("trackEvent", _arg1, _arg2, _arg3, _arg4); return (true); } public function getClientInfo():Boolean{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getClientInfo' method for the moment.")); }; return (false); } public function trackTrans():void{ enqueue("trackTrans"); } public function trackPageview(_arg1:String=""):void{ enqueue("trackPageview", _arg1); } public function setClientInfo(_arg1:Boolean):void{ enqueue("setClientInfo", _arg1); } public function linkByPost(_arg1:Object, _arg2:Boolean=false):void{ enqueue("linkByPost", _arg1, _arg2); } public function setCookieTimeout(_arg1:int):void{ enqueue("setCookieTimeout", _arg1); } public function isEmpty():Boolean{ return ((_ar.length == 0)); } public function getDetectTitle():Boolean{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getDetectTitle' method for the moment.")); }; return (false); } public function resetSession():void{ enqueue("resetSession"); } public function setDetectFlash(_arg1:Boolean):void{ enqueue("setDetectFlash", _arg1); } public function clear():void{ _ar = []; } public function setCampNameKey(_arg1:String):void{ enqueue("setCampNameKey", _arg1); } public function addItem(_arg1:String, _arg2:String, _arg3:String, _arg4:String, _arg5:Number, _arg6:int):void{ enqueue("addItem", _arg1, _arg2, _arg3, _arg4, _arg5, _arg6); } public function createEventTracker(_arg1:String):EventTracker{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'createEventTracker' method for the moment.")); }; return (null); } public function setVar(_arg1:String):void{ enqueue("setVar", _arg1); } public function clearIgnoredOrganic():void{ enqueue("clearIgnoredOrganic"); } public function setDomainName(_arg1:String):void{ enqueue("setDomainName", _arg1); } public function setCampSourceKey(_arg1:String):void{ enqueue("setCampSourceKey", _arg1); } public function addTrans(_arg1:String, _arg2:String, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:String, _arg7:String, _arg8:String):Object{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'addTrans' method for the moment.")); }; return (null); } public function setCampContentKey(_arg1:String):void{ enqueue("setCampContentKey", _arg1); } public function setLocalServerMode():void{ enqueue("setLocalServerMode"); } public function getLocalGifPath():String{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getLocalGifPath' method for the moment.")); }; return (""); } public function setAllowAnchor(_arg1:Boolean):void{ enqueue("setAllowAnchor", _arg1); } public function clearIgnoredRef():void{ enqueue("clearIgnoredRef"); } public function setLocalGifPath(_arg1:String):void{ enqueue("setLocalGifPath", _arg1); } public function getVersion():String{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getVersion' method for the moment.")); }; return (""); } public function setCookiePath(_arg1:String):void{ enqueue("setCookiePath", _arg1); } public function setSampleRate(_arg1:Number):void{ enqueue("setSampleRate", _arg1); } public function setDetectTitle(_arg1:Boolean):void{ enqueue("setDetectTitle", _arg1); } public function setAllowHash(_arg1:Boolean):void{ enqueue("setAllowHash", _arg1); } public function addIgnoredOrganic(_arg1:String):void{ enqueue("addIgnoredOrganic", _arg1); } public function setCampNOKey(_arg1:String):void{ enqueue("setCampNOKey", _arg1); } public function getServiceMode():ServerOperationMode{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getServiceMode' method for the moment.")); }; return (null); } public function setLocalRemoteServerMode():void{ enqueue("setLocalRemoteServerMode"); } public function cookiePathCopy(_arg1:String):void{ enqueue("cookiePathCopy", _arg1); } public function getDetectFlash():Boolean{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getDetectFlash' method for the moment.")); }; return (false); } public function setCampaignTrack(_arg1:Boolean):void{ enqueue("setCampaignTrack", _arg1); } public function clearOrganic():void{ enqueue("clearOrganic"); } public function setCampTermKey(_arg1:String):void{ enqueue("setCampTermKey", _arg1); } public function addIgnoredRef(_arg1:String):void{ enqueue("addIgnoredRef", _arg1); } public function setCampMediumKey(_arg1:String):void{ enqueue("setCampMediumKey", _arg1); } public function setSessionTimeout(_arg1:int):void{ enqueue("setSessionTimeout", _arg1); } public function setRemoteServerMode():void{ enqueue("setRemoteServerMode"); } public function element(){ return (_ar[0]); } public function getAccount():String{ if (CACHE_THROW_ERROR){ throw (new IllegalOperationError("The tracker is not ready and you can use the 'getAccount' method for the moment.")); }; return (""); } } }//package com.google.analytics.core
Section 22
//TrackerMode (com.google.analytics.core.TrackerMode) package com.google.analytics.core { public class TrackerMode { public static const BRIDGE:String = "Bridge"; public static const AS3:String = "AS3"; } }//package com.google.analytics.core
Section 23
//Utils (com.google.analytics.core.Utils) package com.google.analytics.core { public class Utils { public static function trim(_arg1:String, _arg2:Boolean=false):String{ var _local3:Array; var _local4:String; var _local5:int; var _local6:int; var _local7:int; if (_arg1 == ""){ return (""); }; _local3 = [" ", "\n", "\r", "\t"]; _local4 = _arg1; if (_arg2){ _local5 = 0; while ((((_local5 < _local3.length)) && ((_local4.indexOf(_local3[_local5]) > -1)))) { _local4 = _local4.split(_local3[_local5]).join(""); _local5++; }; } else { _local6 = 0; while ((((_local6 < _local4.length)) && ((_local3.indexOf(_local4.charAt(_local6)) > -1)))) { _local6++; }; _local4 = _local4.substr(_local6); _local7 = (_local4.length - 1); while ((((_local7 >= 0)) && ((_local3.indexOf(_local4.charAt(_local7)) > -1)))) { _local7--; }; _local4 = _local4.substring(0, (_local7 + 1)); }; return (_local4); } public static function generateHash(_arg1:String):int{ var _local2:int; var _local3:int; var _local4:int; var _local5:int; _local2 = 1; _local3 = 0; if (((!((_arg1 == null))) && (!((_arg1 == ""))))){ _local2 = 0; _local4 = (_arg1.length - 1); while (_local4 >= 0) { _local5 = _arg1.charCodeAt(_local4); _local2 = ((((_local2 << 6) & 268435455) + _local5) + (_local5 << 14)); _local3 = (_local2 & 266338304); if (_local3 != 0){ _local2 = (_local2 ^ (_local3 >> 21)); }; _local4--; }; }; return (_local2); } public static function generate32bitRandom():int{ return (Math.round((Math.random() * 2147483647))); } public static function validateAccount(_arg1:String):Boolean{ var _local2:RegExp; _local2 = /^UA-[0-9]*-[0-9]*$/; return (_local2.test(_arg1)); } } }//package com.google.analytics.core
Section 24
//Cookie (com.google.analytics.data.Cookie) package com.google.analytics.data { public interface Cookie { function fromSharedObject(_arg1:Object):void; function toURLString():String; function get creation():Date; function toSharedObject():Object; function isExpired():Boolean; function set creation(_arg1:Date):void; function set expiration(_arg1:Date):void; function get expiration():Date; } }//package com.google.analytics.data
Section 25
//UTMA (com.google.analytics.data.UTMA) package com.google.analytics.data { import com.google.analytics.utils.*; public class UTMA extends UTMCookie { private var _sessionId:Number; private var _domainHash:Number; private var _firstTime:Number; private var _currentTime:Number; private var _lastTime:Number; private var _sessionCount:Number; public function UTMA(_arg1:Number=NaN, _arg2:Number=NaN, _arg3:Number=NaN, _arg4:Number=NaN, _arg5:Number=NaN, _arg6:Number=NaN){ super("utma", "__utma", ["domainHash", "sessionId", "firstTime", "lastTime", "currentTime", "sessionCount"], (Timespan.twoyears * 1000)); this.domainHash = _arg1; this.sessionId = _arg2; this.firstTime = _arg3; this.lastTime = _arg4; this.currentTime = _arg5; this.sessionCount = _arg6; } public function get lastTime():Number{ return (_lastTime); } public function set lastTime(_arg1:Number):void{ _lastTime = _arg1; update(); } public function set currentTime(_arg1:Number):void{ _currentTime = _arg1; update(); } public function get sessionId():Number{ return (_sessionId); } public function get sessionCount():Number{ return (_sessionCount); } public function get firstTime():Number{ return (_firstTime); } public function get currentTime():Number{ return (_currentTime); } public function set domainHash(_arg1:Number):void{ _domainHash = _arg1; update(); } public function set sessionId(_arg1:Number):void{ _sessionId = _arg1; update(); } public function set sessionCount(_arg1:Number):void{ _sessionCount = _arg1; update(); } public function get domainHash():Number{ return (_domainHash); } public function set firstTime(_arg1:Number):void{ _firstTime = _arg1; update(); } } }//package com.google.analytics.data
Section 26
//UTMB (com.google.analytics.data.UTMB) package com.google.analytics.data { import com.google.analytics.utils.*; public class UTMB extends UTMCookie { private var _trackCount:Number; private var _lastTime:Number; private var _domainHash:Number; private var _token:Number; public static var defaultTimespan:Number = Timespan.thirtyminutes; public function UTMB(_arg1:Number=NaN, _arg2:Number=NaN, _arg3:Number=NaN, _arg4:Number=NaN){ super("utmb", "__utmb", ["domainHash", "trackCount", "token", "lastTime"], (defaultTimespan * 1000)); this.domainHash = _arg1; this.trackCount = _arg2; this.token = _arg3; this.lastTime = _arg4; } public function set token(_arg1:Number):void{ _token = _arg1; update(); } public function set trackCount(_arg1:Number):void{ _trackCount = _arg1; update(); } public function get lastTime():Number{ return (_lastTime); } public function set domainHash(_arg1:Number):void{ _domainHash = _arg1; update(); } public function set lastTime(_arg1:Number):void{ _lastTime = _arg1; update(); } public function get domainHash():Number{ return (_domainHash); } public function get token():Number{ return (_token); } public function get trackCount():Number{ return (_trackCount); } } }//package com.google.analytics.data
Section 27
//UTMC (com.google.analytics.data.UTMC) package com.google.analytics.data { public class UTMC extends UTMCookie { private var _domainHash:Number; public function UTMC(_arg1:Number=NaN){ super("utmc", "__utmc", ["domainHash"]); this.domainHash = _arg1; } public function set domainHash(_arg1:Number):void{ _domainHash = _arg1; update(); } public function get domainHash():Number{ return (_domainHash); } } }//package com.google.analytics.data
Section 28
//UTMCookie (com.google.analytics.data.UTMCookie) package com.google.analytics.data { import com.google.analytics.core.*; public class UTMCookie implements Cookie { protected var inURL:String; protected var name:String; private var _creation:Date; private var _expiration:Date; public var proxy:Buffer; private var _timespan:Number; protected var fields:Array; public function UTMCookie(_arg1:String, _arg2:String, _arg3:Array, _arg4:Number=0){ this.name = _arg1; this.inURL = _arg2; this.fields = _arg3; _timestamp(_arg4); } public function isEmpty():Boolean{ var _local1:int; var _local2:String; var _local3:int; _local1 = 0; _local3 = 0; while (_local3 < fields.length) { _local2 = fields[_local3]; if ((((this[_local2] is Number)) && (isNaN(this[_local2])))){ _local1++; } else { if ((((this[_local2] is String)) && ((this[_local2] == "")))){ _local1++; }; }; _local3++; }; if (_local1 == fields.length){ return (true); }; return (false); } protected function update():void{ resetTimestamp(); if (proxy){ proxy.update(name, toSharedObject()); }; } public function fromSharedObject(_arg1:Object):void{ var _local2:String; var _local3:int; var _local4:int; _local3 = fields.length; _local4 = 0; while (_local4 < _local3) { _local2 = fields[_local4]; if (_arg1[_local2]){ this[_local2] = _arg1[_local2]; }; _local4++; }; if (_arg1.creation){ this.creation = _arg1.creation; }; if (_arg1.expiration){ this.expiration = _arg1.expiration; }; } private function _timestamp(_arg1:Number):void{ creation = new Date(); _timespan = _arg1; if (_arg1 > 0){ expiration = new Date((creation.valueOf() + _arg1)); }; } public function isExpired():Boolean{ var _local1:Date; var _local2:Number; _local1 = new Date(); _local2 = (expiration.valueOf() - _local1.valueOf()); if (_local2 <= 0){ return (true); }; return (false); } public function set expiration(_arg1:Date):void{ _expiration = _arg1; } public function get creation():Date{ return (_creation); } public function reset():void{ var _local1:String; var _local2:int; _local2 = 0; while (_local2 < fields.length) { _local1 = fields[_local2]; if ((this[_local1] is Number)){ this[_local1] = NaN; } else { if ((this[_local1] is String)){ this[_local1] = ""; }; }; _local2++; }; resetTimestamp(); update(); } public function valueOf():String{ var _local1:Array; var _local2:String; var _local3:*; var _local4:int; _local1 = []; _local4 = 0; while (_local4 < fields.length) { _local2 = fields[_local4]; _local3 = this[_local2]; if ((_local3 is String)){ if (_local3 == ""){ _local3 = "-"; _local1.push(_local3); } else { _local1.push(_local3); }; } else { if ((_local3 is Number)){ if (_local3 == 0){ _local1.push(_local3); } else { if (isNaN(_local3)){ _local3 = "-"; _local1.push(_local3); } else { _local1.push(_local3); }; }; }; }; _local4++; }; return (("" + _local1.join("."))); } public function resetTimestamp(_arg1:Number=NaN):void{ if (!isNaN(_arg1)){ _timespan = _arg1; }; _creation = null; _expiration = null; _timestamp(_timespan); } public function get expiration():Date{ if (_expiration){ return (_expiration); }; return (new Date((new Date().valueOf() + 1000))); } public function toURLString():String{ return (((inURL + "=") + valueOf())); } public function toSharedObject():Object{ var _local1:Object; var _local2:String; var _local3:*; var _local4:int; _local1 = {}; _local4 = 0; for (;_local4 < fields.length;_local4++) { _local2 = fields[_local4]; _local3 = this[_local2]; if ((_local3 is String)){ _local1[_local2] = _local3; } else { if (_local3 == 0){ _local1[_local2] = _local3; } else { if (isNaN(_local3)){ continue; } else { _local1[_local2] = _local3; }; }; }; }; _local1.creation = creation; _local1.expiration = expiration; return (_local1); } public function toString(_arg1:Boolean=false):String{ var _local2:Array; var _local3:String; var _local4:*; var _local5:int; var _local6:int; var _local7:String; _local2 = []; _local5 = fields.length; _local6 = 0; for (;_local6 < _local5;_local6++) { _local3 = fields[_local6]; _local4 = this[_local3]; if ((_local4 is String)){ _local2.push((((_local3 + ": \"") + _local4) + "\"")); } else { if (_local4 == 0){ _local2.push(((_local3 + ": ") + _local4)); } else { if (isNaN(_local4)){ continue; } else { _local2.push(((_local3 + ": ") + _local4)); }; }; }; }; _local7 = (((name.toUpperCase() + " {") + _local2.join(", ")) + "}"); if (_arg1){ _local7 = (_local7 + (((" creation:" + creation) + ", expiration:") + expiration)); }; return (_local7); } public function set creation(_arg1:Date):void{ _creation = _arg1; } } }//package com.google.analytics.data
Section 29
//UTMK (com.google.analytics.data.UTMK) package com.google.analytics.data { public class UTMK extends UTMCookie { private var _hash:Number; public function UTMK(_arg1:Number=NaN){ super("utmk", "__utmk", ["hash"]); this.hash = _arg1; } public function set hash(_arg1:Number):void{ _hash = _arg1; update(); } public function get hash():Number{ return (_hash); } } }//package com.google.analytics.data
Section 30
//UTMV (com.google.analytics.data.UTMV) package com.google.analytics.data { import com.google.analytics.utils.*; public class UTMV extends UTMCookie { private var _domainHash:Number; private var _value:String; public function UTMV(_arg1:Number=NaN, _arg2:String=""){ super("utmv", "__utmv", ["domainHash", "value"], (Timespan.twoyears * 1000)); this.domainHash = _arg1; this.value = _arg2; } override public function toURLString():String{ return (((inURL + "=") + encodeURI(valueOf()))); } public function get value():String{ return (_value); } public function get domainHash():Number{ return (_domainHash); } public function set domainHash(_arg1:Number):void{ _domainHash = _arg1; update(); } public function set value(_arg1:String):void{ _value = _arg1; update(); } } }//package com.google.analytics.data
Section 31
//UTMZ (com.google.analytics.data.UTMZ) package com.google.analytics.data { import com.google.analytics.utils.*; public class UTMZ extends UTMCookie { private var _campaignTracking:String; private var _campaignCreation:Number; private var _responseCount:Number; private var _domainHash:Number; private var _campaignSessions:Number; public static var defaultTimespan:Number = Timespan.sixmonths; public function UTMZ(_arg1:Number=NaN, _arg2:Number=NaN, _arg3:Number=NaN, _arg4:Number=NaN, _arg5:String=""){ super("utmz", "__utmz", ["domainHash", "campaignCreation", "campaignSessions", "responseCount", "campaignTracking"], (defaultTimespan * 1000)); this.domainHash = _arg1; this.campaignCreation = _arg2; this.campaignSessions = _arg3; this.responseCount = _arg4; this.campaignTracking = _arg5; } public function set responseCount(_arg1:Number):void{ _responseCount = _arg1; update(); } public function set domainHash(_arg1:Number):void{ _domainHash = _arg1; update(); } public function set campaignCreation(_arg1:Number):void{ _campaignCreation = _arg1; update(); } public function get campaignTracking():String{ return (_campaignTracking); } public function get campaignSessions():Number{ return (_campaignSessions); } public function get domainHash():Number{ return (_domainHash); } public function get responseCount():Number{ return (_responseCount); } public function get campaignCreation():Number{ return (_campaignCreation); } public function set campaignSessions(_arg1:Number):void{ _campaignSessions = _arg1; update(); } public function set campaignTracking(_arg1:String):void{ _campaignTracking = _arg1; update(); } } }//package com.google.analytics.data
Section 32
//X10 (com.google.analytics.data.X10) package com.google.analytics.data { public class X10 { private var _delimEnd:String;// = ")" private var _delimSet:String;// = "*" private var _escapeChar:String;// = "'" private var _delimBegin:String;// = "(" private var _delimNumValue:String;// = "!" private var _key:String;// = "k" private var _set:Array; private var _projectData:Object; private var _hasData:int; private var _escapeCharMap:Object; private var _minimum:int; private var _value:String;// = "v" public function X10(){ _key = "k"; _value = "v"; _set = [_key, _value]; _delimBegin = "("; _delimEnd = ")"; _delimSet = "*"; _delimNumValue = "!"; _escapeChar = "'"; super(); _projectData = {}; _escapeCharMap = {}; _escapeCharMap[_escapeChar] = "'0"; _escapeCharMap[_delimEnd] = "'1"; _escapeCharMap[_delimSet] = "'2"; _escapeCharMap[_delimNumValue] = "'3"; _minimum = 1; } private function _clearInternal(_arg1:Number, _arg2:String):void{ var _local3:Boolean; var _local4:int; var _local5:int; if (((hasProject(_arg1)) && (!((_projectData[_arg1][_arg2] == undefined))))){ _projectData[_arg1][_arg2] = undefined; _local3 = true; _local5 = _set.length; _local4 = 0; while (_local4 < _local5) { if (_projectData[_arg1][_set[_local4]] != undefined){ _local3 = false; break; }; _local4++; }; if (_local3){ _projectData[_arg1] = undefined; _hasData = (_hasData - 1); }; }; } public function hasData():Boolean{ return ((_hasData > 0)); } private function _setInternal(_arg1:Number, _arg2:String, _arg3:Number, _arg4:String):void{ if (!hasProject(_arg1)){ _projectData[_arg1] = {}; }; if (_projectData[_arg1][_arg2] == undefined){ _projectData[_arg1][_arg2] = []; }; _projectData[_arg1][_arg2][_arg3] = _arg4; _hasData = (_hasData + 1); } public function hasProject(_arg1:Number):Boolean{ return (_projectData[_arg1]); } public function clearKey(_arg1:Number):void{ _clearInternal(_arg1, _key); } private function _renderDataType(_arg1:Array):String{ var _local2:Array; var _local3:String; var _local4:int; _local2 = []; _local4 = 0; while (_local4 < _arg1.length) { if (_arg1[_local4] != undefined){ _local3 = ""; if (((!((_local4 == _minimum))) && ((_arg1[(_local4 - 1)] == undefined)))){ _local3 = (_local3 + _local4.toString()); _local3 = (_local3 + _delimNumValue); }; _local3 = (_local3 + _escapeExtensibleValue(_arg1[_local4])); _local2.push(_local3); }; _local4++; }; return (((_delimBegin + _local2.join(_delimSet)) + _delimEnd)); } public function getKey(_arg1:Number, _arg2:Number):String{ return ((_getInternal(_arg1, _key, _arg2) as String)); } public function clearValue(_arg1:Number):void{ _clearInternal(_arg1, _value); } public function renderMergedUrlString(_arg1:X10=null):String{ var _local2:Array; var _local3:String; if (!_arg1){ return (renderUrlString()); }; _local2 = [_arg1.renderUrlString()]; for (_local3 in _projectData) { if (((hasProject(Number(_local3))) && (!(_arg1.hasProject(Number(_local3)))))){ _local2.push((_local3 + _renderProject(_projectData[_local3]))); }; }; return (_local2.join("")); } public function setValue(_arg1:Number, _arg2:Number, _arg3:Number):Boolean{ if (((((!((Math.round(_arg3) == _arg3))) || (isNaN(_arg3)))) || ((_arg3 == Infinity)))){ return (false); }; _setInternal(_arg1, _value, _arg2, _arg3.toString()); return (true); } public function renderUrlString():String{ var _local1:Array; var _local2:String; _local1 = []; for (_local2 in _projectData) { if (hasProject(Number(_local2))){ _local1.push((_local2 + _renderProject(_projectData[_local2]))); }; }; return (_local1.join("")); } private function _getInternal(_arg1:Number, _arg2:String, _arg3:Number):Object{ if (((hasProject(_arg1)) && (!((_projectData[_arg1][_arg2] == undefined))))){ return (_projectData[_arg1][_arg2][_arg3]); }; return (undefined); } public function setKey(_arg1:Number, _arg2:Number, _arg3:String):Boolean{ _setInternal(_arg1, _key, _arg2, _arg3); return (true); } public function getValue(_arg1:Number, _arg2:Number){ var _local3:*; _local3 = _getInternal(_arg1, _value, _arg2); if (_local3 == null){ return (null); }; return (Number(_local3)); } private function _renderProject(_arg1:Object):String{ var _local2:String; var _local3:Boolean; var _local4:int; var _local5:Array; var _local6:int; _local2 = ""; _local3 = false; _local6 = _set.length; _local4 = 0; while (_local4 < _local6) { _local5 = _arg1[_set[_local4]]; if (_local5){ if (_local3){ _local2 = (_local2 + _set[_local4]); }; _local2 = (_local2 + _renderDataType(_local5)); _local3 = false; } else { _local3 = true; }; _local4++; }; return (_local2); } private function _escapeExtensibleValue(_arg1:String):String{ var _local2:String; var _local3:int; var _local4:String; var _local5:String; _local2 = ""; _local3 = 0; while (_local3 < _arg1.length) { _local4 = _arg1.charAt(_local3); _local5 = _escapeCharMap[_local4]; if (_local5){ _local2 = (_local2 + _local5); } else { _local2 = (_local2 + _local4); }; _local3++; }; return (_local2); } } }//package com.google.analytics.data
Section 33
//_Style (com.google.analytics.debug._Style) package com.google.analytics.debug { import flash.net.*; import flash.text.*; public class _Style { public var borderColor:uint; public var backgroundColor:uint; private var _sheet:StyleSheet; public var roundedCorner:uint; public var alertColor:uint; public var infoColor:uint; public var successColor:uint; private var _loader:URLLoader; public var failureColor:uint; private var _defaultSheet:String; public var warningColor:uint; public function _Style(){ _sheet = new StyleSheet(); _loader = new URLLoader(); _init(); } private function _parseSheet(_arg1:String):void{ _sheet.parseCSS(_arg1); } public function get sheet():StyleSheet{ return (_sheet); } private function _init():void{ _defaultSheet = ""; _defaultSheet = (_defaultSheet + "a{text-decoration: underline;}\n"); _defaultSheet = (_defaultSheet + ".uiLabel{color: #000000;font-family: Arial;font-size: 12;margin-left: 2;margin-right: 2;}\n"); _defaultSheet = (_defaultSheet + ".uiWarning{color: #ffffff;font-family: Arial;font-size: 14;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + ".uiAlert{color: #ffffff;font-family: Arial;font-size: 14;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + ".uiInfo{color: #000000;font-family: Arial;font-size: 14;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + ".uiSuccess{color: #ffffff;font-family: Arial;font-size: 12;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + ".uiFailure{color: #ffffff;font-family: Arial;font-size: 12;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + ".uiAlertAction{color: #ffffff;text-align: center;font-family: Arial;font-size: 12;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + ".uiAlertTitle{color: #ffffff;font-family: Arial;font-size: 16;font-weight: bold;margin-left: 6;margin-right: 6;}\n"); _defaultSheet = (_defaultSheet + "\n"); roundedCorner = 6; backgroundColor = 0xCCCCCC; borderColor = 0x555555; infoColor = 16777113; alertColor = 0xFFCC00; warningColor = 0xCC0000; successColor = 0xFF00; failureColor = 0xFF0000; _parseSheet(_defaultSheet); } } }//package com.google.analytics.debug
Section 34
//Alert (com.google.analytics.debug.Alert) package com.google.analytics.debug { import flash.events.*; public class Alert extends Label { public var actionOnNextLine:Boolean;// = true public var autoClose:Boolean;// = true private var _actions:Array; public function Alert(_arg1:String, _arg2:Array, _arg3:String="uiAlert", _arg4:uint=0, _arg5:Align=null, _arg6:Boolean=false, _arg7:Boolean=true){ var _local8:int; autoClose = true; actionOnNextLine = true; if (_arg4 == 0){ _arg4 = Style.alertColor; }; if (_arg5 == null){ _arg5 = Align.center; }; super(_arg1, _arg3, _arg4, _arg5, _arg6); this.selectable = true; super.mouseChildren = true; this.buttonMode = true; this.mouseEnabled = true; this.useHandCursor = true; this.actionOnNextLine = _arg7; _actions = []; _local8 = 0; while (_local8 < _arg2.length) { _arg2[_local8].container = this; _actions.push(_arg2[_local8]); _local8++; }; } protected function getAction(_arg1:String):AlertAction{ var _local2:int; _local2 = 0; while (_local2 < _actions.length) { if (_arg1 == _actions[_local2].activator){ return (_actions[_local2]); }; _local2++; }; return (null); } override protected function layout():void{ super.layout(); _defineActions(); } protected function spaces(_arg1:int):String{ var _local2:String; var _local3:String; var _local4:int; _local2 = ""; _local3 = " "; _local4 = 0; while (_local4 < (_arg1 + 1)) { _local2 = (_local2 + _local3); _local4++; }; return (_local2); } override public function onLink(_arg1:TextEvent):void{ var _local2:AlertAction; if (isValidAction(_arg1.text)){ _local2 = getAction(_arg1.text); if (_local2){ _local2.execute(); }; }; if (autoClose){ close(); }; } protected function isValidAction(_arg1:String):Boolean{ var _local2:int; _local2 = 0; while (_local2 < _actions.length) { if (_arg1 == _actions[_local2].activator){ return (true); }; _local2++; }; return (false); } private function _defineActions():void{ var _local1:String; var _local2:Array; var _local3:AlertAction; var _local4:int; _local1 = ""; if (actionOnNextLine){ _local1 = (_local1 + "\n"); } else { _local1 = (_local1 + " |"); }; _local1 = (_local1 + " "); _local2 = []; _local4 = 0; while (_local4 < _actions.length) { _local3 = _actions[_local4]; _local2.push((((("<a href=\"event:" + _local3.activator) + "\">") + _local3.name) + "</a>")); _local4++; }; _local1 = (_local1 + _local2.join(" | ")); appendText(_local1, "uiAlertAction"); } public function close():void{ if (parent != null){ parent.removeChild(this); }; } } }//package com.google.analytics.debug
Section 35
//AlertAction (com.google.analytics.debug.AlertAction) package com.google.analytics.debug { public class AlertAction { public var container:Alert; private var _callback; public var name:String; public var activator:String; public function AlertAction(_arg1:String, _arg2:String, _arg3){ this.name = _arg1; this.activator = _arg2; _callback = _arg3; } public function execute():void{ if (_callback){ if ((_callback is Function)){ (_callback as Function)(); } else { if ((_callback is String)){ var _local1 = container; _local1[_callback](); }; }; }; } } }//package com.google.analytics.debug
Section 36
//Align (com.google.analytics.debug.Align) package com.google.analytics.debug { public class Align { private var _value:int; private var _name:String; public static const bottomRight:Align = new Align(18, "bottomRight"); ; public static const right:Align = new Align(16, "right"); ; public static const left:Align = new Align(32, "left"); ; public static const topRight:Align = new Align(17, "topRight"); ; public static const bottom:Align = new Align(2, "bottom"); ; public static const bottomLeft:Align = new Align(34, "bottomLeft"); ; public static const topLeft:Align = new Align(33, "topLeft"); ; public static const center:Align = new Align(0x0100, "center"); ; public static const none:Align = new Align(0, "none"); ; public static const top:Align = new Align(1, "top"); ; public function Align(_arg1:int=0, _arg2:String=""){ _value = _arg1; _name = _arg2; } public function valueOf():int{ return (_value); } public function toString():String{ return (_name); } } }//package com.google.analytics.debug
Section 37
//Background (com.google.analytics.debug.Background) package com.google.analytics.debug { import flash.display.*; public class Background { public static function drawRounded(_arg1, _arg2:Graphics, _arg3:uint=0, _arg4:uint=0):void{ var _local5:uint; var _local6:uint; var _local7:uint; _local7 = Style.roundedCorner; if ((((_arg3 > 0)) && ((_arg4 > 0)))){ _local5 = _arg3; _local6 = _arg4; } else { _local5 = _arg1.width; _local6 = _arg1.height; }; if (((_arg1.stickToEdge) && (!((_arg1.alignement == Align.none))))){ switch (_arg1.alignement){ case Align.top: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, 0, 0, _local7, _local7); break; case Align.topLeft: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, 0, 0, 0, _local7); break; case Align.topRight: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, 0, 0, _local7, 0); break; case Align.bottom: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, _local7, _local7, 0, 0); break; case Align.bottomLeft: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, 0, _local7, 0, 0); break; case Align.bottomRight: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, _local7, 0, 0, 0); break; case Align.left: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, 0, _local7, 0, _local7); break; case Align.right: _arg2.drawRoundRectComplex(0, 0, _local5, _local6, _local7, 0, _local7, 0); break; case Align.center: _arg2.drawRoundRect(0, 0, _local5, _local6, _local7, _local7); break; }; } else { _arg2.drawRoundRect(0, 0, _local5, _local6, _local7, _local7); }; } } }//package com.google.analytics.debug
Section 38
//Debug (com.google.analytics.debug.Debug) package com.google.analytics.debug { import flash.events.*; import flash.ui.*; public class Debug extends Label { private var _lines:Array; private var _preferredForcedWidth:uint;// = 540 private var _linediff:int;// = 0 public var maxLines:uint;// = 16 public static var count:uint = 0; public function Debug(_arg1:uint=0, _arg2:Align=null, _arg3:Boolean=false){ if (_arg2 == null){ _arg2 = Align.bottom; }; super("", "uiLabel", _arg1, _arg2, _arg3); this.name = ("Debug" + count++); _lines = []; selectable = true; addEventListener(KeyboardEvent.KEY_DOWN, onKey); } public function writeBold(_arg1:String):void{ write(_arg1, true); } private function _getLinesToDisplay(_arg1:int=0):Array{ var _local2:Array; var _local3:uint; var _local4:uint; if ((_lines.length - 1) > maxLines){ if ((_linediff <= 0)){ _linediff = (_linediff + _arg1); } else { if ((((_linediff > 0)) && ((_arg1 < 0)))){ _linediff = (_linediff + _arg1); }; }; _local3 = ((_lines.length - maxLines) + _linediff); _local4 = (_local3 + maxLines); _local2 = _lines.slice(_local3, _local4); } else { _local2 = _lines; }; return (_local2); } private function onKey(_arg1:KeyboardEvent=null):void{ var _local2:Array; switch (_arg1.keyCode){ case Keyboard.DOWN: _local2 = _getLinesToDisplay(1); break; case Keyboard.UP: _local2 = _getLinesToDisplay(-1); break; default: _local2 = null; }; if (_local2 == null){ return; }; text = _local2.join("\n"); } override public function get forcedWidth():uint{ if (this.parent){ if (UISprite(this.parent).forcedWidth > _preferredForcedWidth){ return (_preferredForcedWidth); }; return (UISprite(this.parent).forcedWidth); //unresolved jump }; return (super.forcedWidth); } public function write(_arg1:String, _arg2:Boolean=false):void{ var _local3:Array; if (_arg1.indexOf("") > -1){ _local3 = _arg1.split("\n"); } else { _local3 = [_arg1]; }; var _local4 = ""; var _local5 = ""; if (_arg2){ _local4 = "<b>"; _local5 = "</b>"; }; var _local6:int; while (_local6 < _local3.length) { _lines.push(((_local4 + _local3[_local6]) + _local5)); _local6++; }; var _local7:Array = _getLinesToDisplay(); text = _local7.join("\n"); } public function close():void{ dispose(); } override protected function dispose():void{ removeEventListener(KeyboardEvent.KEY_DOWN, onKey); super.dispose(); } } }//package com.google.analytics.debug
Section 39
//DebugConfiguration (com.google.analytics.debug.DebugConfiguration) package com.google.analytics.debug { import com.google.analytics.core.*; import flash.net.*; import flash.utils.*; import flash.ui.*; public class DebugConfiguration { public var showHideKey:Number; private var _mode:VisualDebugMode; private var _verbose:Boolean;// = false public var destroyKey:Number; public var GIFRequests:Boolean;// = false public var showInfos:Boolean;// = true public var infoTimeout:Number;// = 1000 public var minimizedOnStart:Boolean;// = false private var _active:Boolean;// = false public var traceOutput:Boolean;// = false public var layout:ILayout; public var warningTimeout:Number;// = 1500 public var javascript:Boolean;// = false public var showWarnings:Boolean;// = true private var _visualInitialized:Boolean;// = false public function DebugConfiguration(){ _mode = VisualDebugMode.basic; showHideKey = Keyboard.SPACE; destroyKey = Keyboard.BACKSPACE; super(); } public function get verbose():Boolean{ return (_verbose); } public function set verbose(_arg1:Boolean):void{ _verbose = _arg1; } public function set mode(_arg1):void{ if ((_arg1 is String)){ switch (_arg1){ case "geek": _arg1 = VisualDebugMode.geek; break; case "advanced": _arg1 = VisualDebugMode.advanced; break; case "basic": default: _arg1 = VisualDebugMode.basic; }; }; _mode = _arg1; } public function success(_arg1:String):void{ if (layout){ layout.createSuccessAlert(_arg1); }; if (traceOutput){ trace((("[+] " + _arg1) + " !!")); }; } public function get active():Boolean{ return (_active); } private function _initializeVisual():void{ if (layout){ layout.init(); _visualInitialized = true; }; } private function _destroyVisual():void{ if (((layout) && (_visualInitialized))){ layout.destroy(); }; } public function warning(_arg1:String, _arg2:VisualDebugMode=null):void{ if (_filter(_arg2)){ return; }; if (((layout) && (showWarnings))){ layout.createWarning(_arg1); }; if (traceOutput){ trace((("## " + _arg1) + " ##")); }; } private function _filter(_arg1:VisualDebugMode=null):Boolean{ return (((_arg1) && ((int(_arg1) >= int(this.mode))))); } public function failure(_arg1:String):void{ if (layout){ layout.createFailureAlert(_arg1); }; if (traceOutput){ trace((("[-] " + _arg1) + " !!")); }; } public function get mode(){ return (_mode); } public function set active(_arg1:Boolean):void{ _active = _arg1; if (_active){ _initializeVisual(); } else { _destroyVisual(); }; } protected function trace(_arg1:String):void{ var _local7:Array; var _local8:int; var _local2:Array = []; var _local3 = ""; var _local4 = ""; if (this.mode == VisualDebugMode.geek){ _local3 = (getTimer() + " - "); _local4 = (new Array(_local3.length).join(" ") + " "); }; if (_arg1.indexOf("\n") > -1){ _local7 = _arg1.split("\n"); _local8 = 0; while (_local8 < _local7.length) { if (_local7[_local8] == ""){ } else { if (_local8 == 0){ _local2.push((_local3 + _local7[_local8])); } else { _local2.push((_local4 + _local7[_local8])); }; }; _local8++; }; } else { _local2.push((_local3 + _arg1)); }; var _local5:int = _local2.length; var _local6:int; while (_local6 < _local5) { trace(_local2[_local6]); _local6++; }; } public function alert(_arg1:String):void{ if (layout){ layout.createAlert(_arg1); }; if (traceOutput){ trace((("!! " + _arg1) + " !!")); }; } public function info(_arg1:String, _arg2:VisualDebugMode=null):void{ if (_filter(_arg2)){ return; }; if (((layout) && (showInfos))){ layout.createInfo(_arg1); }; if (traceOutput){ trace(_arg1); }; } public function alertGifRequest(_arg1:String, _arg2:URLRequest, _arg3:GIFRequest):void{ if (layout){ layout.createGIFRequestAlert(_arg1, _arg2, _arg3); }; if (traceOutput){ trace(((">> " + _arg1) + " <<")); }; } } }//package com.google.analytics.debug
Section 40
//FailureAlert (com.google.analytics.debug.FailureAlert) package com.google.analytics.debug { public class FailureAlert extends Alert { public function FailureAlert(_arg1:DebugConfiguration, _arg2:String, _arg3:Array){ var _local4:Align; var _local5:Boolean; var _local6:Boolean; _local4 = Align.bottomLeft; _local5 = true; _local6 = false; if (_arg1.verbose){ _arg2 = ((("<u><span class=\"uiAlertTitle\">Failure</span>" + spaces(18)) + "</u>\n\n") + _arg2); _local4 = Align.center; _local5 = false; _local6 = true; }; super(_arg2, _arg3, "uiFailure", Style.failureColor, _local4, _local5, _local6); } } }//package com.google.analytics.debug
Section 41
//GIFRequestAlert (com.google.analytics.debug.GIFRequestAlert) package com.google.analytics.debug { public class GIFRequestAlert extends Alert { public function GIFRequestAlert(_arg1:String, _arg2:Array){ super(_arg1, _arg2); } } }//package com.google.analytics.debug
Section 42
//ILayout (com.google.analytics.debug.ILayout) package com.google.analytics.debug { import com.google.analytics.core.*; import flash.net.*; import flash.display.*; public interface ILayout { function createWarning(_arg1:String):void; function addToStage(_arg1:DisplayObject):void; function createGIFRequestAlert(_arg1:String, _arg2:URLRequest, _arg3:GIFRequest):void; function createPanel(_arg1:String, _arg2:uint, _arg3:uint):void; function createInfo(_arg1:String):void; function createFailureAlert(_arg1:String):void; function addToPanel(_arg1:String, _arg2:DisplayObject):void; function init():void; function createSuccessAlert(_arg1:String):void; function createVisualDebug():void; function createAlert(_arg1:String):void; function destroy():void; function bringToFront(_arg1:DisplayObject):void; function isAvailable():Boolean; } }//package com.google.analytics.debug
Section 43
//Info (com.google.analytics.debug.Info) package com.google.analytics.debug { import flash.events.*; import flash.utils.*; public class Info extends Label { private var _timer:Timer; public function Info(_arg1:String="", _arg2:uint=3000){ super(_arg1, "uiInfo", Style.infoColor, Align.top, true); if (_arg2 > 0){ _timer = new Timer(_arg2, 1); _timer.start(); _timer.addEventListener(TimerEvent.TIMER_COMPLETE, onComplete, false, 0, true); }; } public function onComplete(_arg1:TimerEvent):void{ close(); } override public function onLink(_arg1:TextEvent):void{ switch (_arg1.text){ case "hide": close(); break; }; } public function close():void{ if (parent != null){ parent.removeChild(this); }; } } }//package com.google.analytics.debug
Section 44
//Label (com.google.analytics.debug.Label) package com.google.analytics.debug { import flash.events.*; import flash.display.*; import flash.text.*; public class Label extends UISprite { private var _color:uint; private var _background:Shape; private var _textField:TextField; public var stickToEdge:Boolean; private var _text:String; protected var selectable:Boolean; private var _tag:String; public static var count:uint = 0; public function Label(_arg1:String="", _arg2:String="uiLabel", _arg3:uint=0, _arg4:Align=null, _arg5:Boolean=false){ this.name = ("Label" + count++); selectable = false; _background = new Shape(); _textField = new TextField(); _text = _arg1; _tag = _arg2; if (_arg4 == null){ _arg4 = Align.none; }; this.alignement = _arg4; this.stickToEdge = _arg5; if (_arg3 == 0){ _arg3 = Style.backgroundColor; }; _color = _arg3; _textField.addEventListener(TextEvent.LINK, onLink); } public function get tag():String{ return (_tag); } private function _draw():void{ var _local1:Graphics = _background.graphics; _local1.clear(); _local1.beginFill(_color); var _local2:uint = _textField.width; var _local3:uint = _textField.height; if (forcedWidth > 0){ _local2 = forcedWidth; }; Background.drawRounded(this, _local1, _local2, _local3); _local1.endFill(); } public function get text():String{ return (_textField.text); } public function appendText(_arg1:String, _arg2:String=""):void{ if (_arg1 == ""){ return; }; if (_arg2 == ""){ _arg2 = tag; }; _textField.htmlText = (_textField.htmlText + (((("<span class=\"" + _arg2) + "\">") + _arg1) + "</span>")); _text = (_text + _arg1); _draw(); resize(); } public function set text(_arg1:String):void{ if (_arg1 == ""){ _arg1 = _text; }; _textField.htmlText = (((("<span class=\"" + tag) + "\">") + _arg1) + "</span>"); _text = _arg1; _draw(); resize(); } override protected function layout():void{ _textField.type = TextFieldType.DYNAMIC; _textField.autoSize = TextFieldAutoSize.LEFT; _textField.background = false; _textField.selectable = selectable; _textField.multiline = true; _textField.styleSheet = Style.sheet; this.text = _text; addChild(_background); addChild(_textField); } public function set tag(_arg1:String):void{ _tag = _arg1; text = ""; } public function onLink(_arg1:TextEvent):void{ } override protected function dispose():void{ _textField.removeEventListener(TextEvent.LINK, onLink); super.dispose(); } } }//package com.google.analytics.debug
Section 45
//Layout (com.google.analytics.debug.Layout) package com.google.analytics.debug { import com.google.analytics.core.*; import flash.net.*; import flash.events.*; import flash.display.*; import com.google.analytics.*; public class Layout implements ILayout { private var _display:DisplayObject; private var _infoQueue:Array; private var _maxCharPerLine:int;// = 85 private var _hasInfo:Boolean; private var _warningQueue:Array; private var _hasDebug:Boolean; private var _hasWarning:Boolean; private var _mainPanel:Panel; private var _GRAlertQueue:Array; private var _debug:DebugConfiguration; public var visualDebug:Debug; private var _hasGRAlert:Boolean; public function Layout(_arg1:DebugConfiguration, _arg2:DisplayObject){ _display = _arg2; _debug = _arg1; _hasWarning = false; _hasInfo = false; _hasDebug = false; _hasGRAlert = false; _warningQueue = []; _infoQueue = []; _GRAlertQueue = []; } private function onKey(_arg1:KeyboardEvent=null):void{ switch (_arg1.keyCode){ case _debug.showHideKey: _mainPanel.visible = !(_mainPanel.visible); break; case _debug.destroyKey: destroy(); break; }; } public function createWarning(_arg1:String):void{ if (((_hasWarning) || (!(isAvailable())))){ _warningQueue.push(_arg1); return; }; _arg1 = _filterMaxChars(_arg1); _hasWarning = true; var _local2:Warning = new Warning(_arg1, _debug.warningTimeout); addToPanel("analytics", _local2); _local2.addEventListener(Event.REMOVED_FROM_STAGE, _clearWarning, false, 0, true); if (_hasDebug){ visualDebug.writeBold(_arg1); }; } public function bringToFront(_arg1:DisplayObject):void{ _display.stage.setChildIndex(_arg1, (_display.stage.numChildren - 1)); } public function createFailureAlert(_arg1:String):void{ var _local2:AlertAction; if (_debug.verbose){ _arg1 = _filterMaxChars(_arg1); _local2 = new AlertAction("Close", "close", "close"); } else { _local2 = new AlertAction("X", "close", "close"); }; var _local3:Alert = new FailureAlert(_debug, _arg1, [_local2]); addToPanel("analytics", _local3); if (_hasDebug){ if (_debug.verbose){ _arg1 = _arg1.split("\n").join(""); _arg1 = _filterMaxChars(_arg1, 66); }; visualDebug.writeBold(_arg1); }; } public function init():void{ var _local1 = 10; var _local2:uint = (_display.stage.stageWidth - (_local1 * 2)); var _local3:uint = (_display.stage.stageHeight - (_local1 * 2)); var _local4:Panel = new Panel("analytics", _local2, _local3); _local4.alignement = Align.top; _local4.stickToEdge = false; _local4.title = ("Google Analytics v" + GATracker.version); _mainPanel = _local4; addToStage(_local4); bringToFront(_local4); if (_debug.minimizedOnStart){ _mainPanel.onToggle(); }; createVisualDebug(); _display.stage.addEventListener(KeyboardEvent.KEY_DOWN, onKey, false, 0, true); } public function addToPanel(_arg1:String, _arg2:DisplayObject):void{ var _local4:Panel; var _local3:DisplayObject = _display.stage.getChildByName(_arg1); if (_local3){ _local4 = (_local3 as Panel); _local4.addData(_arg2); } else { trace((("panel \"" + _arg1) + "\" not found")); }; } private function _clearInfo(_arg1:Event):void{ _hasInfo = false; if (_infoQueue.length > 0){ createInfo(_infoQueue.shift()); }; } private function _filterMaxChars(_arg1:String, _arg2:int=0):String{ var _local6:String; var _local3 = "\n"; var _local4:Array = []; var _local5:Array = _arg1.split(_local3); if (_arg2 == 0){ _arg2 = _maxCharPerLine; }; var _local7:int; while (_local7 < _local5.length) { _local6 = _local5[_local7]; while (_local6.length > _arg2) { _local4.push(_local6.substr(0, _arg2)); _local6 = _local6.substring(_arg2); }; _local4.push(_local6); _local7++; }; return (_local4.join(_local3)); } private function _clearGRAlert(_arg1:Event):void{ _hasGRAlert = false; if (_GRAlertQueue.length > 0){ createGIFRequestAlert.apply(this, _GRAlertQueue.shift()); }; } public function createSuccessAlert(_arg1:String):void{ var _local2:AlertAction; if (_debug.verbose){ _arg1 = _filterMaxChars(_arg1); _local2 = new AlertAction("Close", "close", "close"); } else { _local2 = new AlertAction("X", "close", "close"); }; var _local3:Alert = new SuccessAlert(_debug, _arg1, [_local2]); addToPanel("analytics", _local3); if (_hasDebug){ if (_debug.verbose){ _arg1 = _arg1.split("\n").join(""); _arg1 = _filterMaxChars(_arg1, 66); }; visualDebug.writeBold(_arg1); }; } public function isAvailable():Boolean{ return (!((_display.stage == null))); } public function createAlert(_arg1:String):void{ _arg1 = _filterMaxChars(_arg1); var _local2:Alert = new Alert(_arg1, [new AlertAction("Close", "close", "close")]); addToPanel("analytics", _local2); if (_hasDebug){ visualDebug.writeBold(_arg1); }; } public function createInfo(_arg1:String):void{ if (((_hasInfo) || (!(isAvailable())))){ _infoQueue.push(_arg1); return; }; _arg1 = _filterMaxChars(_arg1); _hasInfo = true; var _local2:Info = new Info(_arg1, _debug.infoTimeout); addToPanel("analytics", _local2); _local2.addEventListener(Event.REMOVED_FROM_STAGE, _clearInfo, false, 0, true); if (_hasDebug){ visualDebug.write(_arg1); }; } public function createGIFRequestAlert(_arg1:String, _arg2:URLRequest, _arg3:GIFRequest):void{ var message = _arg1; var request = _arg2; var ref = _arg3; if (_hasGRAlert){ _GRAlertQueue.push([message, request, ref]); return; }; _hasGRAlert = true; var f:Function = function ():void{ ref.sendRequest(request); }; message = _filterMaxChars(message); var gra:GIFRequestAlert = new GIFRequestAlert(message, [new AlertAction("OK", "ok", f), new AlertAction("Cancel", "cancel", "close")]); addToPanel("analytics", gra); gra.addEventListener(Event.REMOVED_FROM_STAGE, _clearGRAlert, false, 0, true); if (_hasDebug){ if (_debug.verbose){ message = message.split("\n").join(""); message = _filterMaxChars(message, 66); }; visualDebug.write(message); }; } public function createVisualDebug():void{ if (!visualDebug){ visualDebug = new Debug(); visualDebug.alignement = Align.bottom; visualDebug.stickToEdge = true; addToPanel("analytics", visualDebug); _hasDebug = true; }; } public function addToStage(_arg1:DisplayObject):void{ _display.stage.addChild(_arg1); } private function _clearWarning(_arg1:Event):void{ _hasWarning = false; if (_warningQueue.length > 0){ createWarning(_warningQueue.shift()); }; } public function createPanel(_arg1:String, _arg2:uint, _arg3:uint):void{ var _local4:Panel = new Panel(_arg1, _arg2, _arg3); _local4.alignement = Align.center; _local4.stickToEdge = false; addToStage(_local4); bringToFront(_local4); } public function destroy():void{ _mainPanel.close(); _debug.layout = null; } } }//package com.google.analytics.debug
Section 46
//Margin (com.google.analytics.debug.Margin) package com.google.analytics.debug { public class Margin { public var bottom:int; public var top:int; public var right:int; public var left:int; public function Margin(_arg1:int=0, _arg2:int=0, _arg3:int=0, _arg4:int=0){ this.top = _arg1; this.bottom = _arg2; this.left = _arg3; this.right = _arg4; } } }//package com.google.analytics.debug
Section 47
//Panel (com.google.analytics.debug.Panel) package com.google.analytics.debug { import flash.events.*; import flash.display.*; public class Panel extends UISprite { private var _savedH:uint; private var _data:UISprite; private var _mask:Sprite; private var _background:Shape; private var _savedW:uint; private var _stickToEdge:Boolean; private var _border:Shape; private var _borderColor:uint; protected var baseAlpha:Number; private var _backgroundColor:uint; private var _title:Label; private var _colapsed:Boolean; private var _name:String; public function Panel(_arg1:String, _arg2:uint, _arg3:uint, _arg4:uint=0, _arg5:uint=0, _arg6:Number=0.3, _arg7:Align=null, _arg8:Boolean=false){ _name = _arg1; this.name = _arg1; this.mouseEnabled = false; _colapsed = false; forcedWidth = _arg2; forcedHeight = _arg3; this.baseAlpha = _arg6; _background = new Shape(); _data = new UISprite(); _data.forcedWidth = _arg2; _data.forcedHeight = _arg3; _data.mouseEnabled = false; _title = new Label(_arg1, "uiLabel", 0xFFFFFF, Align.topLeft, _arg8); _title.buttonMode = true; _title.margin.top = 0.6; _title.margin.left = 0.6; _title.addEventListener(MouseEvent.CLICK, onToggle); _title.mouseChildren = false; _border = new Shape(); _mask = new Sprite(); _mask.useHandCursor = false; _mask.mouseEnabled = false; _mask.mouseChildren = false; if (_arg7 == null){ _arg7 = Align.none; }; this.alignement = _arg7; this.stickToEdge = _arg8; if (_arg4 == 0){ _arg4 = Style.backgroundColor; }; _backgroundColor = _arg4; if (_arg5 == 0){ _arg5 = Style.borderColor; }; _borderColor = _arg5; } public function get stickToEdge():Boolean{ return (_stickToEdge); } public function onToggle(_arg1:MouseEvent=null):void{ if (_colapsed){ _data.visible = true; } else { _data.visible = false; }; _colapsed = !(_colapsed); _update(); resize(); } public function set stickToEdge(_arg1:Boolean):void{ _stickToEdge = _arg1; _title.stickToEdge = _arg1; } override protected function dispose():void{ _title.removeEventListener(MouseEvent.CLICK, onToggle); super.dispose(); } private function _draw():void{ var _local1:uint; var _local2:uint; if (((_savedW) && (_savedH))){ forcedWidth = _savedW; forcedHeight = _savedH; }; if (!_colapsed){ _local1 = forcedWidth; _local2 = forcedHeight; } else { _local1 = _title.width; _local2 = _title.height; _savedW = forcedWidth; _savedH = forcedHeight; forcedWidth = _local1; forcedHeight = _local2; }; var _local3:Graphics = _background.graphics; _local3.clear(); _local3.beginFill(_backgroundColor); Background.drawRounded(this, _local3, _local1, _local2); _local3.endFill(); var _local4:Graphics = _data.graphics; _local4.clear(); _local4.beginFill(_backgroundColor, 0); Background.drawRounded(this, _local4, _local1, _local2); _local4.endFill(); var _local5:Graphics = _border.graphics; _local5.clear(); _local5.lineStyle(0.1, _borderColor); Background.drawRounded(this, _local5, _local1, _local2); _local5.endFill(); var _local6:Graphics = _mask.graphics; _local6.clear(); _local6.beginFill(_backgroundColor); Background.drawRounded(this, _local6, (_local1 + 1), (_local2 + 1)); _local6.endFill(); } public function get title():String{ return (_title.text); } private function _update():void{ _draw(); if (baseAlpha < 1){ _background.alpha = baseAlpha; _border.alpha = baseAlpha; }; } public function addData(_arg1:DisplayObject):void{ _data.addChild(_arg1); } override protected function layout():void{ _update(); addChild(_background); addChild(_data); addChild(_title); addChild(_border); addChild(_mask); mask = _mask; } public function set title(_arg1:String):void{ _title.text = _arg1; } public function close():void{ dispose(); if (parent != null){ parent.removeChild(this); }; } } }//package com.google.analytics.debug
Section 48
//Style (com.google.analytics.debug.Style) package com.google.analytics.debug { public const Style:_Style = new _Style(); }//package com.google.analytics.debug
Section 49
//SuccessAlert (com.google.analytics.debug.SuccessAlert) package com.google.analytics.debug { public class SuccessAlert extends Alert { public function SuccessAlert(_arg1:DebugConfiguration, _arg2:String, _arg3:Array){ var _local4:Align; var _local5:Boolean; var _local6:Boolean; _local4 = Align.bottomLeft; _local5 = true; _local6 = false; if (_arg1.verbose){ _arg2 = ((("<u><span class=\"uiAlertTitle\">Success</span>" + spaces(18)) + "</u>\n\n") + _arg2); _local4 = Align.center; _local5 = false; _local6 = true; }; super(_arg2, _arg3, "uiSuccess", Style.successColor, _local4, _local5, _local6); } } }//package com.google.analytics.debug
Section 50
//UISprite (com.google.analytics.debug.UISprite) package com.google.analytics.debug { import flash.events.*; import flash.display.*; public class UISprite extends Sprite { private var _forcedHeight:uint; protected var listenResize:Boolean; public var alignement:Align; private var _forcedWidth:uint; public var margin:Margin; protected var alignTarget:DisplayObject; public function UISprite(_arg1:DisplayObject=null){ listenResize = false; alignement = Align.none; this.alignTarget = _arg1; margin = new Margin(); addEventListener(Event.ADDED_TO_STAGE, _onAddedToStage); addEventListener(Event.REMOVED_FROM_STAGE, _onRemovedFromStage); } protected function dispose():void{ var _local1:DisplayObject; var _local2:int; _local2 = 0; while (_local2 < numChildren) { _local1 = getChildAt(_local2); if (_local1){ removeChild(_local1); }; _local2++; }; } protected function layout():void{ } public function get forcedHeight():uint{ if (_forcedHeight){ return (_forcedHeight); }; return (height); } public function alignTo(_arg1:Align, _arg2:DisplayObject=null):void{ var _local3:uint; var _local4:uint; var _local5:uint; var _local6:uint; var _local7:UISprite; if (_arg2 == null){ if ((parent is Stage)){ _arg2 = this.stage; } else { _arg2 = parent; }; }; if (_arg2 == this.stage){ if (this.stage == null){ return; }; _local3 = this.stage.stageHeight; _local4 = this.stage.stageWidth; _local5 = 0; _local6 = 0; } else { _local7 = (_arg2 as UISprite); if (_local7.forcedHeight){ _local3 = _local7.forcedHeight; } else { _local3 = _local7.height; }; if (_local7.forcedWidth){ _local4 = _local7.forcedWidth; } else { _local4 = _local7.width; }; _local5 = 0; _local6 = 0; }; switch (_arg1){ case Align.top: x = ((_local4 / 2) - (forcedWidth / 2)); y = (_local6 + margin.top); break; case Align.bottom: x = ((_local4 / 2) - (forcedWidth / 2)); y = (((_local6 + _local3) - forcedHeight) - margin.bottom); break; case Align.left: x = (_local5 + margin.left); y = ((_local3 / 2) - (forcedHeight / 2)); break; case Align.right: x = (((_local5 + _local4) - forcedWidth) - margin.right); y = ((_local3 / 2) - (forcedHeight / 2)); break; case Align.center: x = ((_local4 / 2) - (forcedWidth / 2)); y = ((_local3 / 2) - (forcedHeight / 2)); break; case Align.topLeft: x = (_local5 + margin.left); y = (_local6 + margin.top); break; case Align.topRight: x = (((_local5 + _local4) - forcedWidth) - margin.right); y = (_local6 + margin.top); break; case Align.bottomLeft: x = (_local5 + margin.left); y = (((_local6 + _local3) - forcedHeight) - margin.bottom); break; case Align.bottomRight: x = (((_local5 + _local4) - forcedWidth) - margin.right); y = (((_local6 + _local3) - forcedHeight) - margin.bottom); break; }; if (((!(listenResize)) && (!((_arg1 == Align.none))))){ _arg2.addEventListener(Event.RESIZE, onResize, false, 0, true); listenResize = true; }; this.alignement = _arg1; this.alignTarget = _arg2; } public function get forcedWidth():uint{ if (_forcedWidth){ return (_forcedWidth); }; return (width); } protected function onResize(_arg1:Event):void{ resize(); } private function _onRemovedFromStage(_arg1:Event):void{ removeEventListener(Event.ADDED_TO_STAGE, _onAddedToStage); removeEventListener(Event.REMOVED_FROM_STAGE, _onRemovedFromStage); dispose(); } public function resize():void{ if (alignement != Align.none){ alignTo(alignement, alignTarget); }; } private function _onAddedToStage(_arg1:Event):void{ layout(); resize(); } public function set forcedHeight(_arg1:uint):void{ _forcedHeight = _arg1; } public function set forcedWidth(_arg1:uint):void{ _forcedWidth = _arg1; } } }//package com.google.analytics.debug
Section 51
//VisualDebugMode (com.google.analytics.debug.VisualDebugMode) package com.google.analytics.debug { public class VisualDebugMode { private var _value:int; private var _name:String; public static const advanced:VisualDebugMode = new VisualDebugMode(1, "advanced"); ; public static const geek:VisualDebugMode = new VisualDebugMode(2, "geek"); ; public static const basic:VisualDebugMode = new VisualDebugMode(0, "basic"); ; public function VisualDebugMode(_arg1:int=0, _arg2:String=""){ _value = _arg1; _name = _arg2; } public function valueOf():int{ return (_value); } public function toString():String{ return (_name); } } }//package com.google.analytics.debug
Section 52
//Warning (com.google.analytics.debug.Warning) package com.google.analytics.debug { import flash.events.*; import flash.utils.*; public class Warning extends Label { private var _timer:Timer; public function Warning(_arg1:String="", _arg2:uint=3000){ super(_arg1, "uiWarning", Style.warningColor, Align.top, false); margin.top = 32; if (_arg2 > 0){ _timer = new Timer(_arg2, 1); _timer.start(); _timer.addEventListener(TimerEvent.TIMER_COMPLETE, onComplete, false, 0, true); }; } public function onComplete(_arg1:TimerEvent):void{ close(); } override public function onLink(_arg1:TextEvent):void{ switch (_arg1.text){ case "hide": close(); break; }; } public function close():void{ if (parent != null){ parent.removeChild(this); }; } } }//package com.google.analytics.debug
Section 53
//AnalyticsEvent (com.google.analytics.events.AnalyticsEvent) package com.google.analytics.events { import flash.events.*; import com.google.analytics.*; public class AnalyticsEvent extends Event { public var tracker:AnalyticsTracker; public static const READY:String = "ready"; public function AnalyticsEvent(_arg1:String, _arg2:AnalyticsTracker, _arg3:Boolean=false, _arg4:Boolean=false){ super(_arg1, _arg3, _arg4); this.tracker = _arg2; } override public function clone():Event{ return (new AnalyticsEvent(type, tracker, bubbles, cancelable)); } } }//package com.google.analytics.events
Section 54
//AdSenseGlobals (com.google.analytics.external.AdSenseGlobals) package com.google.analytics.external { import com.google.analytics.debug.*; public class AdSenseGlobals extends JavascriptProxy { private var _gaGlobalVerified:Boolean;// = false public static var gaGlobal_js:XML = <script> <![CDATA[ function() { try { gaGlobal } catch(e) { gaGlobal = {} ; } } ]]> </script> ; public function AdSenseGlobals(_arg1:DebugConfiguration){ _gaGlobalVerified = false; super(_arg1); } public function set vid(_arg1:String):void{ if (!isAvailable()){ return; }; _verify(); setProperty("gaGlobal.vid", _arg1); } public function get hid():String{ if (!isAvailable()){ return (null); }; _verify(); return (getProperty("gaGlobal.hid")); } public function get dh():String{ if (!isAvailable()){ return (null); }; _verify(); return (getProperty("gaGlobal.dh")); } public function get gaGlobal():Object{ if (!isAvailable()){ return (null); }; _verify(); return (getProperty("gaGlobal")); } public function set hid(_arg1:String):void{ if (!isAvailable()){ return; }; _verify(); setProperty("gaGlobal.hid", _arg1); } public function get sid():String{ if (!isAvailable()){ return (null); }; _verify(); return (getProperty("gaGlobal.sid")); } private function _verify():void{ if (!_gaGlobalVerified){ executeBlock(gaGlobal_js); _gaGlobalVerified = true; }; } public function get vid():String{ if (!isAvailable()){ return (null); }; _verify(); return (getProperty("gaGlobal.vid")); } public function set sid(_arg1:String):void{ if (!isAvailable()){ return; }; _verify(); setProperty("gaGlobal.sid", _arg1); } } }//package com.google.analytics.external
Section 55
//HTMLDOM (com.google.analytics.external.HTMLDOM) package com.google.analytics.external { import com.google.analytics.debug.*; public class HTMLDOM extends JavascriptProxy { private var _referrer:String; private var _protocol:String; private var _host:String; private var _location:String; private var _pathname:String; private var _title:String; private var _characterSet:String; private var _search:String; private var _language:String; private var _colorDepth:String; public static var cache_properties_js:XML = <script> <![CDATA[ function() { var obj = {}; obj.host = document.location.host; obj.language = navigator.language ? navigator.language : navigator.browserLanguage; obj.characterSet = document.characterSet ? document.characterSet : document.charset; obj.colorDepth = window.screen.colorDepth; obj.location = document.location.toString(); obj.pathname = document.location.pathname; obj.protocol = document.location.protocol; obj.search = document.location.search; obj.referrer = document.referrer; obj.title = document.title; return obj; } ]]> </script> ; public function HTMLDOM(_arg1:DebugConfiguration){ super(_arg1); } public function get search():String{ if (_search){ return (_search); }; if (!isAvailable()){ return (null); }; _search = getProperty("document.location.search"); return (_search); } public function get location():String{ if (_location){ return (_location); }; if (!isAvailable()){ return (null); }; _location = getPropertyString("document.location"); return (_location); } public function get pathname():String{ if (_pathname){ return (_pathname); }; if (!isAvailable()){ return (null); }; _pathname = getProperty("document.location.pathname"); return (_pathname); } public function get referrer():String{ if (_referrer){ return (_referrer); }; if (!isAvailable()){ return (null); }; _referrer = getProperty("document.referrer"); return (_referrer); } public function get protocol():String{ if (_protocol){ return (_protocol); }; if (!isAvailable()){ return (null); }; _protocol = getProperty("document.location.protocol"); return (_protocol); } public function cacheProperties():void{ var _local1:Object; if (!isAvailable()){ return; }; _local1 = call(cache_properties_js); if (_local1){ _host = _local1.host; _language = _local1.language; _characterSet = _local1.characterSet; _colorDepth = _local1.colorDepth; _location = _local1.location; _pathname = _local1.pathname; _protocol = _local1.protocol; _search = _local1.search; _referrer = _local1.referrer; _title = _local1.title; }; } public function get colorDepth():String{ if (_colorDepth){ return (_colorDepth); }; if (!isAvailable()){ return (null); }; _colorDepth = getProperty("window.screen.colorDepth"); return (_colorDepth); } public function get title():String{ if (_title){ return (_title); }; if (!isAvailable()){ return (null); }; _title = getProperty("document.title"); return (_title); } public function get host():String{ if (_host){ return (_host); }; if (!isAvailable()){ return (null); }; _host = getProperty("document.location.host"); return (_host); } public function get characterSet():String{ var _local1:String; if (_characterSet){ return (_characterSet); }; if (!isAvailable()){ return (null); }; _local1 = getProperty("document.characterSet"); if (_local1 == null){ _local1 = getProperty("document.charset"); }; _characterSet = _local1; return (_characterSet); } public function get language():String{ var _local1:String; if (_language){ return (_language); }; if (!isAvailable()){ return (null); }; _local1 = getProperty("navigator.language"); if (_local1 == null){ _local1 = getProperty("navigator.browserLanguage"); }; _language = _local1; return (_language); } } }//package com.google.analytics.external
Section 56
//JavascriptProxy (com.google.analytics.external.JavascriptProxy) package com.google.analytics.external { import com.google.analytics.debug.*; import flash.external.*; import flash.system.*; public class JavascriptProxy { private var _notAvailableWarning:Boolean;// = true private var _debug:DebugConfiguration; public static var setProperty_js:XML = <script> <![CDATA[ function( path , value ) { var paths; var prop; if( path.indexOf(".") > 0 ) { paths = path.split("."); prop = paths.pop() ; } else { paths = []; prop = path; } var target = window ; var len = paths.length ; for( var i = 0 ; i < len ; i++ ) { target = target[ paths[i] ] ; } target[ prop ] = value ; } ]]> </script> ; public static var hasProperty_js:XML = <script> <![CDATA[ function( path ) { var paths; if( path.indexOf(".") > 0 ) { paths = path.split("."); } else { paths = [path]; } var target = window ; var len = paths.length ; for( var i = 0 ; i < len ; i++ ) { target = target[ paths[i] ] ; } if( target ) { return true; } else { return false; } } ]]> </script> ; public static var setPropertyRef_js:XML = <script> <![CDATA[ function( path , target ) { var paths; var prop; if( path.indexOf(".") > 0 ) { paths = path.split("."); prop = paths.pop() ; } else { paths = []; prop = path; } alert( "paths:"+paths.length+", prop:"+prop ); var targets; var name; if( target.indexOf(".") > 0 ) { targets = target.split("."); name = targets.pop(); } else { targets = []; name = target; } alert( "targets:"+targets.length+", name:"+name ); var root = window; var len = paths.length; for( var i = 0 ; i < len ; i++ ) { root = root[ paths[i] ] ; } var ref = window; var depth = targets.length; for( var j = 0 ; j < depth ; j++ ) { ref = ref[ targets[j] ] ; } root[ prop ] = ref[name] ; } ]]> </script> ; public function JavascriptProxy(_arg1:DebugConfiguration){ _notAvailableWarning = true; super(); _debug = _arg1; } public function getProperty(_arg1:String){ return (call((_arg1 + ".valueOf"))); } public function hasProperty(_arg1:String):Boolean{ return (call(hasProperty_js, _arg1)); } public function setProperty(_arg1:String, _arg2):void{ call(setProperty_js, _arg1, _arg2); } public function executeBlock(_arg1:String):void{ var data = _arg1; if (isAvailable()){ try { ExternalInterface.call(data); } catch(e:SecurityError) { if (_debug.javascript){ _debug.warning("ExternalInterface is not allowed.\nEnsure that allowScriptAccess is set to \"always\" in the Flash embed HTML."); }; } catch(e:Error) { if (_debug.javascript){ _debug.warning(("ExternalInterface failed to make the call\nreason: " + e.message)); }; }; }; } public function getPropertyString(_arg1:String):String{ return (call((_arg1 + ".toString"))); } public function setPropertyByReference(_arg1:String, _arg2:String):void{ call(setPropertyRef_js, _arg1, _arg2); } public function call(_arg1:String, ... _args){ var output:String; var functionName = _arg1; var args = _args; if (isAvailable()){ try { if (((_debug.javascript) && (_debug.verbose))){ output = ""; output = ("Flash->JS: " + functionName); output = (output + "( "); if (args.length > 0){ output = (output + args.join(",")); }; output = (output + " )"); _debug.info(output); }; args.unshift(functionName); return (ExternalInterface.call.apply(ExternalInterface, args)); } catch(e:SecurityError) { if (_debug.javascript){ _debug.warning("ExternalInterface is not allowed.\nEnsure that allowScriptAccess is set to \"always\" in the Flash embed HTML."); }; } catch(e:Error) { if (_debug.javascript){ _debug.warning(("ExternalInterface failed to make the call\nreason: " + e.message)); }; }; }; return (null); } public function isAvailable():Boolean{ var _local1:Boolean; _local1 = ExternalInterface.available; if (((_local1) && ((Capabilities.playerType == "External")))){ _local1 = false; }; if (((((!(_local1)) && (_debug.javascript))) && (_notAvailableWarning))){ _debug.warning("ExternalInterface is not available."); _notAvailableWarning = false; }; return (_local1); } } }//package com.google.analytics.external
Section 57
//Environment (com.google.analytics.utils.Environment) package com.google.analytics.utils { import com.google.analytics.core.*; import com.google.analytics.debug.*; import com.google.analytics.external.*; import flash.system.*; public class Environment { private var _dom:HTMLDOM; private var _appName:String; private var _debug:DebugConfiguration; private var _appVersion:Version; private var _url:String; private var _protocol:Protocols; private var _userAgent:UserAgent; public function Environment(_arg1:String="", _arg2:String="", _arg3:String="", _arg4:DebugConfiguration=null, _arg5:HTMLDOM=null){ var _local6:Version; super(); if (_arg2 == ""){ if (isAIR()){ _arg2 = "AIR"; } else { _arg2 = "Flash"; }; }; if (_arg3 == ""){ _local6 = flashVersion; } else { _local6 = Version.fromString(_arg3); }; _url = _arg1; _appName = _arg2; _appVersion = _local6; _debug = _arg4; _dom = _arg5; } public function isAIR():Boolean{ return ((((playerType == "Desktop")) && ((Security.sandboxType.toString() == "application")))); } public function get playerType():String{ return (Capabilities.playerType); } public function get locationSearch():String{ var _local1:String; _local1 = _dom.search; if (_local1){ return (_local1); }; return (""); } public function get protocol():Protocols{ if (!_protocol){ _findProtocol(); }; return (_protocol); } public function get flashVersion():Version{ var _local1:Version; _local1 = Version.fromString(Capabilities.version.split(" ")[1], ","); return (_local1); } public function get screenWidth():Number{ return (Capabilities.screenResolutionX); } public function get languageEncoding():String{ var _local1:String; if (System.useCodePage){ _local1 = _dom.characterSet; if (_local1){ return (_local1); }; return ("-"); }; return ("UTF-8"); } public function get appName():String{ return (_appName); } public function get screenColorDepth():String{ var _local1:String; var _local2:String; switch (Capabilities.screenColor){ case "bw": _local1 = "1"; break; case "gray": _local1 = "2"; break; case "color": default: _local1 = "24"; }; _local2 = _dom.colorDepth; if (_local2){ _local1 = _local2; }; return (_local1); } private function _findProtocol():void{ var _local1:Protocols; var _local2:String; var _local3:String; var _local4:String; var _local5:String; _local1 = Protocols.none; if (_url != ""){ _local4 = _url.toLowerCase(); _local5 = _local4.substr(0, 5); switch (_local5){ case "file:": _local1 = Protocols.file; break; case "http:": _local1 = Protocols.HTTP; break; case "https": if (_local4.charAt(5) == ":"){ _local1 = Protocols.HTTPS; }; break; default: _protocol = Protocols.none; }; }; _local2 = _dom.protocol; _local3 = (_local1.toString() + ":").toLowerCase(); if (((((_local2) && (!((_local2 == _local3))))) && (_debug))){ _debug.warning(((("Protocol mismatch: SWF=" + _local3) + ", DOM=") + _local2)); }; _protocol = _local1; } public function get locationSWFPath():String{ return (_url); } public function get platform():String{ var _local1:String; _local1 = Capabilities.manufacturer; return (_local1.split("Adobe ")[1]); } public function get operatingSystem():String{ return (Capabilities.os); } public function set appName(_arg1:String):void{ _appName = _arg1; userAgent.applicationProduct = _arg1; } public function get userAgent():UserAgent{ if (!_userAgent){ _userAgent = new UserAgent(this, appName, appVersion.toString(4)); }; return (_userAgent); } ga_internal function set url(_arg1:String):void{ _url = _arg1; } public function get referrer():String{ var _local1:String; _local1 = _dom.referrer; if (_local1){ return (_local1); }; if (protocol == Protocols.file){ return ("localhost"); }; return (""); } public function isInHTML():Boolean{ return ((Capabilities.playerType == "PlugIn")); } public function get language():String{ var _local1:String; var _local2:String; _local1 = _dom.language; _local2 = Capabilities.language; if (_local1){ if ((((_local1.length > _local2.length)) && ((_local1.substr(0, _local2.length) == _local2)))){ _local2 = _local1; }; }; return (_local2); } public function get domainName():String{ var _local1:String; var _local2:String; var _local3:int; if ((((protocol == Protocols.HTTP)) || ((protocol == Protocols.HTTPS)))){ _local1 = _url.toLowerCase(); if (protocol == Protocols.HTTP){ _local2 = _local1.split("http://").join(""); } else { if (protocol == Protocols.HTTPS){ _local2 = _local1.split("https://").join(""); }; }; _local3 = _local2.indexOf("/"); if (_local3 > -1){ _local2 = _local2.substring(0, _local3); }; return (_local2); }; if (protocol == Protocols.file){ return ("localhost"); }; return (""); } public function set userAgent(_arg1:UserAgent):void{ _userAgent = _arg1; } public function set appVersion(_arg1:Version):void{ _appVersion = _arg1; userAgent.applicationVersion = _arg1.toString(4); } public function get screenHeight():Number{ return (Capabilities.screenResolutionY); } public function get locationPath():String{ var _local1:String; _local1 = _dom.pathname; if (_local1){ return (_local1); }; return (""); } public function get documentTitle():String{ var _local1:String; _local1 = _dom.title; if (_local1){ return (_local1); }; return (""); } public function get appVersion():Version{ return (_appVersion); } } }//package com.google.analytics.utils
Section 58
//Protocols (com.google.analytics.utils.Protocols) package com.google.analytics.utils { public class Protocols { private var _value:int; private var _name:String; public static const none:Protocols = new Protocols(0, "none"); ; public static const HTTPS:Protocols = new Protocols(3, "HTTPS"); ; public static const file:Protocols = new Protocols(1, "file"); ; public static const HTTP:Protocols = new Protocols(2, "HTTP"); ; public function Protocols(_arg1:int=0, _arg2:String=""){ _value = _arg1; _name = _arg2; } public function valueOf():int{ return (_value); } public function toString():String{ return (_name); } } }//package com.google.analytics.utils
Section 59
//Timespan (com.google.analytics.utils.Timespan) package com.google.analytics.utils { public class Timespan { public static var sixmonths:Number = 15768000; public static var twoyears:Number = 63072000; public static var thirtyminutes:Number = 1800; } }//package com.google.analytics.utils
Section 60
//URL (com.google.analytics.utils.URL) package com.google.analytics.utils { public class URL { private var _url:String; public function URL(_arg1:String=""){ _url = _arg1.toLowerCase(); } public function get domain():String{ var _local1:Array; if (((!((hostName == ""))) && ((hostName.indexOf(".") > -1)))){ _local1 = hostName.split("."); switch (_local1.length){ case 2: return (hostName); case 3: if (_local1[1] == "co"){ return (hostName); }; _local1.shift(); return (_local1.join(".")); case 4: _local1.shift(); return (_local1.join(".")); }; }; return (""); } public function get path():String{ var _local1:String = _url; if (_local1.indexOf("://") > -1){ _local1 = _local1.split("://")[1]; }; if (_local1.indexOf(hostName) == 0){ _local1 = _local1.substr(hostName.length); }; if (_local1.indexOf("?") > -1){ _local1 = _local1.split("?")[0]; }; if (_local1.charAt(0) != "/"){ _local1 = ("/" + _local1); }; return (_local1); } public function get protocol():Protocols{ var _local1:String = _url.split("://")[0]; switch (_local1){ case "file": return (Protocols.file); case "http": return (Protocols.HTTP); case "https": return (Protocols.HTTPS); default: return (Protocols.none); }; } public function get hostName():String{ var _local1:String = _url; if (_local1.indexOf("://") > -1){ _local1 = _local1.split("://")[1]; }; if (_local1.indexOf("/") > -1){ _local1 = _local1.split("/")[0]; }; if (_local1.indexOf("?") > -1){ _local1 = _local1.split("?")[0]; }; if ((((protocol == Protocols.file)) || ((protocol == Protocols.none)))){ return (""); }; return (_local1); } public function get subDomain():String{ if (((!((domain == ""))) && (!((domain == hostName))))){ return (hostName.split(("." + domain)).join("")); }; return (""); } public function get search():String{ var _local1:String = _url; if (_local1.indexOf("://") > -1){ _local1 = _local1.split("://")[1]; }; if (_local1.indexOf(hostName) == 0){ _local1 = _local1.substr(hostName.length); }; if (_local1.indexOf("?") > -1){ _local1 = _local1.split("?")[1]; } else { _local1 = ""; }; return (_local1); } } }//package com.google.analytics.utils
Section 61
//UserAgent (com.google.analytics.utils.UserAgent) package com.google.analytics.utils { import com.google.analytics.core.*; import flash.system.*; public class UserAgent { private var _version:Version; private var _localInfo:Environment; private var _applicationProduct:String; public static var minimal:Boolean = false; public function UserAgent(_arg1:Environment, _arg2:String="", _arg3:String=""){ _localInfo = _arg1; applicationProduct = _arg2; _version = Version.fromString(_arg3); } public function get tamarinProductToken():String{ if (UserAgent.minimal){ return (""); }; if (System.vmVersion){ return (("Tamarin/" + Utils.trim(System.vmVersion, true))); }; return (""); } public function set applicationProduct(_arg1:String):void{ _applicationProduct = _arg1; } public function get applicationVersion():String{ return (_version.toString(2)); } public function get applicationProductToken():String{ var _local1:String; _local1 = applicationProduct; if (applicationVersion != ""){ _local1 = (_local1 + ("/" + applicationVersion)); }; return (_local1); } public function get vendorProductToken():String{ var _local1:String; _local1 = ""; if (_localInfo.isAIR()){ _local1 = (_local1 + "AIR"); } else { _local1 = (_local1 + "FlashPlayer"); }; _local1 = (_local1 + "/"); _local1 = (_local1 + _version.toString(3)); return (_local1); } public function toString():String{ var _local1:String; _local1 = ""; _local1 = (_local1 + applicationProductToken); if (applicationComment != ""){ _local1 = (_local1 + (" " + applicationComment)); }; if (tamarinProductToken != ""){ _local1 = (_local1 + (" " + tamarinProductToken)); }; if (vendorProductToken != ""){ _local1 = (_local1 + (" " + vendorProductToken)); }; return (_local1); } public function get applicationComment():String{ var _local1:Array; _local1 = []; _local1.push(_localInfo.platform); _local1.push(_localInfo.playerType); if (!UserAgent.minimal){ _local1.push(_localInfo.operatingSystem); _local1.push(_localInfo.language); }; if (Capabilities.isDebugger){ _local1.push("DEBUG"); }; if (_local1.length > 0){ return ((("(" + _local1.join("; ")) + ")")); }; return (""); } public function set applicationVersion(_arg1:String):void{ _version = Version.fromString(_arg1); } public function get applicationProduct():String{ return (_applicationProduct); } } }//package com.google.analytics.utils
Section 62
//Variables (com.google.analytics.utils.Variables) package com.google.analytics.utils { import flash.net.*; public dynamic class Variables { public var post:Array; public var URIencode:Boolean; public var pre:Array; public var sort:Boolean;// = true public function Variables(_arg1:String=null, _arg2:Array=null, _arg3:Array=null){ pre = []; post = []; super(); if (_arg1){ decode(_arg1); }; if (_arg2){ this.pre = _arg2; }; if (_arg3){ this.post = _arg3; }; } private function _join(_arg1:Variables):void{ var _local2:String; if (!_arg1){ return; }; for (_local2 in _arg1) { this[_local2] = _arg1[_local2]; }; } public function join(... _args):void{ var _local2:int = _args.length; var _local3:int; while (_local3 < _local2) { if (!(_args[_local3] is Variables)){ } else { _join(_args[_local3]); }; _local3++; }; } public function toString():String{ var _local2:String; var _local3:String; var _local4:String; var _local5:int; var _local6:int; var _local7:String; var _local8:String; var _local1:Array = []; for (_local3 in this) { _local2 = this[_local3]; if (URIencode){ _local2 = encodeURI(_local2); }; _local1.push(((_local3 + "=") + _local2)); }; if (sort){ _local1.sort(); }; if (pre.length > 0){ pre.reverse(); _local5 = 0; while (_local5 < pre.length) { _local7 = pre[_local5]; _local6 = 0; while (_local6 < _local1.length) { _local4 = _local1[_local6]; if (_local4.indexOf(_local7) == 0){ _local1.unshift(_local1.splice(_local6, 1)[0]); }; _local6++; }; _local5++; }; pre.reverse(); }; if (post.length > 0){ _local5 = 0; while (_local5 < post.length) { _local8 = post[_local5]; _local6 = 0; while (_local6 < _local1.length) { _local4 = _local1[_local6]; if (_local4.indexOf(_local8) == 0){ _local1.push(_local1.splice(_local6, 1)[0]); }; _local6++; }; _local5++; }; }; return (_local1.join("&")); } public function decode(_arg1:String):void{ var _local2:Array; var _local3:String; var _local4:String; var _local5:String; var _local6:Array; if (_arg1 == ""){ return; }; if (_arg1.indexOf("&") > -1){ _local2 = _arg1.split("&"); } else { _local2 = [_arg1]; }; var _local7:int; while (_local7 < _local2.length) { _local3 = _local2[_local7]; if (_local3.indexOf("=") > -1){ _local6 = _local3.split("="); _local4 = _local6[0]; _local5 = decodeURI(_local6[1]); this[_local4] = _local5; }; _local7++; }; } public function toURLVariables():URLVariables{ var _local2:String; var _local1:URLVariables = new URLVariables(); for (_local2 in this) { _local1[_local2] = this[_local2]; }; return (_local1); } } }//package com.google.analytics.utils
Section 63
//Version (com.google.analytics.utils.Version) package com.google.analytics.utils { public class Version { private var _maxBuild:uint;// = 0xFF private var _maxMinor:uint;// = 15 private var _maxMajor:uint;// = 15 private var _revision:uint; private var _separator:String;// = "." private var _maxRevision:uint;// = 0xFFFF private var _build:uint; private var _minor:uint; private var _major:uint; public function Version(_arg1:uint=0, _arg2:uint=0, _arg3:uint=0, _arg4:uint=0){ var _local5:Version; _maxMajor = 15; _maxMinor = 15; _maxBuild = 0xFF; _maxRevision = 0xFFFF; _separator = "."; super(); if ((((((((_arg1 > _maxMajor)) && ((_arg2 == 0)))) && ((_arg3 == 0)))) && ((_arg4 == 0)))){ _local5 = Version.fromNumber(_arg1); _arg1 = _local5.major; _arg2 = _local5.minor; _arg3 = _local5.build; _arg4 = _local5.revision; }; this.major = _arg1; this.minor = _arg2; this.build = _arg3; this.revision = _arg4; } public function toString(_arg1:int=0):String{ var _local2:Array; if ((((_arg1 <= 0)) || ((_arg1 > 4)))){ _arg1 = getFields(); }; switch (_arg1){ case 1: _local2 = [major]; break; case 2: _local2 = [major, minor]; break; case 3: _local2 = [major, minor, build]; break; case 4: default: _local2 = [major, minor, build, revision]; }; return (_local2.join(_separator)); } public function get revision():uint{ return (_revision); } public function set build(_arg1:uint):void{ _build = Math.min(_arg1, _maxBuild); } public function set minor(_arg1:uint):void{ _minor = Math.min(_arg1, _maxMinor); } public function get build():uint{ return (_build); } public function set major(_arg1:uint):void{ _major = Math.min(_arg1, _maxMajor); } public function get minor():uint{ return (_minor); } public function valueOf():uint{ return (((((major << 28) | (minor << 24)) | (build << 16)) | revision)); } public function get major():uint{ return (_major); } public function set revision(_arg1:uint):void{ _revision = Math.min(_arg1, _maxRevision); } private function getFields():int{ var _local1:int; _local1 = 4; if (revision == 0){ _local1--; }; if ((((_local1 == 3)) && ((build == 0)))){ _local1--; }; if ((((_local1 == 2)) && ((minor == 0)))){ _local1--; }; return (_local1); } public function equals(_arg1):Boolean{ if (!(_arg1 is Version)){ return (false); }; if ((((((((_arg1.major == major)) && ((_arg1.minor == minor)))) && ((_arg1.build == build)))) && ((_arg1.revision == revision)))){ return (true); }; return (false); } public static function fromString(_arg1:String="", _arg2:String="."):Version{ var _local3:Version; var _local4:Array; _local3 = new (Version); if ((((_arg1 == "")) || ((_arg1 == null)))){ return (_local3); }; if (_arg1.indexOf(_arg2) > -1){ _local4 = _arg1.split(_arg2); _local3.major = parseInt(_local4[0]); _local3.minor = parseInt(_local4[1]); _local3.build = parseInt(_local4[2]); _local3.revision = parseInt(_local4[3]); } else { _local3.major = parseInt(_arg1); }; return (_local3); } public static function fromNumber(_arg1:Number=0):Version{ var _local2:Version; _local2 = new (Version); if (((((((((((isNaN(_arg1)) || ((_arg1 == 0)))) || ((_arg1 < 0)))) || ((_arg1 == Number.MAX_VALUE)))) || ((_arg1 == Number.POSITIVE_INFINITY)))) || ((_arg1 == Number.NEGATIVE_INFINITY)))){ return (_local2); }; _local2.major = (_arg1 >>> 28); _local2.minor = ((_arg1 & 251658240) >>> 24); _local2.build = ((_arg1 & 0xFF0000) >>> 16); _local2.revision = (_arg1 & 0xFFFF); return (_local2); } } }//package com.google.analytics.utils
Section 64
//Bridge (com.google.analytics.v4.Bridge) package com.google.analytics.v4 { import com.google.analytics.core.*; import com.google.analytics.debug.*; import com.google.analytics.external.*; public class Bridge implements GoogleAnalyticsAPI { private var _debug:DebugConfiguration; private var _proxy:JavascriptProxy; private var _jsContainer:String;// = "_GATracker" private var _hasGATracker:Boolean;// = false private var _account:String; private static var _linkTrackingObject_js:XML = <script> <![CDATA[ function( container , target ) { var targets ; var name ; if( target.indexOf(".") > 0 ) { targets = target.split("."); name = targets.pop(); } else { targets = []; name = target; } var ref = window; var depth = targets.length; for( var j = 0 ; j < depth ; j++ ) { ref = ref[ targets[j] ] ; } window[container][target] = ref[name] ; } ]]> </script> ; private static var _createTrackingObject_js:XML = <script> <![CDATA[ function( acct ) { _GATracker[acct] = _gat._getTracker(acct); } ]]> </script> ; private static var _injectTrackingObject_js:XML = <script> <![CDATA[ function() { try { _GATracker } catch(e) { _GATracker = {}; } } ]]> </script> ; private static var _checkGAJS_js:XML = <script> <![CDATA[ function() { if( _gat && _gat._getTracker ) { return true; } return false; } ]]> </script> ; private static var _checkValidTrackingObject_js:XML = <script> <![CDATA[ function(acct) { if( _GATracker[acct] && (_GATracker[acct]._getAccount) ) { return true ; } else { return false; } } ]]> </script> ; public function Bridge(_arg1:String, _arg2:DebugConfiguration, _arg3:JavascriptProxy){ var _local4:String; var _local5:String; var _local6:String; super(); _account = _arg1; _debug = _arg2; _proxy = _arg3; if (!_checkGAJS()){ _local4 = ""; _local4 = (_local4 + "ga.js not found, be sure to check if\n"); _local4 = (_local4 + "<script src=\"http://www.google-analytics.com/ga.js\"></script>\n"); _local4 = (_local4 + "is included in the HTML."); _debug.warning(_local4); throw (new Error(_local4)); }; if (!_hasGATracker){ if (((_debug.javascript) && (_debug.verbose))){ _local5 = ""; _local5 = (_local5 + "The Google Analytics tracking code was not found on the container page\n"); _local5 = (_local5 + "we create it"); _debug.info(_local5, VisualDebugMode.advanced); }; _injectTrackingObject(); }; if (Utils.validateAccount(_arg1)){ _createTrackingObject(_arg1); } else { if (_checkTrackingObject(_arg1)){ _linkTrackingObject(_arg1); } else { _local6 = ""; _local6 = (_local6 + (("JS Object \"" + _arg1) + "\" doesn't exist in DOM\n")); _local6 = (_local6 + "Bridge object not created."); _debug.warning(_local6); throw (new Error(_local6)); }; }; } public function link(_arg1:String, _arg2:Boolean=false):void{ _debug.info((((("link( " + _arg1) + ", ") + _arg2) + " )")); _call("_link", _arg1, _arg2); } public function addOrganic(_arg1:String, _arg2:String):void{ _debug.info((("addOrganic( " + [_arg1, _arg2].join(", ")) + " )")); _call("_addOrganic", _arg1); } public function setAllowLinker(_arg1:Boolean):void{ _debug.info((("setAllowLinker( " + _arg1) + " )")); _call("_setAllowLinker", _arg1); } private function _linkTrackingObject(_arg1:String):void{ _proxy.call(_linkTrackingObject_js, _jsContainer, _arg1); } public function trackEvent(_arg1:String, _arg2:String, _arg3:String=null, _arg4:Number=NaN):Boolean{ var _local5 = 2; if (((_arg3) && (!((_arg3 == ""))))){ _local5 = 3; }; if ((((_local5 == 3)) && (!(isNaN(_arg4))))){ _local5 = 4; }; switch (_local5){ case 4: _debug.info((("trackEvent( " + [_arg1, _arg2, _arg3, _arg4].join(", ")) + " )")); return (_call("_trackEvent", _arg1, _arg2, _arg3, _arg4)); case 3: _debug.info((("trackEvent( " + [_arg1, _arg2, _arg3].join(", ")) + " )")); return (_call("_trackEvent", _arg1, _arg2, _arg3)); case 2: default: _debug.info((("trackEvent( " + [_arg1, _arg2].join(", ")) + " )")); return (_call("_trackEvent", _arg1, _arg2)); }; } public function setClientInfo(_arg1:Boolean):void{ _debug.info((("setClientInfo( " + _arg1) + " )")); _call("_setClientInfo", _arg1); } public function trackTrans():void{ _debug.info("trackTrans()"); _call("_trackTrans"); } public function setCookieTimeout(_arg1:int):void{ _debug.info((("setCookieTimeout( " + _arg1) + " )")); _call("_setCookieTimeout", _arg1); } public function trackPageview(_arg1:String=""):void{ _debug.info((("trackPageview( " + _arg1) + " )")); _call("_trackPageview", _arg1); } public function getClientInfo():Boolean{ _debug.info("getClientInfo()"); return (_call("_getClientInfo")); } private function _checkValidTrackingObject(_arg1:String):Boolean{ return (_proxy.call(_checkValidTrackingObject_js, _arg1)); } private function _checkGAJS():Boolean{ return (_proxy.call(_checkGAJS_js)); } public function linkByPost(_arg1:Object, _arg2:Boolean=false):void{ _debug.warning((((("linkByPost( " + _arg1) + ", ") + _arg2) + " ) not implemented")); } private function _call(_arg1:String, ... _args){ _args.unshift(((((("window." + _jsContainer) + "[\"") + _account) + "\"].") + _arg1)); return (_proxy.call.apply(_proxy, _args)); } public function hasGAJS():Boolean{ return (_checkGAJS()); } private function _checkTrackingObject(_arg1:String):Boolean{ var _local2:Boolean = _proxy.hasProperty(_arg1); var _local3:Boolean = _proxy.hasProperty((_arg1 + "._getAccount")); return (((_local2) && (_local3))); } public function resetSession():void{ _debug.warning("resetSession() not implemented"); } public function getDetectTitle():Boolean{ _debug.info("getDetectTitle()"); return (_call("_getDetectTitle")); } public function setCampNameKey(_arg1:String):void{ _debug.info((("setCampNameKey( " + _arg1) + " )")); _call("_setCampNameKey", _arg1); } public function setDetectFlash(_arg1:Boolean):void{ _debug.info((("setDetectFlash( " + _arg1) + " )")); _call("_setDetectFlash", _arg1); } public function createEventTracker(_arg1:String):EventTracker{ _debug.info((("createEventTracker( " + _arg1) + " )")); return (new EventTracker(_arg1, this)); } public function addItem(_arg1:String, _arg2:String, _arg3:String, _arg4:String, _arg5:Number, _arg6:int):void{ _debug.info((("addItem( " + [_arg1, _arg2, _arg3, _arg4, _arg5, _arg6].join(", ")) + " )")); _call("_addItem", _arg1, _arg2, _arg3, _arg4, _arg5, _arg6); } public function clearIgnoredOrganic():void{ _debug.info("clearIgnoredOrganic()"); _call("_clearIgnoreOrganic"); } public function setVar(_arg1:String):void{ _debug.info((("setVar( " + _arg1) + " )")); _call("_setVar", _arg1); } public function setDomainName(_arg1:String):void{ _debug.info((("setDomainName( " + _arg1) + " )")); _call("_setDomainName", _arg1); } public function hasTrackingAccount(_arg1:String):Boolean{ if (Utils.validateAccount(_arg1)){ return (_checkValidTrackingObject(_arg1)); }; return (_checkTrackingObject(_arg1)); } public function setCampSourceKey(_arg1:String):void{ _debug.info((("setCampSourceKey( " + _arg1) + " )")); _call("_setCampSourceKey", _arg1); } public function addTrans(_arg1:String, _arg2:String, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:String, _arg7:String, _arg8:String):Object{ _debug.info((("addTrans( " + [_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7, _arg8].join(", ")) + " )")); _call("_addTrans", _arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7, _arg8); return (null); } public function setCampContentKey(_arg1:String):void{ _debug.info((("setCampContentKey( " + _arg1) + " )")); _call("_setCampContentKey", _arg1); } public function setLocalServerMode():void{ _debug.info("setLocalServerMode()"); _call("_setLocalServerMode"); } public function getLocalGifPath():String{ _debug.info("getLocalGifPath()"); return (_call("_getLocalGifPath")); } public function clearIgnoredRef():void{ _debug.info("clearIgnoredRef()"); _call("_clearIgnoreRef"); } public function setAllowAnchor(_arg1:Boolean):void{ _debug.info((("setAllowAnchor( " + _arg1) + " )")); _call("_setAllowAnchor", _arg1); } public function setLocalGifPath(_arg1:String):void{ _debug.info((("setLocalGifPath( " + _arg1) + " )")); _call("_setLocalGifPath", _arg1); } public function getVersion():String{ _debug.info("getVersion()"); return (_call("_getVersion")); } private function _injectTrackingObject():void{ _proxy.executeBlock(_injectTrackingObject_js); _hasGATracker = true; } public function setCookiePath(_arg1:String):void{ _debug.info((("setCookiePath( " + _arg1) + " )")); _call("_setCookiePath", _arg1); } public function setSampleRate(_arg1:Number):void{ _debug.info((("setSampleRate( " + _arg1) + " )")); _call("_setSampleRate", _arg1); } public function setAllowHash(_arg1:Boolean):void{ _debug.info((("setAllowHash( " + _arg1) + " )")); _call("_setAllowHash", _arg1); } public function addIgnoredOrganic(_arg1:String):void{ _debug.info((("addIgnoredOrganic( " + _arg1) + " )")); _call("_addIgnoredOrganic", _arg1); } public function setCampNOKey(_arg1:String):void{ _debug.info((("setCampNOKey( " + _arg1) + " )")); _call("_setCampNOKey", _arg1); } public function cookiePathCopy(_arg1:String):void{ _debug.info((("cookiePathCopy( " + _arg1) + " )")); _call("_cookiePathCopy", _arg1); } public function setLocalRemoteServerMode():void{ _debug.info("setLocalRemoteServerMode()"); _call("_setLocalRemoteServerMode"); } public function getServiceMode():ServerOperationMode{ _debug.info("getServiceMode()"); return (_call("_getServiceMode")); } public function setDetectTitle(_arg1:Boolean):void{ _debug.info((("setDetectTitle( " + _arg1) + " )")); _call("_setDetectTitle", _arg1); } private function _createTrackingObject(_arg1:String):void{ _proxy.call(_createTrackingObject_js, _arg1); } public function setCampaignTrack(_arg1:Boolean):void{ _debug.info((("setCampaignTrack( " + _arg1) + " )")); _call("_setCampaignTrack", _arg1); } public function clearOrganic():void{ _debug.info("clearOrganic()"); _call("_clearOrganic"); } public function setCampTermKey(_arg1:String):void{ _debug.info((("setCampTermKey( " + _arg1) + " )")); _call("_setCampTermKey", _arg1); } public function getDetectFlash():Boolean{ _debug.info("getDetectFlash()"); return (_call("_getDetectFlash")); } public function setCampMediumKey(_arg1:String):void{ _debug.info((("setCampMediumKey( " + _arg1) + " )")); _call("_setCampMediumKey", _arg1); } public function addIgnoredRef(_arg1:String):void{ _debug.info((("addIgnoredRef( " + _arg1) + " )")); _call("_addIgnoredRef", _arg1); } public function setSessionTimeout(_arg1:int):void{ _debug.info((("setSessionTimeout( " + _arg1) + " )")); _call("_setSessionTimeout", _arg1); } public function setRemoteServerMode():void{ _debug.info("setRemoteServerMode()"); _call("_setRemoteServerMode"); } public function getAccount():String{ _debug.info("getAccount()"); return (_call("_getAccount")); } } }//package com.google.analytics.v4
Section 65
//Configuration (com.google.analytics.v4.Configuration) package com.google.analytics.v4 { import com.google.analytics.core.*; import com.google.analytics.debug.*; import com.google.analytics.utils.*; import com.google.analytics.campaign.*; public class Configuration { public var serverMode:ServerOperationMode; public var detectFlash:Boolean;// = true public var allowLocalTracking:Boolean;// = true public var secureRemoteGIFpath:String;// = "https://ssl.google-analytics.com/__utm.gif" public var hasSiteOverlay:Boolean;// = false private var _version:String;// = "4.3as" public var allowDomainHash:Boolean;// = true public var detectClientInfo:Boolean;// = true public var idleLoop:Number;// = 30 public var isTrackOutboundSubdomains:Boolean;// = false public var cookiePath:String;// = "/" public var transactionFieldDelim:String;// = "|" private var _organic:Organic; private var _cookieName:String;// = "analytics" public var campaignKey:CampaignKey; public var google:String;// = "google" public var googleCsePath:String;// = "cse" public var bucketCapacity:Number;// = 10 private var _sampleRate:Number;// = 1 public var remoteGIFpath:String;// = "http://www.google-analytics.com/__utm.gif" public var googleSearchParam:String;// = "q" public var allowLinker:Boolean;// = false public var maxOutboundLinkExamined:Number;// = 1000 private var _debug:DebugConfiguration; private var _trackingLimitPerSession:int;// = 500 private var _domain:Domain; public var allowAnchor:Boolean;// = false public var tokenCliff:int;// = 10 public var sessionTimeout:Number; public var idleTimeout:Number;// = 60 public var campaignTracking:Boolean;// = true public var domainName:String;// = "" public var detectTitle:Boolean;// = true public var tokenRate:Number;// = 0.2 public var conversionTimeout:Number; public var localGIFpath:String;// = "/__utm.gif" public function Configuration(_arg1:DebugConfiguration=null){ _version = "4.3as"; _sampleRate = 1; _trackingLimitPerSession = 500; _organic = new Organic(); googleCsePath = "cse"; googleSearchParam = "q"; google = "google"; _cookieName = "analytics"; allowDomainHash = true; allowAnchor = false; allowLinker = false; hasSiteOverlay = false; tokenRate = 0.2; conversionTimeout = Timespan.sixmonths; sessionTimeout = Timespan.thirtyminutes; idleLoop = 30; idleTimeout = 60; maxOutboundLinkExamined = 1000; tokenCliff = 10; bucketCapacity = 10; detectClientInfo = true; detectFlash = true; detectTitle = true; campaignKey = new CampaignKey(); campaignTracking = true; isTrackOutboundSubdomains = false; serverMode = ServerOperationMode.remote; localGIFpath = "/__utm.gif"; remoteGIFpath = "http://www.google-analytics.com/__utm.gif"; secureRemoteGIFpath = "https://ssl.google-analytics.com/__utm.gif"; cookiePath = "/"; transactionFieldDelim = "|"; domainName = ""; allowLocalTracking = true; super(); _debug = _arg1; _domain = new Domain(DomainNameMode.auto, "", _debug); serverMode = ServerOperationMode.remote; _initOrganicSources(); } public function get organic():Organic{ return (_organic); } public function get trackingLimitPerSession():int{ return (_trackingLimitPerSession); } private function _initOrganicSources():void{ addOrganicSource(google, googleSearchParam); addOrganicSource("yahoo", "p"); addOrganicSource("msn", "q"); addOrganicSource("aol", "query"); addOrganicSource("aol", "encquery"); addOrganicSource("lycos", "query"); addOrganicSource("ask", "q"); addOrganicSource("altavista", "q"); addOrganicSource("netscape", "query"); addOrganicSource("cnn", "query"); addOrganicSource("looksmart", "qt"); addOrganicSource("about", "terms"); addOrganicSource("mamma", "query"); addOrganicSource("alltheweb", "q"); addOrganicSource("gigablast", "q"); addOrganicSource("voila", "rdata"); addOrganicSource("virgilio", "qs"); addOrganicSource("live", "q"); addOrganicSource("baidu", "wd"); addOrganicSource("alice", "qs"); addOrganicSource("yandex", "text"); addOrganicSource("najdi", "q"); addOrganicSource("aol", "q"); addOrganicSource("club-internet", "q"); addOrganicSource("mama", "query"); addOrganicSource("seznam", "q"); addOrganicSource("search", "q"); addOrganicSource("wp", "szukaj"); addOrganicSource("onet", "qt"); addOrganicSource("netsprint", "q"); addOrganicSource("google.interia", "q"); addOrganicSource("szukacz", "q"); addOrganicSource("yam", "k"); addOrganicSource("pchome", "q"); addOrganicSource("kvasir", "searchExpr"); addOrganicSource("sesam", "q"); addOrganicSource("ozu", "q"); addOrganicSource("terra", "query"); addOrganicSource("nostrum", "query"); addOrganicSource("mynet", "q"); addOrganicSource("ekolay", "q"); addOrganicSource("search.ilse", "search_for"); } public function get sampleRate():Number{ return (_sampleRate); } public function get cookieName():String{ return (_cookieName); } public function addOrganicSource(_arg1:String, _arg2:String):void{ var engine = _arg1; var keyword = _arg2; try { _organic.addSource(engine, keyword); } catch(e:Error) { if (((_debug) && (_debug.active))){ _debug.warning(e.message); }; }; } public function get domain():Domain{ return (_domain); } public function set sampleRate(_arg1:Number):void{ if (_arg1 <= 0){ _arg1 = 0.1; }; if (_arg1 > 1){ _arg1 = 1; }; _arg1 = Number(_arg1.toFixed(2)); _sampleRate = _arg1; } public function get version():String{ return (_version); } } }//package com.google.analytics.v4
Section 66
//GoogleAnalyticsAPI (com.google.analytics.v4.GoogleAnalyticsAPI) package com.google.analytics.v4 { import com.google.analytics.core.*; public interface GoogleAnalyticsAPI { function setCampSourceKey(_arg1:String):void; function getServiceMode():ServerOperationMode; function resetSession():void; function setLocalServerMode():void; function setCampContentKey(_arg1:String):void; function addOrganic(_arg1:String, _arg2:String):void; function setDetectFlash(_arg1:Boolean):void; function addTrans(_arg1:String, _arg2:String, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:String, _arg7:String, _arg8:String):Object; function trackEvent(_arg1:String, _arg2:String, _arg3:String=null, _arg4:Number=NaN):Boolean; function setCampTermKey(_arg1:String):void; function setCampNameKey(_arg1:String):void; function addIgnoredOrganic(_arg1:String):void; function addItem(_arg1:String, _arg2:String, _arg3:String, _arg4:String, _arg5:Number, _arg6:int):void; function setAllowLinker(_arg1:Boolean):void; function getClientInfo():Boolean; function getDetectFlash():Boolean; function setCampaignTrack(_arg1:Boolean):void; function createEventTracker(_arg1:String):EventTracker; function setCookieTimeout(_arg1:int):void; function setAllowAnchor(_arg1:Boolean):void; function trackTrans():void; function clearOrganic():void; function trackPageview(_arg1:String=""):void; function setLocalGifPath(_arg1:String):void; function getVersion():String; function getLocalGifPath():String; function setVar(_arg1:String):void; function clearIgnoredOrganic():void; function setCampMediumKey(_arg1:String):void; function addIgnoredRef(_arg1:String):void; function setClientInfo(_arg1:Boolean):void; function setCookiePath(_arg1:String):void; function setSampleRate(_arg1:Number):void; function setSessionTimeout(_arg1:int):void; function setRemoteServerMode():void; function clearIgnoredRef():void; function setDomainName(_arg1:String):void; function setDetectTitle(_arg1:Boolean):void; function setAllowHash(_arg1:Boolean):void; function getAccount():String; function linkByPost(_arg1:Object, _arg2:Boolean=false):void; function link(_arg1:String, _arg2:Boolean=false):void; function setCampNOKey(_arg1:String):void; function setLocalRemoteServerMode():void; function cookiePathCopy(_arg1:String):void; function getDetectTitle():Boolean; } }//package com.google.analytics.v4
Section 67
//Tracker (com.google.analytics.v4.Tracker) package com.google.analytics.v4 { import com.google.analytics.core.*; import com.google.analytics.debug.*; import com.google.analytics.data.*; import com.google.analytics.utils.*; import com.google.analytics.external.*; import com.google.analytics.campaign.*; public class Tracker implements GoogleAnalyticsAPI { private const EVENT_TRACKER_LABEL_KEY_NUM:int = 3; private const EVENT_TRACKER_VALUE_VALUE_NUM:int = 1; private const EVENT_TRACKER_PROJECT_ID:int = 5; private const EVENT_TRACKER_OBJECT_NAME_KEY_NUM:int = 1; private const EVENT_TRACKER_TYPE_KEY_NUM:int = 2; private var _adSense:AdSenseGlobals; private var _eventTracker:X10; private var _noSessionInformation:Boolean;// = false private var _browserInfo:BrowserInfo; private var _debug:DebugConfiguration; private var _isNewVisitor:Boolean;// = false private var _buffer:Buffer; private var _config:Configuration; private var _x10Module:X10; private var _campaign:CampaignManager; private var _formatedReferrer:String; private var _timeStamp:Number; private var _info:Environment; private var _domainHash:Number; private var _campaignInfo:CampaignInfo; private var _gifRequest:GIFRequest; private var _hasInitData:Boolean;// = false private var _account:String; public function Tracker(_arg1:String, _arg2:Configuration, _arg3:DebugConfiguration, _arg4:Environment, _arg5:Buffer, _arg6:GIFRequest, _arg7:AdSenseGlobals){ var _local8:String; super(); _account = _arg1; _config = _arg2; _debug = _arg3; _info = _arg4; _buffer = _arg5; _gifRequest = _arg6; _adSense = _arg7; if (!Utils.validateAccount(_arg1)){ _local8 = (("Account \"" + _arg1) + "\" is not valid."); _debug.warning(_local8); throw (new Error(_local8)); }; _initData(); } private function _doTracking():Boolean{ if (((((!((_info.protocol == Protocols.file))) && (!((_info.protocol == Protocols.none))))) && (_isNotGoogleSearch()))){ return (true); }; if (_config.allowLocalTracking){ return (true); }; return (false); } public function addOrganic(_arg1:String, _arg2:String):void{ _debug.info((("addOrganic( " + [_arg1, _arg2].join(", ")) + " )")); _config.organic.addSource(_arg1, _arg2); } public function setAllowLinker(_arg1:Boolean):void{ _config.allowLinker = _arg1; _debug.info((("setAllowLinker( " + _config.allowLinker) + " )")); } public function trackEvent(_arg1:String, _arg2:String, _arg3:String=null, _arg4:Number=NaN):Boolean{ var _local5:Boolean; var _local6 = 2; if (((!((_arg1 == ""))) && (!((_arg2 == ""))))){ _eventTracker.clearKey(EVENT_TRACKER_PROJECT_ID); _eventTracker.clearValue(EVENT_TRACKER_PROJECT_ID); _local5 = _eventTracker.setKey(EVENT_TRACKER_PROJECT_ID, EVENT_TRACKER_OBJECT_NAME_KEY_NUM, _arg1); _local5 = _eventTracker.setKey(EVENT_TRACKER_PROJECT_ID, EVENT_TRACKER_TYPE_KEY_NUM, _arg2); if (((_arg3) && (!((_arg3 == ""))))){ _local5 = _eventTracker.setKey(EVENT_TRACKER_PROJECT_ID, EVENT_TRACKER_LABEL_KEY_NUM, _arg3); _local6 = 3; if (!isNaN(_arg4)){ _local5 = _eventTracker.setValue(EVENT_TRACKER_PROJECT_ID, EVENT_TRACKER_VALUE_VALUE_NUM, _arg4); _local6 = 4; }; }; if (_local5){ _debug.info(((("valid event tracking call\ncategory: " + _arg1) + "\naction: ") + _arg2), VisualDebugMode.geek); _sendXEvent(_eventTracker); }; } else { _debug.warning(((("event tracking call is not valid, failed!\ncategory: " + _arg1) + "\naction: ") + _arg2), VisualDebugMode.geek); _local5 = false; }; switch (_local6){ case 4: _debug.info((("trackEvent( " + [_arg1, _arg2, _arg3, _arg4].join(", ")) + " )")); break; case 3: _debug.info((("trackEvent( " + [_arg1, _arg2, _arg3].join(", ")) + " )")); break; case 2: default: _debug.info((("trackEvent( " + [_arg1, _arg2].join(", ")) + " )")); }; return (_local5); } public function trackPageview(_arg1:String=""):void{ _debug.info((("trackPageview( " + _arg1) + " )")); if (_doTracking()){ _initData(); _trackMetrics(_arg1); _noSessionInformation = false; } else { _debug.warning((("trackPageview( " + _arg1) + " ) failed")); }; } public function setCookieTimeout(_arg1:int):void{ _config.conversionTimeout = _arg1; _debug.info((("setCookieTimeout( " + _config.conversionTimeout) + " )")); } public function trackTrans():void{ _debug.warning("trackTrans() not implemented"); } public function setClientInfo(_arg1:Boolean):void{ _config.detectClientInfo = _arg1; _debug.info((("setClientInfo( " + _config.detectClientInfo) + " )")); } public function linkByPost(_arg1:Object, _arg2:Boolean=false):void{ _debug.warning((("linkByPost( " + [_arg1, _arg2].join(", ")) + " ) not implemented")); } private function _initData():void{ var _local1:String; var _local2:String; if (!_hasInitData){ _updateDomainName(); _domainHash = _getDomainHash(); _timeStamp = Math.round((new Date().getTime() / 1000)); if (_debug.verbose){ _local1 = ""; _local1 = (_local1 + "_initData 0"); _local1 = (_local1 + ("\ndomain name: " + _config.domainName)); _local1 = (_local1 + ("\ndomain hash: " + _domainHash)); _local1 = (_local1 + (((("\ntimestamp: " + _timeStamp) + " (") + new Date((_timeStamp * 1000))) + ")")); _debug.info(_local1, VisualDebugMode.geek); }; }; if (_doTracking()){ _handleCookie(); }; if (!_hasInitData){ if (_doTracking()){ _formatedReferrer = _formatReferrer(); _browserInfo = new BrowserInfo(_config, _info); _debug.info(("browserInfo: " + _browserInfo.toURLString()), VisualDebugMode.advanced); if (_config.campaignTracking){ _campaign = new CampaignManager(_config, _debug, _buffer, _domainHash, _formatedReferrer, _timeStamp); _campaignInfo = _campaign.getCampaignInformation(_info.locationSearch, _noSessionInformation); _debug.info(("campaignInfo: " + _campaignInfo.toURLString()), VisualDebugMode.advanced); }; }; _x10Module = new X10(); _eventTracker = new X10(); _hasInitData = true; }; if (_config.hasSiteOverlay){ _debug.warning("Site Overlay is not supported"); }; if (_debug.verbose){ _local2 = ""; _local2 = (_local2 + "_initData (misc)"); _local2 = (_local2 + ("\nflash version: " + _info.flashVersion.toString(4))); _local2 = (_local2 + ("\nprotocol: " + _info.protocol)); _local2 = (_local2 + (("\ndefault domain name (auto): \"" + _info.domainName) + "\"")); _local2 = (_local2 + ("\nlanguage: " + _info.language)); _local2 = (_local2 + ("\ndomain hash: " + _getDomainHash())); _local2 = (_local2 + ("\nuser-agent: " + _info.userAgent)); _debug.info(_local2, VisualDebugMode.geek); }; } public function getDetectTitle():Boolean{ _debug.info("getDetectTitle()"); return (_config.detectTitle); } public function resetSession():void{ _debug.info("resetSession()"); _buffer.resetCurrentSession(); } public function getClientInfo():Boolean{ _debug.info("getClientInfo()"); return (_config.detectClientInfo); } private function _sendXEvent(_arg1:X10=null):void{ var _local2:Variables; var _local3:EventInfo; var _local4:Variables; var _local5:Variables; _initData(); if (_takeSample()){ _local2 = new Variables(); _local2.URIencode = true; _local3 = new EventInfo(true, _x10Module, _arg1); _local4 = _local3.toVariables(); _local5 = _renderMetricsSearchVariables(); _local2.join(_local4, _local5); _gifRequest.send(_account, _local2, false, true); }; } public function setDetectFlash(_arg1:Boolean):void{ _config.detectFlash = _arg1; _debug.info((("setDetectFlash( " + _config.detectFlash) + " )")); } public function setCampNameKey(_arg1:String):void{ _config.campaignKey.UCCN = _arg1; var _local2 = (("setCampNameKey( " + _config.campaignKey.UCCN) + " )"); if (_debug.mode == VisualDebugMode.geek){ _debug.info((_local2 + " [UCCN]")); } else { _debug.info(_local2); }; } private function _formatReferrer():String{ var _local2:String; var _local3:URL; var _local4:URL; var _local1:String = _info.referrer; if ((((_local1 == "")) || ((_local1 == "localhost")))){ _local1 = "-"; } else { _local2 = _info.domainName; _local3 = new URL(_local1); _local4 = new URL(("http://" + _local2)); if (_local3.hostName == _local2){ return ("-"); }; if (_local4.domain == _local3.domain){ if (_local4.subDomain != _local3.subDomain){ _local1 = "0"; }; }; if ((((_local1.charAt(0) == "[")) && (_local1.charAt((_local1.length - 1))))){ _local1 = "-"; }; }; _debug.info(("formated referrer: " + _local1), VisualDebugMode.advanced); return (_local1); } private function _visitCode():Number{ if (_debug.verbose){ _debug.info(("visitCode: " + _buffer.utma.sessionId), VisualDebugMode.geek); }; return (_buffer.utma.sessionId); } public function createEventTracker(_arg1:String):EventTracker{ _debug.info((("createEventTracker( " + _arg1) + " )")); return (new EventTracker(_arg1, this)); } public function addItem(_arg1:String, _arg2:String, _arg3:String, _arg4:String, _arg5:Number, _arg6:int):void{ _debug.warning((("addItem( " + [_arg1, _arg2, _arg3, _arg4, _arg5, _arg6].join(", ")) + " ) not implemented")); } public function clearIgnoredOrganic():void{ _debug.info("clearIgnoredOrganic()"); _config.organic.clearIgnoredKeywords(); } public function setVar(_arg1:String):void{ var _local2:Variables; if (((!((_arg1 == ""))) && (_isNotGoogleSearch()))){ _initData(); _buffer.utmv.domainHash = _domainHash; _buffer.utmv.value = _arg1; if (_debug.verbose){ _debug.info(_buffer.utmv.toString(), VisualDebugMode.geek); }; _debug.info((("setVar( " + _arg1) + " )")); if (_takeSample()){ _local2 = new Variables(); _local2.utmt = "var"; _gifRequest.send(_account, _local2); }; } else { _debug.warning((("setVar \"" + _arg1) + "\" is ignored")); }; } public function setDomainName(_arg1:String):void{ if (_arg1 == "auto"){ _config.domain.mode = DomainNameMode.auto; } else { if (_arg1 == "none"){ _config.domain.mode = DomainNameMode.none; } else { _config.domain.mode = DomainNameMode.custom; _config.domain.name = _arg1; }; }; _updateDomainName(); _debug.info((("setDomainName( " + _config.domainName) + " )")); } private function _updateDomainName():void{ var _local1:String; if (_config.domain.mode == DomainNameMode.auto){ _local1 = _info.domainName; if (_local1.substring(0, 4) == "www."){ _local1 = _local1.substring(4); }; _config.domain.name = _local1; }; _config.domainName = _config.domain.name.toLowerCase(); _debug.info(("domain name: " + _config.domainName), VisualDebugMode.advanced); } public function addTrans(_arg1:String, _arg2:String, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:String, _arg7:String, _arg8:String):Object{ _debug.warning((("addTrans( " + [_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7, _arg8].join(", ")) + " ) not implemented")); return (null); } private function _renderMetricsSearchVariables(_arg1:String=""):Variables{ var _local4:Variables; var _local2:Variables = new Variables(); _local2.URIencode = true; var _local3:DocumentInfo = new DocumentInfo(_config, _info, _formatedReferrer, _arg1, _adSense); _debug.info(("docInfo: " + _local3.toURLString()), VisualDebugMode.geek); if (_config.campaignTracking){ _local4 = _campaignInfo.toVariables(); }; var _local5:Variables = _browserInfo.toVariables(); _local2.join(_local3.toVariables(), _local5, _local4); return (_local2); } public function setCampContentKey(_arg1:String):void{ _config.campaignKey.UCCT = _arg1; var _local2 = (("setCampContentKey( " + _config.campaignKey.UCCT) + " )"); if (_debug.mode == VisualDebugMode.geek){ _debug.info((_local2 + " [UCCT]")); } else { _debug.info(_local2); }; } private function _handleCookie():void{ var _local1:String; var _local2:String; var _local3:Array; var _local4:String; if (_config.allowLinker){ }; if (((_buffer.hasUTMA()) && (!(_buffer.utma.isEmpty())))){ if (((!(_buffer.hasUTMB())) || (!(_buffer.hasUTMC())))){ _buffer.updateUTMA(_timeStamp); _noSessionInformation = true; }; if (_debug.verbose){ _debug.info(("from cookie " + _buffer.utma.toString()), VisualDebugMode.geek); }; } else { _debug.info("create a new utma", VisualDebugMode.advanced); _buffer.utma.domainHash = _domainHash; _buffer.utma.sessionId = _getUniqueSessionId(); _buffer.utma.firstTime = _timeStamp; _buffer.utma.lastTime = _timeStamp; _buffer.utma.currentTime = _timeStamp; _buffer.utma.sessionCount = 1; if (_debug.verbose){ _debug.info(_buffer.utma.toString(), VisualDebugMode.geek); }; _noSessionInformation = true; _isNewVisitor = true; }; if (((_adSense.gaGlobal) && ((_adSense.dh == String(_domainHash))))){ if (_adSense.sid){ _buffer.utma.currentTime = Number(_adSense.sid); if (_debug.verbose){ _local1 = ""; _local1 = (_local1 + "AdSense sid found\n"); _local1 = (_local1 + (((("Override currentTime(" + _buffer.utma.currentTime) + ") from AdSense sid(") + Number(_adSense.sid)) + ")")); _debug.info(_local1, VisualDebugMode.geek); }; }; if (_isNewVisitor){ if (_adSense.sid){ _buffer.utma.lastTime = Number(_adSense.sid); if (_debug.verbose){ _local2 = ""; _local2 = (_local2 + "AdSense sid found (new visitor)\n"); _local2 = (_local2 + (((("Override lastTime(" + _buffer.utma.lastTime) + ") from AdSense sid(") + Number(_adSense.sid)) + ")")); _debug.info(_local2, VisualDebugMode.geek); }; }; if (_adSense.vid){ _local3 = _adSense.vid.split("."); _buffer.utma.sessionId = Number(_local3[0]); _buffer.utma.firstTime = Number(_local3[1]); if (_debug.verbose){ _local4 = ""; _local4 = (_local4 + "AdSense vid found (new visitor)\n"); _local4 = (_local4 + (((("Override sessionId(" + _buffer.utma.sessionId) + ") from AdSense vid(") + Number(_local3[0])) + ")\n")); _local4 = (_local4 + (((("Override firstTime(" + _buffer.utma.firstTime) + ") from AdSense vid(") + Number(_local3[1])) + ")")); _debug.info(_local4, VisualDebugMode.geek); }; }; if (_debug.verbose){ _debug.info(("AdSense modified : " + _buffer.utma.toString()), VisualDebugMode.geek); }; }; }; _buffer.utmb.domainHash = _domainHash; if (isNaN(_buffer.utmb.trackCount)){ _buffer.utmb.trackCount = 0; }; if (isNaN(_buffer.utmb.token)){ _buffer.utmb.token = _config.tokenCliff; }; if (isNaN(_buffer.utmb.lastTime)){ _buffer.utmb.lastTime = _buffer.utma.currentTime; }; _buffer.utmc.domainHash = _domainHash; if (_debug.verbose){ _debug.info(_buffer.utmb.toString(), VisualDebugMode.advanced); _debug.info(_buffer.utmc.toString(), VisualDebugMode.advanced); }; } public function setLocalServerMode():void{ _config.serverMode = ServerOperationMode.local; _debug.info("setLocalServerMode()"); } public function clearIgnoredRef():void{ _debug.info("clearIgnoredRef()"); _config.organic.clearIgnoredReferrals(); } public function setCampSourceKey(_arg1:String):void{ _config.campaignKey.UCSR = _arg1; var _local2 = (("setCampSourceKey( " + _config.campaignKey.UCSR) + " )"); if (_debug.mode == VisualDebugMode.geek){ _debug.info((_local2 + " [UCSR]")); } else { _debug.info(_local2); }; } public function getLocalGifPath():String{ _debug.info("getLocalGifPath()"); return (_config.localGIFpath); } public function setLocalGifPath(_arg1:String):void{ _config.localGIFpath = _arg1; _debug.info((("setLocalGifPath( " + _config.localGIFpath) + " )")); } public function getVersion():String{ _debug.info("getVersion()"); return (_config.version); } public function setAllowAnchor(_arg1:Boolean):void{ _config.allowAnchor = _arg1; _debug.info((("setAllowAnchor( " + _config.allowAnchor) + " )")); } private function _isNotGoogleSearch():Boolean{ var _local1:String = _config.domainName; var _local2 = (_local1.indexOf("www.google.") < 0); var _local3 = (_local1.indexOf(".google.") < 0); var _local4 = (_local1.indexOf("google.") < 0); var _local5 = (_local1.indexOf("google.org") > -1); return (((((((((_local2) || (_local3))) || (_local4))) || (!((_config.cookiePath == "/"))))) || (_local5))); } public function setSampleRate(_arg1:Number):void{ if (_arg1 < 0){ _debug.warning("sample rate can not be negative, ignoring value."); } else { _config.sampleRate = _arg1; }; _debug.info((("setSampleRate( " + _config.sampleRate) + " )")); } private function _takeSample():Boolean{ if (_debug.verbose){ _debug.info((((("takeSample: (" + (_visitCode() % 10000)) + ") < (") + (_config.sampleRate * 10000)) + ")"), VisualDebugMode.geek); }; return (((_visitCode() % 10000) < (_config.sampleRate * 10000))); } public function setCookiePath(_arg1:String):void{ _config.cookiePath = _arg1; _debug.info((("setCookiePath( " + _config.cookiePath) + " )")); } public function setAllowHash(_arg1:Boolean):void{ _config.allowDomainHash = _arg1; _debug.info((("setAllowHash( " + _config.allowDomainHash) + " )")); } private function _generateUserDataHash():Number{ var _local1 = ""; _local1 = (_local1 + _info.appName); _local1 = (_local1 + _info.appVersion); _local1 = (_local1 + _info.language); _local1 = (_local1 + _info.platform); _local1 = (_local1 + _info.userAgent.toString()); _local1 = (_local1 + (((_info.screenWidth + "x") + _info.screenHeight) + _info.screenColorDepth)); _local1 = (_local1 + _info.referrer); return (Utils.generateHash(_local1)); } public function setCampNOKey(_arg1:String):void{ _config.campaignKey.UCNO = _arg1; var _local2 = (("setCampNOKey( " + _config.campaignKey.UCNO) + " )"); if (_debug.mode == VisualDebugMode.geek){ _debug.info((_local2 + " [UCNO]")); } else { _debug.info(_local2); }; } public function addIgnoredOrganic(_arg1:String):void{ _debug.info((("addIgnoredOrganic( " + _arg1) + " )")); _config.organic.addIgnoredKeyword(_arg1); } public function setLocalRemoteServerMode():void{ _config.serverMode = ServerOperationMode.both; _debug.info("setLocalRemoteServerMode()"); } public function cookiePathCopy(_arg1:String):void{ _debug.warning((("cookiePathCopy( " + _arg1) + " ) not implemented")); } public function setDetectTitle(_arg1:Boolean):void{ _config.detectTitle = _arg1; _debug.info((("setDetectTitle( " + _config.detectTitle) + " )")); } public function setCampTermKey(_arg1:String):void{ _config.campaignKey.UCTR = _arg1; var _local2 = (("setCampTermKey( " + _config.campaignKey.UCTR) + " )"); if (_debug.mode == VisualDebugMode.geek){ _debug.info((_local2 + " [UCTR]")); } else { _debug.info(_local2); }; } public function getServiceMode():ServerOperationMode{ _debug.info("getServiceMode()"); return (_config.serverMode); } private function _trackMetrics(_arg1:String=""):void{ var _local2:Variables; var _local3:Variables; var _local4:Variables; var _local5:EventInfo; if (_takeSample()){ _local2 = new Variables(); _local2.URIencode = true; if (((_x10Module) && (_x10Module.hasData()))){ _local5 = new EventInfo(false, _x10Module); _local3 = _local5.toVariables(); }; _local4 = _renderMetricsSearchVariables(_arg1); _local2.join(_local3, _local4); _gifRequest.send(_account, _local2); }; } public function setCampaignTrack(_arg1:Boolean):void{ _config.campaignTracking = _arg1; _debug.info((("setCampaignTrack( " + _config.campaignTracking) + " )")); } public function addIgnoredRef(_arg1:String):void{ _debug.info((("addIgnoredRef( " + _arg1) + " )")); _config.organic.addIgnoredReferral(_arg1); } public function clearOrganic():void{ _debug.info("clearOrganic()"); _config.organic.clearEngines(); } public function getDetectFlash():Boolean{ _debug.info("getDetectFlash()"); return (_config.detectFlash); } public function setCampMediumKey(_arg1:String):void{ _config.campaignKey.UCMD = _arg1; var _local2 = (("setCampMediumKey( " + _config.campaignKey.UCMD) + " )"); if (_debug.mode == VisualDebugMode.geek){ _debug.info((_local2 + " [UCMD]")); } else { _debug.info(_local2); }; } private function _getUniqueSessionId():Number{ var _local1:Number = ((Utils.generate32bitRandom() ^ _generateUserDataHash()) * 2147483647); _debug.info(("Session ID: " + _local1), VisualDebugMode.geek); return (_local1); } private function _getDomainHash():Number{ if (((((!(_config.domainName)) || ((_config.domainName == "")))) || ((_config.domain.mode == DomainNameMode.none)))){ _config.domainName = ""; return (1); }; _updateDomainName(); if (_config.allowDomainHash){ return (Utils.generateHash(_config.domainName)); }; return (1); } public function setSessionTimeout(_arg1:int):void{ _config.sessionTimeout = _arg1; _debug.info((("setSessionTimeout( " + _config.sessionTimeout) + " )")); } public function getAccount():String{ _debug.info("getAccount()"); return (_account); } public function link(_arg1:String, _arg2:Boolean=false):void{ _debug.warning((("link( " + [_arg1, _arg2].join(", ")) + " ) not implemented")); } public function setRemoteServerMode():void{ _config.serverMode = ServerOperationMode.remote; _debug.info("setRemoteServerMode()"); } } }//package com.google.analytics.v4
Section 68
//AnalyticsTracker (com.google.analytics.AnalyticsTracker) package com.google.analytics { import com.google.analytics.v4.*; import com.google.analytics.debug.*; import flash.events.*; public interface AnalyticsTracker extends GoogleAnalyticsAPI, IEventDispatcher { function set config(_arg1:Configuration):void; function isReady():Boolean; function get mode():String; function set debug(_arg1:DebugConfiguration):void; function get account():String; function set mode(_arg1:String):void; function get config():Configuration; function get debug():DebugConfiguration; function set account(_arg1:String):void; function get visualDebug():Boolean; function set visualDebug(_arg1:Boolean):void; } }//package com.google.analytics
Section 69
//API (com.google.analytics.API) package com.google.analytics { import com.google.analytics.utils.*; public class API { public static var version:Version = new Version(); version.major = 1; version.minor = 0; version.build = 1; version.revision = "$Rev: 319 $ ".split(" ")[1]; } }//package com.google.analytics
Section 70
//GATracker (com.google.analytics.GATracker) package com.google.analytics { import com.google.analytics.core.*; import com.google.analytics.v4.*; import com.google.analytics.debug.*; import flash.events.*; import flash.display.*; import com.google.analytics.utils.*; import com.google.analytics.external.*; import com.google.analytics.events.*; public class GATracker implements AnalyticsTracker { private var _adSense:AdSenseGlobals; private var _env:Environment; private var _visualDebug:Boolean; private var _idleTimer:IdleTimer; private var _debug:DebugConfiguration; private var _buffer:Buffer; private var _config:Configuration; private var _mode:String; private var _display:DisplayObject; private var _jsproxy:JavascriptProxy; private var _dom:HTMLDOM; private var _eventDispatcher:EventDispatcher; private var _ready:Boolean;// = false private var _gifRequest:GIFRequest; private var _account:String; private var _tracker:GoogleAnalyticsAPI; public static var version:Version = API.version; public static var autobuild:Boolean = true; public function GATracker(_arg1:DisplayObject, _arg2:String, _arg3:String="AS3", _arg4:Boolean=false, _arg5:Configuration=null, _arg6:DebugConfiguration=null){ _ready = false; super(); _display = _arg1; _eventDispatcher = new EventDispatcher(this); _tracker = new TrackerCache(); this.account = _arg2; this.mode = _arg3; this.visualDebug = _arg4; if (!_arg6){ this.debug = new DebugConfiguration(); }; if (!_arg5){ this.config = new Configuration(_arg6); }; if (autobuild){ _factory(); }; } public function link(_arg1:String, _arg2:Boolean=false):void{ _tracker.link(_arg1, _arg2); } public function addOrganic(_arg1:String, _arg2:String):void{ _tracker.addOrganic(_arg1, _arg2); } public function setAllowLinker(_arg1:Boolean):void{ _tracker.setAllowLinker(_arg1); } public function trackEvent(_arg1:String, _arg2:String, _arg3:String=null, _arg4:Number=NaN):Boolean{ return (_tracker.trackEvent(_arg1, _arg2, _arg3, _arg4)); } public function setCookieTimeout(_arg1:int):void{ _tracker.setCookieTimeout(_arg1); } public function trackTrans():void{ _tracker.trackTrans(); } public function trackPageview(_arg1:String=""):void{ _tracker.trackPageview(_arg1); } public function getClientInfo():Boolean{ return (_tracker.getClientInfo()); } public function setClientInfo(_arg1:Boolean):void{ _tracker.setClientInfo(_arg1); } public function get account():String{ return (_account); } public function linkByPost(_arg1:Object, _arg2:Boolean=false):void{ _tracker.linkByPost(_arg1, _arg2); } public function getDetectTitle():Boolean{ return (_tracker.getDetectTitle()); } public function dispatchEvent(_arg1:Event):Boolean{ return (_eventDispatcher.dispatchEvent(_arg1)); } public function get config():Configuration{ return (_config); } public function set mode(_arg1:String):void{ _mode = _arg1; } public function removeEventListener(_arg1:String, _arg2:Function, _arg3:Boolean=false):void{ _eventDispatcher.removeEventListener(_arg1, _arg2, _arg3); } public function setDetectFlash(_arg1:Boolean):void{ _tracker.setDetectFlash(_arg1); } public function resetSession():void{ _tracker.resetSession(); } public function setCampNameKey(_arg1:String):void{ _tracker.setCampNameKey(_arg1); } public function get debug():DebugConfiguration{ return (_debug); } public function addItem(_arg1:String, _arg2:String, _arg3:String, _arg4:String, _arg5:Number, _arg6:int):void{ _tracker.addItem(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6); } private function _bridgeFactory():GoogleAnalyticsAPI{ debug.info(((("GATracker (Bridge) v" + version) + "\naccount: ") + account)); return (new Bridge(account, _debug, _jsproxy)); } public function addEventListener(_arg1:String, _arg2:Function, _arg3:Boolean=false, _arg4:int=0, _arg5:Boolean=false):void{ _eventDispatcher.addEventListener(_arg1, _arg2, _arg3, _arg4, _arg5); } public function clearIgnoredOrganic():void{ _tracker.clearIgnoredOrganic(); } public function set account(_arg1:String):void{ _account = _arg1; } public function setVar(_arg1:String):void{ _tracker.setVar(_arg1); } public function build():void{ if (!isReady()){ _factory(); }; } public function setDomainName(_arg1:String):void{ _tracker.setDomainName(_arg1); } public function createEventTracker(_arg1:String):EventTracker{ return (_tracker.createEventTracker(_arg1)); } public function set config(_arg1:Configuration):void{ _config = _arg1; } public function addTrans(_arg1:String, _arg2:String, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:String, _arg7:String, _arg8:String):Object{ return (_tracker.addTrans(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7, _arg8)); } public function setCampSourceKey(_arg1:String):void{ _tracker.setCampSourceKey(_arg1); } public function setCampContentKey(_arg1:String):void{ _tracker.setCampContentKey(_arg1); } public function willTrigger(_arg1:String):Boolean{ return (_eventDispatcher.willTrigger(_arg1)); } public function setLocalServerMode():void{ _tracker.setLocalServerMode(); } public function isReady():Boolean{ return (_ready); } public function getLocalGifPath():String{ return (_tracker.getLocalGifPath()); } public function setAllowAnchor(_arg1:Boolean):void{ _tracker.setAllowAnchor(_arg1); } public function clearIgnoredRef():void{ _tracker.clearIgnoredRef(); } public function get mode():String{ return (_mode); } public function set debug(_arg1:DebugConfiguration):void{ _debug = _arg1; } public function setLocalGifPath(_arg1:String):void{ _tracker.setLocalGifPath(_arg1); } public function getVersion():String{ return (_tracker.getVersion()); } public function setSampleRate(_arg1:Number):void{ _tracker.setSampleRate(_arg1); } public function setCookiePath(_arg1:String):void{ _tracker.setCookiePath(_arg1); } public function setAllowHash(_arg1:Boolean):void{ _tracker.setAllowHash(_arg1); } public function setCampNOKey(_arg1:String):void{ _tracker.setCampNOKey(_arg1); } public function addIgnoredOrganic(_arg1:String):void{ _tracker.addIgnoredOrganic(_arg1); } public function setLocalRemoteServerMode():void{ _tracker.setLocalRemoteServerMode(); } public function cookiePathCopy(_arg1:String):void{ _tracker.cookiePathCopy(_arg1); } private function _factory():void{ var _local1:GoogleAnalyticsAPI; var _local2:TrackerCache; _jsproxy = new JavascriptProxy(debug); if (visualDebug){ debug.layout = new Layout(debug, _display); debug.active = visualDebug; }; _local2 = (_tracker as TrackerCache); switch (mode){ case TrackerMode.BRIDGE: _local1 = _bridgeFactory(); break; case TrackerMode.AS3: default: _local1 = _trackerFactory(); }; if (!_local2.isEmpty()){ _local2.tracker = _local1; _local2.flush(); }; _tracker = _local1; _ready = true; dispatchEvent(new AnalyticsEvent(AnalyticsEvent.READY, this)); } public function setCampTermKey(_arg1:String):void{ _tracker.setCampTermKey(_arg1); } private function _trackerFactory():GoogleAnalyticsAPI{ debug.info(((("GATracker (AS3) v" + version) + "\naccount: ") + account)); _adSense = new AdSenseGlobals(debug); _dom = new HTMLDOM(debug); _dom.cacheProperties(); _env = new Environment("", "", "", debug, _dom); _buffer = new Buffer(config, debug, false); _gifRequest = new GIFRequest(config, debug, _buffer, _env); _idleTimer = new IdleTimer(config, debug, _display, _buffer); _env.url = _display.stage.loaderInfo.url; return (new Tracker(account, config, debug, _env, _buffer, _gifRequest, _adSense)); } public function setDetectTitle(_arg1:Boolean):void{ _tracker.setDetectTitle(_arg1); } public function getServiceMode():ServerOperationMode{ return (_tracker.getServiceMode()); } public function clearOrganic():void{ _tracker.clearOrganic(); } public function setCampaignTrack(_arg1:Boolean):void{ _tracker.setCampaignTrack(_arg1); } public function addIgnoredRef(_arg1:String):void{ _tracker.addIgnoredRef(_arg1); } public function set visualDebug(_arg1:Boolean):void{ _visualDebug = _arg1; } public function setCampMediumKey(_arg1:String):void{ _tracker.setCampMediumKey(_arg1); } public function setSessionTimeout(_arg1:int):void{ _tracker.setSessionTimeout(_arg1); } public function getDetectFlash():Boolean{ return (_tracker.getDetectFlash()); } public function get visualDebug():Boolean{ return (_visualDebug); } public function getAccount():String{ return (_tracker.getAccount()); } public function hasEventListener(_arg1:String):Boolean{ return (_eventDispatcher.hasEventListener(_arg1)); } public function setRemoteServerMode():void{ _tracker.setRemoteServerMode(); } } var _local1:* = ServerOperationMode; return (_local1); }//package com.google.analytics
Section 71
//BaseScrollPane (fl.containers.BaseScrollPane) package fl.containers { import fl.core.*; import flash.events.*; import flash.display.*; import fl.controls.*; import flash.geom.*; import fl.events.*; public class BaseScrollPane extends UIComponent { protected var defaultLineScrollSize:Number;// = 4 protected var _maxHorizontalScrollPosition:Number;// = 0 protected var vScrollBar:Boolean; protected var disabledOverlay:Shape; protected var hScrollBar:Boolean; protected var availableWidth:Number; protected var _verticalPageScrollSize:Number;// = 0 protected var vOffset:Number;// = 0 protected var _verticalScrollBar:ScrollBar; protected var useFixedHorizontalScrolling:Boolean;// = false protected var contentWidth:Number;// = 0 protected var contentHeight:Number;// = 0 protected var _horizontalPageScrollSize:Number;// = 0 protected var background:DisplayObject; protected var _useBitmpScrolling:Boolean;// = false protected var contentPadding:Number;// = 0 protected var availableHeight:Number; protected var _horizontalScrollBar:ScrollBar; protected var contentScrollRect:Rectangle; protected var _horizontalScrollPolicy:String; protected var _verticalScrollPolicy:String; protected static const SCROLL_BAR_STYLES:Object = {upArrowDisabledSkin:"upArrowDisabledSkin", upArrowDownSkin:"upArrowDownSkin", upArrowOverSkin:"upArrowOverSkin", upArrowUpSkin:"upArrowUpSkin", downArrowDisabledSkin:"downArrowDisabledSkin", downArrowDownSkin:"downArrowDownSkin", downArrowOverSkin:"downArrowOverSkin", downArrowUpSkin:"downArrowUpSkin", thumbDisabledSkin:"thumbDisabledSkin", thumbDownSkin:"thumbDownSkin", thumbOverSkin:"thumbOverSkin", thumbUpSkin:"thumbUpSkin", thumbIcon:"thumbIcon", trackDisabledSkin:"trackDisabledSkin", trackDownSkin:"trackDownSkin", trackOverSkin:"trackOverSkin", trackUpSkin:"trackUpSkin", repeatDelay:"repeatDelay", repeatInterval:"repeatInterval"}; private static var defaultStyles:Object = {repeatDelay:500, repeatInterval:35, skin:"ScrollPane_upSkin", contentPadding:0, disabledAlpha:0.5}; public function BaseScrollPane(){ contentWidth = 0; contentHeight = 0; contentPadding = 0; vOffset = 0; _maxHorizontalScrollPosition = 0; _horizontalPageScrollSize = 0; _verticalPageScrollSize = 0; defaultLineScrollSize = 4; useFixedHorizontalScrolling = false; _useBitmpScrolling = false; super(); } protected function handleWheel(_arg1:MouseEvent):void{ if (((((!(enabled)) || (!(_verticalScrollBar.visible)))) || ((contentHeight <= availableHeight)))){ return; }; _verticalScrollBar.scrollPosition = (_verticalScrollBar.scrollPosition - (_arg1.delta * verticalLineScrollSize)); setVerticalScrollPosition(_verticalScrollBar.scrollPosition); dispatchEvent(new ScrollEvent(ScrollBarDirection.VERTICAL, _arg1.delta, horizontalScrollPosition)); } public function get verticalScrollPosition():Number{ return (_verticalScrollBar.scrollPosition); } protected function drawDisabledOverlay():void{ if (enabled){ if (contains(disabledOverlay)){ removeChild(disabledOverlay); }; } else { disabledOverlay.x = (disabledOverlay.y = contentPadding); disabledOverlay.width = availableWidth; disabledOverlay.height = availableHeight; disabledOverlay.alpha = (getStyleValue("disabledAlpha") as Number); addChild(disabledOverlay); }; } public function set verticalScrollPosition(_arg1:Number):void{ drawNow(); _verticalScrollBar.scrollPosition = _arg1; setVerticalScrollPosition(_verticalScrollBar.scrollPosition, false); } protected function setContentSize(_arg1:Number, _arg2:Number):void{ if ((((((contentWidth == _arg1)) || (useFixedHorizontalScrolling))) && ((contentHeight == _arg2)))){ return; }; contentWidth = _arg1; contentHeight = _arg2; invalidate(InvalidationType.SIZE); } public function get horizontalScrollPosition():Number{ return (_horizontalScrollBar.scrollPosition); } public function get horizontalScrollBar():ScrollBar{ return (_horizontalScrollBar); } override public function set enabled(_arg1:Boolean):void{ if (enabled == _arg1){ return; }; _verticalScrollBar.enabled = _arg1; _horizontalScrollBar.enabled = _arg1; super.enabled = _arg1; } public function get verticalLineScrollSize():Number{ return (_verticalScrollBar.lineScrollSize); } public function get horizontalScrollPolicy():String{ return (_horizontalScrollPolicy); } protected function calculateAvailableSize():void{ var _local1:Number; var _local2:Number; var _local3:Number; var _local4:Number; var _local5:Number; _local1 = ScrollBar.WIDTH; _local2 = (contentPadding = Number(getStyleValue("contentPadding"))); _local3 = ((height - (2 * _local2)) - vOffset); vScrollBar = (((_verticalScrollPolicy == ScrollPolicy.ON)) || ((((_verticalScrollPolicy == ScrollPolicy.AUTO)) && ((contentHeight > _local3))))); _local4 = ((width - (vScrollBar) ? _local1 : 0) - (2 * _local2)); _local5 = (useFixedHorizontalScrolling) ? _maxHorizontalScrollPosition : (contentWidth - _local4); hScrollBar = (((_horizontalScrollPolicy == ScrollPolicy.ON)) || ((((_horizontalScrollPolicy == ScrollPolicy.AUTO)) && ((_local5 > 0))))); if (hScrollBar){ _local3 = (_local3 - _local1); }; if (((((((hScrollBar) && (!(vScrollBar)))) && ((_verticalScrollPolicy == ScrollPolicy.AUTO)))) && ((contentHeight > _local3)))){ vScrollBar = true; _local4 = (_local4 - _local1); }; availableHeight = (_local3 + vOffset); availableWidth = _local4; } public function get maxVerticalScrollPosition():Number{ drawNow(); return (Math.max(0, (contentHeight - availableHeight))); } public function set horizontalScrollPosition(_arg1:Number):void{ drawNow(); _horizontalScrollBar.scrollPosition = _arg1; setHorizontalScrollPosition(_horizontalScrollBar.scrollPosition, false); } public function get horizontalLineScrollSize():Number{ return (_horizontalScrollBar.lineScrollSize); } public function set verticalPageScrollSize(_arg1:Number):void{ _verticalPageScrollSize = _arg1; invalidate(InvalidationType.SIZE); } public function get verticalScrollPolicy():String{ return (_verticalScrollPolicy); } protected function setHorizontalScrollPosition(_arg1:Number, _arg2:Boolean=false):void{ } public function get useBitmapScrolling():Boolean{ return (_useBitmpScrolling); } protected function handleScroll(_arg1:ScrollEvent):void{ if (_arg1.target == _verticalScrollBar){ setVerticalScrollPosition(_arg1.position); } else { setHorizontalScrollPosition(_arg1.position); }; } public function set verticalLineScrollSize(_arg1:Number):void{ _verticalScrollBar.lineScrollSize = _arg1; } public function get verticalScrollBar():ScrollBar{ return (_verticalScrollBar); } protected function setVerticalScrollPosition(_arg1:Number, _arg2:Boolean=false):void{ } public function set horizontalPageScrollSize(_arg1:Number):void{ _horizontalPageScrollSize = _arg1; invalidate(InvalidationType.SIZE); } override protected function draw():void{ if (isInvalid(InvalidationType.STYLES)){ setStyles(); drawBackground(); if (contentPadding != getStyleValue("contentPadding")){ invalidate(InvalidationType.SIZE, false); }; }; if (isInvalid(InvalidationType.SIZE, InvalidationType.STATE)){ drawLayout(); }; updateChildren(); super.draw(); } public function set horizontalScrollPolicy(_arg1:String):void{ _horizontalScrollPolicy = _arg1; invalidate(InvalidationType.SIZE); } override protected function configUI():void{ var _local1:Graphics; super.configUI(); contentScrollRect = new Rectangle(0, 0, 85, 85); _verticalScrollBar = new ScrollBar(); _verticalScrollBar.addEventListener(ScrollEvent.SCROLL, handleScroll, false, 0, true); _verticalScrollBar.visible = false; _verticalScrollBar.lineScrollSize = defaultLineScrollSize; addChild(_verticalScrollBar); copyStylesToChild(_verticalScrollBar, SCROLL_BAR_STYLES); _horizontalScrollBar = new ScrollBar(); _horizontalScrollBar.direction = ScrollBarDirection.HORIZONTAL; _horizontalScrollBar.addEventListener(ScrollEvent.SCROLL, handleScroll, false, 0, true); _horizontalScrollBar.visible = false; _horizontalScrollBar.lineScrollSize = defaultLineScrollSize; addChild(_horizontalScrollBar); copyStylesToChild(_horizontalScrollBar, SCROLL_BAR_STYLES); disabledOverlay = new Shape(); _local1 = disabledOverlay.graphics; _local1.beginFill(0xFFFFFF); _local1.drawRect(0, 0, width, height); _local1.endFill(); addEventListener(MouseEvent.MOUSE_WHEEL, handleWheel, false, 0, true); } protected function calculateContentWidth():void{ } public function get verticalPageScrollSize():Number{ if (isNaN(availableHeight)){ drawNow(); }; return (((((_verticalPageScrollSize == 0)) && (!(isNaN(availableHeight))))) ? availableHeight : _verticalPageScrollSize); } protected function drawLayout():void{ calculateAvailableSize(); calculateContentWidth(); background.width = width; background.height = height; if (vScrollBar){ _verticalScrollBar.visible = true; _verticalScrollBar.x = ((width - ScrollBar.WIDTH) - contentPadding); _verticalScrollBar.y = contentPadding; _verticalScrollBar.height = availableHeight; } else { _verticalScrollBar.visible = false; }; _verticalScrollBar.setScrollProperties(availableHeight, 0, (contentHeight - availableHeight), verticalPageScrollSize); setVerticalScrollPosition(_verticalScrollBar.scrollPosition, false); if (hScrollBar){ _horizontalScrollBar.visible = true; _horizontalScrollBar.x = contentPadding; _horizontalScrollBar.y = ((height - ScrollBar.WIDTH) - contentPadding); _horizontalScrollBar.width = availableWidth; } else { _horizontalScrollBar.visible = false; }; _horizontalScrollBar.setScrollProperties(availableWidth, 0, (useFixedHorizontalScrolling) ? _maxHorizontalScrollPosition : (contentWidth - availableWidth), horizontalPageScrollSize); setHorizontalScrollPosition(_horizontalScrollBar.scrollPosition, false); drawDisabledOverlay(); } protected function drawBackground():void{ var _local1:DisplayObject; _local1 = background; background = getDisplayObjectInstance(getStyleValue("skin")); background.width = width; background.height = height; addChildAt(background, 0); if (((!((_local1 == null))) && (!((_local1 == background))))){ removeChild(_local1); }; } public function set horizontalLineScrollSize(_arg1:Number):void{ _horizontalScrollBar.lineScrollSize = _arg1; } public function get horizontalPageScrollSize():Number{ if (isNaN(availableWidth)){ drawNow(); }; return (((((_horizontalPageScrollSize == 0)) && (!(isNaN(availableWidth))))) ? availableWidth : _horizontalPageScrollSize); } public function get maxHorizontalScrollPosition():Number{ drawNow(); return (Math.max(0, (contentWidth - availableWidth))); } protected function setStyles():void{ copyStylesToChild(_verticalScrollBar, SCROLL_BAR_STYLES); copyStylesToChild(_horizontalScrollBar, SCROLL_BAR_STYLES); } protected function updateChildren():void{ _verticalScrollBar.enabled = (_horizontalScrollBar.enabled = enabled); _verticalScrollBar.drawNow(); _horizontalScrollBar.drawNow(); } public function set verticalScrollPolicy(_arg1:String):void{ _verticalScrollPolicy = _arg1; invalidate(InvalidationType.SIZE); } public function set useBitmapScrolling(_arg1:Boolean):void{ _useBitmpScrolling = _arg1; invalidate(InvalidationType.STATE); } public static function getStyleDefinition():Object{ return (mergeStyles(defaultStyles, ScrollBar.getStyleDefinition())); } } }//package fl.containers
Section 72
//CellRenderer (fl.controls.listClasses.CellRenderer) package fl.controls.listClasses { import flash.events.*; import fl.controls.*; public class CellRenderer extends LabelButton implements ICellRenderer { protected var _data:Object; protected var _listData:ListData; private static var defaultStyles:Object = {upSkin:"CellRenderer_upSkin", downSkin:"CellRenderer_downSkin", overSkin:"CellRenderer_overSkin", disabledSkin:"CellRenderer_disabledSkin", selectedDisabledSkin:"CellRenderer_selectedDisabledSkin", selectedUpSkin:"CellRenderer_selectedUpSkin", selectedDownSkin:"CellRenderer_selectedDownSkin", selectedOverSkin:"CellRenderer_selectedOverSkin", textFormat:null, disabledTextFormat:null, embedFonts:null, textPadding:5}; public function CellRenderer():void{ toggle = true; focusEnabled = false; } override protected function toggleSelected(_arg1:MouseEvent):void{ } override public function get selected():Boolean{ return (super.selected); } public function set listData(_arg1:ListData):void{ _listData = _arg1; label = _listData.label; setStyle("icon", _listData.icon); } override public function set selected(_arg1:Boolean):void{ super.selected = _arg1; } public function set data(_arg1:Object):void{ _data = _arg1; } public function get listData():ListData{ return (_listData); } override public function setSize(_arg1:Number, _arg2:Number):void{ super.setSize(_arg1, _arg2); } override protected function drawLayout():void{ var _local1:Number; var _local2:Number; var _local3:Number; _local1 = Number(getStyleValue("textPadding")); _local2 = 0; if (icon != null){ icon.x = _local1; icon.y = Math.round(((height - icon.height) >> 1)); _local2 = (icon.width + _local1); }; if (label.length > 0){ textField.visible = true; _local3 = Math.max(0, ((width - _local2) - (_local1 * 2))); textField.width = _local3; textField.height = (textField.textHeight + 4); textField.x = (_local2 + _local1); textField.y = Math.round(((height - textField.height) >> 1)); } else { textField.visible = false; }; background.width = width; background.height = height; } public function get data():Object{ return (_data); } public static function getStyleDefinition():Object{ return (defaultStyles); } } }//package fl.controls.listClasses
Section 73
//ICellRenderer (fl.controls.listClasses.ICellRenderer) package fl.controls.listClasses { public interface ICellRenderer { function setSize(_arg1:Number, _arg2:Number):void; function get listData():ListData; function get data():Object; function setMouseState(_arg1:String):void; function set x(_arg1:Number):void; function set y(_arg1:Number):void; function set data(_arg1:Object):void; function set selected(_arg1:Boolean):void; function set listData(_arg1:ListData):void; function get selected():Boolean; } }//package fl.controls.listClasses
Section 74
//ListData (fl.controls.listClasses.ListData) package fl.controls.listClasses { import fl.core.*; public class ListData { protected var _index:uint; protected var _owner:UIComponent; protected var _label:String; protected var _icon:Object;// = null protected var _row:uint; protected var _column:uint; public function ListData(_arg1:String, _arg2:Object, _arg3:UIComponent, _arg4:uint, _arg5:uint, _arg6:uint=0){ _icon = null; super(); _label = _arg1; _icon = _arg2; _owner = _arg3; _index = _arg4; _row = _arg5; _column = _arg6; } public function get owner():UIComponent{ return (_owner); } public function get label():String{ return (_label); } public function get row():uint{ return (_row); } public function get index():uint{ return (_index); } public function get icon():Object{ return (_icon); } public function get column():uint{ return (_column); } } }//package fl.controls.listClasses
Section 75
//BaseButton (fl.controls.BaseButton) package fl.controls { import fl.core.*; import flash.events.*; import flash.display.*; import fl.events.*; import flash.utils.*; public class BaseButton extends UIComponent { protected var _selected:Boolean;// = false private var unlockedMouseState:String; protected var pressTimer:Timer; protected var mouseState:String; protected var background:DisplayObject; private var _mouseStateLocked:Boolean;// = false protected var _autoRepeat:Boolean;// = false private static var defaultStyles:Object = {upSkin:"Button_upSkin", downSkin:"Button_downSkin", overSkin:"Button_overSkin", disabledSkin:"Button_disabledSkin", selectedDisabledSkin:"Button_selectedDisabledSkin", selectedUpSkin:"Button_selectedUpSkin", selectedDownSkin:"Button_selectedDownSkin", selectedOverSkin:"Button_selectedOverSkin", focusRectSkin:null, focusRectPadding:null, repeatDelay:500, repeatInterval:35}; public function BaseButton(){ _selected = false; _autoRepeat = false; _mouseStateLocked = false; super(); buttonMode = true; mouseChildren = false; useHandCursor = false; setupMouseEvents(); setMouseState("up"); pressTimer = new Timer(1, 0); pressTimer.addEventListener(TimerEvent.TIMER, buttonDown, false, 0, true); } protected function endPress():void{ pressTimer.reset(); } public function set mouseStateLocked(_arg1:Boolean):void{ _mouseStateLocked = _arg1; if (_arg1 == false){ setMouseState(unlockedMouseState); } else { unlockedMouseState = mouseState; }; } public function get autoRepeat():Boolean{ return (_autoRepeat); } public function set autoRepeat(_arg1:Boolean):void{ _autoRepeat = _arg1; } override public function set enabled(_arg1:Boolean):void{ super.enabled = _arg1; mouseEnabled = _arg1; } public function get selected():Boolean{ return (_selected); } protected function mouseEventHandler(_arg1:MouseEvent):void{ if (_arg1.type == MouseEvent.MOUSE_DOWN){ setMouseState("down"); startPress(); } else { if ((((_arg1.type == MouseEvent.ROLL_OVER)) || ((_arg1.type == MouseEvent.MOUSE_UP)))){ setMouseState("over"); endPress(); } else { if (_arg1.type == MouseEvent.ROLL_OUT){ setMouseState("up"); endPress(); }; }; }; } public function setMouseState(_arg1:String):void{ if (_mouseStateLocked){ unlockedMouseState = _arg1; return; }; if (mouseState == _arg1){ return; }; mouseState = _arg1; invalidate(InvalidationType.STATE); } protected function startPress():void{ if (_autoRepeat){ pressTimer.delay = Number(getStyleValue("repeatDelay")); pressTimer.start(); }; dispatchEvent(new ComponentEvent(ComponentEvent.BUTTON_DOWN, true)); } protected function buttonDown(_arg1:TimerEvent):void{ if (!_autoRepeat){ endPress(); return; }; if (pressTimer.currentCount == 1){ pressTimer.delay = Number(getStyleValue("repeatInterval")); }; dispatchEvent(new ComponentEvent(ComponentEvent.BUTTON_DOWN, true)); } public function set selected(_arg1:Boolean):void{ if (_selected == _arg1){ return; }; _selected = _arg1; invalidate(InvalidationType.STATE); } override public function get enabled():Boolean{ return (super.enabled); } override protected function draw():void{ if (isInvalid(InvalidationType.STYLES, InvalidationType.STATE)){ drawBackground(); invalidate(InvalidationType.SIZE, false); }; if (isInvalid(InvalidationType.SIZE)){ drawLayout(); }; super.draw(); } protected function setupMouseEvents():void{ addEventListener(MouseEvent.ROLL_OVER, mouseEventHandler, false, 0, true); addEventListener(MouseEvent.MOUSE_DOWN, mouseEventHandler, false, 0, true); addEventListener(MouseEvent.MOUSE_UP, mouseEventHandler, false, 0, true); addEventListener(MouseEvent.ROLL_OUT, mouseEventHandler, false, 0, true); } protected function drawLayout():void{ background.width = width; background.height = height; } protected function drawBackground():void{ var _local1:String; var _local2:DisplayObject; _local1 = (enabled) ? mouseState : "disabled"; if (selected){ _local1 = (("selected" + _local1.substr(0, 1).toUpperCase()) + _local1.substr(1)); }; _local1 = (_local1 + "Skin"); _local2 = background; background = getDisplayObjectInstance(getStyleValue(_local1)); addChildAt(background, 0); if (((!((_local2 == null))) && (!((_local2 == background))))){ removeChild(_local2); }; } public static function getStyleDefinition():Object{ return (defaultStyles); } } }//package fl.controls
Section 76
//Button (fl.controls.Button) package fl.controls { import fl.core.*; import flash.display.*; import fl.managers.*; public class Button extends LabelButton implements IFocusManagerComponent { protected var emphasizedBorder:DisplayObject; protected var _emphasized:Boolean;// = false private static var defaultStyles:Object = {emphasizedSkin:"Button_emphasizedSkin", emphasizedPadding:2}; public static var createAccessibilityImplementation:Function; public function Button(){ _emphasized = false; super(); } override public function drawFocus(_arg1:Boolean):void{ var _local2:Number; var _local3:*; super.drawFocus(_arg1); if (_arg1){ _local2 = Number(getStyleValue("emphasizedPadding")); if ((((_local2 < 0)) || (!(_emphasized)))){ _local2 = 0; }; _local3 = getStyleValue("focusRectPadding"); _local3 = ((_local3)==null) ? 2 : _local3; _local3 = (_local3 + _local2); uiFocusRect.x = -(_local3); uiFocusRect.y = -(_local3); uiFocusRect.width = (width + (_local3 * 2)); uiFocusRect.height = (height + (_local3 * 2)); }; } public function set emphasized(_arg1:Boolean):void{ _emphasized = _arg1; invalidate(InvalidationType.STYLES); } override protected function draw():void{ if (((isInvalid(InvalidationType.STYLES)) || (isInvalid(InvalidationType.SIZE)))){ drawEmphasized(); }; super.draw(); if (emphasizedBorder != null){ setChildIndex(emphasizedBorder, (numChildren - 1)); }; } public function get emphasized():Boolean{ return (_emphasized); } override protected function initializeAccessibility():void{ if (Button.createAccessibilityImplementation != null){ Button.createAccessibilityImplementation(this); }; } protected function drawEmphasized():void{ var _local1:Object; var _local2:Number; if (emphasizedBorder != null){ removeChild(emphasizedBorder); }; emphasizedBorder = null; if (!_emphasized){ return; }; _local1 = getStyleValue("emphasizedSkin"); if (_local1 != null){ emphasizedBorder = getDisplayObjectInstance(_local1); }; if (emphasizedBorder != null){ addChildAt(emphasizedBorder, 0); _local2 = Number(getStyleValue("emphasizedPadding")); emphasizedBorder.x = (emphasizedBorder.y = -(_local2)); emphasizedBorder.width = (width + (_local2 * 2)); emphasizedBorder.height = (height + (_local2 * 2)); }; } public static function getStyleDefinition():Object{ return (UIComponent.mergeStyles(LabelButton.getStyleDefinition(), defaultStyles)); } } }//package fl.controls
Section 77
//ButtonLabelPlacement (fl.controls.ButtonLabelPlacement) package fl.controls { public class ButtonLabelPlacement { public static const TOP:String = "top"; public static const LEFT:String = "left"; public static const BOTTOM:String = "bottom"; public static const RIGHT:String = "right"; } }//package fl.controls
Section 78
//ComboBox (fl.controls.ComboBox) package fl.controls { import fl.controls.listClasses.*; import fl.core.*; import flash.events.*; import flash.display.*; import flash.text.*; import flash.geom.*; import fl.data.*; import fl.managers.*; import fl.events.*; import flash.ui.*; public class ComboBox extends UIComponent implements IFocusManagerComponent { protected var _dropdownWidth:Number; protected var highlightedCell:int;// = -1 protected var _prompt:String; protected var isOpen:Boolean;// = false protected var list:List; protected var _rowCount:uint;// = 5 protected var currentIndex:int; protected var isKeyDown:Boolean;// = false protected var _labels:Array; protected var background:BaseButton; protected var inputField:TextInput; protected var listOverIndex:uint; protected var editableValue:String; protected var _editable:Boolean;// = false private var collectionItemImport:SimpleCollectionItem; protected static const BACKGROUND_STYLES:Object = {overSkin:"overSkin", downSkin:"downSkin", upSkin:"upSkin", disabledSkin:"disabledSkin", repeatInterval:"repeatInterval"}; protected static const LIST_STYLES:Object = {upSkin:"comboListUpSkin", overSkin:"comboListOverSkin", downSkin:"comobListDownSkin", disabledSkin:"comboListDisabledSkin", downArrowDisabledSkin:"downArrowDisabledSkin", downArrowDownSkin:"downArrowDownSkin", downArrowOverSkin:"downArrowOverSkin", downArrowUpSkin:"downArrowUpSkin", upArrowDisabledSkin:"upArrowDisabledSkin", upArrowDownSkin:"upArrowDownSkin", upArrowOverSkin:"upArrowOverSkin", upArrowUpSkin:"upArrowUpSkin", thumbDisabledSkin:"thumbDisabledSkin", thumbDownSkin:"thumbDownSkin", thumbOverSkin:"thumbOverSkin", thumbUpSkin:"thumbUpSkin", thumbIcon:"thumbIcon", trackDisabledSkin:"trackDisabledSkin", trackDownSkin:"trackDownSkin", trackOverSkin:"trackOverSkin", trackUpSkin:"trackUpSkin", repeatDelay:"repeatDelay", repeatInterval:"repeatInterval", textFormat:"textFormat", disabledAlpha:"disabledAlpha", skin:"listSkin"}; private static var defaultStyles:Object = {upSkin:"ComboBox_upSkin", downSkin:"ComboBox_downSkin", overSkin:"ComboBox_overSkin", disabledSkin:"ComboBox_disabledSkin", focusRectSkin:null, focusRectPadding:null, textFormat:null, disabledTextFormat:null, textPadding:3, buttonWidth:24, disabledAlpha:null, listSkin:null}; public static var createAccessibilityImplementation:Function; public function ComboBox(){ _rowCount = 5; _editable = false; isOpen = false; highlightedCell = -1; isKeyDown = false; super(); } protected function drawList():void{ list.rowCount = Math.max(0, Math.min(_rowCount, list.dataProvider.length)); } public function set imeMode(_arg1:String):void{ inputField.imeMode = _arg1; } public function get dropdown():List{ return (list); } public function get dropdownWidth():Number{ return (list.width); } public function sortItemsOn(_arg1:String, _arg2:Object=null){ return (list.sortItemsOn(_arg1, _arg2)); } protected function onEnter(_arg1:ComponentEvent):void{ _arg1.stopPropagation(); } public function removeItemAt(_arg1:uint):void{ list.removeItemAt(_arg1); invalidate(InvalidationType.DATA); } public function open():void{ currentIndex = selectedIndex; if (((isOpen) || ((length == 0)))){ return; }; dispatchEvent(new Event(Event.OPEN)); isOpen = true; addEventListener(Event.ENTER_FRAME, addCloseListener, false, 0, true); positionList(); list.scrollToSelected(); stage.addChild(list); } public function get selectedItem():Object{ return (list.selectedItem); } public function set text(_arg1:String):void{ if (!editable){ return; }; inputField.text = _arg1; } public function get labelField():String{ return (list.labelField); } override protected function keyDownHandler(_arg1:KeyboardEvent):void{ var _local2:int; var _local3:uint; var _local4:Number; var _local5:int; isKeyDown = true; if (_arg1.ctrlKey){ switch (_arg1.keyCode){ case Keyboard.UP: if (highlightedCell > -1){ selectedIndex = highlightedCell; dispatchEvent(new Event(Event.CHANGE)); }; close(); break; case Keyboard.DOWN: open(); break; }; return; }; _arg1.stopPropagation(); _local2 = Math.max(((calculateAvailableHeight() / list.rowHeight) << 0), 1); _local3 = selectedIndex; _local4 = ((highlightedCell)==-1) ? selectedIndex : highlightedCell; _local5 = -1; switch (_arg1.keyCode){ case Keyboard.SPACE: if (isOpen){ close(); } else { open(); }; return; case Keyboard.ESCAPE: if (isOpen){ if (highlightedCell > -1){ selectedIndex = selectedIndex; }; close(); }; return; case Keyboard.UP: _local5 = Math.max(0, (_local4 - 1)); break; case Keyboard.DOWN: _local5 = Math.min((length - 1), (_local4 + 1)); break; case Keyboard.PAGE_UP: _local5 = Math.max((_local4 - _local2), 0); break; case Keyboard.PAGE_DOWN: _local5 = Math.min((_local4 + _local2), (length - 1)); break; case Keyboard.HOME: _local5 = 0; break; case Keyboard.END: _local5 = (length - 1); break; case Keyboard.ENTER: if (((_editable) && ((highlightedCell == -1)))){ editableValue = inputField.text; selectedIndex = -1; } else { if (((isOpen) && ((highlightedCell > -1)))){ editableValue = null; selectedIndex = highlightedCell; dispatchEvent(new Event(Event.CHANGE)); }; }; dispatchEvent(new ComponentEvent(ComponentEvent.ENTER)); close(); return; default: if (editable){ break; }; _local5 = list.getNextIndexAtLetter(String.fromCharCode(_arg1.keyCode), _local4); break; }; if (_local5 > -1){ if (isOpen){ highlightCell(_local5); inputField.text = list.itemToLabel(getItemAt(_local5)); } else { highlightCell(); selectedIndex = _local5; dispatchEvent(new Event(Event.CHANGE)); }; }; } public function set dropdownWidth(_arg1:Number):void{ _dropdownWidth = _arg1; invalidate(InvalidationType.SIZE); } public function get editable():Boolean{ return (_editable); } override protected function focusInHandler(_arg1:FocusEvent):void{ super.focusInHandler(_arg1); if (editable){ stage.focus = inputField.textField; }; } protected function onStageClick(_arg1:MouseEvent):void{ if (!isOpen){ return; }; if (((!(contains((_arg1.target as DisplayObject)))) && (!(list.contains((_arg1.target as DisplayObject)))))){ if (highlightedCell != -1){ selectedIndex = highlightedCell; dispatchEvent(new Event(Event.CHANGE)); }; close(); }; } protected function handleDataChange(_arg1:DataChangeEvent):void{ invalidate(InvalidationType.DATA); } override protected function keyUpHandler(_arg1:KeyboardEvent):void{ isKeyDown = false; } protected function onListItemUp(_arg1:MouseEvent):void{ var _local2:*; stage.removeEventListener(MouseEvent.MOUSE_UP, onListItemUp); if (((!((_arg1.target is ICellRenderer))) || (!(list.contains((_arg1.target as DisplayObject)))))){ return; }; editableValue = null; _local2 = selectedIndex; selectedIndex = _arg1.target.listData.index; if (_local2 != selectedIndex){ dispatchEvent(new Event(Event.CHANGE)); }; close(); } public function removeAll():void{ list.removeAll(); inputField.text = ""; invalidate(InvalidationType.DATA); } public function set selectedItem(_arg1:Object):void{ list.selectedItem = _arg1; invalidate(InvalidationType.SELECTED); } protected function highlightCell(_arg1:int=-1):void{ var _local2:ICellRenderer; if (highlightedCell > -1){ _local2 = list.itemToCellRenderer(getItemAt(highlightedCell)); if (_local2 != null){ _local2.setMouseState("up"); }; }; if (_arg1 == -1){ return; }; list.scrollToIndex(_arg1); list.drawNow(); _local2 = list.itemToCellRenderer(getItemAt(_arg1)); if (_local2 != null){ _local2.setMouseState("over"); highlightedCell = _arg1; }; } public function itemToLabel(_arg1:Object):String{ if (_arg1 == null){ return (""); }; return (list.itemToLabel(_arg1)); } public function addItemAt(_arg1:Object, _arg2:uint):void{ list.addItemAt(_arg1, _arg2); invalidate(InvalidationType.DATA); } public function replaceItemAt(_arg1:Object, _arg2:uint):Object{ return (list.replaceItemAt(_arg1, _arg2)); } protected function showPrompt():void{ inputField.text = _prompt; } public function set rowCount(_arg1:uint):void{ _rowCount = _arg1; invalidate(InvalidationType.SIZE); } public function get restrict():String{ return (inputField.restrict); } protected function setEmbedFonts():void{ var _local1:Object; _local1 = getStyleValue("embedFonts"); if (_local1 != null){ inputField.textField.embedFonts = _local1; }; } public function sortItems(... _args){ return (list.sortItems.apply(list, _args)); } public function set labelField(_arg1:String):void{ list.labelField = _arg1; invalidate(InvalidationType.DATA); } public function set editable(_arg1:Boolean):void{ _editable = _arg1; drawTextField(); } public function set prompt(_arg1:String):void{ if (_arg1 == ""){ _prompt = null; } else { _prompt = _arg1; }; invalidate(InvalidationType.STATE); } public function get length():int{ return (list.length); } protected function drawTextField():void{ inputField.setStyle("upSkin", ""); inputField.setStyle("disabledSkin", ""); inputField.enabled = enabled; inputField.editable = _editable; inputField.textField.selectable = ((enabled) && (_editable)); inputField.mouseEnabled = (inputField.mouseChildren = ((enabled) && (_editable))); inputField.focusEnabled = false; if (_editable){ inputField.addEventListener(FocusEvent.FOCUS_IN, onInputFieldFocus, false, 0, true); inputField.addEventListener(FocusEvent.FOCUS_OUT, onInputFieldFocusOut, false, 0, true); } else { inputField.removeEventListener(FocusEvent.FOCUS_IN, onInputFieldFocus); inputField.removeEventListener(FocusEvent.FOCUS_OUT, onInputFieldFocusOut); }; } protected function onInputFieldFocusOut(_arg1:FocusEvent):void{ inputField.removeEventListener(ComponentEvent.ENTER, onEnter); selectedIndex = selectedIndex; } protected function passEvent(_arg1:Event):void{ dispatchEvent(_arg1); } public function get imeMode():String{ return (inputField.imeMode); } public function get labelFunction():Function{ return (list.labelFunction); } protected function calculateAvailableHeight():Number{ var _local1:Number; _local1 = Number(getStyleValue("contentPadding")); return ((list.height - (_local1 * 2))); } public function get selectedIndex():int{ return (list.selectedIndex); } override protected function focusOutHandler(_arg1:FocusEvent):void{ isKeyDown = false; if (isOpen){ if (((!(_arg1.relatedObject)) || (!(list.contains(_arg1.relatedObject))))){ if (((!((highlightedCell == -1))) && (!((highlightedCell == selectedIndex))))){ selectedIndex = highlightedCell; dispatchEvent(new Event(Event.CHANGE)); }; close(); }; }; super.focusOutHandler(_arg1); } public function get selectedLabel():String{ if (editableValue != null){ return (editableValue); }; if (selectedIndex == -1){ return (null); }; return (itemToLabel(selectedItem)); } public function get text():String{ return (inputField.text); } protected function onListChange(_arg1:Event):void{ editableValue = null; dispatchEvent(_arg1); invalidate(InvalidationType.SELECTED); if (isKeyDown){ return; }; close(); } protected function onToggleListVisibility(_arg1:MouseEvent):void{ _arg1.stopPropagation(); dispatchEvent(_arg1); if (isOpen){ close(); } else { open(); stage.addEventListener(MouseEvent.MOUSE_UP, onListItemUp, false, 0, true); }; } override protected function draw():void{ var _local1:*; _local1 = selectedIndex; if ((((_local1 == -1)) && (((((!((prompt == null))) || (editable))) || ((length == 0)))))){ _local1 = Math.max(-1, Math.min(_local1, (length - 1))); } else { editableValue = null; _local1 = Math.max(0, Math.min(_local1, (length - 1))); }; if (list.selectedIndex != _local1){ list.selectedIndex = _local1; invalidate(InvalidationType.SELECTED, false); }; if (isInvalid(InvalidationType.STYLES)){ setStyles(); setEmbedFonts(); invalidate(InvalidationType.SIZE, false); }; if (isInvalid(InvalidationType.SIZE, InvalidationType.DATA, InvalidationType.STATE)){ drawTextFormat(); drawLayout(); invalidate(InvalidationType.DATA); }; if (isInvalid(InvalidationType.DATA)){ drawList(); invalidate(InvalidationType.SELECTED, true); }; if (isInvalid(InvalidationType.SELECTED)){ if ((((_local1 == -1)) && (!((editableValue == null))))){ inputField.text = editableValue; } else { if (_local1 > -1){ if (length > 0){ inputField.horizontalScrollPosition = 0; inputField.text = itemToLabel(list.selectedItem); }; } else { if ((((_local1 == -1)) && (!((_prompt == null))))){ showPrompt(); } else { inputField.text = ""; }; }; }; if (((((editable) && ((selectedIndex > -1)))) && ((stage.focus == inputField.textField)))){ inputField.setSelection(0, inputField.length); }; }; drawTextField(); super.draw(); } public function addItem(_arg1:Object):void{ list.addItem(_arg1); invalidate(InvalidationType.DATA); } public function get rowCount():uint{ return (_rowCount); } override protected function configUI():void{ super.configUI(); background = new BaseButton(); background.focusEnabled = false; copyStylesToChild(background, BACKGROUND_STYLES); background.addEventListener(MouseEvent.MOUSE_DOWN, onToggleListVisibility, false, 0, true); addChild(background); inputField = new TextInput(); inputField.focusTarget = (this as IFocusManagerComponent); inputField.focusEnabled = false; inputField.addEventListener(Event.CHANGE, onTextInput, false, 0, true); addChild(inputField); list = new List(); list.focusEnabled = false; copyStylesToChild(list, LIST_STYLES); list.addEventListener(Event.CHANGE, onListChange, false, 0, true); list.addEventListener(ListEvent.ITEM_CLICK, onListChange, false, 0, true); list.addEventListener(ListEvent.ITEM_ROLL_OUT, passEvent, false, 0, true); list.addEventListener(ListEvent.ITEM_ROLL_OVER, passEvent, false, 0, true); list.verticalScrollBar.addEventListener(Event.SCROLL, passEvent, false, 0, true); } protected function positionList():void{ var _local1:Point; _local1 = localToGlobal(new Point(0, 0)); list.x = _local1.x; if (((_local1.y + height) + list.height) > stage.stageHeight){ list.y = (_local1.y - list.height); } else { list.y = (_local1.y + height); }; } public function get value():String{ var _local1:Object; if (editableValue != null){ return (editableValue); }; _local1 = selectedItem; if (((!(_editable)) && (!((_local1.data == null))))){ return (_local1.data); }; return (itemToLabel(_local1)); } public function get prompt():String{ return (_prompt); } public function set dataProvider(_arg1:DataProvider):void{ _arg1.addEventListener(DataChangeEvent.DATA_CHANGE, handleDataChange, false, 0, true); list.dataProvider = _arg1; invalidate(InvalidationType.DATA); } public function set restrict(_arg1:String):void{ if (((componentInspectorSetting) && ((_arg1 == "")))){ _arg1 = null; }; if (!_editable){ return; }; inputField.restrict = _arg1; } protected function onTextInput(_arg1:Event):void{ _arg1.stopPropagation(); if (!_editable){ return; }; editableValue = inputField.text; selectedIndex = -1; dispatchEvent(new Event(Event.CHANGE)); } protected function onInputFieldFocus(_arg1:FocusEvent):void{ inputField.addEventListener(ComponentEvent.ENTER, onEnter, false, 0, true); close(); } public function getItemAt(_arg1:uint):Object{ return (list.getItemAt(_arg1)); } override protected function initializeAccessibility():void{ if (ComboBox.createAccessibilityImplementation != null){ ComboBox.createAccessibilityImplementation(this); }; } protected function drawLayout():void{ var _local1:Number; var _local2:Number; _local1 = (getStyleValue("buttonWidth") as Number); _local2 = (getStyleValue("textPadding") as Number); background.setSize(width, height); inputField.x = (inputField.y = _local2); inputField.setSize(((width - _local1) - _local2), (height - _local2)); list.width = (isNaN(_dropdownWidth)) ? width : _dropdownWidth; background.enabled = enabled; background.drawNow(); } public function removeItem(_arg1:Object):Object{ return (list.removeItem(_arg1)); } private function addCloseListener(_arg1:Event){ removeEventListener(Event.ENTER_FRAME, addCloseListener); if (!isOpen){ return; }; stage.addEventListener(MouseEvent.MOUSE_DOWN, onStageClick, false, 0, true); } public function get dataProvider():DataProvider{ return (list.dataProvider); } public function get textField():TextInput{ return (inputField); } protected function setStyles():void{ copyStylesToChild(background, BACKGROUND_STYLES); copyStylesToChild(list, LIST_STYLES); } public function set labelFunction(_arg1:Function):void{ list.labelFunction = _arg1; invalidate(InvalidationType.DATA); } protected function drawTextFormat():void{ var _local1:TextFormat; _local1 = (getStyleValue((_enabled) ? "textFormat" : "disabledTextFormat") as TextFormat); if (_local1 == null){ _local1 = new TextFormat(); }; inputField.textField.defaultTextFormat = _local1; inputField.textField.setTextFormat(_local1); setEmbedFonts(); } public function set selectedIndex(_arg1:int):void{ list.selectedIndex = _arg1; highlightCell(); invalidate(InvalidationType.SELECTED); } public function close():void{ highlightCell(); highlightedCell = -1; if (!isOpen){ return; }; dispatchEvent(new Event(Event.CLOSE)); stage.removeEventListener(MouseEvent.MOUSE_DOWN, onStageClick); isOpen = false; stage.removeChild(list); } public static function getStyleDefinition():Object{ return (mergeStyles(defaultStyles, List.getStyleDefinition())); } } }//package fl.controls
Section 79
//LabelButton (fl.controls.LabelButton) package fl.controls { import fl.core.*; import flash.events.*; import flash.display.*; import flash.text.*; import fl.managers.*; import fl.events.*; import flash.ui.*; public class LabelButton extends BaseButton implements IFocusManagerComponent { protected var _labelPlacement:String;// = "right" protected var _toggle:Boolean;// = false protected var icon:DisplayObject; protected var oldMouseState:String; protected var mode:String;// = "center" public var textField:TextField; protected var _label:String;// = "Label" private static var defaultStyles:Object = {icon:null, upIcon:null, downIcon:null, overIcon:null, disabledIcon:null, selectedDisabledIcon:null, selectedUpIcon:null, selectedDownIcon:null, selectedOverIcon:null, textFormat:null, disabledTextFormat:null, textPadding:5, embedFonts:false}; public static var createAccessibilityImplementation:Function; public function LabelButton(){ _labelPlacement = ButtonLabelPlacement.RIGHT; _toggle = false; _label = "Label"; mode = "center"; super(); } protected function toggleSelected(_arg1:MouseEvent):void{ selected = !(selected); dispatchEvent(new Event(Event.CHANGE, true)); } public function get labelPlacement():String{ return (_labelPlacement); } override protected function keyDownHandler(_arg1:KeyboardEvent):void{ if (!enabled){ return; }; if (_arg1.keyCode == Keyboard.SPACE){ if (oldMouseState == null){ oldMouseState = mouseState; }; setMouseState("down"); startPress(); }; } protected function setEmbedFont(){ var _local1:Object; _local1 = getStyleValue("embedFonts"); if (_local1 != null){ textField.embedFonts = _local1; }; } override protected function keyUpHandler(_arg1:KeyboardEvent):void{ if (!enabled){ return; }; if (_arg1.keyCode == Keyboard.SPACE){ setMouseState(oldMouseState); oldMouseState = null; endPress(); dispatchEvent(new MouseEvent(MouseEvent.CLICK)); }; } override public function get selected():Boolean{ return ((_toggle) ? _selected : false); } public function set labelPlacement(_arg1:String):void{ _labelPlacement = _arg1; invalidate(InvalidationType.SIZE); } public function set toggle(_arg1:Boolean):void{ if (((!(_arg1)) && (super.selected))){ selected = false; }; _toggle = _arg1; if (_toggle){ addEventListener(MouseEvent.CLICK, toggleSelected, false, 0, true); } else { removeEventListener(MouseEvent.CLICK, toggleSelected); }; invalidate(InvalidationType.STATE); } public function get label():String{ return (_label); } override public function set selected(_arg1:Boolean):void{ _selected = _arg1; if (_toggle){ invalidate(InvalidationType.STATE); }; } override protected function draw():void{ if (textField.text != _label){ label = _label; }; if (isInvalid(InvalidationType.STYLES, InvalidationType.STATE)){ drawBackground(); drawIcon(); drawTextFormat(); invalidate(InvalidationType.SIZE, false); }; if (isInvalid(InvalidationType.SIZE)){ drawLayout(); }; if (isInvalid(InvalidationType.SIZE, InvalidationType.STYLES)){ if (((isFocused) && (focusManager.showFocusIndicator))){ drawFocus(true); }; }; validate(); } public function get toggle():Boolean{ return (_toggle); } override protected function configUI():void{ super.configUI(); textField = new TextField(); textField.type = TextFieldType.DYNAMIC; textField.selectable = false; addChild(textField); } override protected function drawLayout():void{ var _local1:Number; var _local2:String; var _local3:Number; var _local4:Number; var _local5:Number; var _local6:Number; var _local7:Number; var _local8:Number; _local1 = Number(getStyleValue("textPadding")); _local2 = ((((icon == null)) && ((mode == "center")))) ? ButtonLabelPlacement.TOP : _labelPlacement; textField.height = (textField.textHeight + 4); _local3 = (textField.textWidth + 4); _local4 = (textField.textHeight + 4); _local5 = ((icon)==null) ? 0 : (icon.width + _local1); _local6 = ((icon)==null) ? 0 : (icon.height + _local1); textField.visible = (label.length > 0); if (icon != null){ icon.x = Math.round(((width - icon.width) / 2)); icon.y = Math.round(((height - icon.height) / 2)); }; if (textField.visible == false){ textField.width = 0; textField.height = 0; } else { if ((((_local2 == ButtonLabelPlacement.BOTTOM)) || ((_local2 == ButtonLabelPlacement.TOP)))){ _local7 = Math.max(0, Math.min(_local3, (width - (2 * _local1)))); if ((height - 2) > _local4){ _local8 = _local4; } else { _local8 = (height - 2); }; _local3 = _local7; textField.width = _local3; _local4 = _local8; textField.height = _local4; textField.x = Math.round(((width - _local3) / 2)); textField.y = Math.round(((((height - textField.height) - _local6) / 2) + ((_local2)==ButtonLabelPlacement.BOTTOM) ? _local6 : 0)); if (icon != null){ icon.y = Math.round(((_local2)==ButtonLabelPlacement.BOTTOM) ? (textField.y - _local6) : ((textField.y + textField.height) + _local1)); }; } else { _local7 = Math.max(0, Math.min(_local3, ((width - _local5) - (2 * _local1)))); _local3 = _local7; textField.width = _local3; textField.x = Math.round(((((width - _local3) - _local5) / 2) + ((_local2)!=ButtonLabelPlacement.LEFT) ? _local5 : 0)); textField.y = Math.round(((height - textField.height) / 2)); if (icon != null){ icon.x = Math.round(((_local2)!=ButtonLabelPlacement.LEFT) ? (textField.x - _local5) : ((textField.x + _local3) + _local1)); }; }; }; super.drawLayout(); } override protected function initializeAccessibility():void{ if (LabelButton.createAccessibilityImplementation != null){ LabelButton.createAccessibilityImplementation(this); }; } protected function drawIcon():void{ var _local1:DisplayObject; var _local2:String; var _local3:Object; _local1 = icon; _local2 = (enabled) ? mouseState : "disabled"; if (selected){ _local2 = (("selected" + _local2.substr(0, 1).toUpperCase()) + _local2.substr(1)); }; _local2 = (_local2 + "Icon"); _local3 = getStyleValue(_local2); if (_local3 == null){ _local3 = getStyleValue("icon"); }; if (_local3 != null){ icon = getDisplayObjectInstance(_local3); }; if (icon != null){ addChildAt(icon, 1); }; if (((!((_local1 == null))) && (!((_local1 == icon))))){ removeChild(_local1); }; } public function set label(_arg1:String):void{ _label = _arg1; if (textField.text != _label){ textField.text = _label; dispatchEvent(new ComponentEvent(ComponentEvent.LABEL_CHANGE)); }; invalidate(InvalidationType.SIZE); invalidate(InvalidationType.STYLES); } protected function drawTextFormat():void{ var _local1:Object; var _local2:TextFormat; var _local3:TextFormat; _local1 = UIComponent.getStyleDefinition(); _local2 = (enabled) ? (_local1.defaultTextFormat as TextFormat) : (_local1.defaultDisabledTextFormat as TextFormat); textField.setTextFormat(_local2); _local3 = (getStyleValue((enabled) ? "textFormat" : "disabledTextFormat") as TextFormat); if (_local3 != null){ textField.setTextFormat(_local3); } else { _local3 = _local2; }; textField.defaultTextFormat = _local3; setEmbedFont(); } public static function getStyleDefinition():Object{ return (mergeStyles(defaultStyles, BaseButton.getStyleDefinition())); } } }//package fl.controls
Section 80
//List (fl.controls.List) package fl.controls { import fl.controls.listClasses.*; import fl.core.*; import flash.events.*; import flash.display.*; import flash.geom.*; import fl.managers.*; import flash.utils.*; import flash.ui.*; public class List extends SelectableList implements IFocusManagerComponent { protected var _labelField:String;// = "label" protected var _rowHeight:Number;// = 20 protected var _cellRenderer:Object; protected var _iconField:String;// = "icon" protected var _labelFunction:Function; protected var _iconFunction:Function; private static var defaultStyles:Object = {focusRectSkin:null, focusRectPadding:null}; public static var createAccessibilityImplementation:Function; public function List(){ _rowHeight = 20; _labelField = "label"; _iconField = "icon"; super(); } public function get iconField():String{ return (_iconField); } protected function doKeySelection(_arg1:int, _arg2:Boolean, _arg3:Boolean):void{ var _local4:Boolean; var _local5:int; var _local6:Array; var _local7:int; var _local8:int; _local4 = false; if (_arg2){ _local6 = []; _local7 = lastCaretIndex; _local8 = _arg1; if (_local7 == -1){ _local7 = ((caretIndex)!=-1) ? caretIndex : _arg1; }; if (_local7 > _local8){ _local8 = _local7; _local7 = _arg1; }; _local5 = _local7; while (_local5 <= _local8) { _local6.push(_local5); _local5++; }; selectedIndices = _local6; caretIndex = _arg1; _local4 = true; } else { selectedIndex = _arg1; caretIndex = (lastCaretIndex = _arg1); _local4 = true; }; if (_local4){ dispatchEvent(new Event(Event.CHANGE)); }; invalidate(InvalidationType.DATA); } override protected function drawList():void{ var _local1:Rectangle; var _local2:uint; var _local3:uint; var _local4:uint; var _local5:Object; var _local6:ICellRenderer; var _local7:Dictionary; var _local8:Dictionary; var _local9:Boolean; var _local10:String; var _local11:Object; var _local12:Sprite; var _local13:String; listHolder.x = (listHolder.y = contentPadding); _local1 = listHolder.scrollRect; _local1.x = _horizontalScrollPosition; _local1.y = (Math.floor(_verticalScrollPosition) % rowHeight); listHolder.scrollRect = _local1; listHolder.cacheAsBitmap = useBitmapScrolling; _local2 = Math.floor((_verticalScrollPosition / rowHeight)); _local3 = Math.min(length, ((_local2 + rowCount) + 1)); _local7 = (renderedItems = new Dictionary(true)); _local4 = _local2; while (_local4 < _local3) { _local7[_dataProvider.getItemAt(_local4)] = true; _local4++; }; _local8 = new Dictionary(true); while (activeCellRenderers.length > 0) { _local6 = (activeCellRenderers.pop() as ICellRenderer); _local5 = _local6.data; if ((((_local7[_local5] == null)) || ((invalidItems[_local5] == true)))){ availableCellRenderers.push(_local6); } else { _local8[_local5] = _local6; invalidItems[_local5] = true; }; list.removeChild((_local6 as DisplayObject)); }; invalidItems = new Dictionary(true); _local4 = _local2; while (_local4 < _local3) { _local9 = false; _local5 = _dataProvider.getItemAt(_local4); if (_local8[_local5] != null){ _local9 = true; _local6 = _local8[_local5]; delete _local8[_local5]; } else { if (availableCellRenderers.length > 0){ _local6 = (availableCellRenderers.pop() as ICellRenderer); } else { _local6 = (getDisplayObjectInstance(getStyleValue("cellRenderer")) as ICellRenderer); _local12 = (_local6 as Sprite); if (_local12 != null){ _local12.addEventListener(MouseEvent.CLICK, handleCellRendererClick, false, 0, true); _local12.addEventListener(MouseEvent.ROLL_OVER, handleCellRendererMouseEvent, false, 0, true); _local12.addEventListener(MouseEvent.ROLL_OUT, handleCellRendererMouseEvent, false, 0, true); _local12.addEventListener(Event.CHANGE, handleCellRendererChange, false, 0, true); _local12.doubleClickEnabled = true; _local12.addEventListener(MouseEvent.DOUBLE_CLICK, handleCellRendererDoubleClick, false, 0, true); if (_local12["setStyle"] != null){ for (_local13 in rendererStyles) { var _local16 = _local12; _local16["setStyle"](_local13, rendererStyles[_local13]); }; }; }; }; }; list.addChild((_local6 as Sprite)); activeCellRenderers.push(_local6); _local6.y = (rowHeight * (_local4 - _local2)); _local6.setSize((availableWidth + _maxHorizontalScrollPosition), rowHeight); _local10 = itemToLabel(_local5); _local11 = null; if (_iconFunction != null){ _local11 = _iconFunction(_local5); } else { if (_iconField != null){ _local11 = _local5[_iconField]; }; }; if (!_local9){ _local6.data = _local5; }; _local6.listData = new ListData(_local10, _local11, this, _local4, _local4, 0); _local6.selected = !((_selectedIndices.indexOf(_local4) == -1)); if ((_local6 is UIComponent)){ (_local6 as UIComponent).drawNow(); }; _local4++; }; } public function get iconFunction():Function{ return (_iconFunction); } public function set iconField(_arg1:String):void{ if (_arg1 == _iconField){ return; }; _iconField = _arg1; invalidate(InvalidationType.DATA); } override protected function keyDownHandler(_arg1:KeyboardEvent):void{ var _local2:int; if (!selectable){ return; }; switch (_arg1.keyCode){ case Keyboard.UP: case Keyboard.DOWN: case Keyboard.END: case Keyboard.HOME: case Keyboard.PAGE_UP: case Keyboard.PAGE_DOWN: moveSelectionVertically(_arg1.keyCode, ((_arg1.shiftKey) && (_allowMultipleSelection)), ((_arg1.ctrlKey) && (_allowMultipleSelection))); break; case Keyboard.LEFT: case Keyboard.RIGHT: moveSelectionHorizontally(_arg1.keyCode, ((_arg1.shiftKey) && (_allowMultipleSelection)), ((_arg1.ctrlKey) && (_allowMultipleSelection))); break; case Keyboard.SPACE: if (caretIndex == -1){ caretIndex = 0; }; doKeySelection(caretIndex, _arg1.shiftKey, _arg1.ctrlKey); scrollToSelected(); break; default: _local2 = getNextIndexAtLetter(String.fromCharCode(_arg1.keyCode), selectedIndex); if (_local2 > -1){ selectedIndex = _local2; scrollToSelected(); }; break; }; _arg1.stopPropagation(); } override public function itemToLabel(_arg1:Object):String{ if (_labelFunction != null){ return (String(_labelFunction(_arg1))); }; return (((_arg1[_labelField])!=null) ? String(_arg1[_labelField]) : ""); } public function get labelField():String{ return (_labelField); } override protected function moveSelectionVertically(_arg1:uint, _arg2:Boolean, _arg3:Boolean):void{ var _local4:int; var _local5:int; var _local6:int; _local4 = Math.max(Math.floor((calculateAvailableHeight() / rowHeight)), 1); _local5 = -1; _local6 = 0; switch (_arg1){ case Keyboard.UP: if (caretIndex > 0){ _local5 = (caretIndex - 1); }; break; case Keyboard.DOWN: if (caretIndex < (length - 1)){ _local5 = (caretIndex + 1); }; break; case Keyboard.PAGE_UP: if (caretIndex > 0){ _local5 = Math.max((caretIndex - _local4), 0); }; break; case Keyboard.PAGE_DOWN: if (caretIndex < (length - 1)){ _local5 = Math.min((caretIndex + _local4), (length - 1)); }; break; case Keyboard.HOME: if (caretIndex > 0){ _local5 = 0; }; break; case Keyboard.END: if (caretIndex < (length - 1)){ _local5 = (length - 1); }; break; }; if (_local5 >= 0){ doKeySelection(_local5, _arg2, _arg3); scrollToSelected(); }; } public function set labelField(_arg1:String):void{ if (_arg1 == _labelField){ return; }; _labelField = _arg1; invalidate(InvalidationType.DATA); } public function set rowCount(_arg1:uint):void{ var _local2:Number; var _local3:Number; _local2 = Number(getStyleValue("contentPadding")); _local3 = ((((_horizontalScrollPolicy == ScrollPolicy.ON)) || ((((_horizontalScrollPolicy == ScrollPolicy.AUTO)) && ((_maxHorizontalScrollPosition > 0)))))) ? 15 : 0; height = (((rowHeight * _arg1) + (2 * _local2)) + _local3); } override protected function setHorizontalScrollPosition(_arg1:Number, _arg2:Boolean=false):void{ list.x = -(_arg1); super.setHorizontalScrollPosition(_arg1, true); } public function set iconFunction(_arg1:Function):void{ if (_iconFunction == _arg1){ return; }; _iconFunction = _arg1; invalidate(InvalidationType.DATA); } public function get labelFunction():Function{ return (_labelFunction); } override protected function moveSelectionHorizontally(_arg1:uint, _arg2:Boolean, _arg3:Boolean):void{ } override protected function setVerticalScrollPosition(_arg1:Number, _arg2:Boolean=false):void{ invalidate(InvalidationType.SCROLL); super.setVerticalScrollPosition(_arg1, true); } protected function calculateAvailableHeight():Number{ var _local1:Number; _local1 = Number(getStyleValue("contentPadding")); return (((height - (_local1 * 2)) - ((((_horizontalScrollPolicy == ScrollPolicy.ON)) || ((((_horizontalScrollPolicy == ScrollPolicy.AUTO)) && ((_maxHorizontalScrollPosition > 0)))))) ? 15 : 0)); } override protected function draw():void{ var _local1:Boolean; _local1 = !((contentHeight == (rowHeight * length))); contentHeight = (rowHeight * length); if (isInvalid(InvalidationType.STYLES)){ setStyles(); drawBackground(); if (contentPadding != getStyleValue("contentPadding")){ invalidate(InvalidationType.SIZE, false); }; if (_cellRenderer != getStyleValue("cellRenderer")){ _invalidateList(); _cellRenderer = getStyleValue("cellRenderer"); }; }; if (((isInvalid(InvalidationType.SIZE, InvalidationType.STATE)) || (_local1))){ drawLayout(); }; if (isInvalid(InvalidationType.RENDERER_STYLES)){ updateRendererStyles(); }; if (isInvalid(InvalidationType.STYLES, InvalidationType.SIZE, InvalidationType.DATA, InvalidationType.SCROLL, InvalidationType.SELECTED)){ drawList(); }; updateChildren(); validate(); } override protected function configUI():void{ useFixedHorizontalScrolling = true; _horizontalScrollPolicy = ScrollPolicy.AUTO; _verticalScrollPolicy = ScrollPolicy.AUTO; super.configUI(); } override public function get rowCount():uint{ return (Math.ceil((calculateAvailableHeight() / rowHeight))); } override protected function initializeAccessibility():void{ if (List.createAccessibilityImplementation != null){ List.createAccessibilityImplementation(this); }; } override public function scrollToIndex(_arg1:int):void{ var _local2:uint; var _local3:uint; drawNow(); _local2 = (Math.floor(((_verticalScrollPosition + availableHeight) / rowHeight)) - 1); _local3 = Math.ceil((_verticalScrollPosition / rowHeight)); if (_arg1 < _local3){ verticalScrollPosition = (_arg1 * rowHeight); } else { if (_arg1 > _local2){ verticalScrollPosition = (((_arg1 + 1) * rowHeight) - availableHeight); }; }; } public function get rowHeight():Number{ return (_rowHeight); } public function set labelFunction(_arg1:Function):void{ if (_labelFunction == _arg1){ return; }; _labelFunction = _arg1; invalidate(InvalidationType.DATA); } public function set rowHeight(_arg1:Number):void{ _rowHeight = _arg1; invalidate(InvalidationType.SIZE); } public static function getStyleDefinition():Object{ return (mergeStyles(defaultStyles, SelectableList.getStyleDefinition())); } } }//package fl.controls
Section 81
//ScrollBar (fl.controls.ScrollBar) package fl.controls { import fl.core.*; import flash.events.*; import fl.events.*; public class ScrollBar extends UIComponent { private var _direction:String;// = "vertical" protected var inDrag:Boolean;// = false protected var upArrow:BaseButton; private var _pageScrollSize:Number;// = 0 protected var downArrow:BaseButton; private var _pageSize:Number;// = 10 private var thumbScrollOffset:Number; private var _maxScrollPosition:Number;// = 0 private var _scrollPosition:Number;// = 0 protected var track:BaseButton; private var _minScrollPosition:Number;// = 0 private var _lineScrollSize:Number;// = 1 protected var thumb:LabelButton; protected static const THUMB_STYLES:Object = {disabledSkin:"thumbDisabledSkin", downSkin:"thumbDownSkin", overSkin:"thumbOverSkin", upSkin:"thumbUpSkin", icon:"thumbIcon", textPadding:0}; public static const WIDTH:Number = 15; protected static const DOWN_ARROW_STYLES:Object = {disabledSkin:"downArrowDisabledSkin", downSkin:"downArrowDownSkin", overSkin:"downArrowOverSkin", upSkin:"downArrowUpSkin", repeatDelay:"repeatDelay", repeatInterval:"repeatInterval"}; protected static const UP_ARROW_STYLES:Object = {disabledSkin:"upArrowDisabledSkin", downSkin:"upArrowDownSkin", overSkin:"upArrowOverSkin", upSkin:"upArrowUpSkin", repeatDelay:"repeatDelay", repeatInterval:"repeatInterval"}; protected static const TRACK_STYLES:Object = {disabledSkin:"trackDisabledSkin", downSkin:"trackDownSkin", overSkin:"trackOverSkin", upSkin:"trackUpSkin", repeatDelay:"repeatDelay", repeatInterval:"repeatInterval"}; private static var defaultStyles:Object = {downArrowDisabledSkin:"ScrollArrowDown_disabledSkin", downArrowDownSkin:"ScrollArrowDown_downSkin", downArrowOverSkin:"ScrollArrowDown_overSkin", downArrowUpSkin:"ScrollArrowDown_upSkin", thumbDisabledSkin:"ScrollThumb_upSkin", thumbDownSkin:"ScrollThumb_downSkin", thumbOverSkin:"ScrollThumb_overSkin", thumbUpSkin:"ScrollThumb_upSkin", trackDisabledSkin:"ScrollTrack_skin", trackDownSkin:"ScrollTrack_skin", trackOverSkin:"ScrollTrack_skin", trackUpSkin:"ScrollTrack_skin", upArrowDisabledSkin:"ScrollArrowUp_disabledSkin", upArrowDownSkin:"ScrollArrowUp_downSkin", upArrowOverSkin:"ScrollArrowUp_overSkin", upArrowUpSkin:"ScrollArrowUp_upSkin", thumbIcon:"ScrollBar_thumbIcon", repeatDelay:500, repeatInterval:35}; public function ScrollBar(){ _pageSize = 10; _pageScrollSize = 0; _lineScrollSize = 1; _minScrollPosition = 0; _maxScrollPosition = 0; _scrollPosition = 0; _direction = ScrollBarDirection.VERTICAL; inDrag = false; super(); setStyles(); focusEnabled = false; } public function get minScrollPosition():Number{ return (_minScrollPosition); } public function set minScrollPosition(_arg1:Number):void{ setScrollProperties(_pageSize, _arg1, _maxScrollPosition); } public function setScrollPosition(_arg1:Number, _arg2:Boolean=true):void{ var _local3:Number; _local3 = scrollPosition; _scrollPosition = Math.max(_minScrollPosition, Math.min(_maxScrollPosition, _arg1)); if (_local3 == _scrollPosition){ return; }; if (_arg2){ dispatchEvent(new ScrollEvent(_direction, (scrollPosition - _local3), scrollPosition)); }; updateThumb(); } public function set scrollPosition(_arg1:Number):void{ setScrollPosition(_arg1, true); } public function get pageScrollSize():Number{ return (((_pageScrollSize)==0) ? _pageSize : _pageScrollSize); } public function set pageSize(_arg1:Number):void{ if (_arg1 > 0){ _pageSize = _arg1; }; } public function setScrollProperties(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number=0):void{ this.pageSize = _arg1; _minScrollPosition = _arg2; _maxScrollPosition = _arg3; if (_arg4 >= 0){ _pageScrollSize = _arg4; }; enabled = (_maxScrollPosition > _minScrollPosition); setScrollPosition(_scrollPosition, false); updateThumb(); } override public function set enabled(_arg1:Boolean):void{ super.enabled = _arg1; downArrow.enabled = (track.enabled = (thumb.enabled = (upArrow.enabled = ((enabled) && ((_maxScrollPosition > _minScrollPosition)))))); updateThumb(); } protected function updateThumb():void{ var _local1:Number; _local1 = ((_maxScrollPosition - _minScrollPosition) + _pageSize); if ((((((track.height <= 12)) || ((_maxScrollPosition <= _minScrollPosition)))) || ((((_local1 == 0)) || (isNaN(_local1)))))){ thumb.height = 12; thumb.visible = false; } else { thumb.height = Math.max(13, ((_pageSize / _local1) * track.height)); thumb.y = (track.y + ((track.height - thumb.height) * ((_scrollPosition - _minScrollPosition) / (_maxScrollPosition - _minScrollPosition)))); thumb.visible = enabled; }; } protected function thumbPressHandler(_arg1:MouseEvent):void{ inDrag = true; thumbScrollOffset = (mouseY - thumb.y); thumb.mouseStateLocked = true; mouseChildren = false; stage.addEventListener(MouseEvent.MOUSE_MOVE, handleThumbDrag, false, 0, true); stage.addEventListener(MouseEvent.MOUSE_UP, thumbReleaseHandler, false, 0, true); } protected function thumbReleaseHandler(_arg1:MouseEvent):void{ inDrag = false; mouseChildren = true; thumb.mouseStateLocked = false; stage.removeEventListener(MouseEvent.MOUSE_MOVE, handleThumbDrag); stage.removeEventListener(MouseEvent.MOUSE_UP, thumbReleaseHandler); } public function set pageScrollSize(_arg1:Number):void{ if (_arg1 >= 0){ _pageScrollSize = _arg1; }; } protected function handleThumbDrag(_arg1:MouseEvent):void{ var _local2:Number; _local2 = Math.max(0, Math.min((track.height - thumb.height), ((mouseY - track.y) - thumbScrollOffset))); setScrollPosition((((_local2 / (track.height - thumb.height)) * (_maxScrollPosition - _minScrollPosition)) + _minScrollPosition)); } public function set direction(_arg1:String):void{ var _local2:Boolean; if (_direction == _arg1){ return; }; _direction = _arg1; if (isLivePreview){ return; }; setScaleY(1); _local2 = (_direction == ScrollBarDirection.HORIZONTAL); if (((_local2) && (componentInspectorSetting))){ if (rotation == 90){ return; }; setScaleX(-1); rotation = -90; }; if (!componentInspectorSetting){ if (((_local2) && ((rotation == 0)))){ rotation = -90; setScaleX(-1); } else { if (((!(_local2)) && ((rotation == -90)))){ rotation = 0; setScaleX(1); }; }; }; invalidate(InvalidationType.SIZE); } public function set lineScrollSize(_arg1:Number):void{ if (_arg1 > 0){ _lineScrollSize = _arg1; }; } override public function get height():Number{ return (((_direction)==ScrollBarDirection.HORIZONTAL) ? super.width : super.height); } protected function scrollPressHandler(_arg1:ComponentEvent):void{ var _local2:Number; var _local3:Number; _arg1.stopImmediatePropagation(); if (_arg1.currentTarget == upArrow){ setScrollPosition((_scrollPosition - _lineScrollSize)); } else { if (_arg1.currentTarget == downArrow){ setScrollPosition((_scrollPosition + _lineScrollSize)); } else { _local2 = (((track.mouseY / track.height) * (_maxScrollPosition - _minScrollPosition)) + _minScrollPosition); _local3 = ((pageScrollSize)==0) ? pageSize : pageScrollSize; if (_scrollPosition < _local2){ setScrollPosition(Math.min(_local2, (_scrollPosition + _local3))); } else { if (_scrollPosition > _local2){ setScrollPosition(Math.max(_local2, (_scrollPosition - _local3))); }; }; }; }; } public function get pageSize():Number{ return (_pageSize); } public function set maxScrollPosition(_arg1:Number):void{ setScrollProperties(_pageSize, _minScrollPosition, _arg1); } public function get scrollPosition():Number{ return (_scrollPosition); } override public function get enabled():Boolean{ return (super.enabled); } override protected function draw():void{ var _local1:Number; if (isInvalid(InvalidationType.SIZE)){ _local1 = super.height; downArrow.move(0, Math.max(upArrow.height, (_local1 - downArrow.height))); track.setSize(WIDTH, Math.max(0, (_local1 - (downArrow.height + upArrow.height)))); updateThumb(); }; if (isInvalid(InvalidationType.STYLES, InvalidationType.STATE)){ setStyles(); }; downArrow.drawNow(); upArrow.drawNow(); track.drawNow(); thumb.drawNow(); validate(); } override protected function configUI():void{ super.configUI(); track = new BaseButton(); track.move(0, 14); track.useHandCursor = false; track.autoRepeat = true; track.focusEnabled = false; addChild(track); thumb = new LabelButton(); thumb.label = ""; thumb.setSize(WIDTH, 15); thumb.move(0, 15); thumb.focusEnabled = false; addChild(thumb); downArrow = new BaseButton(); downArrow.setSize(WIDTH, 14); downArrow.autoRepeat = true; downArrow.focusEnabled = false; addChild(downArrow); upArrow = new BaseButton(); upArrow.setSize(WIDTH, 14); upArrow.move(0, 0); upArrow.autoRepeat = true; upArrow.focusEnabled = false; addChild(upArrow); upArrow.addEventListener(ComponentEvent.BUTTON_DOWN, scrollPressHandler, false, 0, true); downArrow.addEventListener(ComponentEvent.BUTTON_DOWN, scrollPressHandler, false, 0, true); track.addEventListener(ComponentEvent.BUTTON_DOWN, scrollPressHandler, false, 0, true); thumb.addEventListener(MouseEvent.MOUSE_DOWN, thumbPressHandler, false, 0, true); enabled = false; } public function get direction():String{ return (_direction); } public function get lineScrollSize():Number{ return (_lineScrollSize); } override public function setSize(_arg1:Number, _arg2:Number):void{ if (_direction == ScrollBarDirection.HORIZONTAL){ super.setSize(_arg2, _arg1); } else { super.setSize(_arg1, _arg2); }; } public function get maxScrollPosition():Number{ return (_maxScrollPosition); } override public function get width():Number{ return (((_direction)==ScrollBarDirection.HORIZONTAL) ? super.height : super.width); } protected function setStyles():void{ copyStylesToChild(downArrow, DOWN_ARROW_STYLES); copyStylesToChild(thumb, THUMB_STYLES); copyStylesToChild(track, TRACK_STYLES); copyStylesToChild(upArrow, UP_ARROW_STYLES); } public static function getStyleDefinition():Object{ return (defaultStyles); } } }//package fl.controls
Section 82
//ScrollBarDirection (fl.controls.ScrollBarDirection) package fl.controls { public class ScrollBarDirection { public static const HORIZONTAL:String = "horizontal"; public static const VERTICAL:String = "vertical"; } }//package fl.controls
Section 83
//ScrollPolicy (fl.controls.ScrollPolicy) package fl.controls { public class ScrollPolicy { public static const OFF:String = "off"; public static const ON:String = "on"; public static const AUTO:String = "auto"; } }//package fl.controls
Section 84
//SelectableList (fl.controls.SelectableList) package fl.controls { import fl.controls.listClasses.*; import fl.core.*; import flash.events.*; import flash.display.*; import fl.data.*; import fl.managers.*; import fl.events.*; import flash.utils.*; import fl.containers.*; import flash.ui.*; public class SelectableList extends BaseScrollPane implements IFocusManagerComponent { protected var invalidItems:Dictionary; protected var renderedItems:Dictionary; protected var listHolder:Sprite; protected var _allowMultipleSelection:Boolean;// = false protected var lastCaretIndex:int;// = -1 protected var _selectedIndices:Array; protected var availableCellRenderers:Array; protected var list:Sprite; protected var caretIndex:int;// = -1 protected var updatedRendererStyles:Object; protected var preChangeItems:Array; protected var activeCellRenderers:Array; protected var rendererStyles:Object; protected var _verticalScrollPosition:Number; protected var _dataProvider:DataProvider; protected var _horizontalScrollPosition:Number; private var collectionItemImport:SimpleCollectionItem; protected var _selectable:Boolean;// = true private static var defaultStyles:Object = {skin:"List_skin", cellRenderer:CellRenderer, contentPadding:null, disabledAlpha:null}; public static var createAccessibilityImplementation:Function; public function SelectableList(){ _allowMultipleSelection = false; _selectable = true; caretIndex = -1; lastCaretIndex = -1; super(); activeCellRenderers = []; availableCellRenderers = []; invalidItems = new Dictionary(true); renderedItems = new Dictionary(true); _selectedIndices = []; if (dataProvider == null){ dataProvider = new DataProvider(); }; verticalScrollPolicy = ScrollPolicy.AUTO; rendererStyles = {}; updatedRendererStyles = {}; } protected function drawList():void{ } public function set allowMultipleSelection(_arg1:Boolean):void{ if (_arg1 == _allowMultipleSelection){ return; }; _allowMultipleSelection = _arg1; if (((!(_arg1)) && ((_selectedIndices.length > 1)))){ _selectedIndices = [_selectedIndices.pop()]; invalidate(InvalidationType.DATA); }; } public function sortItemsOn(_arg1:String, _arg2:Object=null){ return (_dataProvider.sortOn(_arg1, _arg2)); } public function removeItemAt(_arg1:uint):Object{ return (_dataProvider.removeItemAt(_arg1)); } public function get selectedItem():Object{ return (((_selectedIndices.length)==0) ? null : _dataProvider.getItemAt(selectedIndex)); } override protected function keyDownHandler(_arg1:KeyboardEvent):void{ if (!selectable){ return; }; switch (_arg1.keyCode){ case Keyboard.UP: case Keyboard.DOWN: case Keyboard.END: case Keyboard.HOME: case Keyboard.PAGE_UP: case Keyboard.PAGE_DOWN: moveSelectionVertically(_arg1.keyCode, ((_arg1.shiftKey) && (_allowMultipleSelection)), ((_arg1.ctrlKey) && (_allowMultipleSelection))); _arg1.stopPropagation(); break; case Keyboard.LEFT: case Keyboard.RIGHT: moveSelectionHorizontally(_arg1.keyCode, ((_arg1.shiftKey) && (_allowMultipleSelection)), ((_arg1.ctrlKey) && (_allowMultipleSelection))); _arg1.stopPropagation(); break; }; } public function get selectable():Boolean{ return (_selectable); } public function itemToCellRenderer(_arg1:Object):ICellRenderer{ var _local2:*; var _local3:ICellRenderer; if (_arg1 != null){ for (_local2 in activeCellRenderers) { _local3 = (activeCellRenderers[_local2] as ICellRenderer); if (_local3.data == _arg1){ return (_local3); }; }; }; return (null); } public function getNextIndexAtLetter(_arg1:String, _arg2:int=-1):int{ var _local3:int; var _local4:Number; var _local5:Number; var _local6:Object; var _local7:String; if (length == 0){ return (-1); }; _arg1 = _arg1.toUpperCase(); _local3 = (length - 1); _local4 = 0; while (_local4 < _local3) { _local5 = ((_arg2 + 1) + _local4); if (_local5 > (length - 1)){ _local5 = (_local5 - length); }; _local6 = getItemAt(_local5); if (_local6 == null){ break; }; _local7 = itemToLabel(_local6); if (_local7 == null){ } else { if (_local7.charAt(0).toUpperCase() == _arg1){ return (_local5); }; }; _local4++; }; return (-1); } public function invalidateList():void{ _invalidateList(); invalidate(InvalidationType.DATA); } override public function set enabled(_arg1:Boolean):void{ super.enabled = _arg1; list.mouseChildren = _enabled; } public function get selectedIndices():Array{ return (_selectedIndices.concat()); } public function set selectable(_arg1:Boolean):void{ if (_arg1 == _selectable){ return; }; if (!_arg1){ selectedIndices = []; }; _selectable = _arg1; } public function itemToLabel(_arg1:Object):String{ return (_arg1["label"]); } public function addItemAt(_arg1:Object, _arg2:uint):void{ _dataProvider.addItemAt(_arg1, _arg2); invalidateList(); } public function replaceItemAt(_arg1:Object, _arg2:uint):Object{ return (_dataProvider.replaceItemAt(_arg1, _arg2)); } protected function handleDataChange(_arg1:DataChangeEvent):void{ var _local2:int; var _local3:int; var _local4:String; var _local5:uint; _local2 = _arg1.startIndex; _local3 = _arg1.endIndex; _local4 = _arg1.changeType; if (_local4 == DataChangeType.INVALIDATE_ALL){ clearSelection(); invalidateList(); } else { if (_local4 == DataChangeType.INVALIDATE){ _local5 = 0; while (_local5 < _arg1.items.length) { invalidateItem(_arg1.items[_local5]); _local5++; }; } else { if (_local4 == DataChangeType.ADD){ _local5 = 0; while (_local5 < _selectedIndices.length) { if (_selectedIndices[_local5] >= _local2){ _selectedIndices[_local5] = (_selectedIndices[_local5] + (_local2 - _local3)); }; _local5++; }; } else { if (_local4 == DataChangeType.REMOVE){ _local5 = 0; while (_local5 < _selectedIndices.length) { if (_selectedIndices[_local5] >= _local2){ if (_selectedIndices[_local5] <= _local3){ delete _selectedIndices[_local5]; } else { _selectedIndices[_local5] = (_selectedIndices[_local5] - ((_local2 - _local3) + 1)); }; }; _local5++; }; } else { if (_local4 == DataChangeType.REMOVE_ALL){ clearSelection(); } else { if (_local4 == DataChangeType.REPLACE){ } else { selectedItems = preChangeItems; preChangeItems = null; }; }; }; }; }; }; invalidate(InvalidationType.DATA); } protected function _invalidateList():void{ availableCellRenderers = []; while (activeCellRenderers.length > 0) { list.removeChild((activeCellRenderers.pop() as DisplayObject)); }; } protected function updateRendererStyles():void{ var _local1:Array; var _local2:uint; var _local3:uint; var _local4:String; _local1 = availableCellRenderers.concat(activeCellRenderers); _local2 = _local1.length; _local3 = 0; while (_local3 < _local2) { if (_local1[_local3].setStyle == null){ } else { for (_local4 in updatedRendererStyles) { _local1[_local3].setStyle(_local4, updatedRendererStyles[_local4]); }; _local1[_local3].drawNow(); }; _local3++; }; updatedRendererStyles = {}; } public function set selectedItem(_arg1:Object):void{ var _local2:int; _local2 = _dataProvider.getItemIndex(_arg1); selectedIndex = _local2; } public function sortItems(... _args){ return (_dataProvider.sort.apply(_dataProvider, _args)); } public function removeAll():void{ _dataProvider.removeAll(); } protected function handleCellRendererChange(_arg1:Event):void{ var _local2:ICellRenderer; var _local3:uint; _local2 = (_arg1.currentTarget as ICellRenderer); _local3 = _local2.listData.index; _dataProvider.invalidateItemAt(_local3); } protected function moveSelectionVertically(_arg1:uint, _arg2:Boolean, _arg3:Boolean):void{ } override protected function setHorizontalScrollPosition(_arg1:Number, _arg2:Boolean=false):void{ var _local3:Number; if (_arg1 == _horizontalScrollPosition){ return; }; _local3 = (_arg1 - _horizontalScrollPosition); _horizontalScrollPosition = _arg1; if (_arg2){ dispatchEvent(new ScrollEvent(ScrollBarDirection.HORIZONTAL, _local3, _arg1)); }; } public function scrollToSelected():void{ scrollToIndex(selectedIndex); } public function invalidateItem(_arg1:Object):void{ if (renderedItems[_arg1] == null){ return; }; invalidItems[_arg1] = true; invalidate(InvalidationType.DATA); } protected function handleCellRendererClick(_arg1:MouseEvent):void{ var _local2:ICellRenderer; var _local3:uint; var _local4:int; var _local5:int; var _local6:uint; if (!_enabled){ return; }; _local2 = (_arg1.currentTarget as ICellRenderer); _local3 = _local2.listData.index; if (((!(dispatchEvent(new ListEvent(ListEvent.ITEM_CLICK, false, true, _local2.listData.column, _local2.listData.row, _local3, _local2.data)))) || (!(_selectable)))){ return; }; _local4 = selectedIndices.indexOf(_local3); if (!_allowMultipleSelection){ if (_local4 != -1){ return; }; _local2.selected = true; _selectedIndices = [_local3]; lastCaretIndex = (caretIndex = _local3); } else { if (_arg1.shiftKey){ _local6 = ((_selectedIndices.length)>0) ? _selectedIndices[0] : _local3; _selectedIndices = []; if (_local6 > _local3){ _local5 = _local6; while (_local5 >= _local3) { _selectedIndices.push(_local5); _local5--; }; } else { _local5 = _local6; while (_local5 <= _local3) { _selectedIndices.push(_local5); _local5++; }; }; caretIndex = _local3; } else { if (_arg1.ctrlKey){ if (_local4 != -1){ _local2.selected = false; _selectedIndices.splice(_local4, 1); } else { _local2.selected = true; _selectedIndices.push(_local3); }; caretIndex = _local3; } else { _selectedIndices = [_local3]; lastCaretIndex = (caretIndex = _local3); }; }; }; dispatchEvent(new Event(Event.CHANGE)); invalidate(InvalidationType.DATA); } public function get length():uint{ return (_dataProvider.length); } public function get allowMultipleSelection():Boolean{ return (_allowMultipleSelection); } protected function onPreChange(_arg1:DataChangeEvent):void{ switch (_arg1.changeType){ case DataChangeType.REMOVE: case DataChangeType.ADD: case DataChangeType.INVALIDATE: case DataChangeType.REMOVE_ALL: case DataChangeType.REPLACE: case DataChangeType.INVALIDATE_ALL: break; default: preChangeItems = selectedItems; break; }; } public function getRendererStyle(_arg1:String, _arg2:int=-1):Object{ return (rendererStyles[_arg1]); } override protected function setVerticalScrollPosition(_arg1:Number, _arg2:Boolean=false):void{ var _local3:Number; if (_arg1 == _verticalScrollPosition){ return; }; _local3 = (_arg1 - _verticalScrollPosition); _verticalScrollPosition = _arg1; if (_arg2){ dispatchEvent(new ScrollEvent(ScrollBarDirection.VERTICAL, _local3, _arg1)); }; } protected function moveSelectionHorizontally(_arg1:uint, _arg2:Boolean, _arg3:Boolean):void{ } public function set selectedIndices(_arg1:Array):void{ if (!_selectable){ return; }; _selectedIndices = ((_arg1)==null) ? [] : _arg1.concat(); invalidate(InvalidationType.SELECTED); } public function get selectedIndex():int{ return (((_selectedIndices.length)==0) ? -1 : _selectedIndices[(_selectedIndices.length - 1)]); } override protected function draw():void{ super.draw(); } override protected function configUI():void{ super.configUI(); listHolder = new Sprite(); addChild(listHolder); listHolder.scrollRect = contentScrollRect; list = new Sprite(); listHolder.addChild(list); } public function addItem(_arg1:Object):void{ _dataProvider.addItem(_arg1); invalidateList(); } protected function handleCellRendererMouseEvent(_arg1:MouseEvent):void{ var _local2:ICellRenderer; var _local3:String; _local2 = (_arg1.target as ICellRenderer); _local3 = ((_arg1.type)==MouseEvent.ROLL_OVER) ? ListEvent.ITEM_ROLL_OVER : ListEvent.ITEM_ROLL_OUT; dispatchEvent(new ListEvent(_local3, false, false, _local2.listData.column, _local2.listData.row, _local2.listData.index, _local2.data)); } public function clearRendererStyle(_arg1:String, _arg2:int=-1):void{ delete rendererStyles[_arg1]; updatedRendererStyles[_arg1] = null; invalidate(InvalidationType.RENDERER_STYLES); } protected function handleCellRendererDoubleClick(_arg1:MouseEvent):void{ var _local2:ICellRenderer; var _local3:uint; if (!_enabled){ return; }; _local2 = (_arg1.currentTarget as ICellRenderer); _local3 = _local2.listData.index; dispatchEvent(new ListEvent(ListEvent.ITEM_DOUBLE_CLICK, false, true, _local2.listData.column, _local2.listData.row, _local3, _local2.data)); } public function get rowCount():uint{ return (0); } public function isItemSelected(_arg1:Object):Boolean{ return ((selectedItems.indexOf(_arg1) > -1)); } public function set dataProvider(_arg1:DataProvider):void{ if (_dataProvider != null){ _dataProvider.removeEventListener(DataChangeEvent.DATA_CHANGE, handleDataChange); _dataProvider.removeEventListener(DataChangeEvent.PRE_DATA_CHANGE, onPreChange); }; _dataProvider = _arg1; _dataProvider.addEventListener(DataChangeEvent.DATA_CHANGE, handleDataChange, false, 0, true); _dataProvider.addEventListener(DataChangeEvent.PRE_DATA_CHANGE, onPreChange, false, 0, true); clearSelection(); invalidateList(); } override protected function drawLayout():void{ super.drawLayout(); contentScrollRect = listHolder.scrollRect; contentScrollRect.width = availableWidth; contentScrollRect.height = availableHeight; listHolder.scrollRect = contentScrollRect; } public function getItemAt(_arg1:uint):Object{ return (_dataProvider.getItemAt(_arg1)); } override protected function initializeAccessibility():void{ if (SelectableList.createAccessibilityImplementation != null){ SelectableList.createAccessibilityImplementation(this); }; } public function scrollToIndex(_arg1:int):void{ } public function removeItem(_arg1:Object):Object{ return (_dataProvider.removeItem(_arg1)); } public function get dataProvider():DataProvider{ return (_dataProvider); } public function set maxHorizontalScrollPosition(_arg1:Number):void{ _maxHorizontalScrollPosition = _arg1; invalidate(InvalidationType.SIZE); } public function setRendererStyle(_arg1:String, _arg2:Object, _arg3:uint=0):void{ if (rendererStyles[_arg1] == _arg2){ return; }; updatedRendererStyles[_arg1] = _arg2; rendererStyles[_arg1] = _arg2; invalidate(InvalidationType.RENDERER_STYLES); } public function invalidateItemAt(_arg1:uint):void{ var _local2:Object; _local2 = _dataProvider.getItemAt(_arg1); if (_local2 != null){ invalidateItem(_local2); }; } public function set selectedItems(_arg1:Array):void{ var _local2:Array; var _local3:uint; var _local4:int; if (_arg1 == null){ selectedIndices = null; return; }; _local2 = []; _local3 = 0; while (_local3 < _arg1.length) { _local4 = _dataProvider.getItemIndex(_arg1[_local3]); if (_local4 != -1){ _local2.push(_local4); }; _local3++; }; selectedIndices = _local2; } public function clearSelection():void{ selectedIndex = -1; } override public function get maxHorizontalScrollPosition():Number{ return (_maxHorizontalScrollPosition); } public function get selectedItems():Array{ var _local1:Array; var _local2:uint; _local1 = []; _local2 = 0; while (_local2 < _selectedIndices.length) { _local1.push(_dataProvider.getItemAt(_selectedIndices[_local2])); _local2++; }; return (_local1); } public function set selectedIndex(_arg1:int):void{ selectedIndices = ((_arg1)==-1) ? null : [_arg1]; } public static function getStyleDefinition():Object{ return (mergeStyles(defaultStyles, BaseScrollPane.getStyleDefinition())); } } }//package fl.controls
Section 85
//TextInput (fl.controls.TextInput) package fl.controls { import fl.core.*; import flash.events.*; import flash.display.*; import flash.text.*; import fl.managers.*; import fl.events.*; import flash.ui.*; public class TextInput extends UIComponent implements IFocusManagerComponent { protected var _html:Boolean;// = false protected var _savedHTML:String; protected var background:DisplayObject; protected var _editable:Boolean;// = true public var textField:TextField; private static var defaultStyles:Object = {upSkin:"TextInput_upSkin", disabledSkin:"TextInput_disabledSkin", focusRectSkin:null, focusRectPadding:null, textFormat:null, disabledTextFormat:null, textPadding:0, embedFonts:false}; public static var createAccessibilityImplementation:Function; public function TextInput(){ _editable = true; _html = false; super(); } override public function drawFocus(_arg1:Boolean):void{ if (focusTarget != null){ focusTarget.drawFocus(_arg1); return; }; super.drawFocus(_arg1); } public function set imeMode(_arg1:String):void{ _imeMode = _arg1; } override protected function isOurFocus(_arg1:DisplayObject):Boolean{ return ((((_arg1 == textField)) || (super.isOurFocus(_arg1)))); } protected function handleKeyDown(_arg1:KeyboardEvent):void{ if (_arg1.keyCode == Keyboard.ENTER){ dispatchEvent(new ComponentEvent(ComponentEvent.ENTER, true)); }; } public function set text(_arg1:String):void{ textField.text = _arg1; _html = false; invalidate(InvalidationType.DATA); invalidate(InvalidationType.STYLES); } protected function updateTextFieldType():void{ textField.type = (((enabled) && (editable))) ? TextFieldType.INPUT : TextFieldType.DYNAMIC; textField.selectable = enabled; } public function get selectionEndIndex():int{ return (textField.selectionEndIndex); } public function get editable():Boolean{ return (_editable); } override protected function focusInHandler(_arg1:FocusEvent):void{ var _local2:IFocusManager; if (_arg1.target == this){ stage.focus = textField; }; _local2 = focusManager; if (((editable) && (_local2))){ _local2.showFocusIndicator = true; if (((textField.selectable) && ((textField.selectionBeginIndex == textField.selectionBeginIndex)))){ setSelection(0, textField.length); }; }; super.focusInHandler(_arg1); if (editable){ setIMEMode(true); }; } public function get selectionBeginIndex():int{ return (textField.selectionBeginIndex); } public function set alwaysShowSelection(_arg1:Boolean):void{ textField.alwaysShowSelection = _arg1; } override public function set enabled(_arg1:Boolean):void{ super.enabled = _arg1; updateTextFieldType(); } protected function setEmbedFont(){ var _local1:Object; _local1 = getStyleValue("embedFonts"); if (_local1 != null){ textField.embedFonts = _local1; }; } public function get horizontalScrollPosition():int{ return (textField.scrollH); } public function set condenseWhite(_arg1:Boolean):void{ textField.condenseWhite = _arg1; } public function set displayAsPassword(_arg1:Boolean):void{ textField.displayAsPassword = _arg1; } public function set horizontalScrollPosition(_arg1:int):void{ textField.scrollH = _arg1; } public function get restrict():String{ return (textField.restrict); } public function get textWidth():Number{ return (textField.textWidth); } public function get textHeight():Number{ return (textField.textHeight); } public function set editable(_arg1:Boolean):void{ _editable = _arg1; updateTextFieldType(); } public function get maxChars():int{ return (textField.maxChars); } public function get length():int{ return (textField.length); } public function getLineMetrics(_arg1:int):TextLineMetrics{ return (textField.getLineMetrics(_arg1)); } public function get imeMode():String{ return (_imeMode); } override protected function focusOutHandler(_arg1:FocusEvent):void{ super.focusOutHandler(_arg1); if (editable){ setIMEMode(false); }; } public function set htmlText(_arg1:String):void{ if (_arg1 == ""){ text = ""; return; }; _html = true; _savedHTML = _arg1; textField.htmlText = _arg1; invalidate(InvalidationType.DATA); invalidate(InvalidationType.STYLES); } public function get text():String{ return (textField.text); } override public function get enabled():Boolean{ return (super.enabled); } public function get condenseWhite():Boolean{ return (textField.condenseWhite); } public function get alwaysShowSelection():Boolean{ return (textField.alwaysShowSelection); } override protected function draw():void{ var _local1:Object; if (isInvalid(InvalidationType.STYLES, InvalidationType.STATE)){ drawTextFormat(); drawBackground(); _local1 = getStyleValue("embedFonts"); if (_local1 != null){ textField.embedFonts = _local1; }; invalidate(InvalidationType.SIZE, false); }; if (isInvalid(InvalidationType.SIZE)){ drawLayout(); }; super.draw(); } protected function handleTextInput(_arg1:TextEvent):void{ _arg1.stopPropagation(); dispatchEvent(new TextEvent(TextEvent.TEXT_INPUT, true, false, _arg1.text)); } override protected function configUI():void{ super.configUI(); tabChildren = true; textField = new TextField(); addChild(textField); updateTextFieldType(); textField.addEventListener(TextEvent.TEXT_INPUT, handleTextInput, false, 0, true); textField.addEventListener(Event.CHANGE, handleChange, false, 0, true); textField.addEventListener(KeyboardEvent.KEY_DOWN, handleKeyDown, false, 0, true); } public function setSelection(_arg1:int, _arg2:int):void{ textField.setSelection(_arg1, _arg2); } public function get displayAsPassword():Boolean{ return (textField.displayAsPassword); } public function appendText(_arg1:String):void{ textField.appendText(_arg1); } public function set restrict(_arg1:String):void{ if (((componentInspectorSetting) && ((_arg1 == "")))){ _arg1 = null; }; textField.restrict = _arg1; } public function get htmlText():String{ return (textField.htmlText); } protected function drawBackground():void{ var _local1:DisplayObject; var _local2:String; _local1 = background; _local2 = (enabled) ? "upSkin" : "disabledSkin"; background = getDisplayObjectInstance(getStyleValue(_local2)); if (background == null){ return; }; addChildAt(background, 0); if (((((!((_local1 == null))) && (!((_local1 == background))))) && (contains(_local1)))){ removeChild(_local1); }; } override public function setFocus():void{ stage.focus = textField; } protected function drawLayout():void{ var _local1:Number; _local1 = Number(getStyleValue("textPadding")); if (background != null){ background.width = width; background.height = height; }; textField.width = (width - (2 * _local1)); textField.height = (height - (2 * _local1)); textField.x = (textField.y = _local1); } public function set maxChars(_arg1:int):void{ textField.maxChars = _arg1; } public function get maxHorizontalScrollPosition():int{ return (textField.maxScrollH); } protected function drawTextFormat():void{ var _local1:Object; var _local2:TextFormat; var _local3:TextFormat; _local1 = UIComponent.getStyleDefinition(); _local2 = (enabled) ? (_local1.defaultTextFormat as TextFormat) : (_local1.defaultDisabledTextFormat as TextFormat); textField.setTextFormat(_local2); _local3 = (getStyleValue((enabled) ? "textFormat" : "disabledTextFormat") as TextFormat); if (_local3 != null){ textField.setTextFormat(_local3); } else { _local3 = _local2; }; textField.defaultTextFormat = _local3; setEmbedFont(); if (_html){ textField.htmlText = _savedHTML; }; } protected function handleChange(_arg1:Event):void{ _arg1.stopPropagation(); dispatchEvent(new Event(Event.CHANGE, true)); } public static function getStyleDefinition():Object{ return (defaultStyles); } } }//package fl.controls
Section 86
//UIScrollBar (fl.controls.UIScrollBar) package fl.controls { import fl.core.*; import flash.events.*; import flash.text.*; import fl.events.*; public class UIScrollBar extends ScrollBar { protected var inScroll:Boolean;// = false protected var _scrollTarget:TextField; protected var inEdit:Boolean;// = false private static var defaultStyles:Object = {}; public function UIScrollBar(){ inEdit = false; inScroll = false; super(); } protected function handleTargetScroll(_arg1:Event):void{ if (inDrag){ return; }; if (!enabled){ return; }; inEdit = true; updateScrollTargetProperties(); scrollPosition = ((direction)==ScrollBarDirection.HORIZONTAL) ? _scrollTarget.scrollH : _scrollTarget.scrollV; inEdit = false; } override public function set minScrollPosition(_arg1:Number):void{ super.minScrollPosition = ((_arg1)<0) ? 0 : _arg1; } override public function setScrollPosition(_arg1:Number, _arg2:Boolean=true):void{ super.setScrollPosition(_arg1, _arg2); if (!_scrollTarget){ inScroll = false; return; }; updateTargetScroll(); } override public function setScrollProperties(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number=0):void{ var _local5:Number; var _local6:Number; _local5 = _arg3; _local6 = ((_arg2)<0) ? 0 : _arg2; if (_scrollTarget != null){ if (direction == ScrollBarDirection.HORIZONTAL){ _local5 = ((_arg3)>_scrollTarget.maxScrollH) ? _scrollTarget.maxScrollH : _local5; } else { _local5 = ((_arg3)>_scrollTarget.maxScrollV) ? _scrollTarget.maxScrollV : _local5; }; }; super.setScrollProperties(_arg1, _local6, _local5, _arg4); } public function get scrollTargetName():String{ return (_scrollTarget.name); } public function get scrollTarget():TextField{ return (_scrollTarget); } protected function updateScrollTargetProperties():void{ var _local1:Boolean; var _local2:Number; if (_scrollTarget == null){ setScrollProperties(pageSize, minScrollPosition, maxScrollPosition, pageScrollSize); scrollPosition = 0; } else { _local1 = (direction == ScrollBarDirection.HORIZONTAL); _local2 = (_local1) ? _scrollTarget.width : 10; setScrollProperties(_local2, (_local1) ? 0 : 1, (_local1) ? _scrollTarget.maxScrollH : _scrollTarget.maxScrollV, pageScrollSize); scrollPosition = (_local1) ? _scrollTarget.scrollH : _scrollTarget.scrollV; }; } public function update():void{ inEdit = true; updateScrollTargetProperties(); inEdit = false; } public function set scrollTargetName(_arg1:String):void{ var target = _arg1; try { scrollTarget = (parent.getChildByName(target) as TextField); } catch(error:Error) { throw (new Error("ScrollTarget not found, or is not a TextField")); }; } override public function set direction(_arg1:String):void{ if (isLivePreview){ return; }; super.direction = _arg1; updateScrollTargetProperties(); } protected function handleTargetChange(_arg1:Event):void{ inEdit = true; setScrollPosition(((direction)==ScrollBarDirection.HORIZONTAL) ? _scrollTarget.scrollH : _scrollTarget.scrollV, true); updateScrollTargetProperties(); inEdit = false; } override public function set maxScrollPosition(_arg1:Number):void{ var _local2:Number; _local2 = _arg1; if (_scrollTarget != null){ if (direction == ScrollBarDirection.HORIZONTAL){ _local2 = ((_local2)>_scrollTarget.maxScrollH) ? _scrollTarget.maxScrollH : _local2; } else { _local2 = ((_local2)>_scrollTarget.maxScrollV) ? _scrollTarget.maxScrollV : _local2; }; }; super.maxScrollPosition = _local2; } protected function updateTargetScroll(_arg1:ScrollEvent=null):void{ if (inEdit){ return; }; if (direction == ScrollBarDirection.HORIZONTAL){ _scrollTarget.scrollH = scrollPosition; } else { _scrollTarget.scrollV = scrollPosition; }; } override protected function draw():void{ if (isInvalid(InvalidationType.DATA)){ updateScrollTargetProperties(); }; super.draw(); } public function set scrollTarget(_arg1:TextField):void{ if (_scrollTarget != null){ _scrollTarget.removeEventListener(Event.CHANGE, handleTargetChange, false); _scrollTarget.removeEventListener(TextEvent.TEXT_INPUT, handleTargetChange, false); _scrollTarget.removeEventListener(Event.SCROLL, handleTargetScroll, false); removeEventListener(ScrollEvent.SCROLL, updateTargetScroll, false); }; _scrollTarget = _arg1; if (_scrollTarget != null){ _scrollTarget.addEventListener(Event.CHANGE, handleTargetChange, false, 0, true); _scrollTarget.addEventListener(TextEvent.TEXT_INPUT, handleTargetChange, false, 0, true); _scrollTarget.addEventListener(Event.SCROLL, handleTargetScroll, false, 0, true); addEventListener(ScrollEvent.SCROLL, updateTargetScroll, false, 0, true); }; invalidate(InvalidationType.DATA); } override public function get direction():String{ return (super.direction); } public static function getStyleDefinition():Object{ return (UIComponent.mergeStyles(defaultStyles, ScrollBar.getStyleDefinition())); } } }//package fl.controls
Section 87
//ComponentShim (fl.core.ComponentShim) package fl.core { import flash.display.*; public dynamic class ComponentShim extends MovieClip { } }//package fl.core
Section 88
//InvalidationType (fl.core.InvalidationType) package fl.core { public class InvalidationType { public static const SIZE:String = "size"; public static const ALL:String = "all"; public static const DATA:String = "data"; public static const SCROLL:String = "scroll"; public static const STATE:String = "state"; public static const STYLES:String = "styles"; public static const SELECTED:String = "selected"; public static const RENDERER_STYLES:String = "rendererStyles"; } }//package fl.core
Section 89
//UIComponent (fl.core.UIComponent) package fl.core { import flash.events.*; import flash.display.*; import flash.text.*; import fl.managers.*; import fl.events.*; import flash.utils.*; import flash.system.*; public class UIComponent extends Sprite { protected var _enabled:Boolean;// = true private var _mouseFocusEnabled:Boolean;// = true protected var startHeight:Number; protected var _height:Number; protected var _oldIMEMode:String;// = null protected var startWidth:Number; public var focusTarget:IFocusManagerComponent; protected var errorCaught:Boolean;// = false protected var uiFocusRect:DisplayObject; protected var _width:Number; public var version:String;// = "3.0.0.15" protected var isFocused:Boolean;// = false protected var callLaterMethods:Dictionary; private var _focusEnabled:Boolean;// = true private var tempText:TextField; protected var invalidateFlag:Boolean;// = false protected var _inspector:Boolean;// = false protected var sharedStyles:Object; protected var invalidHash:Object; protected var isLivePreview:Boolean;// = false protected var _imeMode:String;// = null protected var instanceStyles:Object; protected var _x:Number; protected var _y:Number; public static var inCallLaterPhase:Boolean = false; private static var defaultStyles:Object = {focusRectSkin:"focusRectSkin", focusRectPadding:2, textFormat:new TextFormat("_sans", 11, 0, false, false, false, "", "", TextFormatAlign.LEFT, 0, 0, 0, 0), disabledTextFormat:new TextFormat("_sans", 11, 0x999999, false, false, false, "", "", TextFormatAlign.LEFT, 0, 0, 0, 0), defaultTextFormat:new TextFormat("_sans", 11, 0, false, false, false, "", "", TextFormatAlign.LEFT, 0, 0, 0, 0), defaultDisabledTextFormat:new TextFormat("_sans", 11, 0x999999, false, false, false, "", "", TextFormatAlign.LEFT, 0, 0, 0, 0)}; public static var createAccessibilityImplementation:Function; private static var focusManagers:Dictionary = new Dictionary(false); public function UIComponent(){ version = "3.0.0.15"; isLivePreview = false; invalidateFlag = false; _enabled = true; isFocused = false; _focusEnabled = true; _mouseFocusEnabled = true; _imeMode = null; _oldIMEMode = null; errorCaught = false; _inspector = false; super(); instanceStyles = {}; sharedStyles = {}; invalidHash = {}; callLaterMethods = new Dictionary(); StyleManager.registerInstance(this); configUI(); invalidate(InvalidationType.ALL); tabEnabled = (this is IFocusManagerComponent); focusRect = false; if (tabEnabled){ addEventListener(FocusEvent.FOCUS_IN, focusInHandler); addEventListener(FocusEvent.FOCUS_OUT, focusOutHandler); addEventListener(KeyboardEvent.KEY_DOWN, keyDownHandler); addEventListener(KeyboardEvent.KEY_UP, keyUpHandler); }; initializeFocusManager(); addEventListener(Event.ENTER_FRAME, hookAccessibility, false, 0, true); } public function drawFocus(_arg1:Boolean):void{ var _local2:Number; isFocused = _arg1; if (((!((uiFocusRect == null))) && (contains(uiFocusRect)))){ removeChild(uiFocusRect); uiFocusRect = null; }; if (_arg1){ uiFocusRect = (getDisplayObjectInstance(getStyleValue("focusRectSkin")) as Sprite); if (uiFocusRect == null){ return; }; _local2 = Number(getStyleValue("focusRectPadding")); uiFocusRect.x = -(_local2); uiFocusRect.y = -(_local2); uiFocusRect.width = (width + (_local2 * 2)); uiFocusRect.height = (height + (_local2 * 2)); addChildAt(uiFocusRect, 0); }; } private function callLaterDispatcher(_arg1:Event):void{ var _local2:Dictionary; var _local3:Object; if (_arg1.type == Event.ADDED_TO_STAGE){ removeEventListener(Event.ADDED_TO_STAGE, callLaterDispatcher); stage.addEventListener(Event.RENDER, callLaterDispatcher, false, 0, true); stage.invalidate(); return; }; _arg1.target.removeEventListener(Event.RENDER, callLaterDispatcher); if (stage == null){ addEventListener(Event.ADDED_TO_STAGE, callLaterDispatcher, false, 0, true); return; }; inCallLaterPhase = true; _local2 = callLaterMethods; for (_local3 in _local2) { _local3(); delete _local2[_local3]; }; inCallLaterPhase = false; } private function addedHandler(_arg1:Event):void{ removeEventListener("addedToStage", addedHandler); initializeFocusManager(); } protected function getStyleValue(_arg1:String):Object{ return (((instanceStyles[_arg1])==null) ? sharedStyles[_arg1] : instanceStyles[_arg1]); } protected function isOurFocus(_arg1:DisplayObject):Boolean{ return ((_arg1 == this)); } override public function get scaleX():Number{ return ((width / startWidth)); } override public function get scaleY():Number{ return ((height / startHeight)); } override public function set height(_arg1:Number):void{ if (_height == _arg1){ return; }; setSize(width, _arg1); } protected function keyDownHandler(_arg1:KeyboardEvent):void{ } protected function focusInHandler(_arg1:FocusEvent):void{ var _local2:IFocusManager; if (isOurFocus((_arg1.target as DisplayObject))){ _local2 = focusManager; if (((_local2) && (_local2.showFocusIndicator))){ drawFocus(true); isFocused = true; }; }; } public function setStyle(_arg1:String, _arg2:Object):void{ if ((((instanceStyles[_arg1] === _arg2)) && (!((_arg2 is TextFormat))))){ return; }; instanceStyles[_arg1] = _arg2; invalidate(InvalidationType.STYLES); } override public function get visible():Boolean{ return (super.visible); } public function get componentInspectorSetting():Boolean{ return (_inspector); } override public function get x():Number{ return ((isNaN(_x)) ? super.x : _x); } override public function get y():Number{ return ((isNaN(_y)) ? super.y : _y); } protected function setIMEMode(_arg1:Boolean){ var enabled = _arg1; if (_imeMode != null){ if (enabled){ IME.enabled = true; _oldIMEMode = IME.conversionMode; try { if (((!(errorCaught)) && (!((IME.conversionMode == IMEConversionMode.UNKNOWN))))){ IME.conversionMode = _imeMode; }; errorCaught = false; } catch(e:Error) { errorCaught = true; throw (new Error(("IME mode not supported: " + _imeMode))); }; } else { if (((!((IME.conversionMode == IMEConversionMode.UNKNOWN))) && (!((_oldIMEMode == IMEConversionMode.UNKNOWN))))){ IME.conversionMode = _oldIMEMode; }; IME.enabled = false; }; }; } public function set enabled(_arg1:Boolean):void{ if (_arg1 == _enabled){ return; }; _enabled = _arg1; invalidate(InvalidationType.STATE); } public function setSharedStyle(_arg1:String, _arg2:Object):void{ if ((((sharedStyles[_arg1] === _arg2)) && (!((_arg2 is TextFormat))))){ return; }; sharedStyles[_arg1] = _arg2; if (instanceStyles[_arg1] == null){ invalidate(InvalidationType.STYLES); }; } protected function keyUpHandler(_arg1:KeyboardEvent):void{ } public function set focusEnabled(_arg1:Boolean):void{ _focusEnabled = _arg1; } override public function set scaleX(_arg1:Number):void{ setSize((startWidth * _arg1), height); } public function get mouseFocusEnabled():Boolean{ return (_mouseFocusEnabled); } override public function set scaleY(_arg1:Number):void{ setSize(width, (startHeight * _arg1)); } protected function getDisplayObjectInstance(_arg1:Object):DisplayObject{ var classDef:Object; var skin = _arg1; classDef = null; if ((skin is Class)){ return ((new (skin) as DisplayObject)); }; if ((skin is DisplayObject)){ (skin as DisplayObject).x = 0; (skin as DisplayObject).y = 0; return ((skin as DisplayObject)); }; try { classDef = getDefinitionByName(skin.toString()); } catch(e:Error) { try { classDef = (loaderInfo.applicationDomain.getDefinition(skin.toString()) as Object); } catch(e:Error) { }; }; if (classDef == null){ return (null); }; return ((new (classDef) as DisplayObject)); } protected function copyStylesToChild(_arg1:UIComponent, _arg2:Object):void{ var _local3:String; for (_local3 in _arg2) { _arg1.setStyle(_local3, getStyleValue(_arg2[_local3])); }; } protected function beforeComponentParameters():void{ } protected function callLater(_arg1:Function):void{ if (inCallLaterPhase){ return; }; callLaterMethods[_arg1] = true; if (stage != null){ stage.addEventListener(Event.RENDER, callLaterDispatcher, false, 0, true); stage.invalidate(); } else { addEventListener(Event.ADDED_TO_STAGE, callLaterDispatcher, false, 0, true); }; } protected function createFocusManager():void{ if (focusManagers[stage] == null){ focusManagers[stage] = new FocusManager(stage); }; } override public function set visible(_arg1:Boolean):void{ var _local2:String; if (super.visible == _arg1){ return; }; super.visible = _arg1; _local2 = (_arg1) ? ComponentEvent.SHOW : ComponentEvent.HIDE; dispatchEvent(new ComponentEvent(_local2, true)); } protected function hookAccessibility(_arg1:Event):void{ removeEventListener(Event.ENTER_FRAME, hookAccessibility); initializeAccessibility(); } public function set componentInspectorSetting(_arg1:Boolean):void{ _inspector = _arg1; if (_inspector){ beforeComponentParameters(); } else { afterComponentParameters(); }; } override public function set x(_arg1:Number):void{ move(_arg1, _y); } public function drawNow():void{ draw(); } override public function set y(_arg1:Number):void{ move(_x, _arg1); } protected function checkLivePreview():Boolean{ var className:String; if (parent == null){ return (false); }; try { className = getQualifiedClassName(parent); } catch(e:Error) { }; return ((className == "fl.livepreview::LivePreviewParent")); } protected function focusOutHandler(_arg1:FocusEvent):void{ if (isOurFocus((_arg1.target as DisplayObject))){ drawFocus(false); isFocused = false; }; } public function set mouseFocusEnabled(_arg1:Boolean):void{ _mouseFocusEnabled = _arg1; } public function getFocus():InteractiveObject{ if (stage){ return (stage.focus); }; return (null); } protected function validate():void{ invalidHash = {}; } override public function get height():Number{ return (_height); } public function invalidate(_arg1:String="all", _arg2:Boolean=true):void{ invalidHash[_arg1] = true; if (_arg2){ this.callLater(draw); }; } public function get enabled():Boolean{ return (_enabled); } protected function getScaleX():Number{ return (super.scaleX); } protected function getScaleY():Number{ return (super.scaleY); } public function get focusEnabled():Boolean{ return (_focusEnabled); } protected function afterComponentParameters():void{ } protected function draw():void{ if (isInvalid(InvalidationType.SIZE, InvalidationType.STYLES)){ if (((isFocused) && (focusManager.showFocusIndicator))){ drawFocus(true); }; }; validate(); } protected function configUI():void{ var _local1:Number; var _local2:Number; var _local3:Number; isLivePreview = checkLivePreview(); _local1 = rotation; rotation = 0; _local2 = super.width; _local3 = super.height; var _local4 = 1; super.scaleY = _local4; super.scaleX = _local4; setSize(_local2, _local3); move(super.x, super.y); rotation = _local1; startWidth = _local2; startHeight = _local3; if (numChildren > 0){ removeChildAt(0); }; } protected function setScaleX(_arg1:Number):void{ super.scaleX = _arg1; } protected function setScaleY(_arg1:Number):void{ super.scaleY = _arg1; } private function initializeFocusManager():void{ if (stage == null){ addEventListener(Event.ADDED_TO_STAGE, addedHandler, false, 0, true); } else { createFocusManager(); }; } public function set focusManager(_arg1:IFocusManager):void{ UIComponent.focusManagers[this] = _arg1; } public function clearStyle(_arg1:String):void{ setStyle(_arg1, null); } protected function isInvalid(_arg1:String, ... _args):Boolean{ if (((invalidHash[_arg1]) || (invalidHash[InvalidationType.ALL]))){ return (true); }; while (_args.length > 0) { if (invalidHash[_args.pop()]){ return (true); }; }; return (false); } public function setSize(_arg1:Number, _arg2:Number):void{ _width = _arg1; _height = _arg2; invalidate(InvalidationType.SIZE); dispatchEvent(new ComponentEvent(ComponentEvent.RESIZE, false)); } override public function set width(_arg1:Number):void{ if (_width == _arg1){ return; }; setSize(_arg1, height); } public function setFocus():void{ if (stage){ stage.focus = this; }; } protected function initializeAccessibility():void{ if (UIComponent.createAccessibilityImplementation != null){ UIComponent.createAccessibilityImplementation(this); }; } public function get focusManager():IFocusManager{ var _local1:DisplayObject; _local1 = this; while (_local1) { if (UIComponent.focusManagers[_local1] != null){ return (IFocusManager(UIComponent.focusManagers[_local1])); }; _local1 = _local1.parent; }; return (null); } override public function get width():Number{ return (_width); } public function move(_arg1:Number, _arg2:Number):void{ _x = _arg1; _y = _arg2; super.x = Math.round(_arg1); super.y = Math.round(_arg2); dispatchEvent(new ComponentEvent(ComponentEvent.MOVE)); } public function validateNow():void{ invalidate(InvalidationType.ALL, false); draw(); } public function getStyle(_arg1:String):Object{ return (instanceStyles[_arg1]); } public static function getStyleDefinition():Object{ return (defaultStyles); } public static function mergeStyles(... _args):Object{ var _local2:Object; var _local3:uint; var _local4:uint; var _local5:Object; var _local6:String; _local2 = {}; _local3 = _args.length; _local4 = 0; while (_local4 < _local3) { _local5 = _args[_local4]; for (_local6 in _local5) { if (_local2[_local6] != null){ } else { _local2[_local6] = _args[_local4][_local6]; }; }; _local4++; }; return (_local2); } } }//package fl.core
Section 90
//DataProvider (fl.data.DataProvider) package fl.data { import flash.events.*; import fl.events.*; public class DataProvider extends EventDispatcher { protected var data:Array; public function DataProvider(_arg1:Object=null){ if (_arg1 == null){ data = []; } else { data = getDataFromObject(_arg1); }; } protected function dispatchPreChangeEvent(_arg1:String, _arg2:Array, _arg3:int, _arg4:int):void{ dispatchEvent(new DataChangeEvent(DataChangeEvent.PRE_DATA_CHANGE, _arg1, _arg2, _arg3, _arg4)); } public function invalidateItemAt(_arg1:int):void{ checkIndex(_arg1, (data.length - 1)); dispatchChangeEvent(DataChangeType.INVALIDATE, [data[_arg1]], _arg1, _arg1); } public function getItemIndex(_arg1:Object):int{ return (data.indexOf(_arg1)); } protected function getDataFromObject(_arg1:Object):Array{ var _local2:Array; var _local3:Array; var _local4:uint; var _local5:Object; var _local6:XML; var _local7:XMLList; var _local8:XML; var _local9:XMLList; var _local10:XML; var _local11:XMLList; var _local12:XML; if ((_arg1 is Array)){ _local3 = (_arg1 as Array); if (_local3.length > 0){ if ((((_local3[0] is String)) || ((_local3[0] is Number)))){ _local2 = []; _local4 = 0; while (_local4 < _local3.length) { _local5 = {label:String(_local3[_local4]), data:_local3[_local4]}; _local2.push(_local5); _local4++; }; return (_local2); }; }; return (_arg1.concat()); } else { if ((_arg1 is DataProvider)){ return (_arg1.toArray()); }; if ((_arg1 is XML)){ _local6 = (_arg1 as XML); _local2 = []; _local7 = _local6.*; for each (_local8 in _local7) { _arg1 = {}; _local9 = _local8.attributes(); for each (_local10 in _local9) { _arg1[_local10.localName()] = _local10.toString(); }; _local11 = _local8.*; for each (_local12 in _local11) { if (_local12.hasSimpleContent()){ _arg1[_local12.localName()] = _local12.toString(); }; }; _local2.push(_arg1); }; return (_local2); //unresolved jump }; }; throw (new ((!NULL! + !NULL!) + " to Array or DataProvider.").TypeError(!NULL!)); } public function removeItemAt(_arg1:uint):Object{ var _local2:Array; checkIndex(_arg1, (data.length - 1)); dispatchPreChangeEvent(DataChangeType.REMOVE, data.slice(_arg1, (_arg1 + 1)), _arg1, _arg1); _local2 = data.splice(_arg1, 1); dispatchChangeEvent(DataChangeType.REMOVE, _local2, _arg1, _arg1); return (_local2[0]); } public function addItem(_arg1:Object):void{ dispatchPreChangeEvent(DataChangeType.ADD, [_arg1], (data.length - 1), (data.length - 1)); data.push(_arg1); dispatchChangeEvent(DataChangeType.ADD, [_arg1], (data.length - 1), (data.length - 1)); } public function sortOn(_arg1:Object, _arg2:Object=null){ var _local3:Array; dispatchPreChangeEvent(DataChangeType.SORT, data.concat(), 0, (data.length - 1)); _local3 = data.sortOn(_arg1, _arg2); dispatchChangeEvent(DataChangeType.SORT, data.concat(), 0, (data.length - 1)); return (_local3); } public function sort(... _args){ var _local2:Array; dispatchPreChangeEvent(DataChangeType.SORT, data.concat(), 0, (data.length - 1)); _local2 = data.sort.apply(data, _args); dispatchChangeEvent(DataChangeType.SORT, data.concat(), 0, (data.length - 1)); return (_local2); } public function addItems(_arg1:Object):void{ addItemsAt(_arg1, data.length); } public function concat(_arg1:Object):void{ addItems(_arg1); } public function clone():DataProvider{ return (new DataProvider(data)); } public function toArray():Array{ return (data.concat()); } public function get length():uint{ return (data.length); } public function addItemAt(_arg1:Object, _arg2:uint):void{ checkIndex(_arg2, data.length); dispatchPreChangeEvent(DataChangeType.ADD, [_arg1], _arg2, _arg2); data.splice(_arg2, 0, _arg1); dispatchChangeEvent(DataChangeType.ADD, [_arg1], _arg2, _arg2); } public function getItemAt(_arg1:uint):Object{ checkIndex(_arg1, (data.length - 1)); return (data[_arg1]); } override public function toString():String{ return ((("DataProvider [" + data.join(" , ")) + "]")); } public function invalidateItem(_arg1:Object):void{ var _local2:uint; _local2 = getItemIndex(_arg1); if (_local2 == -1){ return; }; invalidateItemAt(_local2); } protected function dispatchChangeEvent(_arg1:String, _arg2:Array, _arg3:int, _arg4:int):void{ dispatchEvent(new DataChangeEvent(DataChangeEvent.DATA_CHANGE, _arg1, _arg2, _arg3, _arg4)); } protected function checkIndex(_arg1:int, _arg2:int):void{ if ((((_arg1 > _arg2)) || ((_arg1 < 0)))){ throw (new RangeError((((("DataProvider index (" + _arg1) + ") is not in acceptable range (0 - ") + _arg2) + ")"))); }; } public function addItemsAt(_arg1:Object, _arg2:uint):void{ var _local3:Array; checkIndex(_arg2, data.length); _local3 = getDataFromObject(_arg1); dispatchPreChangeEvent(DataChangeType.ADD, _local3, _arg2, ((_arg2 + _local3.length) - 1)); data.splice.apply(data, [_arg2, 0].concat(_local3)); dispatchChangeEvent(DataChangeType.ADD, _local3, _arg2, ((_arg2 + _local3.length) - 1)); } public function replaceItem(_arg1:Object, _arg2:Object):Object{ var _local3:int; _local3 = getItemIndex(_arg2); if (_local3 != -1){ return (replaceItemAt(_arg1, _local3)); }; return (null); } public function removeItem(_arg1:Object):Object{ var _local2:int; _local2 = getItemIndex(_arg1); if (_local2 != -1){ return (removeItemAt(_local2)); }; return (null); } public function merge(_arg1:Object):void{ var _local2:Array; var _local3:uint; var _local4:uint; var _local5:uint; var _local6:Object; _local2 = getDataFromObject(_arg1); _local3 = _local2.length; _local4 = data.length; dispatchPreChangeEvent(DataChangeType.ADD, data.slice(_local4, data.length), _local4, (this.data.length - 1)); _local5 = 0; while (_local5 < _local3) { _local6 = _local2[_local5]; if (getItemIndex(_local6) == -1){ data.push(_local6); }; _local5++; }; if (data.length > _local4){ dispatchChangeEvent(DataChangeType.ADD, data.slice(_local4, data.length), _local4, (this.data.length - 1)); } else { dispatchChangeEvent(DataChangeType.ADD, [], -1, -1); }; } public function replaceItemAt(_arg1:Object, _arg2:uint):Object{ var _local3:Array; checkIndex(_arg2, (data.length - 1)); _local3 = [data[_arg2]]; dispatchPreChangeEvent(DataChangeType.REPLACE, _local3, _arg2, _arg2); data[_arg2] = _arg1; dispatchChangeEvent(DataChangeType.REPLACE, _local3, _arg2, _arg2); return (_local3[0]); } public function invalidate():void{ dispatchEvent(new DataChangeEvent(DataChangeEvent.DATA_CHANGE, DataChangeType.INVALIDATE_ALL, data.concat(), 0, data.length)); } public function removeAll():void{ var _local1:Array; _local1 = data.concat(); dispatchPreChangeEvent(DataChangeType.REMOVE_ALL, _local1, 0, _local1.length); data = []; dispatchChangeEvent(DataChangeType.REMOVE_ALL, _local1, 0, _local1.length); } } }//package fl.data
Section 91
//SimpleCollectionItem (fl.data.SimpleCollectionItem) package fl.data { public dynamic class SimpleCollectionItem { public var label:String; public var data:String; public function toString():String{ return ((((("[SimpleCollectionItem: " + label) + ",") + data) + "]")); } } }//package fl.data
Section 92
//ComponentEvent (fl.events.ComponentEvent) package fl.events { import flash.events.*; public class ComponentEvent extends Event { public static const HIDE:String = "hide"; public static const BUTTON_DOWN:String = "buttonDown"; public static const MOVE:String = "move"; public static const RESIZE:String = "resize"; public static const ENTER:String = "enter"; public static const LABEL_CHANGE:String = "labelChange"; public static const SHOW:String = "show"; public function ComponentEvent(_arg1:String, _arg2:Boolean=false, _arg3:Boolean=false){ super(_arg1, _arg2, _arg3); } override public function toString():String{ return (formatToString("ComponentEvent", "type", "bubbles", "cancelable")); } override public function clone():Event{ return (new ComponentEvent(type, bubbles, cancelable)); } } }//package fl.events
Section 93
//DataChangeEvent (fl.events.DataChangeEvent) package fl.events { import flash.events.*; public class DataChangeEvent extends Event { protected var _items:Array; protected var _endIndex:uint; protected var _changeType:String; protected var _startIndex:uint; public static const PRE_DATA_CHANGE:String = "preDataChange"; public static const DATA_CHANGE:String = "dataChange"; public function DataChangeEvent(_arg1:String, _arg2:String, _arg3:Array, _arg4:int=-1, _arg5:int=-1):void{ super(_arg1); _changeType = _arg2; _startIndex = _arg4; _items = _arg3; _endIndex = ((_arg5)==-1) ? _startIndex : _arg5; } public function get changeType():String{ return (_changeType); } public function get startIndex():uint{ return (_startIndex); } public function get items():Array{ return (_items); } override public function clone():Event{ return (new DataChangeEvent(type, _changeType, _items, _startIndex, _endIndex)); } override public function toString():String{ return (formatToString("DataChangeEvent", "type", "changeType", "startIndex", "endIndex", "bubbles", "cancelable")); } public function get endIndex():uint{ return (_endIndex); } } }//package fl.events
Section 94
//DataChangeType (fl.events.DataChangeType) package fl.events { public class DataChangeType { public static const ADD:String = "add"; public static const REMOVE:String = "remove"; public static const REMOVE_ALL:String = "removeAll"; public static const CHANGE:String = "change"; public static const REPLACE:String = "replace"; public static const INVALIDATE:String = "invalidate"; public static const INVALIDATE_ALL:String = "invalidateAll"; public static const SORT:String = "sort"; } }//package fl.events
Section 95
//ListEvent (fl.events.ListEvent) package fl.events { import flash.events.*; public class ListEvent extends Event { protected var _index:int; protected var _item:Object; protected var _columnIndex:int; protected var _rowIndex:int; public static const ITEM_DOUBLE_CLICK:String = "itemDoubleClick"; public static const ITEM_ROLL_OUT:String = "itemRollOut"; public static const ITEM_ROLL_OVER:String = "itemRollOver"; public static const ITEM_CLICK:String = "itemClick"; public function ListEvent(_arg1:String, _arg2:Boolean=false, _arg3:Boolean=false, _arg4:int=-1, _arg5:int=-1, _arg6:int=-1, _arg7:Object=null){ super(_arg1, _arg2, _arg3); _rowIndex = _arg5; _columnIndex = _arg4; _index = _arg6; _item = _arg7; } public function get rowIndex():Object{ return (_rowIndex); } public function get index():int{ return (_index); } public function get item():Object{ return (_item); } public function get columnIndex():int{ return (_columnIndex); } override public function clone():Event{ return (new ListEvent(type, bubbles, cancelable, _columnIndex, _rowIndex)); } override public function toString():String{ return (formatToString("ListEvent", "type", "bubbles", "cancelable", "columnIndex", "rowIndex", "index", "item")); } } }//package fl.events
Section 96
//ScrollEvent (fl.events.ScrollEvent) package fl.events { import flash.events.*; public class ScrollEvent extends Event { private var _position:Number; private var _direction:String; private var _delta:Number; public static const SCROLL:String = "scroll"; public function ScrollEvent(_arg1:String, _arg2:Number, _arg3:Number){ super(ScrollEvent.SCROLL, false, false); _direction = _arg1; _delta = _arg2; _position = _arg3; } override public function clone():Event{ return (new ScrollEvent(_direction, _delta, _position)); } public function get position():Number{ return (_position); } override public function toString():String{ return (formatToString("ScrollEvent", "type", "bubbles", "cancelable", "direction", "delta", "position")); } public function get delta():Number{ return (_delta); } public function get direction():String{ return (_direction); } } }//package fl.events
Section 97
//FocusManager (fl.managers.FocusManager) package fl.managers { import fl.core.*; import flash.events.*; import flash.display.*; import fl.controls.*; import flash.text.*; import flash.utils.*; import flash.ui.*; public class FocusManager implements IFocusManager { private var focusableObjects:Dictionary; private var _showFocusIndicator:Boolean;// = true private var defButton:Button; private var focusableCandidates:Array; private var _form:DisplayObjectContainer; private var _defaultButtonEnabled:Boolean;// = true private var activated:Boolean;// = false private var _defaultButton:Button; private var calculateCandidates:Boolean;// = true private var lastFocus:InteractiveObject; private var lastAction:String; public function FocusManager(_arg1:DisplayObjectContainer){ activated = false; calculateCandidates = true; _showFocusIndicator = true; _defaultButtonEnabled = true; super(); focusableObjects = new Dictionary(true); if (_arg1 != null){ _form = _arg1; addFocusables(DisplayObject(_arg1)); _arg1.addEventListener(Event.ADDED, addedHandler); _arg1.addEventListener(Event.REMOVED, removedHandler); activate(); }; } public function get showFocusIndicator():Boolean{ return (_showFocusIndicator); } private function getIndexOfNextObject(_arg1:int, _arg2:Boolean, _arg3:Boolean, _arg4:String):int{ var _local5:int; var _local6:int; var _local7:DisplayObject; var _local8:IFocusManagerGroup; var _local9:int; var _local10:DisplayObject; var _local11:IFocusManagerGroup; _local5 = focusableCandidates.length; _local6 = _arg1; while (true) { if (_arg2){ _arg1--; } else { _arg1++; }; if (_arg3){ if (((_arg2) && ((_arg1 < 0)))){ break; }; if (((!(_arg2)) && ((_arg1 == _local5)))){ break; }; } else { _arg1 = ((_arg1 + _local5) % _local5); if (_local6 == _arg1){ break; }; }; if (isValidFocusCandidate(focusableCandidates[_arg1], _arg4)){ _local7 = DisplayObject(findFocusManagerComponent(focusableCandidates[_arg1])); if ((_local7 is IFocusManagerGroup)){ _local8 = IFocusManagerGroup(_local7); _local9 = 0; while (_local9 < focusableCandidates.length) { _local10 = focusableCandidates[_local9]; if ((_local10 is IFocusManagerGroup)){ _local11 = IFocusManagerGroup(_local10); if ((((_local11.groupName == _local8.groupName)) && (_local11.selected))){ _arg1 = _local9; break; }; }; _local9++; }; }; return (_arg1); }; }; return (_arg1); } public function set form(_arg1:DisplayObjectContainer):void{ _form = _arg1; } private function addFocusables(_arg1:DisplayObject, _arg2:Boolean=false):void{ var focusable:IFocusManagerComponent; var io:InteractiveObject; var doc:DisplayObjectContainer; var i:int; var child:DisplayObject; var o = _arg1; var skipTopLevel = _arg2; if (!skipTopLevel){ if ((o is IFocusManagerComponent)){ focusable = IFocusManagerComponent(o); if (focusable.focusEnabled){ if (((focusable.tabEnabled) && (isTabVisible(o)))){ focusableObjects[o] = true; calculateCandidates = true; }; o.addEventListener(Event.TAB_ENABLED_CHANGE, tabEnabledChangeHandler); o.addEventListener(Event.TAB_INDEX_CHANGE, tabIndexChangeHandler); }; } else { if ((o is InteractiveObject)){ io = (o as InteractiveObject); if (((((io) && (io.tabEnabled))) && ((findFocusManagerComponent(io) == io)))){ focusableObjects[io] = true; calculateCandidates = true; }; io.addEventListener(Event.TAB_ENABLED_CHANGE, tabEnabledChangeHandler); io.addEventListener(Event.TAB_INDEX_CHANGE, tabIndexChangeHandler); }; }; }; if ((o is DisplayObjectContainer)){ doc = DisplayObjectContainer(o); o.addEventListener(Event.TAB_CHILDREN_CHANGE, tabChildrenChangeHandler); if ((((((doc is Stage)) || ((doc.parent is Stage)))) || (doc.tabChildren))){ i = 0; while (i < doc.numChildren) { try { child = doc.getChildAt(i); if (child != null){ addFocusables(doc.getChildAt(i)); }; } catch(error:SecurityError) { }; i = (i + 1); }; }; }; } private function getChildIndex(_arg1:DisplayObjectContainer, _arg2:DisplayObject):int{ return (_arg1.getChildIndex(_arg2)); } private function mouseFocusChangeHandler(_arg1:FocusEvent):void{ if ((_arg1.relatedObject is TextField)){ return; }; _arg1.preventDefault(); } private function focusOutHandler(_arg1:FocusEvent):void{ var _local2:InteractiveObject; _local2 = (_arg1.target as InteractiveObject); } private function isValidFocusCandidate(_arg1:DisplayObject, _arg2:String):Boolean{ var _local3:IFocusManagerGroup; if (!isEnabledAndVisible(_arg1)){ return (false); }; if ((_arg1 is IFocusManagerGroup)){ _local3 = IFocusManagerGroup(_arg1); if (_arg2 == _local3.groupName){ return (false); }; }; return (true); } public function findFocusManagerComponent(_arg1:InteractiveObject):InteractiveObject{ var _local2:InteractiveObject; _local2 = _arg1; while (_arg1) { if ((((_arg1 is IFocusManagerComponent)) && (IFocusManagerComponent(_arg1).focusEnabled))){ return (_arg1); }; _arg1 = _arg1.parent; }; return (_local2); } private function sortFocusableObjectsTabIndex():void{ var _local1:Object; var _local2:InteractiveObject; focusableCandidates = []; for (_local1 in focusableObjects) { _local2 = InteractiveObject(_local1); if (((_local2.tabIndex) && (!(isNaN(Number(_local2.tabIndex)))))){ focusableCandidates.push(_local2); }; }; focusableCandidates.sort(sortByTabIndex); } private function removeFocusables(_arg1:DisplayObject):void{ var _local2:Object; var _local3:DisplayObject; if ((_arg1 is DisplayObjectContainer)){ _arg1.removeEventListener(Event.TAB_CHILDREN_CHANGE, tabChildrenChangeHandler); _arg1.removeEventListener(Event.TAB_INDEX_CHANGE, tabIndexChangeHandler); for (_local2 in focusableObjects) { _local3 = DisplayObject(_local2); if (DisplayObjectContainer(_arg1).contains(_local3)){ if (_local3 == lastFocus){ lastFocus = null; }; _local3.removeEventListener(Event.TAB_ENABLED_CHANGE, tabEnabledChangeHandler); delete focusableObjects[_local2]; calculateCandidates = true; }; }; }; } private function addedHandler(_arg1:Event):void{ var _local2:DisplayObject; _local2 = DisplayObject(_arg1.target); if (_local2.stage){ addFocusables(DisplayObject(_arg1.target)); }; } private function getTopLevelFocusTarget(_arg1:InteractiveObject):InteractiveObject{ while (_arg1 != InteractiveObject(form)) { if ((((((((_arg1 is IFocusManagerComponent)) && (IFocusManagerComponent(_arg1).focusEnabled))) && (IFocusManagerComponent(_arg1).mouseFocusEnabled))) && (UIComponent(_arg1).enabled))){ return (_arg1); }; _arg1 = _arg1.parent; if (_arg1 == null){ break; }; }; return (null); } private function tabChildrenChangeHandler(_arg1:Event):void{ var _local2:DisplayObjectContainer; if (_arg1.target != _arg1.currentTarget){ return; }; calculateCandidates = true; _local2 = DisplayObjectContainer(_arg1.target); if (_local2.tabChildren){ addFocusables(_local2, true); } else { removeFocusables(_local2); }; } public function sendDefaultButtonEvent():void{ defButton.dispatchEvent(new MouseEvent(MouseEvent.CLICK)); } public function getFocus():InteractiveObject{ var _local1:InteractiveObject; _local1 = form.stage.focus; return (findFocusManagerComponent(_local1)); } private function isEnabledAndVisible(_arg1:DisplayObject):Boolean{ var _local2:DisplayObjectContainer; var _local3:TextField; var _local4:SimpleButton; _local2 = DisplayObject(form).parent; while (_arg1 != _local2) { if ((_arg1 is UIComponent)){ if (!UIComponent(_arg1).enabled){ return (false); }; } else { if ((_arg1 is TextField)){ _local3 = TextField(_arg1); if ((((_local3.type == TextFieldType.DYNAMIC)) || (!(_local3.selectable)))){ return (false); }; } else { if ((_arg1 is SimpleButton)){ _local4 = SimpleButton(_arg1); if (!_local4.enabled){ return (false); }; }; }; }; if (!_arg1.visible){ return (false); }; _arg1 = _arg1.parent; }; return (true); } public function set defaultButton(_arg1:Button):void{ var _local2:Button; _local2 = (_arg1) ? Button(_arg1) : null; if (_local2 != _defaultButton){ if (_defaultButton){ _defaultButton.emphasized = false; }; if (defButton){ defButton.emphasized = false; }; _defaultButton = _local2; defButton = _local2; if (_local2){ _local2.emphasized = true; }; }; } private function deactivateHandler(_arg1:Event):void{ var _local2:InteractiveObject; _local2 = InteractiveObject(_arg1.target); } public function setFocus(_arg1:InteractiveObject):void{ if ((_arg1 is IFocusManagerComponent)){ IFocusManagerComponent(_arg1).setFocus(); } else { form.stage.focus = _arg1; }; } private function setFocusToNextObject(_arg1:FocusEvent):void{ var _local2:InteractiveObject; if (!hasFocusableObjects()){ return; }; _local2 = getNextFocusManagerComponent(_arg1.shiftKey); if (_local2){ setFocus(_local2); }; } private function hasFocusableObjects():Boolean{ var _local1:Object; for (_local1 in focusableObjects) { return (true); }; return (false); } private function tabIndexChangeHandler(_arg1:Event):void{ calculateCandidates = true; } private function sortFocusableObjects():void{ var _local1:Object; var _local2:InteractiveObject; focusableCandidates = []; for (_local1 in focusableObjects) { _local2 = InteractiveObject(_local1); if (((((_local2.tabIndex) && (!(isNaN(Number(_local2.tabIndex)))))) && ((_local2.tabIndex > 0)))){ sortFocusableObjectsTabIndex(); return; }; focusableCandidates.push(_local2); }; focusableCandidates.sort(sortByDepth); } private function keyFocusChangeHandler(_arg1:FocusEvent):void{ showFocusIndicator = true; if ((((((_arg1.keyCode == Keyboard.TAB)) || ((_arg1.keyCode == 0)))) && (!(_arg1.isDefaultPrevented())))){ setFocusToNextObject(_arg1); _arg1.preventDefault(); }; } private function getIndexOfFocusedObject(_arg1:DisplayObject):int{ var _local2:int; var _local3:int; _local2 = focusableCandidates.length; _local3 = 0; _local3 = 0; while (_local3 < _local2) { if (focusableCandidates[_local3] == _arg1){ return (_local3); }; _local3++; }; return (-1); } public function hideFocus():void{ } private function removedHandler(_arg1:Event):void{ var _local2:int; var _local3:DisplayObject; var _local4:InteractiveObject; _local3 = DisplayObject(_arg1.target); if ((((_local3 is IFocusManagerComponent)) && ((focusableObjects[_local3] == true)))){ if (_local3 == lastFocus){ IFocusManagerComponent(lastFocus).drawFocus(false); lastFocus = null; }; _local3.removeEventListener(Event.TAB_ENABLED_CHANGE, tabEnabledChangeHandler); delete focusableObjects[_local3]; calculateCandidates = true; } else { if ((((_local3 is InteractiveObject)) && ((focusableObjects[_local3] == true)))){ _local4 = (_local3 as InteractiveObject); if (_local4){ if (_local4 == lastFocus){ lastFocus = null; }; delete focusableObjects[_local4]; calculateCandidates = true; }; _local3.addEventListener(Event.TAB_ENABLED_CHANGE, tabEnabledChangeHandler); }; }; removeFocusables(_local3); } private function sortByDepth(_arg1:InteractiveObject, _arg2:InteractiveObject):Number{ var _local3:String; var _local4:String; var _local5:int; var _local6:String; var _local7:String; var _local8:String; var _local9:DisplayObject; var _local10:DisplayObject; _local3 = ""; _local4 = ""; _local8 = "0000"; _local9 = DisplayObject(_arg1); _local10 = DisplayObject(_arg2); while (((!((_local9 == DisplayObject(form)))) && (_local9.parent))) { _local5 = getChildIndex(_local9.parent, _local9); _local6 = _local5.toString(16); if (_local6.length < 4){ _local7 = (_local8.substring(0, (4 - _local6.length)) + _local6); }; _local3 = (_local7 + _local3); _local9 = _local9.parent; }; while (((!((_local10 == DisplayObject(form)))) && (_local10.parent))) { _local5 = getChildIndex(_local10.parent, _local10); _local6 = _local5.toString(16); if (_local6.length < 4){ _local7 = (_local8.substring(0, (4 - _local6.length)) + _local6); }; _local4 = (_local7 + _local4); _local10 = _local10.parent; }; return (((_local3 > _local4)) ? 1 : ((_local3 < _local4)) ? -1 : 0); } public function get defaultButton():Button{ return (_defaultButton); } private function activateHandler(_arg1:Event):void{ var _local2:InteractiveObject; _local2 = InteractiveObject(_arg1.target); if (lastFocus){ if ((lastFocus is IFocusManagerComponent)){ IFocusManagerComponent(lastFocus).setFocus(); } else { form.stage.focus = lastFocus; }; }; lastAction = "ACTIVATE"; } public function showFocus():void{ } public function set defaultButtonEnabled(_arg1:Boolean):void{ _defaultButtonEnabled = _arg1; } public function getNextFocusManagerComponent(_arg1:Boolean=false):InteractiveObject{ var _local2:DisplayObject; var _local3:String; var _local4:int; var _local5:Boolean; var _local6:int; var _local7:int; var _local8:IFocusManagerGroup; if (!hasFocusableObjects()){ return (null); }; if (calculateCandidates){ sortFocusableObjects(); calculateCandidates = false; }; _local2 = form.stage.focus; _local2 = DisplayObject(findFocusManagerComponent(InteractiveObject(_local2))); _local3 = ""; if ((_local2 is IFocusManagerGroup)){ _local8 = IFocusManagerGroup(_local2); _local3 = _local8.groupName; }; _local4 = getIndexOfFocusedObject(_local2); _local5 = false; _local6 = _local4; if (_local4 == -1){ if (_arg1){ _local4 = focusableCandidates.length; }; _local5 = true; }; _local7 = getIndexOfNextObject(_local4, _arg1, _local5, _local3); return (findFocusManagerComponent(focusableCandidates[_local7])); } private function mouseDownHandler(_arg1:MouseEvent):void{ var _local2:InteractiveObject; if (_arg1.isDefaultPrevented()){ return; }; _local2 = getTopLevelFocusTarget(InteractiveObject(_arg1.target)); if (!_local2){ return; }; showFocusIndicator = false; if (((((!((_local2 == lastFocus))) || ((lastAction == "ACTIVATE")))) && (!((_local2 is TextField))))){ setFocus(_local2); }; lastAction = "MOUSEDOWN"; } private function isTabVisible(_arg1:DisplayObject):Boolean{ var _local2:DisplayObjectContainer; _local2 = _arg1.parent; while (((((_local2) && (!((_local2 is Stage))))) && (!(((_local2.parent) && ((_local2.parent is Stage))))))) { if (!_local2.tabChildren){ return (false); }; _local2 = _local2.parent; }; return (true); } public function get nextTabIndex():int{ return (0); } private function keyDownHandler(_arg1:KeyboardEvent):void{ if (_arg1.keyCode == Keyboard.TAB){ lastAction = "KEY"; if (calculateCandidates){ sortFocusableObjects(); calculateCandidates = false; }; }; if (((((((defaultButtonEnabled) && ((_arg1.keyCode == Keyboard.ENTER)))) && (defaultButton))) && (defButton.enabled))){ sendDefaultButtonEvent(); }; } private function focusInHandler(_arg1:FocusEvent):void{ var _local2:InteractiveObject; var _local3:Button; _local2 = InteractiveObject(_arg1.target); if (form.contains(_local2)){ lastFocus = findFocusManagerComponent(InteractiveObject(_local2)); if ((lastFocus is Button)){ _local3 = Button(lastFocus); if (defButton){ defButton.emphasized = false; defButton = _local3; _local3.emphasized = true; }; } else { if (((defButton) && (!((defButton == _defaultButton))))){ defButton.emphasized = false; defButton = _defaultButton; _defaultButton.emphasized = true; }; }; }; } private function tabEnabledChangeHandler(_arg1:Event):void{ var _local2:InteractiveObject; var _local3:Boolean; calculateCandidates = true; _local2 = InteractiveObject(_arg1.target); _local3 = (focusableObjects[_local2] == true); if (_local2.tabEnabled){ if (((!(_local3)) && (isTabVisible(_local2)))){ if (!(_local2 is IFocusManagerComponent)){ _local2.focusRect = false; }; focusableObjects[_local2] = true; }; } else { if (_local3){ delete focusableObjects[_local2]; }; }; } public function set showFocusIndicator(_arg1:Boolean):void{ _showFocusIndicator = _arg1; } public function get form():DisplayObjectContainer{ return (_form); } private function sortByTabIndex(_arg1:InteractiveObject, _arg2:InteractiveObject):int{ return (((_arg1.tabIndex > _arg2.tabIndex)) ? 1 : ((_arg1.tabIndex < _arg2.tabIndex)) ? -1 : sortByDepth(_arg1, _arg2)); } public function activate():void{ if (activated){ return; }; form.stage.addEventListener(FocusEvent.MOUSE_FOCUS_CHANGE, mouseFocusChangeHandler, false, 0, true); form.stage.addEventListener(FocusEvent.KEY_FOCUS_CHANGE, keyFocusChangeHandler, false, 0, true); form.addEventListener(FocusEvent.FOCUS_IN, focusInHandler, true); form.addEventListener(FocusEvent.FOCUS_OUT, focusOutHandler, true); form.stage.addEventListener(Event.ACTIVATE, activateHandler, false, 0, true); form.stage.addEventListener(Event.DEACTIVATE, deactivateHandler, false, 0, true); form.addEventListener(MouseEvent.MOUSE_DOWN, mouseDownHandler); form.addEventListener(KeyboardEvent.KEY_DOWN, keyDownHandler, true); activated = true; if (lastFocus){ setFocus(lastFocus); }; } public function deactivate():void{ form.stage.removeEventListener(FocusEvent.MOUSE_FOCUS_CHANGE, mouseFocusChangeHandler); form.stage.removeEventListener(FocusEvent.KEY_FOCUS_CHANGE, keyFocusChangeHandler); form.removeEventListener(FocusEvent.FOCUS_IN, focusInHandler, true); form.removeEventListener(FocusEvent.FOCUS_OUT, focusOutHandler, true); form.stage.removeEventListener(Event.ACTIVATE, activateHandler); form.stage.removeEventListener(Event.DEACTIVATE, deactivateHandler); form.removeEventListener(MouseEvent.MOUSE_DOWN, mouseDownHandler); form.removeEventListener(KeyboardEvent.KEY_DOWN, keyDownHandler, true); activated = false; } public function get defaultButtonEnabled():Boolean{ return (_defaultButtonEnabled); } } }//package fl.managers
Section 98
//IFocusManager (fl.managers.IFocusManager) package fl.managers { import flash.display.*; import fl.controls.*; public interface IFocusManager { function getFocus():InteractiveObject; function deactivate():void; function set defaultButton(_arg1:Button):void; function set showFocusIndicator(_arg1:Boolean):void; function get defaultButtonEnabled():Boolean; function get nextTabIndex():int; function get defaultButton():Button; function get showFocusIndicator():Boolean; function setFocus(_arg1:InteractiveObject):void; function activate():void; function showFocus():void; function set defaultButtonEnabled(_arg1:Boolean):void; function hideFocus():void; function findFocusManagerComponent(_arg1:InteractiveObject):InteractiveObject; function getNextFocusManagerComponent(_arg1:Boolean=false):InteractiveObject; } }//package fl.managers
Section 99
//IFocusManagerComponent (fl.managers.IFocusManagerComponent) package fl.managers { public interface IFocusManagerComponent { function set focusEnabled(_arg1:Boolean):void; function drawFocus(_arg1:Boolean):void; function setFocus():void; function get focusEnabled():Boolean; function get tabEnabled():Boolean; function get tabIndex():int; function get mouseFocusEnabled():Boolean; } }//package fl.managers
Section 100
//IFocusManagerGroup (fl.managers.IFocusManagerGroup) package fl.managers { public interface IFocusManagerGroup { function set groupName(_arg1:String):void; function set selected(_arg1:Boolean):void; function get groupName():String; function get selected():Boolean; } }//package fl.managers
Section 101
//StyleManager (fl.managers.StyleManager) package fl.managers { import fl.core.*; import flash.text.*; import flash.utils.*; public class StyleManager { private var globalStyles:Object; private var classToDefaultStylesDict:Dictionary; private var styleToClassesHash:Object; private var classToStylesDict:Dictionary; private var classToInstancesDict:Dictionary; private static var _instance:StyleManager; public function StyleManager(){ styleToClassesHash = {}; classToInstancesDict = new Dictionary(true); classToStylesDict = new Dictionary(true); classToDefaultStylesDict = new Dictionary(true); globalStyles = UIComponent.getStyleDefinition(); } public static function clearComponentStyle(_arg1:Object, _arg2:String):void{ var _local3:Class; var _local4:Object; _local3 = getClassDef(_arg1); _local4 = getInstance().classToStylesDict[_local3]; if (((!((_local4 == null))) && (!((_local4[_arg2] == null))))){ delete _local4[_arg2]; invalidateComponentStyle(_local3, _arg2); }; } private static function getClassDef(_arg1:Object):Class{ var component = _arg1; if ((component is Class)){ return ((component as Class)); }; try { return ((getDefinitionByName(getQualifiedClassName(component)) as Class)); } catch(e:Error) { if ((component is UIComponent)){ try { return ((component.loaderInfo.applicationDomain.getDefinition(getQualifiedClassName(component)) as Class)); } catch(e:Error) { }; }; }; return (null); } public static function clearStyle(_arg1:String):void{ setStyle(_arg1, null); } public static function setComponentStyle(_arg1:Object, _arg2:String, _arg3:Object):void{ var _local4:Class; var _local5:Object; _local4 = getClassDef(_arg1); _local5 = getInstance().classToStylesDict[_local4]; if (_local5 == null){ _local5 = (getInstance().classToStylesDict[_local4] = {}); }; if (_local5 == _arg3){ return; }; _local5[_arg2] = _arg3; invalidateComponentStyle(_local4, _arg2); } private static function setSharedStyles(_arg1:UIComponent):void{ var _local2:StyleManager; var _local3:Class; var _local4:Object; var _local5:String; _local2 = getInstance(); _local3 = getClassDef(_arg1); _local4 = _local2.classToDefaultStylesDict[_local3]; for (_local5 in _local4) { _arg1.setSharedStyle(_local5, getSharedStyle(_arg1, _local5)); }; } public static function getComponentStyle(_arg1:Object, _arg2:String):Object{ var _local3:Class; var _local4:Object; _local3 = getClassDef(_arg1); _local4 = getInstance().classToStylesDict[_local3]; return (((_local4)==null) ? null : _local4[_arg2]); } private static function getInstance(){ if (_instance == null){ _instance = new (StyleManager); }; return (_instance); } private static function invalidateComponentStyle(_arg1:Class, _arg2:String):void{ var _local3:Dictionary; var _local4:Object; var _local5:UIComponent; _local3 = getInstance().classToInstancesDict[_arg1]; if (_local3 == null){ return; }; for (_local4 in _local3) { _local5 = (_local4 as UIComponent); if (_local5 == null){ } else { _local5.setSharedStyle(_arg2, getSharedStyle(_local5, _arg2)); }; }; } private static function invalidateStyle(_arg1:String):void{ var _local2:Dictionary; var _local3:Object; _local2 = getInstance().styleToClassesHash[_arg1]; if (_local2 == null){ return; }; for (_local3 in _local2) { invalidateComponentStyle(Class(_local3), _arg1); }; } public static function registerInstance(_arg1:UIComponent):void{ var inst:StyleManager; var classDef:Class; var target:Class; var defaultStyles:Object; var styleToClasses:Object; var n:String; var instance = _arg1; inst = getInstance(); classDef = getClassDef(instance); if (classDef == null){ return; }; if (inst.classToInstancesDict[classDef] == null){ inst.classToInstancesDict[classDef] = new Dictionary(true); target = classDef; while (defaultStyles == null) { if (target["getStyleDefinition"] != null){ defaultStyles = target["getStyleDefinition"](); break; }; try { target = (instance.loaderInfo.applicationDomain.getDefinition(getQualifiedSuperclassName(target)) as Class); } catch(err:Error) { try { target = (getDefinitionByName(getQualifiedSuperclassName(target)) as Class); } catch(e:Error) { defaultStyles = UIComponent.getStyleDefinition(); break; }; }; }; styleToClasses = inst.styleToClassesHash; for (n in defaultStyles) { if (styleToClasses[n] == null){ styleToClasses[n] = new Dictionary(true); }; styleToClasses[n][classDef] = true; }; inst.classToDefaultStylesDict[classDef] = defaultStyles; inst.classToStylesDict[classDef] = {}; }; inst.classToInstancesDict[classDef][instance] = true; setSharedStyles(instance); } public static function getStyle(_arg1:String):Object{ return (getInstance().globalStyles[_arg1]); } private static function getSharedStyle(_arg1:UIComponent, _arg2:String):Object{ var _local3:Class; var _local4:StyleManager; var _local5:Object; _local3 = getClassDef(_arg1); _local4 = getInstance(); _local5 = _local4.classToStylesDict[_local3][_arg2]; if (_local5 != null){ return (_local5); }; _local5 = _local4.globalStyles[_arg2]; if (_local5 != null){ return (_local5); }; return (_local4.classToDefaultStylesDict[_local3][_arg2]); } public static function setStyle(_arg1:String, _arg2:Object):void{ var _local3:Object; _local3 = getInstance().globalStyles; if ((((_local3[_arg1] === _arg2)) && (!((_arg2 is TextFormat))))){ return; }; _local3[_arg1] = _arg2; invalidateStyle(_arg1); } } }//package fl.managers
Section 102
//Back (gs.easing.Back) package gs.easing { public class Back { public static function easeOut(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number, _arg5:Number=1.70158):Number{ _arg1 = ((_arg1 / _arg4) - 1); return (((_arg3 * (((_arg1 * _arg1) * (((_arg5 + 1) * _arg1) + _arg5)) + 1)) + _arg2)); } public static function easeIn(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number, _arg5:Number=1.70158):Number{ _arg1 = (_arg1 / _arg4); return (((((_arg3 * _arg1) * _arg1) * (((_arg5 + 1) * _arg1) - _arg5)) + _arg2)); } public static function easeInOut(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number, _arg5:Number=1.70158):Number{ _arg1 = (_arg1 / (_arg4 / 2)); if (_arg1 < 1){ _arg5 = (_arg5 * 1.525); return ((((_arg3 / 2) * ((_arg1 * _arg1) * (((_arg5 + 1) * _arg1) - _arg5))) + _arg2)); }; _arg1 = (_arg1 - 2); _arg5 = (_arg5 * 1.525); return ((((_arg3 / 2) * (((_arg1 * _arg1) * (((_arg5 + 1) * _arg1) + _arg5)) + 2)) + _arg2)); } } }//package gs.easing
Section 103
//TweenEvent (gs.events.TweenEvent) package gs.events { import flash.events.*; public class TweenEvent extends Event { public var info:Object; public static const UPDATE:String = "update"; public static const START:String = "start"; public static const version:Number = 0.9; public static const COMPLETE:String = "complete"; public function TweenEvent(_arg1:String, _arg2:Object=null, _arg3:Boolean=false, _arg4:Boolean=false){ super(_arg1, _arg3, _arg4); this.info = _arg2; } override public function clone():Event{ return (new TweenEvent(this.type, this.info, this.bubbles, this.cancelable)); } } }//package gs.events
Section 104
//AutoAlphaPlugin (gs.plugins.AutoAlphaPlugin) package gs.plugins { import flash.display.*; import gs.*; public class AutoAlphaPlugin extends TweenPlugin { protected var _tweenVisible:Boolean; protected var _tween:TweenLite; protected var _visible:Boolean; protected var _target:Object; public static const VERSION:Number = 1; public static const API:Number = 1; public function AutoAlphaPlugin(){ this.propName = "autoAlpha"; this.overwriteProps = ["alpha", "visible"]; this.onComplete = onCompleteTween; } override public function set changeFactor(_arg1:Number):void{ updateTweens(_arg1); if (((!((_target.visible == true))) && (_tweenVisible))){ _target.visible = true; }; } public function onCompleteTween():void{ if (((((_tweenVisible) && (!((_tween.vars.runBackwards == true))))) && ((_tween.ease == _tween.vars.ease)))){ _target.visible = _visible; }; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ _target = _arg1; _tween = _arg3; _visible = Boolean(!((_arg2 == 0))); _tweenVisible = true; addTween(_arg1, "alpha", _arg1.alpha, _arg2, "alpha"); return (true); } override public function killProps(_arg1:Object):void{ super.killProps(_arg1); _tweenVisible = !(Boolean(("visible" in _arg1))); } } }//package gs.plugins
Section 105
//BevelFilterPlugin (gs.plugins.BevelFilterPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.filters.*; public class BevelFilterPlugin extends FilterPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function BevelFilterPlugin(){ this.propName = "bevelFilter"; this.overwriteProps = ["bevelFilter"]; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ _target = _arg1; _type = BevelFilter; initFilter(_arg2, new BevelFilter(0, 0, 0xFFFFFF, 0.5, 0, 0.5, 2, 2, 0, ((_arg2.quality) || (2)))); return (true); } } }//package gs.plugins
Section 106
//BezierPlugin (gs.plugins.BezierPlugin) package gs.plugins { import gs.*; import gs.utils.tween.*; public class BezierPlugin extends TweenPlugin { protected var _future:Object; protected var _orient:Boolean; protected var _orientData:Array; protected var _beziers:Object; protected var _target:Object; protected static const _RAD2DEG:Number = 57.2957795130823; public static const VERSION:Number = 1.01; public static const API:Number = 1; public function BezierPlugin(){ _future = {}; super(); this.propName = "bezier"; this.overwriteProps = []; } override public function set changeFactor(_arg1:Number):void{ var _local2:int; var _local3:String; var _local4:Object; var _local5:Number; var _local6:uint; var _local7:Number; var _local8:int; var _local9:Object; var _local10:Boolean; var _local11:Number; var _local12:Number; var _local13:Array; var _local14:Number; if (_arg1 == 1){ for (_local3 in _beziers) { _local2 = (_beziers[_local3].length - 1); _target[_local3] = _beziers[_local3][_local2][2]; }; } else { for (_local3 in _beziers) { _local6 = _beziers[_local3].length; if (_arg1 < 0){ _local2 = 0; } else { if (_arg1 >= 1){ _local2 = (_local6 - 1); } else { _local2 = int((_local6 * _arg1)); }; }; _local5 = ((_arg1 - (_local2 * (1 / _local6))) * _local6); _local4 = _beziers[_local3][_local2]; if (this.round){ _local7 = (_local4[0] + (_local5 * (((2 * (1 - _local5)) * (_local4[1] - _local4[0])) + (_local5 * (_local4[2] - _local4[0]))))); _local8 = ((_local7)<0) ? -1 : 1; _target[_local3] = ((((_local7 % 1) * _local8))>0.5) ? (int(_local7) + _local8) : int(_local7); } else { _target[_local3] = (_local4[0] + (_local5 * (((2 * (1 - _local5)) * (_local4[1] - _local4[0])) + (_local5 * (_local4[2] - _local4[0]))))); }; }; }; if (_orient){ _local9 = _target; _local10 = this.round; _target = _future; this.round = false; _orient = false; this.changeFactor = (_arg1 + 0.01); _target = _local9; this.round = _local10; _orient = true; _local2 = 0; while (_local2 < _orientData.length) { _local13 = _orientData[_local2]; _local14 = ((_local13[3]) || (0)); _local11 = (_future[_local13[0]] - _target[_local13[0]]); _local12 = (_future[_local13[1]] - _target[_local13[1]]); _target[_local13[2]] = ((Math.atan2(_local12, _local11) * _RAD2DEG) + _local14); _local2++; }; }; } protected function init(_arg1:TweenLite, _arg2:Array, _arg3:Boolean):void{ var _local4:Object; var _local5:int; var _local6:String; _target = _arg1.target; if (_arg1.exposedVars.orientToBezier == true){ _orientData = [["x", "y", "rotation", 0]]; _orient = true; } else { if ((_arg1.exposedVars.orientToBezier is Array)){ _orientData = _arg1.exposedVars.orientToBezier; _orient = true; }; }; _local4 = {}; _local5 = 0; while (_local5 < _arg2.length) { for (_local6 in _arg2[_local5]) { if (_local4[_local6] == undefined){ _local4[_local6] = [_arg1.target[_local6]]; }; if (typeof(_arg2[_local5][_local6]) == "number"){ _local4[_local6].push(_arg2[_local5][_local6]); } else { _local4[_local6].push((_arg1.target[_local6] + Number(_arg2[_local5][_local6]))); }; }; _local5++; }; for (_local6 in _local4) { this.overwriteProps[this.overwriteProps.length] = _local6; if (_arg1.exposedVars[_local6] != undefined){ if (typeof(_arg1.exposedVars[_local6]) == "number"){ _local4[_local6].push(_arg1.exposedVars[_local6]); } else { _local4[_local6].push((_arg1.target[_local6] + Number(_arg1.exposedVars[_local6]))); }; delete _arg1.exposedVars[_local6]; _local5 = (_arg1.tweens.length - 1); while (_local5 > -1) { if (_arg1.tweens[_local5].name == _local6){ _arg1.tweens.splice(_local5, 1); }; _local5--; }; }; }; _beziers = parseBeziers(_local4, _arg3); } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ if (!(_arg2 is Array)){ return (false); }; init(_arg3, (_arg2 as Array), false); return (true); } override public function killProps(_arg1:Object):void{ var _local2:String; for (_local2 in _beziers) { if ((_local2 in _arg1)){ delete _beziers[_local2]; }; }; super.killProps(_arg1); } public static function parseBeziers(_arg1:Object, _arg2:Boolean=false):Object{ var _local3:int; var _local4:Array; var _local5:Object; var _local6:String; var _local7:Object; _local7 = {}; if (_arg2){ for (_local6 in _arg1) { _local4 = _arg1[_local6]; _local5 = []; _local7[_local6] = _local5; if (_local4.length > 2){ _local5[_local5.length] = [_local4[0], (_local4[1] - ((_local4[2] - _local4[0]) / 4)), _local4[1]]; _local3 = 1; while (_local3 < (_local4.length - 1)) { _local5[_local5.length] = [_local4[_local3], (_local4[_local3] + (_local4[_local3] - _local5[(_local3 - 1)][1])), _local4[(_local3 + 1)]]; _local3++; }; } else { _local5[_local5.length] = [_local4[0], ((_local4[0] + _local4[1]) / 2), _local4[1]]; }; }; } else { for (_local6 in _arg1) { _local4 = _arg1[_local6]; _local5 = []; _local7[_local6] = _local5; if (_local4.length > 3){ _local5[_local5.length] = [_local4[0], _local4[1], ((_local4[1] + _local4[2]) / 2)]; _local3 = 2; while (_local3 < (_local4.length - 2)) { _local5[_local5.length] = [_local5[(_local3 - 2)][2], _local4[_local3], ((_local4[_local3] + _local4[(_local3 + 1)]) / 2)]; _local3++; }; _local5[_local5.length] = [_local5[(_local5.length - 1)][2], _local4[(_local4.length - 2)], _local4[(_local4.length - 1)]]; } else { if (_local4.length == 3){ _local5[_local5.length] = [_local4[0], _local4[1], _local4[2]]; } else { if (_local4.length == 2){ _local5[_local5.length] = [_local4[0], ((_local4[0] + _local4[1]) / 2), _local4[1]]; }; }; }; }; }; return (_local7); } } }//package gs.plugins
Section 107
//BezierThroughPlugin (gs.plugins.BezierThroughPlugin) package gs.plugins { import gs.*; public class BezierThroughPlugin extends BezierPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function BezierThroughPlugin(){ this.propName = "bezierThrough"; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ if (!(_arg2 is Array)){ return (false); }; init(_arg3, (_arg2 as Array), true); return (true); } } }//package gs.plugins
Section 108
//BlurFilterPlugin (gs.plugins.BlurFilterPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.filters.*; public class BlurFilterPlugin extends FilterPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function BlurFilterPlugin(){ this.propName = "blurFilter"; this.overwriteProps = ["blurFilter"]; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ _target = _arg1; _type = BlurFilter; initFilter(_arg2, new BlurFilter(0, 0, ((_arg2.quality) || (2)))); return (true); } } }//package gs.plugins
Section 109
//ColorMatrixFilterPlugin (gs.plugins.ColorMatrixFilterPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.filters.*; public class ColorMatrixFilterPlugin extends FilterPlugin { protected var _matrix:Array; protected var _matrixTween:EndArrayPlugin; public static const API:Number = 1; public static const VERSION:Number = 1.01; protected static var _lumG:Number = 0.71516; protected static var _lumR:Number = 0.212671; protected static var _idMatrix:Array = [1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1, 0]; protected static var _lumB:Number = 0.072169; public function ColorMatrixFilterPlugin(){ this.propName = "colorMatrixFilter"; this.overwriteProps = ["colorMatrixFilter"]; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ var _local4:Object; var _local5:Array; _target = _arg1; _type = ColorMatrixFilter; _local4 = _arg2; initFilter({}, new ColorMatrixFilter(_idMatrix.slice())); _matrix = ColorMatrixFilter(_filter).matrix; _local5 = []; if (((!((_local4.matrix == null))) && ((_local4.matrix is Array)))){ _local5 = _local4.matrix; } else { if (_local4.relative == true){ _local5 = _matrix.slice(); } else { _local5 = _idMatrix.slice(); }; _local5 = setBrightness(_local5, _local4.brightness); _local5 = setContrast(_local5, _local4.contrast); _local5 = setHue(_local5, _local4.hue); _local5 = setSaturation(_local5, _local4.saturation); _local5 = setThreshold(_local5, _local4.threshold); if (!isNaN(_local4.colorize)){ _local5 = colorize(_local5, _local4.colorize, _local4.amount); }; }; _matrixTween = new EndArrayPlugin(); _matrixTween.init(_matrix, _local5); return (true); } override public function set changeFactor(_arg1:Number):void{ _matrixTween.changeFactor = _arg1; ColorMatrixFilter(_filter).matrix = _matrix; super.changeFactor = _arg1; } public static function setSaturation(_arg1:Array, _arg2:Number):Array{ var _local3:Number; var _local4:Number; var _local5:Number; var _local6:Number; var _local7:Array; if (isNaN(_arg2)){ return (_arg1); }; _local3 = (1 - _arg2); _local4 = (_local3 * _lumR); _local5 = (_local3 * _lumG); _local6 = (_local3 * _lumB); _local7 = [(_local4 + _arg2), _local5, _local6, 0, 0, _local4, (_local5 + _arg2), _local6, 0, 0, _local4, _local5, (_local6 + _arg2), 0, 0, 0, 0, 0, 1, 0]; return (applyMatrix(_local7, _arg1)); } public static function setHue(_arg1:Array, _arg2:Number):Array{ var _local3:Number; var _local4:Number; var _local5:Array; if (isNaN(_arg2)){ return (_arg1); }; _arg2 = (_arg2 * (Math.PI / 180)); _local3 = Math.cos(_arg2); _local4 = Math.sin(_arg2); _local5 = [((_lumR + (_local3 * (1 - _lumR))) + (_local4 * -(_lumR))), ((_lumG + (_local3 * -(_lumG))) + (_local4 * -(_lumG))), ((_lumB + (_local3 * -(_lumB))) + (_local4 * (1 - _lumB))), 0, 0, ((_lumR + (_local3 * -(_lumR))) + (_local4 * 0.143)), ((_lumG + (_local3 * (1 - _lumG))) + (_local4 * 0.14)), ((_lumB + (_local3 * -(_lumB))) + (_local4 * -0.283)), 0, 0, ((_lumR + (_local3 * -(_lumR))) + (_local4 * -((1 - _lumR)))), ((_lumG + (_local3 * -(_lumG))) + (_local4 * _lumG)), ((_lumB + (_local3 * (1 - _lumB))) + (_local4 * _lumB)), 0, 0, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1]; return (applyMatrix(_local5, _arg1)); } public static function setThreshold(_arg1:Array, _arg2:Number):Array{ var _local3:Array; if (isNaN(_arg2)){ return (_arg1); }; _local3 = [(_lumR * 0x0100), (_lumG * 0x0100), (_lumB * 0x0100), 0, (-256 * _arg2), (_lumR * 0x0100), (_lumG * 0x0100), (_lumB * 0x0100), 0, (-256 * _arg2), (_lumR * 0x0100), (_lumG * 0x0100), (_lumB * 0x0100), 0, (-256 * _arg2), 0, 0, 0, 1, 0]; return (applyMatrix(_local3, _arg1)); } public static function applyMatrix(_arg1:Array, _arg2:Array):Array{ var _local3:Array; var _local4:int; var _local5:int; var _local6:int; var _local7:int; if (((!((_arg1 is Array))) || (!((_arg2 is Array))))){ return (_arg2); }; _local3 = []; _local4 = 0; _local5 = 0; _local6 = 0; while (_local6 < 4) { _local7 = 0; while (_local7 < 5) { if (_local7 == 4){ _local5 = _arg1[(_local4 + 4)]; } else { _local5 = 0; }; _local3[(_local4 + _local7)] = (((((_arg1[_local4] * _arg2[_local7]) + (_arg1[(_local4 + 1)] * _arg2[(_local7 + 5)])) + (_arg1[(_local4 + 2)] * _arg2[(_local7 + 10)])) + (_arg1[(_local4 + 3)] * _arg2[(_local7 + 15)])) + _local5); _local7++; }; _local4 = (_local4 + 5); _local6++; }; return (_local3); } public static function colorize(_arg1:Array, _arg2:Number, _arg3:Number=1):Array{ var _local4:Number; var _local5:Number; var _local6:Number; var _local7:Number; var _local8:Array; if (isNaN(_arg2)){ return (_arg1); }; if (isNaN(_arg3)){ _arg3 = 1; }; _local4 = (((_arg2 >> 16) & 0xFF) / 0xFF); _local5 = (((_arg2 >> 8) & 0xFF) / 0xFF); _local6 = ((_arg2 & 0xFF) / 0xFF); _local7 = (1 - _arg3); _local8 = [(_local7 + ((_arg3 * _local4) * _lumR)), ((_arg3 * _local4) * _lumG), ((_arg3 * _local4) * _lumB), 0, 0, ((_arg3 * _local5) * _lumR), (_local7 + ((_arg3 * _local5) * _lumG)), ((_arg3 * _local5) * _lumB), 0, 0, ((_arg3 * _local6) * _lumR), ((_arg3 * _local6) * _lumG), (_local7 + ((_arg3 * _local6) * _lumB)), 0, 0, 0, 0, 0, 1, 0]; return (applyMatrix(_local8, _arg1)); } public static function setBrightness(_arg1:Array, _arg2:Number):Array{ if (isNaN(_arg2)){ return (_arg1); }; _arg2 = ((_arg2 * 100) - 100); return (applyMatrix([1, 0, 0, 0, _arg2, 0, 1, 0, 0, _arg2, 0, 0, 1, 0, _arg2, 0, 0, 0, 1, 0, 0, 0, 0, 0, 1], _arg1)); } public static function setContrast(_arg1:Array, _arg2:Number):Array{ var _local3:Array; if (isNaN(_arg2)){ return (_arg1); }; _arg2 = (_arg2 + 0.01); _local3 = [_arg2, 0, 0, 0, (128 * (1 - _arg2)), 0, _arg2, 0, 0, (128 * (1 - _arg2)), 0, 0, _arg2, 0, (128 * (1 - _arg2)), 0, 0, 0, 1, 0]; return (applyMatrix(_local3, _arg1)); } } }//package gs.plugins
Section 110
//DropShadowFilterPlugin (gs.plugins.DropShadowFilterPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.filters.*; public class DropShadowFilterPlugin extends FilterPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function DropShadowFilterPlugin(){ this.propName = "dropShadowFilter"; this.overwriteProps = ["dropShadowFilter"]; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ _target = _arg1; _type = DropShadowFilter; initFilter(_arg2, new DropShadowFilter(0, 45, 0, 0, 0, 0, 1, ((_arg2.quality) || (2)), _arg2.inner, _arg2.knockout, _arg2.hideObject)); return (true); } } }//package gs.plugins
Section 111
//EndArrayPlugin (gs.plugins.EndArrayPlugin) package gs.plugins { import gs.*; import gs.utils.tween.*; public class EndArrayPlugin extends TweenPlugin { protected var _info:Array; protected var _a:Array; public static const VERSION:Number = 1.01; public static const API:Number = 1; public function EndArrayPlugin(){ _info = []; super(); this.propName = "endArray"; this.overwriteProps = ["endArray"]; } override public function set changeFactor(_arg1:Number):void{ var _local2:int; var _local3:ArrayTweenInfo; var _local4:Number; var _local5:int; if (this.round){ _local2 = (_info.length - 1); while (_local2 > -1) { _local3 = _info[_local2]; _local4 = (_local3.start + (_local3.change * _arg1)); _local5 = ((_local4)<0) ? -1 : 1; _a[_local3.index] = ((((_local4 % 1) * _local5))>0.5) ? (int(_local4) + _local5) : int(_local4); _local2--; }; } else { _local2 = (_info.length - 1); while (_local2 > -1) { _local3 = _info[_local2]; _a[_local3.index] = (_local3.start + (_local3.change * _arg1)); _local2--; }; }; } public function init(_arg1:Array, _arg2:Array):void{ var _local3:int; _a = _arg1; _local3 = (_arg2.length - 1); while (_local3 > -1) { if (((!((_arg1[_local3] == _arg2[_local3]))) && (!((_arg1[_local3] == null))))){ _info[_info.length] = new ArrayTweenInfo(_local3, _a[_local3], (_arg2[_local3] - _a[_local3])); }; _local3--; }; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ if (((!((_arg1 is Array))) || (!((_arg2 is Array))))){ return (false); }; init((_arg1 as Array), _arg2); return (true); } } }//package gs.plugins
Section 112
//FilterPlugin (gs.plugins.FilterPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.filters.*; import gs.utils.tween.*; public class FilterPlugin extends TweenPlugin { protected var _index:int; protected var _filter:BitmapFilter; protected var _type:Class; protected var _remove:Boolean; protected var _target:Object; public static const VERSION:Number = 1.03; public static const API:Number = 1; override public function set changeFactor(_arg1:Number):void{ var _local2:int; var _local3:TweenInfo; var _local4:Array; _local4 = _target.filters; _local2 = (_tweens.length - 1); while (_local2 > -1) { _local3 = _tweens[_local2]; _local3.target[_local3.property] = (_local3.start + (_local3.change * _arg1)); _local2--; }; if (!(_local4[_index] is _type)){ _index = (_local4.length - 1); _local2 = (_local4.length - 1); while (_local2 > -1) { if ((_local4[_local2] is _type)){ _index = _local2; break; }; _local2--; }; }; _local4[_index] = _filter; _target.filters = _local4; } public function onCompleteTween():void{ var _local1:int; var _local2:Array; if (_remove){ _local2 = _target.filters; if (!(_local2[_index] is _type)){ _local1 = (_local2.length - 1); while (_local1 > -1) { if ((_local2[_local1] is _type)){ _local2.splice(_local1, 1); break; }; _local1--; }; } else { _local2.splice(_index, 1); }; _target.filters = _local2; }; } protected function initFilter(_arg1:Object, _arg2:BitmapFilter):void{ var _local3:Array; var _local4:String; var _local5:int; var _local6:HexColorsPlugin; var _local7:Object; _local3 = _target.filters; _index = -1; if (_arg1.index != null){ _index = _arg1.index; } else { _local5 = (_local3.length - 1); while (_local5 > -1) { if ((_local3[_local5] is _type)){ _index = _local5; break; }; _local5--; }; }; if ((((((_index == -1)) || ((_local3[_index] == null)))) || ((_arg1.addFilter == true)))){ _index = ((_arg1.index)!=null) ? _arg1.index : _local3.length; _local3[_index] = _arg2; _target.filters = _local3; }; _filter = _local3[_index]; _remove = Boolean((_arg1.remove == true)); if (_remove){ this.onComplete = onCompleteTween; }; _local7 = ((_arg1.isTV)==true) ? _arg1.exposedVars : _arg1; for (_local4 in _local7) { if (((((((((!((_local4 in _filter))) || ((_filter[_local4] == _local7[_local4])))) || ((_local4 == "remove")))) || ((_local4 == "index")))) || ((_local4 == "addFilter")))){ } else { if ((((((_local4 == "color")) || ((_local4 == "highlightColor")))) || ((_local4 == "shadowColor")))){ _local6 = new HexColorsPlugin(); _local6.initColor(_filter, _local4, _filter[_local4], _local7[_local4]); _tweens[_tweens.length] = new TweenInfo(_local6, "changeFactor", 0, 1, _local4, false); } else { if ((((((((_local4 == "quality")) || ((_local4 == "inner")))) || ((_local4 == "knockout")))) || ((_local4 == "hideObject")))){ _filter[_local4] = _local7[_local4]; } else { addTween(_filter, _local4, _filter[_local4], _local7[_local4], _local4); }; }; }; }; } } }//package gs.plugins
Section 113
//FramePlugin (gs.plugins.FramePlugin) package gs.plugins { import flash.display.*; import gs.*; public class FramePlugin extends TweenPlugin { public var frame:int; protected var _target:MovieClip; public static const VERSION:Number = 1; public static const API:Number = 1; public function FramePlugin(){ this.propName = "frame"; this.overwriteProps = ["frame"]; this.round = true; } override public function set changeFactor(_arg1:Number):void{ updateTweens(_arg1); _target.gotoAndStop(this.frame); } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ if (((!((_arg1 is MovieClip))) || (isNaN(_arg2)))){ return (false); }; _target = (_arg1 as MovieClip); addTween(this, "frame", _target.currentFrame, _arg2, "frame"); return (true); } } }//package gs.plugins
Section 114
//GlowFilterPlugin (gs.plugins.GlowFilterPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.filters.*; public class GlowFilterPlugin extends FilterPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function GlowFilterPlugin(){ this.propName = "glowFilter"; this.overwriteProps = ["glowFilter"]; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ _target = _arg1; _type = GlowFilter; initFilter(_arg2, new GlowFilter(0xFFFFFF, 0, 0, 0, ((_arg2.strength) || (1)), ((_arg2.quality) || (2)), _arg2.inner, _arg2.knockout)); return (true); } } }//package gs.plugins
Section 115
//HexColorsPlugin (gs.plugins.HexColorsPlugin) package gs.plugins { import gs.*; public class HexColorsPlugin extends TweenPlugin { protected var _colors:Array; public static const VERSION:Number = 1.01; public static const API:Number = 1; public function HexColorsPlugin(){ this.propName = "hexColors"; this.overwriteProps = []; _colors = []; } override public function set changeFactor(_arg1:Number):void{ var _local2:int; var _local3:Array; _local2 = (_colors.length - 1); while (_local2 > -1) { _local3 = _colors[_local2]; _local3[0][_local3[1]] = ((((_local3[2] + (_arg1 * _local3[3])) << 16) | ((_local3[4] + (_arg1 * _local3[5])) << 8)) | (_local3[6] + (_arg1 * _local3[7]))); _local2--; }; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ var _local4:String; for (_local4 in _arg2) { initColor(_arg1, _local4, uint(_arg1[_local4]), uint(_arg2[_local4])); }; return (true); } override public function killProps(_arg1:Object):void{ var _local2:int; _local2 = (_colors.length - 1); while (_local2 > -1) { if (_arg1[_colors[_local2][1]] != undefined){ _colors.splice(_local2, 1); }; _local2--; }; super.killProps(_arg1); } public function initColor(_arg1:Object, _arg2:String, _arg3:uint, _arg4:uint):void{ var _local5:Number; var _local6:Number; var _local7:Number; if (_arg3 != _arg4){ _local5 = (_arg3 >> 16); _local6 = ((_arg3 >> 8) & 0xFF); _local7 = (_arg3 & 0xFF); _colors[_colors.length] = [_arg1, _arg2, _local5, ((_arg4 >> 16) - _local5), _local6, (((_arg4 >> 8) & 0xFF) - _local6), _local7, ((_arg4 & 0xFF) - _local7)]; this.overwriteProps[this.overwriteProps.length] = _arg2; }; } } }//package gs.plugins
Section 116
//RemoveTintPlugin (gs.plugins.RemoveTintPlugin) package gs.plugins { public class RemoveTintPlugin extends TintPlugin { public static const VERSION:Number = 1.01; public static const API:Number = 1; public function RemoveTintPlugin(){ this.propName = "removeTint"; } } }//package gs.plugins
Section 117
//RoundPropsPlugin (gs.plugins.RoundPropsPlugin) package gs.plugins { public class RoundPropsPlugin extends TweenPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function RoundPropsPlugin(){ this.propName = "roundProps"; this.overwriteProps = []; this.round = true; } public function add(_arg1:Object, _arg2:String, _arg3:Number, _arg4:Number):void{ addTween(_arg1, _arg2, _arg3, (_arg3 + _arg4), _arg2); this.overwriteProps[this.overwriteProps.length] = _arg2; } } }//package gs.plugins
Section 118
//ShortRotationPlugin (gs.plugins.ShortRotationPlugin) package gs.plugins { import gs.*; public class ShortRotationPlugin extends TweenPlugin { public static const VERSION:Number = 1; public static const API:Number = 1; public function ShortRotationPlugin(){ this.propName = "shortRotation"; this.overwriteProps = []; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ var _local4:String; if (typeof(_arg2) == "number"){ trace("WARNING: You appear to be using the old shortRotation syntax. Instead of passing a number, please pass an object with properties that correspond to the rotations values For example, TweenMax.to(mc, 2, {shortRotation:{rotationX:-170, rotationY:25}})"); return (false); }; for (_local4 in _arg2) { initRotation(_arg1, _local4, _arg1[_local4], _arg2[_local4]); }; return (true); } public function initRotation(_arg1:Object, _arg2:String, _arg3:Number, _arg4:Number):void{ var _local5:Number; _local5 = ((_arg4 - _arg3) % 360); if (((_arg4 - _arg3) % 360) != (_local5 % 180)){ _local5 = ((_local5)<0) ? (_local5 + 360) : (_local5 - 360); }; addTween(_arg1, _arg2, _arg3, (_arg3 + _local5), _arg2); this.overwriteProps[this.overwriteProps.length] = _arg2; } } }//package gs.plugins
Section 119
//TintPlugin (gs.plugins.TintPlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.geom.*; import gs.utils.tween.*; public class TintPlugin extends TweenPlugin { protected var _ct:ColorTransform; protected var _target:DisplayObject; public static const VERSION:Number = 1.01; public static const API:Number = 1; protected static var _props:Array = ["redMultiplier", "greenMultiplier", "blueMultiplier", "alphaMultiplier", "redOffset", "greenOffset", "blueOffset", "alphaOffset"]; public function TintPlugin(){ this.propName = "tint"; this.overwriteProps = ["tint"]; } override public function set changeFactor(_arg1:Number):void{ updateTweens(_arg1); _target.transform.colorTransform = _ct; } public function init(_arg1:DisplayObject, _arg2:ColorTransform):void{ var _local3:int; var _local4:String; _target = _arg1; _ct = _target.transform.colorTransform; _local3 = (_props.length - 1); while (_local3 > -1) { _local4 = _props[_local3]; if (_ct[_local4] != _arg2[_local4]){ _tweens[_tweens.length] = new TweenInfo(_ct, _local4, _ct[_local4], (_arg2[_local4] - _ct[_local4]), "tint", false); }; _local3--; }; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ var _local4:ColorTransform; if (!(_arg1 is DisplayObject)){ return (false); }; _local4 = new ColorTransform(); if (((!((_arg2 == null))) && (!((_arg3.exposedVars.removeTint == true))))){ _local4.color = uint(_arg2); }; if (((!((_arg3.exposedVars.alpha == undefined))) || (!((_arg3.exposedVars.autoAlpha == undefined))))){ _local4.alphaMultiplier = ((_arg3.exposedVars.alpha)!=undefined) ? _arg3.exposedVars.alpha : _arg3.exposedVars.autoAlpha; _arg3.killVars({alpha:1, autoAlpha:1}); } else { _local4.alphaMultiplier = _arg1.alpha; }; init((_arg1 as DisplayObject), _local4); return (true); } } }//package gs.plugins
Section 120
//TweenPlugin (gs.plugins.TweenPlugin) package gs.plugins { import gs.*; import gs.utils.tween.*; public class TweenPlugin { public var overwriteProps:Array; protected var _tweens:Array; public var round:Boolean; public var onComplete:Function; public var propName:String; protected var _changeFactor:Number;// = 0 public static const VERSION:Number = 1.03; public static const API:Number = 1; public function TweenPlugin(){ _tweens = []; _changeFactor = 0; super(); } protected function updateTweens(_arg1:Number):void{ var _local2:int; var _local3:TweenInfo; var _local4:Number; var _local5:int; if (this.round){ _local2 = (_tweens.length - 1); while (_local2 > -1) { _local3 = _tweens[_local2]; _local4 = (_local3.start + (_local3.change * _arg1)); _local5 = ((_local4)<0) ? -1 : 1; _local3.target[_local3.property] = ((((_local4 % 1) * _local5))>0.5) ? (int(_local4) + _local5) : int(_local4); _local2--; }; } else { _local2 = (_tweens.length - 1); while (_local2 > -1) { _local3 = _tweens[_local2]; _local3.target[_local3.property] = (_local3.start + (_local3.change * _arg1)); _local2--; }; }; } public function set changeFactor(_arg1:Number):void{ updateTweens(_arg1); _changeFactor = _arg1; } protected function addTween(_arg1:Object, _arg2:String, _arg3:Number, _arg4, _arg5:String=null):void{ var _local6:Number; if (_arg4 != null){ _local6 = ((typeof(_arg4))=="number") ? (_arg4 - _arg3) : Number(_arg4); if (_local6 != 0){ _tweens[_tweens.length] = new TweenInfo(_arg1, _arg2, _arg3, _local6, ((_arg5) || (_arg2)), false); }; }; } public function killProps(_arg1:Object):void{ var _local2:int; _local2 = (this.overwriteProps.length - 1); while (_local2 > -1) { if ((this.overwriteProps[_local2] in _arg1)){ this.overwriteProps.splice(_local2, 1); }; _local2--; }; _local2 = (_tweens.length - 1); while (_local2 > -1) { if ((_tweens[_local2].name in _arg1)){ _tweens.splice(_local2, 1); }; _local2--; }; } public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ addTween(_arg1, this.propName, _arg1[this.propName], _arg2, this.propName); return (true); } public function get changeFactor():Number{ return (_changeFactor); } public static function activate(_arg1:Array):Boolean{ var _local2:int; var _local3:Object; _local2 = (_arg1.length - 1); while (_local2 > -1) { _local3 = new (_arg1[_local2]); TweenLite.plugins[_local3.propName] = _arg1[_local2]; _local2--; }; return (true); } } }//package gs.plugins
Section 121
//VisiblePlugin (gs.plugins.VisiblePlugin) package gs.plugins { import flash.display.*; import gs.*; public class VisiblePlugin extends TweenPlugin { protected var _tween:TweenLite; protected var _visible:Boolean; protected var _target:Object; public static const VERSION:Number = 1; public static const API:Number = 1; public function VisiblePlugin(){ this.propName = "visible"; this.overwriteProps = ["visible"]; this.onComplete = onCompleteTween; } override public function set changeFactor(_arg1:Number):void{ if (_target.visible != true){ _target.visible = true; }; } public function onCompleteTween():void{ if (((!((_tween.vars.runBackwards == true))) && ((_tween.ease == _tween.vars.ease)))){ _target.visible = _visible; }; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ _target = _arg1; _tween = _arg3; _visible = Boolean(_arg2); return (true); } } }//package gs.plugins
Section 122
//VolumePlugin (gs.plugins.VolumePlugin) package gs.plugins { import flash.display.*; import gs.*; import flash.media.*; public class VolumePlugin extends TweenPlugin { protected var _st:SoundTransform; protected var _target:Object; public static const VERSION:Number = 1; public static const API:Number = 1; public function VolumePlugin(){ this.propName = "volume"; this.overwriteProps = ["volume"]; } override public function set changeFactor(_arg1:Number):void{ updateTweens(_arg1); _target.soundTransform = _st; } override public function onInitTween(_arg1:Object, _arg2, _arg3:TweenLite):Boolean{ if (((isNaN(_arg2)) || (!(_arg1.hasOwnProperty("soundTransform"))))){ return (false); }; _target = _arg1; _st = _target.soundTransform; addTween(_st, "volume", _st.volume, _arg2, "volume"); return (Boolean(!((_tweens.length == 0)))); } } }//package gs.plugins
Section 123
//ArrayTweenInfo (gs.utils.tween.ArrayTweenInfo) package gs.utils.tween { public class ArrayTweenInfo { public var change:Number; public var index:uint; public var start:Number; public function ArrayTweenInfo(_arg1:uint, _arg2:Number, _arg3:Number){ this.index = _arg1; this.start = _arg2; this.change = _arg3; } } }//package gs.utils.tween
Section 124
//TweenInfo (gs.utils.tween.TweenInfo) package gs.utils.tween { public class TweenInfo { public var start:Number; public var name:String; public var change:Number; public var target:Object; public var property:String; public var isPlugin:Boolean; public function TweenInfo(_arg1:Object, _arg2:String, _arg3:Number, _arg4:Number, _arg5:String, _arg6:Boolean){ this.target = _arg1; this.property = _arg2; this.start = _arg3; this.change = _arg4; this.name = _arg5; this.isPlugin = _arg6; } } }//package gs.utils.tween
Section 125
//OverwriteManager (gs.OverwriteManager) package gs { import flash.utils.*; import gs.utils.tween.*; import flash.errors.*; public class OverwriteManager { public static const ALL:int = 1; public static const NONE:int = 0; public static const AUTO:int = 2; public static const CONCURRENT:int = 3; public static const version:Number = 3.11; public static var mode:int; public static var enabled:Boolean; public static function killVars(_arg1:Object, _arg2:Object, _arg3:Array):void{ var _local4:int; var _local5:String; var _local6:TweenInfo; _local4 = (_arg3.length - 1); while (_local4 > -1) { _local6 = _arg3[_local4]; if ((_local6.name in _arg1)){ _arg3.splice(_local4, 1); } else { if (((_local6.isPlugin) && ((_local6.name == "_MULTIPLE_")))){ _local6.target.killProps(_arg1); if (_local6.target.overwriteProps.length == 0){ _arg3.splice(_local4, 1); }; }; }; _local4--; }; for (_local5 in _arg1) { delete _arg2[_local5]; }; } public static function manageOverwrites(_arg1:TweenLite, _arg2:Array):void{ var _local3:Object; var _local4:int; var _local5:Number; var _local6:Array; var _local7:int; var _local8:TweenLite; var _local9:Array; var _local10:Object; var _local11:int; var _local12:TweenInfo; var _local13:Array; _local3 = _arg1.vars; _local4 = ((_local3.overwrite)==undefined) ? mode : int(_local3.overwrite); if ((((_local4 < 2)) || ((_arg2 == null)))){ return; }; _local5 = _arg1.startTime; _local6 = []; _local7 = (_arg2.length - 1); while (_local7 > -1) { _local8 = _arg2[_local7]; if (((((!((_local8 == _arg1))) && ((_local8.startTime <= _local5)))) && (((_local8.startTime + ((_local8.duration * 1000) / _local8.combinedTimeScale)) > _local5)))){ _local6[_local6.length] = _local8; }; _local7--; }; if ((((_local6.length == 0)) || ((_arg1.tweens.length == 0)))){ return; }; if (_local4 == AUTO){ _local9 = _arg1.tweens; _local10 = {}; _local7 = (_local9.length - 1); while (_local7 > -1) { _local12 = _local9[_local7]; if (((_local12.isPlugin) && ((_local12.name == "_MULTIPLE_")))){ _local13 = _local12.target.overwriteProps; _local11 = (_local13.length - 1); while (_local11 > -1) { _local10[_local13[_local11]] = true; _local11--; }; _local10[_local12.target.propName] = true; } else { _local10[_local12.name] = true; }; _local7--; }; _local7 = (_local6.length - 1); while (_local7 > -1) { killVars(_local10, _local6[_local7].exposedVars, _local6[_local7].tweens); _local7--; }; } else { _local7 = (_local6.length - 1); while (_local7 > -1) { _local6[_local7].enabled = false; _local7--; }; }; } public static function init(_arg1:int=2):int{ if (TweenLite.version < 10.04){ trace("TweenLite warning: Your TweenLite class needs to be updated to work with OverwriteManager (or you may need to clear your ASO files). Please download and install the latest version from http://www.tweenlite.com."); }; TweenLite.overwriteManager = OverwriteManager; mode = _arg1; enabled = true; return (mode); } } }//package gs
Section 126
//TweenLite (gs.TweenLite) package gs { import flash.events.*; import flash.display.*; import flash.utils.*; import gs.utils.tween.*; import gs.plugins.*; public class TweenLite { public var delay:Number; protected var _hasUpdate:Boolean; protected var _hasPlugins:Boolean; public var started:Boolean; public var initted:Boolean; public var active:Boolean; public var startTime:Number; public var target:Object; public var duration:Number; public var gc:Boolean; public var vars:Object; public var ease:Function; public var tweens:Array; public var exposedVars:Object; public var combinedTimeScale:Number; public var initTime:Number; public static const version:Number = 10.06; private static var _timer:Timer = new Timer(2000); public static var defaultEase:Function = TweenLite.easeOut; public static var plugins:Object = {}; public static var currentTime:uint; public static var masterList:Dictionary = new Dictionary(false); protected static var _reservedProps:Object = {ease:1, delay:1, overwrite:1, onComplete:1, onCompleteParams:1, runBackwards:1, startAt:1, onUpdate:1, onUpdateParams:1, roundProps:1, onStart:1, onStartParams:1, persist:1, renderOnStart:1, proxiedEase:1, easeParams:1, yoyo:1, loop:1, onCompleteListener:1, onUpdateListener:1, onStartListener:1, orientToBezier:1}; public static var killDelayedCallsTo:Function = TweenLite.killTweensOf; public static var timingSprite:Sprite = new Sprite(); public static var overwriteManager:Object; private static var _tlInitted:Boolean; public function TweenLite(_arg1:Object, _arg2:Number, _arg3:Object){ var _local4:int; super(); if (_arg1 == null){ return; }; if (!_tlInitted){ TweenPlugin.activate([TintPlugin, RemoveTintPlugin, FramePlugin, AutoAlphaPlugin, VisiblePlugin, VolumePlugin, EndArrayPlugin]); currentTime = getTimer(); timingSprite.addEventListener(Event.ENTER_FRAME, updateAll, false, 0, true); if (overwriteManager == null){ overwriteManager = {mode:1, enabled:false}; }; _timer.addEventListener("timer", killGarbage, false, 0, true); _timer.start(); _tlInitted = true; }; this.vars = _arg3; this.duration = ((_arg2) || (0.001)); this.delay = ((_arg3.delay) || (0)); this.combinedTimeScale = ((_arg3.timeScale) || (1)); this.active = Boolean((((_arg2 == 0)) && ((this.delay == 0)))); this.target = _arg1; if (typeof(this.vars.ease) != "function"){ this.vars.ease = defaultEase; }; if (this.vars.easeParams != null){ this.vars.proxiedEase = this.vars.ease; this.vars.ease = easeProxy; }; this.ease = this.vars.ease; this.exposedVars = ((this.vars.isTV)==true) ? this.vars.exposedVars : this.vars; this.tweens = []; this.initTime = currentTime; this.startTime = (this.initTime + (this.delay * 1000)); _local4 = ((((_arg3.overwrite == undefined)) || (((!(overwriteManager.enabled)) && ((_arg3.overwrite > 1)))))) ? overwriteManager.mode : int(_arg3.overwrite); if (((!((_arg1 in masterList))) || ((_local4 == 1)))){ masterList[_arg1] = [this]; } else { masterList[_arg1].push(this); }; if ((((((this.vars.runBackwards == true)) && (!((this.vars.renderOnStart == true))))) || (this.active))){ initTweenVals(); if (this.active){ render((this.startTime + 1)); } else { render(this.startTime); }; if (((((!((this.exposedVars.visible == null))) && ((this.vars.runBackwards == true)))) && ((this.target is DisplayObject)))){ this.target.visible = this.exposedVars.visible; }; }; } public function set enabled(_arg1:Boolean):void{ var _local2:Array; var _local3:Boolean; var _local4:int; if (_arg1){ if (!(this.target in masterList)){ masterList[this.target] = [this]; } else { _local2 = masterList[this.target]; _local4 = (_local2.length - 1); while (_local4 > -1) { if (_local2[_local4] == this){ _local3 = true; break; }; _local4--; }; if (!_local3){ _local2[_local2.length] = this; }; }; }; this.gc = (_arg1) ? false : true; if (this.gc){ this.active = false; } else { this.active = this.started; }; } public function clear():void{ this.tweens = []; this.vars = (this.exposedVars = {ease:this.vars.ease}); _hasUpdate = false; } public function render(_arg1:uint):void{ var _local2:Number; var _local3:Number; var _local4:TweenInfo; var _local5:int; _local2 = ((_arg1 - this.startTime) * 0.001); if (_local2 >= this.duration){ _local2 = this.duration; _local3 = ((((this.ease == this.vars.ease)) || ((this.duration == 0.001)))) ? 1 : 0; } else { _local3 = this.ease(_local2, 0, 1, this.duration); }; _local5 = (this.tweens.length - 1); while (_local5 > -1) { _local4 = this.tweens[_local5]; _local4.target[_local4.property] = (_local4.start + (_local3 * _local4.change)); _local5--; }; if (_hasUpdate){ this.vars.onUpdate.apply(null, this.vars.onUpdateParams); }; if (_local2 == this.duration){ complete(true); }; } public function activate():void{ this.started = (this.active = true); if (!this.initted){ initTweenVals(); }; if (this.vars.onStart != null){ this.vars.onStart.apply(null, this.vars.onStartParams); }; if (this.duration == 0.001){ this.startTime = (this.startTime - 1); }; } public function get enabled():Boolean{ return ((this.gc) ? false : true); } public function initTweenVals():void{ var _local1:String; var _local2:int; var _local3:*; var _local4:TweenInfo; for (_local1 in this.exposedVars) { if ((_local1 in _reservedProps)){ } else { if ((_local1 in plugins)){ _local3 = new (plugins[_local1]); if (_local3.onInitTween(this.target, this.exposedVars[_local1], this) == false){ this.tweens[this.tweens.length] = new TweenInfo(this.target, _local1, this.target[_local1], ((typeof(this.exposedVars[_local1]))=="number") ? (this.exposedVars[_local1] - this.target[_local1]) : Number(this.exposedVars[_local1]), _local1, false); } else { this.tweens[this.tweens.length] = new TweenInfo(_local3, "changeFactor", 0, 1, ((_local3.overwriteProps.length)==1) ? _local3.overwriteProps[0] : "_MULTIPLE_", true); _hasPlugins = true; }; } else { this.tweens[this.tweens.length] = new TweenInfo(this.target, _local1, this.target[_local1], ((typeof(this.exposedVars[_local1]))=="number") ? (this.exposedVars[_local1] - this.target[_local1]) : Number(this.exposedVars[_local1]), _local1, false); }; }; }; if (this.vars.runBackwards == true){ _local2 = (this.tweens.length - 1); while (_local2 > -1) { _local4 = this.tweens[_local2]; this.tweens[_local2].start = (_local4.start + _local4.change); _local4.change = -(_local4.change); _local2--; }; }; if (this.vars.onUpdate != null){ _hasUpdate = true; }; if (((TweenLite.overwriteManager.enabled) && ((this.target in masterList)))){ overwriteManager.manageOverwrites(this, masterList[this.target]); }; this.initted = true; } protected function easeProxy(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number):Number{ return (this.vars.proxiedEase.apply(null, arguments.concat(this.vars.easeParams))); } public function killVars(_arg1:Object):void{ if (overwriteManager.enabled){ overwriteManager.killVars(_arg1, this.exposedVars, this.tweens); }; } public function complete(_arg1:Boolean=false):void{ var _local2:int; if (!_arg1){ if (!this.initted){ initTweenVals(); }; this.startTime = (currentTime - ((this.duration * 1000) / this.combinedTimeScale)); render(currentTime); return; }; if (_hasPlugins){ _local2 = (this.tweens.length - 1); while (_local2 > -1) { if (((this.tweens[_local2].isPlugin) && (!((this.tweens[_local2].target.onComplete == null))))){ this.tweens[_local2].target.onComplete(); }; _local2--; }; }; if (this.vars.persist != true){ this.enabled = false; }; if (this.vars.onComplete != null){ this.vars.onComplete.apply(null, this.vars.onCompleteParams); }; } public static function updateAll(_arg1:Event=null):void{ var _local2:uint; var _local3:Dictionary; var _local4:Array; var _local5:int; var _local6:TweenLite; _local2 = (currentTime = getTimer()); _local3 = masterList; for each (_local4 in _local3) { _local5 = (_local4.length - 1); while (_local5 > -1) { _local6 = _local4[_local5]; if (_local6.active){ _local6.render(_local2); } else { if (_local6.gc){ _local4.splice(_local5, 1); } else { if (_local2 >= _local6.startTime){ _local6.activate(); _local6.render(_local2); }; }; }; _local5--; }; }; } public static function removeTween(_arg1:TweenLite, _arg2:Boolean=true):void{ if (_arg1 != null){ if (_arg2){ _arg1.clear(); }; _arg1.enabled = false; }; } public static function killTweensOf(_arg1:Object=null, _arg2:Boolean=false):void{ var _local3:Array; var _local4:int; var _local5:TweenLite; if (((!((_arg1 == null))) && ((_arg1 in masterList)))){ _local3 = masterList[_arg1]; _local4 = (_local3.length - 1); while (_local4 > -1) { _local5 = _local3[_local4]; if (((_arg2) && (!(_local5.gc)))){ _local5.complete(false); }; _local5.clear(); _local4--; }; delete masterList[_arg1]; }; } public static function from(_arg1:Object, _arg2:Number, _arg3:Object):TweenLite{ _arg3.runBackwards = true; return (new TweenLite(_arg1, _arg2, _arg3)); } public static function easeOut(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number):Number{ _arg1 = (_arg1 / _arg4); return ((((-(_arg3) * _arg1) * (_arg1 - 2)) + _arg2)); } protected static function killGarbage(_arg1:TimerEvent):void{ var _local2:Dictionary; var _local3:Object; _local2 = masterList; for (_local3 in _local2) { if (_local2[_local3].length == 0){ delete _local2[_local3]; }; }; } public static function delayedCall(_arg1:Number, _arg2:Function, _arg3:Array=null):TweenLite{ return (new TweenLite(_arg2, 0, {delay:_arg1, onComplete:_arg2, onCompleteParams:_arg3, overwrite:0})); } public static function to(_arg1:Object, _arg2:Number, _arg3:Object):TweenLite{ return (new TweenLite(_arg1, _arg2, _arg3)); } } }//package gs
Section 127
//TweenMax (gs.TweenMax) package gs { import flash.events.*; import flash.utils.*; import gs.utils.tween.*; import gs.plugins.*; import gs.events.*; public class TweenMax extends TweenLite implements IEventDispatcher { protected var _dispatcher:EventDispatcher; protected var _callbacks:Object; public var pauseTime:Number; protected var _repeatCount:Number; protected var _timeScale:Number; public static const version:Number = 10.08; public static var removeTween:Function = TweenLite.removeTween; private static var _overwriteMode:int = (OverwriteManager.enabled) ? OverwriteManager.mode : OverwriteManager.init(); ; protected static var _pausedTweens:Dictionary = new Dictionary(false); protected static var _globalTimeScale:Number = 1; public static var killTweensOf:Function = TweenLite.killTweensOf; public static var killDelayedCallsTo:Function = TweenLite.killTweensOf; private static var _activatedPlugins:Boolean = TweenPlugin.activate([TintPlugin, RemoveTintPlugin, FramePlugin, AutoAlphaPlugin, VisiblePlugin, VolumePlugin, EndArrayPlugin, HexColorsPlugin, BlurFilterPlugin, ColorMatrixFilterPlugin, BevelFilterPlugin, DropShadowFilterPlugin, GlowFilterPlugin, RoundPropsPlugin, BezierPlugin, BezierThroughPlugin, ShortRotationPlugin]); private static var _versionCheck:Boolean = ((TweenLite.version)<10.06) ? trace("TweenMax error! Please update your TweenLite class or try deleting your ASO files. TweenMax requires a more recent version. Download updates at http://www.TweenMax.com.") : true; ; public function TweenMax(_arg1:Object, _arg2:Number, _arg3:Object){ super(_arg1, _arg2, _arg3); if (((!((this.combinedTimeScale == 1))) && ((this.target is TweenMax)))){ _timeScale = 1; this.combinedTimeScale = _globalTimeScale; } else { _timeScale = this.combinedTimeScale; this.combinedTimeScale = (this.combinedTimeScale * _globalTimeScale); }; if (((!((this.combinedTimeScale == 1))) && (!((this.delay == 0))))){ this.startTime = (this.initTime + (this.delay * (1000 / this.combinedTimeScale))); }; if (((((!((this.vars.onCompleteListener == null))) || (!((this.vars.onUpdateListener == null))))) || (!((this.vars.onStartListener == null))))){ initDispatcher(); if ((((_arg2 == 0)) && ((this.delay == 0)))){ onUpdateDispatcher(); onCompleteDispatcher(); }; }; _repeatCount = 0; if (((!(isNaN(this.vars.yoyo))) || (!(isNaN(this.vars.loop))))){ this.vars.persist = true; }; } override public function set enabled(_arg1:Boolean):void{ if (!_arg1){ _pausedTweens[this] = null; delete _pausedTweens[this]; }; super.enabled = _arg1; if (_arg1){ this.combinedTimeScale = (_timeScale * _globalTimeScale); }; } public function set reversed(_arg1:Boolean):void{ if (this.reversed != _arg1){ reverse(); }; } override public function render(_arg1:uint):void{ var _local2:Number; var _local3:Number; var _local4:TweenInfo; var _local5:int; _local2 = (((_arg1 - this.startTime) * 0.001) * this.combinedTimeScale); if (_local2 >= this.duration){ _local2 = this.duration; _local3 = ((((this.ease == this.vars.ease)) || ((this.duration == 0.001)))) ? 1 : 0; } else { _local3 = this.ease(_local2, 0, 1, this.duration); }; _local5 = (this.tweens.length - 1); while (_local5 > -1) { _local4 = this.tweens[_local5]; _local4.target[_local4.property] = (_local4.start + (_local3 * _local4.change)); _local5--; }; if (_hasUpdate){ this.vars.onUpdate.apply(null, this.vars.onUpdateParams); }; if (_local2 == this.duration){ complete(true); }; } protected function adjustStartValues():void{ var _local1:Number; var _local2:Number; var _local3:Number; var _local4:Number; var _local5:TweenInfo; var _local6:int; _local1 = this.progress; if (_local1 != 0){ _local2 = this.ease(_local1, 0, 1, 1); _local3 = (1 / (1 - _local2)); _local6 = (this.tweens.length - 1); while (_local6 > -1) { _local5 = this.tweens[_local6]; _local4 = (_local5.start + _local5.change); if (_local5.isPlugin){ _local5.change = ((_local4 - _local2) * _local3); } else { _local5.change = ((_local4 - _local5.target[_local5.property]) * _local3); }; _local5.start = (_local4 - _local5.change); _local6--; }; }; } public function get timeScale():Number{ return (_timeScale); } public function restart(_arg1:Boolean=false):void{ if (_arg1){ this.initTime = currentTime; this.startTime = (currentTime + (this.delay * (1000 / this.combinedTimeScale))); } else { this.startTime = currentTime; this.initTime = (currentTime - (this.delay * (1000 / this.combinedTimeScale))); }; _repeatCount = 0; if (this.target != this.vars.onComplete){ render(this.startTime); }; this.pauseTime = NaN; _pausedTweens[this] = null; delete _pausedTweens[this]; this.enabled = true; } public function get paused():Boolean{ return (!(isNaN(this.pauseTime))); } public function killProperties(_arg1:Array):void{ var _local2:Object; var _local3:int; _local2 = {}; _local3 = (_arg1.length - 1); while (_local3 > -1) { _local2[_arg1[_local3]] = true; _local3--; }; killVars(_local2); } public function resume():void{ this.enabled = true; if (!isNaN(this.pauseTime)){ this.initTime = (this.initTime + (currentTime - this.pauseTime)); this.startTime = (this.initTime + (this.delay * (1000 / this.combinedTimeScale))); this.pauseTime = NaN; if (((!(this.started)) && ((currentTime >= this.startTime)))){ activate(); } else { this.active = this.started; }; _pausedTweens[this] = null; delete _pausedTweens[this]; }; } override public function complete(_arg1:Boolean=false):void{ if (((((!(isNaN(this.vars.yoyo))) && ((((_repeatCount < this.vars.yoyo)) || ((this.vars.yoyo == 0)))))) || (((!(isNaN(this.vars.loop))) && ((((_repeatCount < this.vars.loop)) || ((this.vars.loop == 0)))))))){ _repeatCount++; if (!isNaN(this.vars.yoyo)){ this.ease = ((this.vars.ease)==this.ease) ? reverseEase : this.vars.ease; }; this.startTime = (_arg1) ? (this.startTime + (this.duration * (1000 / this.combinedTimeScale))) : currentTime; this.initTime = (this.startTime - (this.delay * (1000 / this.combinedTimeScale))); } else { if (this.vars.persist == true){ pause(); }; }; super.complete(_arg1); } public function invalidate(_arg1:Boolean=true):void{ var _local2:Number; if (this.initted){ _local2 = this.progress; if (((!(_arg1)) && (!((_local2 == 0))))){ this.progress = 0; }; this.tweens = []; _hasPlugins = false; this.exposedVars = ((this.vars.isTV)==true) ? this.vars.exposedProps : this.vars; initTweenVals(); _timeScale = ((this.vars.timeScale) || (1)); this.combinedTimeScale = (_timeScale * _globalTimeScale); this.delay = ((this.vars.delay) || (0)); if (isNaN(this.pauseTime)){ this.startTime = (this.initTime + ((this.delay * 1000) / this.combinedTimeScale)); }; if (((((!((this.vars.onCompleteListener == null))) || (!((this.vars.onUpdateListener == null))))) || (!((this.vars.onStartListener == null))))){ if (_dispatcher != null){ this.vars.onStart = _callbacks.onStart; this.vars.onUpdate = _callbacks.onUpdate; this.vars.onComplete = _callbacks.onComplete; _dispatcher = null; }; initDispatcher(); }; if (_local2 != 0){ if (_arg1){ adjustStartValues(); } else { this.progress = _local2; }; }; }; } public function get progress():Number{ var _local1:Number; var _local2:Number; _local1 = (isNaN(this.pauseTime)) ? currentTime : this.pauseTime; _local2 = (((((_local1 - this.initTime) * 0.001) - (this.delay / this.combinedTimeScale)) / this.duration) * this.combinedTimeScale); if (_local2 > 1){ return (1); }; if (_local2 < 0){ return (0); }; return (_local2); } public function willTrigger(_arg1:String):Boolean{ if (_dispatcher == null){ return (false); }; return (_dispatcher.willTrigger(_arg1)); } public function dispatchEvent(_arg1:Event):Boolean{ if (_dispatcher == null){ return (false); }; return (_dispatcher.dispatchEvent(_arg1)); } public function get reversed():Boolean{ return ((this.ease == reverseEase)); } protected function onStartDispatcher(... _args):void{ if (_callbacks.onStart != null){ _callbacks.onStart.apply(null, this.vars.onStartParams); }; _dispatcher.dispatchEvent(new TweenEvent(TweenEvent.START)); } public function setDestination(_arg1:String, _arg2, _arg3:Boolean=true):void{ var _local4:Number; var _local5:int; var _local6:Object; var _local7:Array; var _local8:Boolean; var _local9:Array; var _local10:Object; var _local11:int; var _local12:Array; _local4 = this.progress; if (this.initted){ if (((!(_arg3)) && (!((_local4 == 0))))){ _local5 = (this.tweens.length - 1); while (_local5 > -1) { if (this.tweens[_local5].name == _arg1){ this.tweens[_local5].target[this.tweens[_local5].property] = this.tweens[_local5].start; }; _local5--; }; }; _local6 = this.vars; _local7 = this.tweens; _local8 = _hasPlugins; this.tweens = []; this.vars = (this.exposedVars = {}); this.vars[_arg1] = _arg2; initTweenVals(); if (((!((this.ease == reverseEase))) && ((_local6.ease is Function)))){ this.ease = _local6.ease; }; if (((_arg3) && (!((_local4 == 0))))){ adjustStartValues(); }; _local9 = this.tweens; this.vars = _local6; this.tweens = _local7; _local10 = {}; _local5 = (_local9.length - 1); while (_local5 > -1) { if (_local9[_local5].name == "_MULTIPLE_"){ _local12 = _local9[_local5].target.overwriteProps; _local11 = (_local12.length - 1); while (_local11 > -1) { _local10[_local12[_local11]] = true; _local11--; }; } else { _local10[_local9[_local5].name] = true; }; _local5--; }; killVars(_local10); this.tweens = this.tweens.concat(_local9); _hasPlugins = Boolean(((_local8) || (_hasPlugins))); }; this.vars[_arg1] = _arg2; } public function set timeScale(_arg1:Number):void{ if (_arg1 < 1E-5){ _arg1 = (_timeScale = 1E-5); } else { _timeScale = _arg1; _arg1 = (_arg1 * _globalTimeScale); }; this.initTime = ((currentTime - ((((currentTime - this.initTime) - (this.delay * (1000 / this.combinedTimeScale))) * this.combinedTimeScale) * (1 / _arg1))) - (this.delay * (1000 / _arg1))); if (this.startTime != 999999999999999){ this.startTime = (this.initTime + (this.delay * (1000 / _arg1))); }; this.combinedTimeScale = _arg1; } public function removeEventListener(_arg1:String, _arg2:Function, _arg3:Boolean=false):void{ if (_dispatcher != null){ _dispatcher.removeEventListener(_arg1, _arg2, _arg3); }; } override public function initTweenVals():void{ var _local1:int; var _local2:int; var _local3:String; var _local4:String; var _local5:Array; var _local6:Object; var _local7:TweenInfo; if (this.exposedVars.startAt != null){ this.exposedVars.startAt.overwrite = 0; new TweenMax(this.target, 0, this.exposedVars.startAt); }; super.initTweenVals(); if ((((this.exposedVars.roundProps is Array)) && (!((TweenLite.plugins.roundProps == null))))){ _local5 = this.exposedVars.roundProps; _local1 = (_local5.length - 1); while (_local1 > -1) { _local3 = _local5[_local1]; _local2 = (this.tweens.length - 1); while (_local2 > -1) { _local7 = this.tweens[_local2]; if (_local7.name == _local3){ if (_local7.isPlugin){ _local7.target.round = true; } else { if (_local6 == null){ _local6 = new TweenLite.plugins.roundProps(); _local6.add(_local7.target, _local3, _local7.start, _local7.change); _hasPlugins = true; this.tweens[_local2] = new TweenInfo(_local6, "changeFactor", 0, 1, _local3, true); } else { _local6.add(_local7.target, _local3, _local7.start, _local7.change); this.tweens.splice(_local2, 1); }; }; } else { if (((((_local7.isPlugin) && ((_local7.name == "_MULTIPLE_")))) && (!(_local7.target.round)))){ _local4 = ((" " + _local7.target.overwriteProps.join(" ")) + " "); if (_local4.indexOf(((" " + _local3) + " ")) != -1){ _local7.target.round = true; }; }; }; _local2--; }; _local1--; }; }; } protected function initDispatcher():void{ var _local1:Object; var _local2:String; if (_dispatcher == null){ _dispatcher = new EventDispatcher(this); _callbacks = {onStart:this.vars.onStart, onUpdate:this.vars.onUpdate, onComplete:this.vars.onComplete}; if (this.vars.isTV == true){ this.vars = this.vars.clone(); } else { _local1 = {}; for (_local2 in this.vars) { _local1[_local2] = this.vars[_local2]; }; this.vars = _local1; }; this.vars.onStart = onStartDispatcher; this.vars.onComplete = onCompleteDispatcher; if ((this.vars.onStartListener is Function)){ _dispatcher.addEventListener(TweenEvent.START, this.vars.onStartListener, false, 0, true); }; if ((this.vars.onUpdateListener is Function)){ _dispatcher.addEventListener(TweenEvent.UPDATE, this.vars.onUpdateListener, false, 0, true); this.vars.onUpdate = onUpdateDispatcher; _hasUpdate = true; }; if ((this.vars.onCompleteListener is Function)){ _dispatcher.addEventListener(TweenEvent.COMPLETE, this.vars.onCompleteListener, false, 0, true); }; }; } protected function onUpdateDispatcher(... _args):void{ if (_callbacks.onUpdate != null){ _callbacks.onUpdate.apply(null, this.vars.onUpdateParams); }; _dispatcher.dispatchEvent(new TweenEvent(TweenEvent.UPDATE)); } public function set progress(_arg1:Number):void{ this.startTime = (currentTime - ((this.duration * _arg1) * 1000)); this.initTime = (this.startTime - (this.delay * (1000 / this.combinedTimeScale))); if (!this.started){ activate(); }; render(currentTime); if (!isNaN(this.pauseTime)){ this.pauseTime = currentTime; this.startTime = 999999999999999; this.active = false; }; } public function reverse(_arg1:Boolean=true, _arg2:Boolean=true):void{ var _local3:Number; this.ease = ((this.vars.ease)==this.ease) ? reverseEase : this.vars.ease; _local3 = this.progress; if (((_arg1) && ((_local3 > 0)))){ this.startTime = (currentTime - ((((1 - _local3) * this.duration) * 1000) / this.combinedTimeScale)); this.initTime = (this.startTime - (this.delay * (1000 / this.combinedTimeScale))); }; if (_arg2 != false){ if (_local3 < 1){ resume(); } else { restart(); }; }; } public function addEventListener(_arg1:String, _arg2:Function, _arg3:Boolean=false, _arg4:int=0, _arg5:Boolean=false):void{ if (_dispatcher == null){ initDispatcher(); }; if ((((_arg1 == TweenEvent.UPDATE)) && (!((this.vars.onUpdate == onUpdateDispatcher))))){ this.vars.onUpdate = onUpdateDispatcher; _hasUpdate = true; }; _dispatcher.addEventListener(_arg1, _arg2, _arg3, _arg4, _arg5); } public function set paused(_arg1:Boolean):void{ if (_arg1){ pause(); } else { resume(); }; } public function hasEventListener(_arg1:String):Boolean{ if (_dispatcher == null){ return (false); }; return (_dispatcher.hasEventListener(_arg1)); } public function pause():void{ if (isNaN(this.pauseTime)){ this.pauseTime = currentTime; this.startTime = 999999999999999; this.enabled = false; _pausedTweens[this] = this; }; } public function reverseEase(_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number):Number{ return (this.vars.ease((_arg4 - _arg1), _arg2, _arg3, _arg4)); } protected function onCompleteDispatcher(... _args):void{ if (_callbacks.onComplete != null){ _callbacks.onComplete.apply(null, this.vars.onCompleteParams); }; _dispatcher.dispatchEvent(new TweenEvent(TweenEvent.COMPLETE)); } public static function set globalTimeScale(_arg1:Number):void{ setGlobalTimeScale(_arg1); } public static function pauseAll(_arg1:Boolean=true, _arg2:Boolean=false):void{ changePause(true, _arg1, _arg2); } public static function killAllDelayedCalls(_arg1:Boolean=false):void{ killAll(_arg1, false, true); } public static function setGlobalTimeScale(_arg1:Number):void{ var _local2:Dictionary; var _local3:int; var _local4:Array; if (_arg1 < 1E-5){ _arg1 = 1E-5; }; _local2 = masterList; _globalTimeScale = _arg1; for each (_local4 in _local2) { _local3 = (_local4.length - 1); while (_local3 > -1) { if ((_local4[_local3] is TweenMax)){ _local4[_local3].timeScale = (_local4[_local3].timeScale * 1); }; _local3--; }; }; } public static function get globalTimeScale():Number{ return (_globalTimeScale); } public static function getTweensOf(_arg1:Object):Array{ var _local2:Array; var _local3:Array; var _local4:TweenLite; var _local5:int; _local2 = masterList[_arg1]; _local3 = []; if (_local2 != null){ _local5 = (_local2.length - 1); while (_local5 > -1) { if (!_local2[_local5].gc){ _local3[_local3.length] = _local2[_local5]; }; _local5--; }; }; for each (_local4 in _pausedTweens) { if (_local4.target == _arg1){ _local3[_local3.length] = _local4; }; }; return (_local3); } public static function delayedCall(_arg1:Number, _arg2:Function, _arg3:Array=null, _arg4:Boolean=false):TweenMax{ return (new TweenMax(_arg2, 0, {delay:_arg1, onComplete:_arg2, onCompleteParams:_arg3, persist:_arg4, overwrite:0})); } public static function isTweening(_arg1:Object):Boolean{ var _local2:Array; var _local3:int; _local2 = getTweensOf(_arg1); _local3 = (_local2.length - 1); while (_local3 > -1) { if (((_local2[_local3].active) && (!(_local2[_local3].gc)))){ return (true); }; _local3--; }; return (false); } public static function changePause(_arg1:Boolean, _arg2:Boolean=true, _arg3:Boolean=false):void{ var _local4:Array; var _local5:Boolean; var _local6:int; _local4 = getAllTweens(); _local6 = (_local4.length - 1); while (_local6 > -1) { _local5 = (_local4[_local6].target == _local4[_local6].vars.onComplete); if ((((_local4[_local6] is TweenMax)) && ((((_local5 == _arg3)) || (!((_local5 == _arg2))))))){ _local4[_local6].paused = _arg1; }; _local6--; }; } public static function killAllTweens(_arg1:Boolean=false):void{ killAll(_arg1, true, false); } public static function from(_arg1:Object, _arg2:Number, _arg3:Object):TweenMax{ _arg3.runBackwards = true; return (new TweenMax(_arg1, _arg2, _arg3)); } public static function killAll(_arg1:Boolean=false, _arg2:Boolean=true, _arg3:Boolean=true):void{ var _local4:Array; var _local5:Boolean; var _local6:int; _local4 = getAllTweens(); _local6 = (_local4.length - 1); while (_local6 > -1) { _local5 = (_local4[_local6].target == _local4[_local6].vars.onComplete); if ((((_local5 == _arg3)) || (!((_local5 == _arg2))))){ if (_arg1){ _local4[_local6].complete(false); _local4[_local6].clear(); } else { TweenLite.removeTween(_local4[_local6], true); }; }; _local6--; }; } public static function getAllTweens():Array{ var _local1:Dictionary; var _local2:Array; var _local3:Array; var _local4:int; var _local5:TweenLite; _local1 = masterList; _local2 = []; for each (_local3 in _local1) { _local4 = (_local3.length - 1); while (_local4 > -1) { if (!_local3[_local4].gc){ _local2[_local2.length] = _local3[_local4]; }; _local4--; }; }; for each (_local5 in _pausedTweens) { _local2[_local2.length] = _local5; }; return (_local2); } public static function resumeAll(_arg1:Boolean=true, _arg2:Boolean=false):void{ changePause(false, _arg1, _arg2); } public static function to(_arg1:Object, _arg2:Number, _arg3:Object):TweenMax{ return (new TweenMax(_arg1, _arg2, _arg3)); } } }//package gs
Section 128
//__173 (hair_mania_0827_fla.__173) package hair_mania_0827_fla { import flash.display.*; public dynamic class __173 extends MovieClip { public var quan:MovieClip; } }//package hair_mania_0827_fla
Section 129
//__187 (hair_mania_0827_fla.__187) package hair_mania_0827_fla { import flash.display.*; public dynamic class __187 extends MovieClip { public function __187(){ addFrameScript(0, frame1, 12, frame13); } function frame1(){ stop(); } function frame13(){ stop(); } } }//package hair_mania_0827_fla
Section 130
//__510 (hair_mania_0827_fla.__510) package hair_mania_0827_fla { import flash.display.*; public dynamic class __510 extends MovieClip { public function __510(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 131
//_char_195 (hair_mania_0827_fla._char_195) package hair_mania_0827_fla { import flash.display.*; public dynamic class _char_195 extends MovieClip { public var shoukao:MovieClip; public var char:MovieClip; public var fanwei:MovieClip; public var yanzhao:MovieClip; public function _char_195(){ addFrameScript(0, frame1, 15, frame16); } function frame16(){ gotoAndStop(1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 132
//_complete_plan_603 (hair_mania_0827_fla._complete_plan_603) package hair_mania_0827_fla { import flash.display.*; import flash.text.*; public dynamic class _complete_plan_603 extends MovieClip { public var bt0:按钮_subscore; public var bt4:按钮_wallofhair; public var bt5:按钮SENDTOFRIEND; public var bt1:按钮_tryagain; public var bt3:按钮_moregame; public var bt2:按钮_tryagain; public var err:MovieClip; public var score:TextField; public var username:TextField; } }//package hair_mania_0827_fla
Section 133
//_err_tishi_617 (hair_mania_0827_fla._err_tishi_617) package hair_mania_0827_fla { import flash.display.*; public dynamic class _err_tishi_617 extends MovieClip { public function _err_tishi_617(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 134
//_howtoplay__155 (hair_mania_0827_fla._howtoplay__155) package hair_mania_0827_fla { import flash.display.*; public dynamic class _howtoplay__155 extends MovieClip { public function _howtoplay__155(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 135
//_level_plan_619 (hair_mania_0827_fla._level_plan_619) package hair_mania_0827_fla { import flash.display.*; import flash.text.*; public dynamic class _level_plan_619 extends MovieClip { public var bt0:按钮_subscore; public var bt1:按钮_MAINMENU; public var bt3:按钮_moregame; public var bt2:按钮_tryagain; public var txt:MovieClip; public var err:MovieClip; public var score:TextField; public var username:TextField; } }//package hair_mania_0827_fla
Section 136
//box0_574 (hair_mania_0827_fla.box0_574) package hair_mania_0827_fla { import flash.display.*; public dynamic class box0_574 extends MovieClip { public function box0_574(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 137
//C1_196 (hair_mania_0827_fla.C1_196) package hair_mania_0827_fla { import flash.display.*; public dynamic class C1_196 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 138
//C1_197 (hair_mania_0827_fla.C1_197) package hair_mania_0827_fla { import flash.display.*; public dynamic class C1_197 extends MovieClip { public var hair:MovieClip; public function C1_197(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 139
//C1_200 (hair_mania_0827_fla.C1_200) package hair_mania_0827_fla { import flash.display.*; public dynamic class C1_200 extends MovieClip { public function C1_200(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 140
//C1_213 (hair_mania_0827_fla.C1_213) package hair_mania_0827_fla { import flash.display.*; public dynamic class C1_213 extends MovieClip { public function C1_213(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 141
//C10__374 (hair_mania_0827_fla.C10__374) package hair_mania_0827_fla { import flash.display.*; public dynamic class C10__374 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 142
//C10_376 (hair_mania_0827_fla.C10_376) package hair_mania_0827_fla { import flash.display.*; public dynamic class C10_376 extends MovieClip { public var hair:MovieClip; public function C10_376(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 143
//C10_383 (hair_mania_0827_fla.C10_383) package hair_mania_0827_fla { import flash.display.*; public dynamic class C10_383 extends MovieClip { public function C10_383(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 144
//C10_389 (hair_mania_0827_fla.C10_389) package hair_mania_0827_fla { import flash.display.*; public dynamic class C10_389 extends MovieClip { public function C10_389(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 145
//C11__396 (hair_mania_0827_fla.C11__396) package hair_mania_0827_fla { import flash.display.*; public dynamic class C11__396 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 146
//c11_398 (hair_mania_0827_fla.c11_398) package hair_mania_0827_fla { import flash.display.*; public dynamic class c11_398 extends MovieClip { public var hair:MovieClip; public function c11_398(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 147
//c11_401 (hair_mania_0827_fla.c11_401) package hair_mania_0827_fla { import flash.display.*; public dynamic class c11_401 extends MovieClip { public function c11_401(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 148
//c11_407 (hair_mania_0827_fla.c11_407) package hair_mania_0827_fla { import flash.display.*; public dynamic class c11_407 extends MovieClip { public function c11_407(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 149
//C12__414 (hair_mania_0827_fla.C12__414) package hair_mania_0827_fla { import flash.display.*; public dynamic class C12__414 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 150
//c12_417 (hair_mania_0827_fla.c12_417) package hair_mania_0827_fla { import flash.display.*; public dynamic class c12_417 extends MovieClip { public var hair:MovieClip; public function c12_417(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 151
//c12_419 (hair_mania_0827_fla.c12_419) package hair_mania_0827_fla { import flash.display.*; public dynamic class c12_419 extends MovieClip { public function c12_419(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 152
//c12_426 (hair_mania_0827_fla.c12_426) package hair_mania_0827_fla { import flash.display.*; public dynamic class c12_426 extends MovieClip { public function c12_426(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 153
//C13__434 (hair_mania_0827_fla.C13__434) package hair_mania_0827_fla { import flash.display.*; public dynamic class C13__434 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 154
//c13_437 (hair_mania_0827_fla.c13_437) package hair_mania_0827_fla { import flash.display.*; public dynamic class c13_437 extends MovieClip { public var hair:MovieClip; public function c13_437(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 155
//c13_439 (hair_mania_0827_fla.c13_439) package hair_mania_0827_fla { import flash.display.*; public dynamic class c13_439 extends MovieClip { public function c13_439(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 156
//c13_445 (hair_mania_0827_fla.c13_445) package hair_mania_0827_fla { import flash.display.*; public dynamic class c13_445 extends MovieClip { public function c13_445(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 157
//C14__453 (hair_mania_0827_fla.C14__453) package hair_mania_0827_fla { import flash.display.*; public dynamic class C14__453 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 158
//c14_454 (hair_mania_0827_fla.c14_454) package hair_mania_0827_fla { import flash.display.*; public dynamic class c14_454 extends MovieClip { public var hair:MovieClip; public function c14_454(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 159
//c14_458 (hair_mania_0827_fla.c14_458) package hair_mania_0827_fla { import flash.display.*; public dynamic class c14_458 extends MovieClip { public function c14_458(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 160
//c14_462 (hair_mania_0827_fla.c14_462) package hair_mania_0827_fla { import flash.display.*; public dynamic class c14_462 extends MovieClip { public function c14_462(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 161
//C15__467 (hair_mania_0827_fla.C15__467) package hair_mania_0827_fla { import flash.display.*; public dynamic class C15__467 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 162
//c15_469 (hair_mania_0827_fla.c15_469) package hair_mania_0827_fla { import flash.display.*; public dynamic class c15_469 extends MovieClip { public var hair:MovieClip; public function c15_469(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 163
//c15_472 (hair_mania_0827_fla.c15_472) package hair_mania_0827_fla { import flash.display.*; public dynamic class c15_472 extends MovieClip { public function c15_472(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 164
//c15_478 (hair_mania_0827_fla.c15_478) package hair_mania_0827_fla { import flash.display.*; public dynamic class c15_478 extends MovieClip { public function c15_478(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 165
//C2__224 (hair_mania_0827_fla.C2__224) package hair_mania_0827_fla { import flash.display.*; public dynamic class C2__224 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 166
//c2_226 (hair_mania_0827_fla.c2_226) package hair_mania_0827_fla { import flash.display.*; public dynamic class c2_226 extends MovieClip { public var hair:MovieClip; public function c2_226(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 167
//c2_229 (hair_mania_0827_fla.c2_229) package hair_mania_0827_fla { import flash.display.*; public dynamic class c2_229 extends MovieClip { public function c2_229(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 168
//c2_236 (hair_mania_0827_fla.c2_236) package hair_mania_0827_fla { import flash.display.*; public dynamic class c2_236 extends MovieClip { public function c2_236(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 169
//C3__243 (hair_mania_0827_fla.C3__243) package hair_mania_0827_fla { import flash.display.*; public dynamic class C3__243 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 170
//c3_245 (hair_mania_0827_fla.c3_245) package hair_mania_0827_fla { import flash.display.*; public dynamic class c3_245 extends MovieClip { public var hair:MovieClip; public function c3_245(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 171
//c3_254 (hair_mania_0827_fla.c3_254) package hair_mania_0827_fla { import flash.display.*; public dynamic class c3_254 extends MovieClip { public function c3_254(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 172
//c3_262 (hair_mania_0827_fla.c3_262) package hair_mania_0827_fla { import flash.display.*; public dynamic class c3_262 extends MovieClip { public function c3_262(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 173
//C4_267 (hair_mania_0827_fla.C4_267) package hair_mania_0827_fla { import flash.display.*; public dynamic class C4_267 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 174
//c4_269 (hair_mania_0827_fla.c4_269) package hair_mania_0827_fla { import flash.display.*; public dynamic class c4_269 extends MovieClip { public var hair:MovieClip; public function c4_269(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 175
//c4_271 (hair_mania_0827_fla.c4_271) package hair_mania_0827_fla { import flash.display.*; public dynamic class c4_271 extends MovieClip { public function c4_271(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 176
//c4_277 (hair_mania_0827_fla.c4_277) package hair_mania_0827_fla { import flash.display.*; public dynamic class c4_277 extends MovieClip { public function c4_277(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 177
//C5__282 (hair_mania_0827_fla.C5__282) package hair_mania_0827_fla { import flash.display.*; public dynamic class C5__282 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 178
//c5_284 (hair_mania_0827_fla.c5_284) package hair_mania_0827_fla { import flash.display.*; public dynamic class c5_284 extends MovieClip { public var hair:MovieClip; public function c5_284(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 179
//c5_286 (hair_mania_0827_fla.c5_286) package hair_mania_0827_fla { import flash.display.*; public dynamic class c5_286 extends MovieClip { public function c5_286(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 180
//c5_293 (hair_mania_0827_fla.c5_293) package hair_mania_0827_fla { import flash.display.*; public dynamic class c5_293 extends MovieClip { public function c5_293(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 181
//C6__301 (hair_mania_0827_fla.C6__301) package hair_mania_0827_fla { import flash.display.*; public dynamic class C6__301 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 182
//C6_303 (hair_mania_0827_fla.C6_303) package hair_mania_0827_fla { import flash.display.*; public dynamic class C6_303 extends MovieClip { public var hair:MovieClip; public function C6_303(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 183
//C6_306 (hair_mania_0827_fla.C6_306) package hair_mania_0827_fla { import flash.display.*; public dynamic class C6_306 extends MovieClip { public function C6_306(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 184
//C6_309 (hair_mania_0827_fla.C6_309) package hair_mania_0827_fla { import flash.display.*; public dynamic class C6_309 extends MovieClip { public function C6_309(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 185
//C7__316 (hair_mania_0827_fla.C7__316) package hair_mania_0827_fla { import flash.display.*; public dynamic class C7__316 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 186
//C7_318 (hair_mania_0827_fla.C7_318) package hair_mania_0827_fla { import flash.display.*; public dynamic class C7_318 extends MovieClip { public var hair:MovieClip; public function C7_318(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 187
//C7_320 (hair_mania_0827_fla.C7_320) package hair_mania_0827_fla { import flash.display.*; public dynamic class C7_320 extends MovieClip { public function C7_320(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 188
//C7_327 (hair_mania_0827_fla.C7_327) package hair_mania_0827_fla { import flash.display.*; public dynamic class C7_327 extends MovieClip { public function C7_327(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 189
//C8__334 (hair_mania_0827_fla.C8__334) package hair_mania_0827_fla { import flash.display.*; public dynamic class C8__334 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 190
//C8_336 (hair_mania_0827_fla.C8_336) package hair_mania_0827_fla { import flash.display.*; public dynamic class C8_336 extends MovieClip { public var hair:MovieClip; public function C8_336(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 191
//C8_343 (hair_mania_0827_fla.C8_343) package hair_mania_0827_fla { import flash.display.*; public dynamic class C8_343 extends MovieClip { public function C8_343(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 192
//C8_350 (hair_mania_0827_fla.C8_350) package hair_mania_0827_fla { import flash.display.*; public dynamic class C8_350 extends MovieClip { public function C8_350(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 193
//C9__355 (hair_mania_0827_fla.C9__355) package hair_mania_0827_fla { import flash.display.*; public dynamic class C9__355 extends MovieClip { public var face:MovieClip; public var arm:MovieClip; public var hair:MovieClip; } }//package hair_mania_0827_fla
Section 194
//C9_357 (hair_mania_0827_fla.C9_357) package hair_mania_0827_fla { import flash.display.*; public dynamic class C9_357 extends MovieClip { public var hair:MovieClip; public function C9_357(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 195
//C9_359 (hair_mania_0827_fla.C9_359) package hair_mania_0827_fla { import flash.display.*; public dynamic class C9_359 extends MovieClip { public function C9_359(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 196
//C9_367 (hair_mania_0827_fla.C9_367) package hair_mania_0827_fla { import flash.display.*; public dynamic class C9_367 extends MovieClip { public function C9_367(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 197
//char0_hair__198 (hair_mania_0827_fla.char0_hair__198) package hair_mania_0827_fla { import flash.display.*; public dynamic class char0_hair__198 extends MovieClip { public function char0_hair__198(){ addFrameScript(0, frame1, 99, frame100); } function frame1(){ stop(); } function frame100(){ stop(); } } }//package hair_mania_0827_fla
Section 198
//char10_harit_377 (hair_mania_0827_fla.char10_harit_377) package hair_mania_0827_fla { import flash.display.*; public dynamic class char10_harit_377 extends MovieClip { public function char10_harit_377(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 199
//char11_399 (hair_mania_0827_fla.char11_399) package hair_mania_0827_fla { import flash.display.*; public dynamic class char11_399 extends MovieClip { public function char11_399(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 200
//char14_455 (hair_mania_0827_fla.char14_455) package hair_mania_0827_fla { import flash.display.*; public dynamic class char14_455 extends MovieClip { public function char14_455(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 201
//char5_1_285 (hair_mania_0827_fla.char5_1_285) package hair_mania_0827_fla { import flash.display.*; public dynamic class char5_1_285 extends MovieClip { public function char5_1_285(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 202
//flag_icon_833 (hair_mania_0827_fla.flag_icon_833) package hair_mania_0827_fla { import flash.display.*; public dynamic class flag_icon_833 extends MovieClip { public function flag_icon_833(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 203
//hair3__246 (hair_mania_0827_fla.hair3__246) package hair_mania_0827_fla { import flash.display.*; public dynamic class hair3__246 extends MovieClip { public function hair3__246(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 204
//hair8_t_337 (hair_mania_0827_fla.hair8_t_337) package hair_mania_0827_fla { import flash.display.*; public dynamic class hair8_t_337 extends MovieClip { public function hair8_t_337(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 205
//l_br_835 (hair_mania_0827_fla.l_br_835) package hair_mania_0827_fla { import flash.display.*; import flash.text.*; public dynamic class l_br_835 extends MovieClip { public var text:TextField; public var flag:MovieClip; } }//package hair_mania_0827_fla
Section 206
//levelcomplete_plane_639 (hair_mania_0827_fla.levelcomplete_plane_639) package hair_mania_0827_fla { import flash.display.*; import flash.text.*; public dynamic class levelcomplete_plane_639 extends MovieClip { public var bt0:按钮_continue; public var bt1:按钮SENDTOFRIEND; public var bt2:按钮_moregame; public var txt:MovieClip; public var txt1:TextField; public var txt2:TextField; public var txt0:TextField; public function levelcomplete_plane_639(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 207
//logoani1_52 (hair_mania_0827_fla.logoani1_52) package hair_mania_0827_fla { import flash.display.*; public dynamic class logoani1_52 extends MovieClip { public function logoani1_52(){ addFrameScript(239, frame240); } function frame240(){ stop(); } } }//package hair_mania_0827_fla
Section 208
//logologo_51 (hair_mania_0827_fla.logologo_51) package hair_mania_0827_fla { import flash.net.*; import flash.events.*; import flash.display.*; public dynamic class logologo_51 extends MovieClip { public function logologo_51(){ addFrameScript(0, frame1, 239, frame240); } function frame1(){ this.mouseChildren = false; this.buttonMode = true; this.addEventListener(MouseEvent.MOUSE_DOWN, _down); } public function _down(_arg1){ navigateToURL(new URLRequest("http://www.game.com.cn"), "_blank"); } function frame240(){ MovieClip(parent.parent).gotoAndPlay("game"); stop(); } } }//package hair_mania_0827_fla
Section 209
//test_mianban_779 (hair_mania_0827_fla.test_mianban_779) package hair_mania_0827_fla { import flash.display.*; public dynamic class test_mianban_779 extends MovieClip { public function test_mianban_779(){ addFrameScript(0, frame1); } function frame1(){ mouseEnabled = false; } } }//package hair_mania_0827_fla
Section 210
//think_exit__492 (hair_mania_0827_fla.think_exit__492) package hair_mania_0827_fla { import flash.display.*; public dynamic class think_exit__492 extends MovieClip { public var timebar:MovieClip; public function think_exit__492(){ addFrameScript(0, frame1, 20, frame21); } function frame1(){ stop(); } function frame21(){ stop(); } } }//package hair_mania_0827_fla
Section 211
//timebar_494 (hair_mania_0827_fla.timebar_494) package hair_mania_0827_fla { import flash.display.*; public dynamic class timebar_494 extends MovieClip { public var bar:MovieClip; } }//package hair_mania_0827_fla
Section 212
//Timeline_103 (hair_mania_0827_fla.Timeline_103) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_103 extends MovieClip { public var mc:MovieClip; public function Timeline_103(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 213
//Timeline_108 (hair_mania_0827_fla.Timeline_108) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_108 extends MovieClip { public function Timeline_108(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 214
//Timeline_109 (hair_mania_0827_fla.Timeline_109) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_109 extends MovieClip { public function Timeline_109(){ addFrameScript(67, frame68); } function frame68(){ gotoAndPlay(19); } } }//package hair_mania_0827_fla
Section 215
//Timeline_110 (hair_mania_0827_fla.Timeline_110) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_110 extends MovieClip { public function Timeline_110(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 216
//Timeline_112 (hair_mania_0827_fla.Timeline_112) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_112 extends MovieClip { public function Timeline_112(){ addFrameScript(62, frame63); } function frame63(){ gotoAndPlay("end"); } } }//package hair_mania_0827_fla
Section 217
//Timeline_113 (hair_mania_0827_fla.Timeline_113) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_113 extends MovieClip { public function Timeline_113(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 218
//Timeline_118 (hair_mania_0827_fla.Timeline_118) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_118 extends MovieClip { public function Timeline_118(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 219
//Timeline_124 (hair_mania_0827_fla.Timeline_124) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_124 extends MovieClip { public var mc:MovieClip; public function Timeline_124(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 220
//Timeline_125 (hair_mania_0827_fla.Timeline_125) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_125 extends MovieClip { public var mc:MovieClip; public function Timeline_125(){ addFrameScript(9, frame10); } function frame10(){ stop(); } } }//package hair_mania_0827_fla
Section 221
//Timeline_130 (hair_mania_0827_fla.Timeline_130) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_130 extends MovieClip { public function Timeline_130(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 222
//Timeline_136 (hair_mania_0827_fla.Timeline_136) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_136 extends MovieClip { public function Timeline_136(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 223
//Timeline_139 (hair_mania_0827_fla.Timeline_139) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_139 extends MovieClip { public function Timeline_139(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 224
//Timeline_142 (hair_mania_0827_fla.Timeline_142) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_142 extends MovieClip { public function Timeline_142(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 225
//Timeline_150 (hair_mania_0827_fla.Timeline_150) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_150 extends MovieClip { public function Timeline_150(){ addFrameScript(0, frame1); } function frame1(){ } } }//package hair_mania_0827_fla
Section 226
//Timeline_152 (hair_mania_0827_fla.Timeline_152) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_152 extends MovieClip { public function Timeline_152(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 227
//Timeline_167 (hair_mania_0827_fla.Timeline_167) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_167 extends MovieClip { public var mc:MovieClip; } }//package hair_mania_0827_fla
Section 228
//Timeline_190 (hair_mania_0827_fla.Timeline_190) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_190 extends MovieClip { public function Timeline_190(){ addFrameScript(46, frame47); } function frame47(){ stop(); } } }//package hair_mania_0827_fla
Section 229
//Timeline_486 (hair_mania_0827_fla.Timeline_486) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_486 extends MovieClip { public function Timeline_486(){ addFrameScript(0, frame1, 10, frame11, 11, frame12); } function frame12(){ stop(); } function frame1(){ stop(); } function frame11(){ stop(); } } }//package hair_mania_0827_fla
Section 230
//Timeline_498 (hair_mania_0827_fla.Timeline_498) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_498 extends MovieClip { public var masks:MovieClip; public var bar:MovieClip; } }//package hair_mania_0827_fla
Section 231
//Timeline_582 (hair_mania_0827_fla.Timeline_582) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_582 extends MovieClip { public var mc:MovieClip; } }//package hair_mania_0827_fla
Section 232
//Timeline_622 (hair_mania_0827_fla.Timeline_622) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_622 extends MovieClip { public function Timeline_622(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 233
//Timeline_645 (hair_mania_0827_fla.Timeline_645) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_645 extends MovieClip { public function Timeline_645(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 234
//Timeline_66 (hair_mania_0827_fla.Timeline_66) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_66 extends MovieClip { public function Timeline_66(){ addFrameScript(6, frame7); } function frame7(){ stop(); } } }//package hair_mania_0827_fla
Section 235
//Timeline_67 (hair_mania_0827_fla.Timeline_67) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_67 extends MovieClip { public function Timeline_67(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 236
//Timeline_69 (hair_mania_0827_fla.Timeline_69) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_69 extends MovieClip { public function Timeline_69(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 237
//Timeline_718 (hair_mania_0827_fla.Timeline_718) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_718 extends MovieClip { public function Timeline_718(){ addFrameScript(27, frame28); } function frame28(){ stop(); } } }//package hair_mania_0827_fla
Section 238
//Timeline_722 (hair_mania_0827_fla.Timeline_722) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_722 extends MovieClip { public function Timeline_722(){ addFrameScript(0, frame1, 3, frame4, 10, frame11); } function frame1(){ stop(); } function frame4(){ stop(); } function frame11(){ stop(); } } }//package hair_mania_0827_fla
Section 239
//Timeline_75 (hair_mania_0827_fla.Timeline_75) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_75 extends MovieClip { public var _mc:MovieClip; } }//package hair_mania_0827_fla
Section 240
//Timeline_79 (hair_mania_0827_fla.Timeline_79) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_79 extends MovieClip { public function Timeline_79(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 241
//Timeline_83 (hair_mania_0827_fla.Timeline_83) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_83 extends MovieClip { public function Timeline_83(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 242
//Timeline_92 (hair_mania_0827_fla.Timeline_92) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_92 extends MovieClip { public function Timeline_92(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 243
//Timeline_97 (hair_mania_0827_fla.Timeline_97) package hair_mania_0827_fla { import flash.display.*; public dynamic class Timeline_97 extends MovieClip { public function Timeline_97(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package hair_mania_0827_fla
Section 244
//BarCtrl (lib.BarCtrl) package lib { import flash.events.*; import flash.display.*; import flash.geom.*; public class BarCtrl extends Sprite { private var BAR_DRAG:String;// = "Bar_Drag" public var bar:MovieClip; public var bar_back:MovieClip; private var maxHeight:Number; private var img; private var mouseDown:Boolean; private var y1:Number;// = 60 public function BarCtrl(){ BAR_DRAG = "Bar_Drag"; y1 = 60; super(); } public function init(_arg1){ img = _arg1; bar.buttonMode = true; bar.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); stage.addEventListener(MouseEvent.MOUSE_UP, _mouseUp); stage.addEventListener(MouseEvent.MOUSE_MOVE, _mouseMove); this.addEventListener(Event.ENTER_FRAME, _onEnterFrame); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); maxHeight = (bar_back.height - bar.height); } private function _onUnload(_arg1:Event){ this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function _mouseDown(_arg1:MouseEvent){ mouseDown = true; bar.startDrag(false, new Rectangle(1.9, (bar_back.y + 2), 0, ((bar_back.height - bar.height) - 5))); } private function _mouseMove(_arg1:MouseEvent){ var _local2:*; if (mouseDown){ _local2 = (int(((bar.y / (bar_back.height - bar.height)) * 100)) + 1); if (_local2 == 99){ _local2 = 100; }; y1 = (((((img.height - 318) * -1) / 100) * _local2) + 65); }; } private function _onEnterFrame(_arg1:Event){ img.y = (img.y + ((y1 - img.y) * 0.3)); } private function _mouseUp(_arg1:MouseEvent){ mouseDown = false; stopDrag(); } } }//package lib
Section 245
//Dog (lib.Dog) package lib { import flash.events.*; import flash.display.*; import flash.utils.*; public class Dog extends MovieClip { private var id_moden:int; public var moden; public var _moden:int; private var id_time; public var mc:MovieClip; public function setmoden(_arg1:String){ if (_arg1 == "sleep"){ moden = 3; gotoAndStop("sleep"); }; if (_arg1 == "cry"){ _moden = moden; moden = 2; gotoAndStop("cry"); }; if (_arg1 == "walk"){ moden = _moden; gotoAndStop("walk"); if (moden > 1){ moden = 1; }; }; } public function init(){ moden = 1; mc.gotoAndPlay("moden4"); this.addEventListener(Event.ENTER_FRAME, _onEnterFrame); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); id_moden = 1; id_time = setInterval(goSleep, (1000 * 10)); } private function _onUnload(_arg1:Event){ this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function _onEnterFrame(_arg1:Event){ var f:*; var evt = _arg1; f = 0; try { f = mc.currentFrame; } catch(err) { }; if (moden == 1){ x = (x + 2); if (f != 1){ try { mc.gotoAndStop(1); } catch(err) { }; }; }; if (moden == 0){ x = (x - 2); if (f != 13){ try { mc.gotoAndStop(13); } catch(err) { }; }; }; if ((((x > 120)) && (!((moden == 3))))){ moden = 0; x = 119; try { mc.gotoAndPlay("moden0"); } catch(err) { }; }; if ((((x < 0)) && (!((moden == 3))))){ moden = 1; x = 1; try { mc.gotoAndPlay("moden1"); } catch(err) { }; }; } private function goSleep(){ if (moden != 2){ setmoden("sleep"); }; } } }//package lib
Section 246
//Game (lib.Game) package lib { import flash.events.*; import flash.display.*; import flash.text.*; import spill.localisation.*; import gs.*; import flash.utils.*; import gs.easing.*; import flash.ui.*; public class Game extends MovieClip { public var clock:MovieClip; public var loader:MovieClip; public var tool_target:TextField; public var hair_current:Number; private var levelinfo:LevelInfo; private var id_setTimeout:int; public var bg:MovieClip; public var think_exit:MovieClip; private var toolList:Array; private var hand:Hand; private var _tool; private var toolStation:Number;// = 95 public var logo_mainscreen:BrandingLogo; public var howtoplay:HowToPlay; public var tool_used_text:TextField; public var bt_games:SimpleButton; private var levelfail:LevelFail; private var _language:int; private var spaceTishi:Space_Tishi; private var levelcomplete:LevelComplete; private var toolCurrent:int; public var powerBar:MovieClip; private var mouseLast:Array; private var mouseDown:Boolean; public var bt_sound:按钮_音量; public var 椅子:MovieClip; private var _levelshow:_levelShow; private var toolLimit:int;// = 6 private var levelcompleteend:LevelCompleteEnd; private var tool_id:int; public var dog:_dog; private var exit_time:int; public var char:MovieClip; private var id_time:int; private var __tool; private var unlocknewtool:_unlockNewTool; public var tool_l:MovieClip; public var tool_r:MovieClip; private var levecompleteshow:LevelComplete_show; private var toolWidht:Number;// = 78 public var toolIntro:MovieClip; public var bt_paused:按钮_暂停; private var id_exit:int; private var toolLoader:Sprite; private var tool_moden:int; private var mouseDown_tool:int;// = 0 public var mania:MovieClip; private var pause:Pause; public var time_txt:TextField; public var ball:MovieClip; public static var mouseSpeed:Number = 0; public static var tool_effecting:Boolean; public static var bollx; public static var bolly:Number; public static var time:Number; public static var GameStart:Boolean; public static var spaceTime:Boolean; public static var obj; public static var tool_used:Array; public function Game(){ toolLimit = 6; toolWidht = 78; toolStation = 95; mouseDown_tool = 0; super(); howtoplay = new HowToPlay(); levelinfo = new LevelInfo(); levelfail = new LevelFail(); levelcompleteend = new LevelCompleteEnd(); levelcomplete = new LevelComplete(); spaceTishi = new Space_Tishi(); levecompleteshow = new LevelComplete_show(); unlocknewtool = new _unlockNewTool(); _levelshow = new _levelShow(); hand = new Hand(); } private function _onMouseDown(_arg1:MouseEvent){ var _local2:gameEvent; _local2 = new gameEvent(gameEvent.url_pause_more); dispatchEvent(_local2); } private function showtoolEffect(){ if (tool_id == 1){ soundCtrl.playEffect("_sound1_shandian", 0, 800); __tool = new _tool_2(); addChild(__tool); __tool.x = ball.x; __tool.y = -50; TweenMax.to(__tool, 0.6, {y:ball.y, ease:Back.easeOut, onComplete:Show_toolEffect, onCompleteParams:[__tool]}); } else { if (tool_id == 2){ soundCtrl.playEffect("_sound2_baozha", 0); __tool = new _tool_3(); addChild(__tool); __tool.x = ball.x; __tool.y = ball.y; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 820); } else { if (tool_id == 5){ soundCtrl.playEffect("_sound5_feng", 0); __tool = new _tool_6(); addChild(__tool); __tool.x = 284; __tool.y = (toolLoader.y - 325); __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 1500); } else { if (tool_id == 6){ soundCtrl.playEffect("_sound6_haixiao", 0); __tool = new _tool_7(); addChild(__tool); __tool.x = 0; __tool.y = 0; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 2200); } else { if (tool_id == 10){ soundCtrl.playEffect("_sound10_pen", 0); __tool = new _tool_9(); addChild(__tool); __tool.x = ball.x; __tool.y = ball.y; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 1700); } else { if (tool_id == 15){ soundCtrl.playEffect("_sound15_jidan", 0); __tool = new _tool_14(); addChild(__tool); __tool.x = ball.x; __tool.y = ball.y; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 1700); } else { if (tool_id == 18){ __tool = new _tool_17(); addChild(__tool); __tool.x = ball.x; __tool.y = ball.y; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 1700); } else { if (tool_id == 20){ soundCtrl.playEffect("_sound20_yu", 0, 500); __tool = new _tool_19(); addChild(__tool); __tool.x = ball.x; __tool.y = ball.y; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 3500); } else { if (tool_id == 23){ soundCtrl.playEffect("_sound23_daxiang", 0, 300); __tool = new _tool_24(); addChild(__tool); __tool.x = ball.x; __tool.y = ball.y; __tool.gotoAndPlay(2); setTimeout(Remove_toolEffect, 3500); } else { tool_effecting = false; spaceTime = false; }; }; }; }; }; }; }; }; }; } private function showHowtoplay(){ userData.showHowtoplay = true; howtoplay.y = -130; TweenMax.to(howtoplay, 0.35, {y:0, ease:Back.easeOut}); addChild(howtoplay); howtoplay.target = "game"; howtoplay.init(); howtoplay.bg.visible = false; howtoplay.addEventListener(gameEvent.GOTO, _disHowtoplay); } private function buildMap(){ var _local1:*; var _local2:*; var _local3:*; toolLoader = new Sprite(); addChild(toolLoader); toolLoader.y = 505; toolLoader.x = (toolStation - 110); toolCurrent = 0; _local1 = 0; while (_local1 < toolList.length) { _local3 = new tool(); _local3.addEventListener(gameEvent.Show_tool_intro, show_toolIntro); _local3.addEventListener(gameEvent.Dis_tool_intro, dis_toolIntro); _local3.addEventListener(gameEvent.Press_fack_tool, _Press_fack_tool); _local3.addEventListener(gameEvent.Release_fack_tool, _Release_fack_tool); _local3.buttonMode = true; _local3.id = _local1; toolLoader.addChild(_local3); _local3.x = ((_local1 * toolWidht) + 100); _local3.gotoAndStop(toolList[_local1][0]); _local3.moden = toolList[_local1][2]; _local3.type = toolList[_local1][4]; _local3.addEventListener(gameEvent.TOOL_MOVE, tool_move); toolList[_local1][5] = _local3; _local3.init(); if (toolList[_local1][0] != 30){ _local3._mc.visible = false; }; if (toolList[_local1][6]){ _local3.lock.visible = false; TweenMax.to(_local3, 0.2, {colorMatrixFilter:{}}); } else { _local3.lock.visible = true; TweenMax.to(_local3, 0.2, {colorMatrixFilter:{colorize:0xFFFFFF}}); }; _local1++; }; for each (_local2 in toolList) { if (((((_local2[5].x + toolLoader.x) < (55 + 10))) || (((_local2[5].x + toolLoader.x) > (623 - 10))))){ if (_local2[5].visible){ _local2[5].visible = false; }; } else { if (!_local2[5].visible){ _local2[5].visible = true; }; }; }; stage.addEventListener(MouseEvent.MOUSE_UP, _mouseUp_tool_lr); setChildIndex(tool_l, (numChildren - 1)); setChildIndex(tool_r, (numChildren - 1)); setChildIndex(hand, (numChildren - 1)); if (!userData.showHowtoplay){ userData.showHowtoplay = true; userData.saveData(); showHowtoplay(); } else { showLevelInfo(); }; char.gotoAndStop((userData.level_current + 1)); bt_paused.moden = 2; bt_paused.addEventListener(myButtonEvent.Button_Click, _onClick); bt_sound.moden = 2; bt_sound.addEventListener(myButtonEvent.Button_Click, _onClick); if (soundCtrl.soundOff){ bt_sound.gotoAndStop(2); } else { bt_sound.gotoAndStop(1); }; time = userData.data[userData.level_current][0]; showTime(); clearInterval(id_time); id_time = setInterval(enterFrame, 1000); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); this.addEventListener(Event.ENTER_FRAME, _onEnterFrame); logo_mainscreen.mouseChildren = false; logo_mainscreen.buttonMode = true; logo_mainscreen.addEventListener(MouseEvent.MOUSE_OVER, _onMouseOver); logo_mainscreen.addEventListener(MouseEvent.MOUSE_OUT, _onMouseOut); logo_mainscreen.addEventListener(MouseEvent.MOUSE_DOWN, _onMouseDown); toolIntro.gotoAndStop(1); dog.gotoAndStop(1); dog.init(); } private function _timeout(_arg1:gameEvent){ _tool.dis(); spaceTime = false; tool_effecting = false; } private function char_clear(){ exit_time = 0; think_exit.visible = false; if (char.char.face.currentFrame == 21){ char.char.face.gotoAndStop("moden0"); }; think_exit.gotoAndStop(1); char.char.arm.gotoAndStop("moden0"); char.char.face.gotoAndStop("moden0"); char.shoukao.visible = false; char.yanzhao.visible = false; clearExit(); } private function tool_move(_arg1:gameEvent){ } private function _mouseUp_tool_lr(_arg1:MouseEvent){ mouseDown_tool = 0; } private function _onMouseOver(_arg1:MouseEvent){ TweenMax.to(_arg1.target, 0.1, {colorMatrixFilter:{brightness:1.4}}); } private function checkPowerBar(){ if (GameStart){ if (powerBar.bar.y > 0){ powerBar.bar.y = (powerBar.bar.y - (mouseSpeed / 20)); }; if (powerBar.bar.y < 175){ powerBar.bar.y = (powerBar.bar.y + 2); }; }; if (((spaceTime) && ((powerBar.bar.y < 2)))){ spaceTime = false; if ((((tool_id < 18)) || ((tool_id > 23)))){ spaceTishi.great(1); } else { spaceTishi.great(2); }; _tool.dis(); hairGrowth(); showtoolEffect(); setChildIndex(spaceTishi, (numChildren - 1)); }; if (((((!((tool_moden == 5))) && ((powerBar.bar.y < 2)))) && (GameStart))){ powerBar.bar.y = 2; if (tool_id == 29){ newToolUsed(); char_clear(); char.char.face.gotoAndStop("moden6"); clearTimeout(id_setTimeout); id_setTimeout = setTimeout(char_clear, (1000 * 15)); }; addChild(spaceTishi); if ((((tool_id < 18)) || ((tool_id > 23)))){ spaceTishi.great(1); } else { spaceTishi.great(2); }; _tool.dis(); hairGrowth(); mania.gotoAndStop("moden0"); setChildIndex(spaceTishi, (numChildren - 1)); }; } private function _showLevelFail(){ addChild(levelfail); levelfail.init(); clearInterval(id_exit); } private function hairGrowth(){ var _local1:*; var _local2:int; if (GameStart){ soundCtrl.playEffect("_sound_gold"); newToolUsed(); _local1 = Math.ceil((100 / int(userData.data[userData.level_current][3]))); _local2 = 1; if ((((tool_id < 18)) || ((tool_id > 23)))){ _local2 = ((_local1 + char.char.hair.hair.currentFrame) + 2); }; if ((((_local2 > 100)) && ((tool_used.length >= userData.data[userData.level_current][3])))){ GameStart = false; _local2 = 100; TweenMax.to(this, 1, {hair_current:_local2, onComplete:GameComplete}); } else { if (_local2 == 1){ TweenMax.to(this, 1, {hair_current:_local2, onComplete:hairDown_end}); } else { TweenMax.to(this, 1, {hair_current:_local2}); }; }; }; } private function showLevelFail(){ try { _tool.dis(); } catch(err) { }; mania.gotoAndStop("moden2"); GameStart = false; think_exit.visible = false; think_exit.gotoAndStop(1); clearInterval(id_exit); clearInterval(id_time); addChild(_levelshow); _levelshow.alpha = 0; TweenMax.to(_levelshow, 0.5, {delay:3, alpha:1}); soundCtrl.playMusic("_sound_failed"); setTimeout(_showLevelFail, 6000); } private function checkExit(){ var bai:*; if (((GameStart) && (think_exit.visible))){ exit_time++; bai = ((exit_time / (30 * 15)) * 100); think_exit.timebar.bar.x = ((think_exit.timebar.bar.width / -100) * bai); if (exit_time > (30 * 15)){ if (userData.level_current == 14){ TweenMax.to(this, 0.5, {hair_current:0}); }; char.visible = false; mania.gotoAndStop("moden2"); showLevelFail(); try { _tool.dis(); } catch(err) { }; }; }; } private function checkMouse(){ var _local1:Number; var _local2:Number; var _local3:*; var _local4:*; _local1 = mouseX; _local2 = 0; if (_local1 < 0){ _local1 = 0; }; if (_local1 > 680){ _local1 = 680; }; mouseLast = [_local1, mouseY]; if ((((((((mouseDown_tool == 0)) && (GameStart))) && (!(spaceTime)))) && ((mouseY > 457)))){ _local3 = false; if ((((_local1 < 55)) && ((toolLoader.x < 0)))){ _local2 = (((55 - _local1) / 55) * 15); if (mouseDown){ _local2 = (_local2 + 18); }; toolLoader.x = (toolLoader.x + _local2); }; if (_local1 < 55){ _local3 = true; hand.scaleX = 1; }; if ((((_local1 > 625)) && ((toolLoader.x > (((toolLoader.width * -1) + 680) - 130))))){ _local2 = (((_local1 - 625) / 55) * 15); if (mouseDown){ _local2 = (_local2 + 18); }; toolLoader.x = (toolLoader.x - _local2); }; if (_local1 > 625){ _local3 = true; hand.scaleX = -1; }; if (_local3){ if (!hand.visible){ hand.visible = true; Mouse.hide(); }; } else { if (hand.visible){ Mouse.show(); hand.visible = false; }; }; hand.x = mouseX; hand.y = mouseY; for each (_local4 in toolList) { if (((((_local4[5].x + toolLoader.x) < (55 + 10))) || (((_local4[5].x + toolLoader.x) > (623 - 10))))){ if (_local4[5].visible){ _local4[5].visible = false; }; } else { if (!_local4[5].visible){ _local4[5].visible = true; }; }; }; } else { if (hand.visible){ Mouse.show(); hand.visible = false; }; }; } private function _Press_fack_tool(_arg1:gameEvent){ soundCtrl.playGouGou("_gougou_jiao"); dog.setmoden("cry"); } private function _onEnterFrame(_arg1:Event){ checkExit(); checkHair(); checkPowerBar(); checkMouse(); bollx = ball.x; bolly = ball.y; } private function ToolShow(){ var _local1:*; _local1 = 0; while (_local1 < toolList.length) { if ((((_local1 >= toolCurrent)) && ((_local1 < (toolCurrent + toolLimit))))){ toolList[_local1][5].visible = true; } else { toolList[_local1][5].visible = false; }; _local1++; }; if (mouseDown_tool == 1){ if (toolCurrent > 0){ toolList[((toolCurrent + toolLimit) - 1)][2].visible = true; TweenMax.to(toolList[((toolCurrent + toolLimit) - 1)][2], 0.15, {alpha:0}); toolCurrent--; toolList[toolCurrent][2].visible = true; toolList[toolCurrent][2].alpha = 0; TweenMax.to(toolList[toolCurrent][2], 0.15, {alpha:1}); TweenMax.to(toolLoader, 0.15, {x:((-(toolCurrent) * toolWidht) + toolStation), onComplete:ToolShow}); }; }; if (mouseDown_tool == 2){ if (toolCurrent < (toolList.length - toolLimit)){ toolList[(toolCurrent + toolLimit)][2].alpha = 0; toolList[(toolCurrent + toolLimit)][2].visible = true; TweenMax.to(toolList[(toolCurrent + toolLimit)][2], 0.15, {alpha:1}); TweenMax.to(toolList[toolCurrent][2], 0.15, {alpha:0}); toolCurrent++; TweenMax.to(toolLoader, 0.15, {x:((-(toolCurrent) * toolWidht) + toolStation), onComplete:ToolShow}); }; }; } private function show_toolIntro(_arg1:gameEvent){ mania.gotoAndStop("moden1"); toolIntro.gotoAndStop((_arg1.tool_moden + 1)); mouseDown_tool = 1; _tool = _arg1.target; tool_moden = _arg1.tool_moden; tool_id = _arg1.tool_id; } private function clearExit(){ clearInterval(id_exit); if (GameStart){ id_exit = setInterval(showExit, (1000 * (35 - userData.level_current))); }; } private function _onMouseOut(_arg1:MouseEvent){ TweenMax.to(_arg1.target, 0.1, {colorMatrixFilter:{}}); } private function pauseEnd(){ TweenMax.killAllTweens(true); soundCtrl.paused(true); } public function init(){ var _local1:Array; var _local2:*; var _local3:int; var _local4:*; mouseDown = false; clock.visible = false; clock.gotoAndStop(1); 椅子.y = 0; bg.y = 0; char.y = 0; tool_used = []; tool_target.text = ((userData.data[userData.level_current][3] + "/") + userData.getToolUnlockedNum()); tool_used_text.text = ("0/" + userData.getToolUnlockedNum()); tool_effecting = false; char.visible = true; exit_time = 0; think_exit.visible = false; think_exit.gotoAndStop(1); hair_current = 1; obj = this; mouseLast = []; _language = (Number(language.language_nr) - 1); GameStart = false; spaceTime = false; toolList = []; userData.randomStation(); _local1 = []; _local2 = 0; while (_local2 < userData.tool_station.length) { _local1[_local2] = userData.toolList[userData.tool_station[_local2]]; _local2++; }; _local3 = 0; while (_local3 < _local1.length) { _local4 = _local1[_local3]; if (_local4[6]){ toolList.unshift(_local4); } else { toolList.push(_local4); }; _local3++; }; setTimeout(setBall, 500); char.yanzhao.visible = false; char.shoukao.visible = false; bt_games.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); hand.visible = false; addChild(hand); buildMap(); stage.addEventListener(MouseEvent.MOUSE_DOWN, _down); stage.addEventListener(MouseEvent.MOUSE_UP, _up); } private function _onUnload(_arg1:Event){ var _local2:*; var _local3:*; var _local4:*; clock.stop(); clearInterval(id_exit); clearInterval(id_time); stage.removeEventListener(MouseEvent.MOUSE_DOWN, _down); stage.removeEventListener(MouseEvent.MOUSE_UP, _up); this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); _local2 = (numChildren - 1); while (_local2 > -1) { _local3 = getChildAt(_local2); if ((((_local3 is MovieClip)) || ((_local3 is Sprite)))){ _local4 = (_local3.numChildren - 1); while (_local4 > -1) { _local3.removeChildAt(_local4); _local4--; }; }; removeChildAt(_local2); _local2--; }; } private function newToolUsed(){ var _local1:Boolean; var _local2:*; _local1 = true; _local2 = 0; while (_local2 < tool_used.length) { if (tool_used[_local2] == tool_id){ _local1 = false; }; _local2++; }; if (_local1){ tool_used.push(tool_id); }; tool_used_text.text = ((tool_used.length + "/") + userData.getToolUnlockedNum()); } private function _up(_arg1:MouseEvent){ mouseDown = false; } private function _Release_fack_tool(_arg1:gameEvent){ soundCtrl.stopGouGou("_gougou_jiao"); dog.setmoden("walk"); } private function _levelinfodis(_arg1:gameEvent){ GameStart = true; clearExit(); } private function checkHair(){ var f:int; if (GameStart){ if (hair_current > 1){ hair_current = (hair_current - (0.025 - (userData.level_current / 1200))); }; }; f = 0; try { f = char.char.hair.currentFrame; } catch(err) { }; if (f == 1){ try { char.char.hair.hair.gotoAndStop(int(hair_current)); } catch(err) { }; if (userData.level_current == 14){ char.y = ((1200 / 100) * int(hair_current)); 椅子.y = char.y; bg.y = char.y; }; }; } private function dis_toolIntro(_arg1:gameEvent){ var _local2:Number; var _local3:Number; mania.gotoAndStop("moden0"); toolIntro.gotoAndStop(1); tool_id = _arg1.tool_id; _local2 = getL(mouseX, mouseY, ball.x, ball.y); _local3 = 100; if (_arg1.tool_id > 23){ _local3 = 250; }; _tool = tool(_arg1.target); if ((((_arg1.tool_moden == 5)) && ((_local2 < _local3)))){ if (_arg1.tool_id == 0){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 1){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = ((ball.y - toolLoader.y) - 30); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 2){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = ((ball.y - toolLoader.y) - 20); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 3){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 4){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 5){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 6){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 7){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 8){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 10){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = ((ball.y - toolLoader.y) - 20); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 15){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 18){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 20){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = (ball.y - toolLoader.y); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 23){ _arg1.target.x = ((toolLoader.x * -1) + ball.x); _arg1.target.y = ((ball.y - toolLoader.y) - 20); _arg1.target.mc.gotoAndStop(3); spaceTime = true; addChild(spaceTishi); spaceTishi.init(); spaceTishi.addEventListener(gameEvent.timeBar_timeout, _timeout); tool_effecting = true; }; if (_arg1.tool_id == 24){ newToolUsed(); _arg1.target.dis(); char_clear(); char.char.arm.gotoAndStop("moden1"); char.char.face.gotoAndStop("moden4"); clearTimeout(id_setTimeout); id_setTimeout = setTimeout(char_clear, (1000 * 5)); soundCtrl.playEffect("_sound24_kafei"); }; if (_arg1.tool_id == 25){ newToolUsed(); _arg1.target.dis(); char_clear(); char.char.arm.gotoAndStop("moden2"); char.char.face.gotoAndStop("moden5"); clearTimeout(id_setTimeout); id_setTimeout = setTimeout(char_clear, (1000 * 10)); soundCtrl.playEffect("_sound25_zazhi"); }; if (_arg1.tool_id == 26){ newToolUsed(); _arg1.target.dis(); char_clear(); char.char.arm.gotoAndStop("moden0"); char.char.face.gotoAndStop("moden6"); clearTimeout(id_setTimeout); id_setTimeout = setTimeout(char_clear, (1000 * 10)); }; if (_arg1.tool_id == 27){ newToolUsed(); _arg1.target.dis(); char_clear(); char.yanzhao.visible = true; char.char.arm.gotoAndStop("moden0"); clearTimeout(id_setTimeout); id_setTimeout = setTimeout(char_clear, (1000 * 12)); }; if (_arg1.tool_id == 28){ newToolUsed(); _arg1.target.dis(); char_clear(); char.shoukao.visible = true; char.char.arm.gotoAndStop("moden0"); clearTimeout(id_setTimeout); id_setTimeout = setTimeout(char_clear, (1000 * 13)); soundCtrl.playEffect("_sound28_shoukao"); }; } else { _arg1.target.back(); }; } public function goto(_arg1){ var _local2:gameEvent; _local2 = new gameEvent(gameEvent.GOTO); if (_arg1 == "mailsend"){ _local2.BackTo = "intro"; }; _local2.to = _arg1; dispatchEvent(_local2); } private function showTime(){ var _local1:String; if ((((time < 20)) && (!(clock.visible)))){ clock.visible = true; clock.play(); }; _local1 = String((time % 60)); if (_local1.length <= 1){ _local1 = ("0" + _local1); }; time_txt.text = ((int((time / 60)) + ":") + _local1); } private function GameComplete(){ try { _tool.dis(); } catch(err) { }; char.char.face.gotoAndStop("moden1"); char.char.hair.gotoAndStop("moden1"); if (userData.level_current < 14){ soundCtrl.playMusic("_sound_complete"); }; addChild(levecompleteshow); levecompleteshow.gotoAndPlay(2); think_exit.visible = false; think_exit.gotoAndStop(1); setTimeout(gameEnd, 3300); clearInterval(id_exit); } private function _disHowtoplay(_arg1:gameEvent){ TweenMax.to(howtoplay, 0.45, {y:600, onComplete:disHowtoplay, ease:Back.easeIn}); } private function enterFrame(){ if (GameStart){ time--; if (time == 0){ GameStart = false; showLevelFail(); }; showTime(); }; } private function _mouseDown(_arg1:MouseEvent){ var _local2:*; _local2 = new gameEvent(gameEvent.url_game_more); dispatchEvent(_local2); } private function _down(_arg1:MouseEvent){ mouseDown = true; } private function gameEnd(){ var _local1:Array; var _local2:String; var _local3:Sprite; var _local4:*; var _local5:*; removeChild(levecompleteshow); if (userData.level_current == userData.level){ userData.level++; }; userData.level_current++; _local1 = userData.unlockTool(); if (_local1.length > 0){ addChild(unlocknewtool); _local2 = ""; if (_local1.length > 1){ _local2 = Translate.You_unlocked_x_new_tools[language.language_nr]; } else { _local2 = Translate.You_unlocked_x_new_tool[language.language_nr]; }; unlocknewtool.txt.text = String(_local2.replace(/xxx/, ((" " + String(_local1.length)) + " "))); unlocknewtool.bt0.addEventListener(myButtonEvent.Button_Click, _disUnlockNewTool); unlocknewtool.bt0.moden = 1; unlocknewtool.alpha = 0; TweenMax.to(unlocknewtool, 0.2, {alpha:1}); _local3 = new Sprite(); _local4 = 0; while (_local4 < _local1.length) { _local5 = new tool(); unlocknewtool.addChild(_local3); _local3.addChild(_local5); _local5.gotoAndStop(userData.toolList[_local1[_local4]][0]); _local5._mc.visible = false; _local5.lock.visible = false; _local5.alpha = 0; _local5.x = (_local4 * 80); TweenMax.to(_local5, 0.2, {delay:((_local4 * 0.5) + 0.8), alpha:1}); _local4++; }; _local3.x = ((680 / 2) - ((_local1.length - 1) * 40)); _local3.y = ((550 / 2) - 5); } else { clock.stop(); if (userData.level < 15){ char_clear(); addChild(levelcomplete); levelcomplete.init(); userData.saveData(); } else { char_clear(); addChild(levelcompleteend); levelcompleteend.gotoAndPlay(3); userData.saveData(); }; }; } private function setBall(){ ball.x = (char.fanwei.x - 10); ball.y = (char.fanwei.y - 20); mania.x = (char.fanwei.x - 10); mania.y = (char.fanwei.y - 20); char.yanzhao.visible = false; char.shoukao.visible = false; } private function disHowtoplay(){ removeChild(howtoplay); showLevelInfo(); } public function _showTool(){ var _local1:int; var _local2:*; var _local3:*; var _local4:*; _local1 = toolLoader.numChildren; _local2 = (_local1 - 1); while (_local2 > -1) { toolLoader.removeChildAt(_local3); _local2--; }; _local3 = 0; while (_local3 < toolList.length) { _local4 = new tool(); _local4.addEventListener(gameEvent.Show_tool_intro, show_toolIntro); _local4.addEventListener(gameEvent.Dis_tool_intro, dis_toolIntro); _local4.addEventListener(gameEvent.Press_fack_tool, _Press_fack_tool); _local4.addEventListener(gameEvent.Release_fack_tool, _Release_fack_tool); _local4.buttonMode = true; _local4.id = _local3; toolLoader.addChild(_local4); _local4.x = ((_local3 * toolWidht) + 100); _local4.gotoAndStop(toolList[_local3][0]); _local4.moden = toolList[_local3][2]; _local4.type = toolList[_local3][4]; _local4.addEventListener(gameEvent.TOOL_MOVE, tool_move); toolList[_local3][5] = _local4; _local4.init(); if (toolList[_local3][0] != 30){ _local4._mc.visible = false; }; if (toolList[_local3][6]){ _local4.lock.visible = false; TweenMax.to(_local4, 0.2, {colorMatrixFilter:{}}); } else { _local4.lock.visible = true; TweenMax.to(_local4, 0.2, {colorMatrixFilter:{colorize:0xFFFFFF}}); }; _local3++; }; } private function _onClick(_arg1:myButtonEvent){ if (_arg1.target.name == "bt_sound"){ if ((bt_sound.currentFrame == 1)){ bt_sound.gotoAndStop(2); } else { bt_sound.gotoAndStop(1); }; if ((bt_sound.currentFrame == 1)){ soundCtrl.soundOff = false; } else { soundCtrl.soundOff = true; }; }; if (_arg1.target.name == "bt_paused"){ pause = new Pause(); addChild(pause); pause.init(); pause.y = -130; TweenMax.to(pause, 0.35, {y:0, ease:Back.easeOut, onComplete:pauseEnd}); }; } private function Show_toolEffect(_arg1){ __tool.gotoAndPlay(2); setTimeout(Dis_toolEffect, 1000); } private function Dis_toolEffect(){ TweenMax.to(__tool, 0.6, {y:-50, onComplete:Remove_toolEffect}); } private function getL(_arg1, _arg2, _arg3, _arg4){ return (Math.sqrt((((_arg3 - _arg1) * (_arg3 - _arg1)) + ((_arg4 - _arg2) * (_arg4 - _arg2))))); } private function hairDown_end(){ if (tool_id == 19){ char.char.hair.gotoAndStop("moden5"); } else { if (tool_id == 21){ char.char.hair.gotoAndStop("moden3"); } else { char.char.hair.gotoAndStop("moden4"); }; }; char.char.face.gotoAndStop("moden2"); mania.gotoAndStop("moden2"); showLevelFail(); } private function _mouseDown_tool_lr(_arg1:MouseEvent){ if (_arg1.target.name == "tool_l"){ if (toolCurrent > 0){ toolList[((toolCurrent + toolLimit) - 1)][2].visible = true; TweenMax.to(toolList[((toolCurrent + toolLimit) - 1)][2], 0.15, {alpha:0}); toolCurrent--; toolList[toolCurrent][2].visible = true; toolList[toolCurrent][2].alpha = 0; TweenMax.to(toolList[toolCurrent][2], 0.15, {alpha:1}); TweenMax.to(toolLoader, 0.15, {x:((-(toolCurrent) * toolWidht) + toolStation), onComplete:ToolShow}); }; }; if (_arg1.target.name == "tool_r"){ if (toolCurrent < (toolList.length - toolLimit)){ toolList[(toolCurrent + toolLimit)][2].alpha = 0; toolList[(toolCurrent + toolLimit)][2].visible = true; TweenMax.to(toolList[(toolCurrent + toolLimit)][2], 0.15, {alpha:1}); TweenMax.to(toolList[toolCurrent][2], 0.15, {alpha:0}); toolCurrent++; TweenMax.to(toolLoader, 0.15, {x:((-(toolCurrent) * toolWidht) + toolStation), onComplete:ToolShow}); }; }; } private function showExit(){ if (((GameStart) && (!(think_exit.visible)))){ try { think_exit.visible = true; think_exit.gotoAndPlay(2); } catch(err) { }; if (char.char.face.currentFrame == 1){ char.char.face.gotoAndStop("moden2"); }; }; } private function showLevelInfo(){ clock.stop(); addChild(levelinfo); levelinfo.init(); levelinfo.addEventListener(gameEvent.GOTO, _levelinfodis); } private function _disUnlockNewTool(_arg1:myButtonEvent){ char_clear(); TweenMax.killAll(true); removeChild(unlocknewtool); addChild(levelcomplete); levelcomplete.init(); } private function Remove_toolEffect(){ removeChild(__tool); tool_effecting = false; } public static function showTool(){ if (main._where == "game"){ obj._showTool(); }; } } }//package lib
Section 247
//gameEvent (lib.gameEvent) package lib { import flash.net.*; import flash.events.*; import spill.localisation.*; public class gameEvent extends Event { public var tool_move_to:int; public var to:String; public var tool_moden:int; public var gesture_match:String; public var Button_name:String;// = "" public var Select:int; public var BackTo:String; public var tool_id:int; public var difficulty:int; public static var url_spilgame:String = "url_spilgame"; public static var GESTURE_MATCH:String = "GESTURE_MATCH"; public static var GESTURE_MATCH_C:String = "GESTURE_MATCH_C"; public static var TOOL_MOVE:String = "TOOL_MOVE"; public static var url_gamecomplete_more:String = "url_gamecomplete_more"; public static var Release_fack_tool:String = "Release_fack_tool"; public static var GESTURE_MATCH_TB:String = "GESTURE_MATCH_TB"; public static var url_sendtofriend_more:String = "url_sendtofriend_more"; public static var url_levelfail_more:String = "url_levelfail_more"; public static var timeBar_timeout:String = "timeBar_timeout"; public static var url_game_more:String = "url_game_more"; public static var GESTURE_MATCH_LR:String = "GESTURE_MATCH_LR"; public static var url_highscore_china:String = "url_highscore_china"; public static var Button_Click:String = "Button_Click"; public static var url_wallofhair_more:String = "url_wallofhair_more"; public static var url_level_target_more:String = "url_level_target_more"; public static var url_loading_more:String = "url_loading_more"; public static var url_main_more:String = "url_main_more"; public static var url_highscore_more:String = "url_highscore_more"; public static var url_pause_more:String = "url_pause_more"; public static var url_protection:String = "url_protection"; public static var Press_fack_tool:String = "Press_fack_tool"; public static var GOTO:String = "GOTO"; public static var url_howtoplay_more:String = "url_howtoplay_more"; public static var Show_tool_intro:String = "Show_tool_intro"; public static var url_levelcomplete_more:String = "url_levelcomplete_more"; public static var Dis_tool_intro:String = "Dis_tool_intro"; public function gameEvent(_arg1:String){ Button_name = ""; super(_arg1); checkUrl(_arg1); } private function checkUrl(_arg1){ var _local2:String; var _local3:URLRequest; if (_arg1 == url_spilgame){ _local2 = "http://www.gameportal.net/"; _local3 = new URLRequest(_local2); navigateToURL(_local3, "_blank"); }; if (_arg1 == url_loading_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_loading_moregames")), "_blank"); }; if (_arg1 == url_game_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_ingameing_moregames")), "_blank"); }; if (_arg1 == url_wallofhair_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_wallofhair_moregames")), "_blank"); }; if (_arg1 == url_level_target_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_leveltarget_moregames")), "_blank"); }; if (_arg1 == url_main_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_mainscreen_moregames")), "_blank"); }; if (_arg1 == url_highscore_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_highscore_moregames")), "_blank"); }; if (_arg1 == url_pause_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_pause_moregames")), "_blank"); }; if (_arg1 == url_sendtofriend_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_sendtofriend_moregames")), "_blank"); }; if (_arg1 == url_levelfail_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_levelfail_moregames")), "_blank"); }; if (_arg1 == url_levelcomplete_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_levelcomplete_moregames")), "_blank"); }; if (_arg1 == url_gamecomplete_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_gamecomplete_moregames")), "_blank"); }; if (_arg1 == url_howtoplay_more){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("button_howtoplay_moregames")), "_blank"); }; if (_arg1 == url_highscore_china){ _local3 = new URLRequest(("http://user.game.com.cn/game/?action=highscore&ID=" + Random.gameID)); navigateToURL(_local3, "_blank"); }; if (_arg1 == url_protection){ if (language.language_nr == 2){ navigateToURL(new URLRequest(SpilGame.getMoreGamesLink("site_locked_game")), "_blank"); }; }; } } }//package lib
Section 248
//Highscore (lib.Highscore) package lib { import flash.display.*; import gs.easing.*; public class Highscore extends MovieClip { public var loader:MovieClip; public var bt0:按钮_MAINMENU; public var bt1:按钮_moregame; public var target:String; public function Highscore(){ bt0.moden = 1; bt0.addEventListener(myButtonEvent.Button_Click, _onClick); bt1.moden = 1; bt1.addEventListener(myButtonEvent.Button_Click, _onClick); } public function init(){ soundCtrl.playMusic("_sound_mainscreen"); loader.addChild(main.dd); } private function _onClick(_arg1:myButtonEvent){ var _local2:gameEvent; if (_arg1.target.name == "bt0"){ _local2 = new gameEvent(gameEvent.GOTO); _local2.to = "intro"; dispatchEvent(_local2); }; if (_arg1.target.name == "bt1"){ _local2 = new gameEvent(gameEvent.url_highscore_more); dispatchEvent(_local2); }; } } }//package lib
Section 249
//HowToPlay (lib.HowToPlay) package lib { import flash.events.*; import flash.display.*; import gs.easing.*; public class HowToPlay extends MovieClip { public var bt0:SimpleButton; public var bt_more:按钮_moregame; public var bt1:SimpleButton; public var bt2:SimpleButton; public var bg:MovieClip; private var f:int; public var target:String; public var mc:MovieClip; private var x1:Number; public var bt_back:按钮_返回; public function HowToPlay(){ x1 = mc.x; f = 1; mc.gotoAndStop(1); bt0.addEventListener(MouseEvent.MOUSE_UP, _onClick); bt1.addEventListener(MouseEvent.MOUSE_UP, _onClick); bt2.addEventListener(MouseEvent.MOUSE_UP, _onClick); bt_back.moden = 2; bt_back.addEventListener(MouseEvent.MOUSE_UP, _onClick); bt_more.moden = 1; bt_more.addEventListener(MouseEvent.MOUSE_UP, _onClick); } public function init(){ showButton(); mc.gotoAndStop(1); } private function showButton(){ if ((((target == "intro")) || ((target == null)))){ bt0.visible = false; } else { bt0.visible = true; }; if (target == "game"){ bt_back.visible = false; }; bt1.visible = true; bt2.visible = true; if (f == 1){ bt1.visible = false; }; if (f == 3){ bt2.visible = false; }; } private function _onClick(_arg1:MouseEvent){ var _local2:gameEvent; var _local3:*; if (_arg1.target.name == "bt_more"){ _local3 = new gameEvent(gameEvent.url_howtoplay_more); dispatchEvent(_local3); }; if (_arg1.target.name == "bt2"){ if (f < 3){ f++; }; mc.gotoAndStop(f); }; if (_arg1.target.name == "bt1"){ if (f > 0){ f--; }; mc.gotoAndStop(f); }; showButton(); if ((((_arg1.target.name == "bt0")) || ((_arg1.target.name == "bt_back")))){ _local2 = new gameEvent(gameEvent.GOTO); _local2.to = target; dispatchEvent(_local2); }; } } }//package lib
Section 250
//Intro (lib.Intro) package lib { import flash.events.*; import flash.display.*; import spill.localisation.*; import gs.*; import gs.easing.*; public class Intro extends MovieClip { public var bt12:按钮_huge_hair; public var loader:MovieClip; public var bt0:按钮_startgame; public var bt4:按钮_moregame; public var bt1:按钮_howtoplay; public var bt3:按钮_wallofhair; public var bt2:按钮_highScore; public var bt13:按钮_back; private var wallofhairfame:Wallofhairfame; public var gameportal:SimpleButton; public var __id4_:LanguageSelectBox; public var bt10:按钮_Big_hair; public var bt11:按钮_Great_hair; public static var obj; public function Intro(){ addFrameScript(0, frame1, 32, frame33, 45, frame46, 46, frame47, 77, frame78); __setProp___id4___1(); } function __setProp___id4___1(){ try { __id4_["componentInspectorSetting"] = true; } catch(e:Error) { }; __id4_.popupLocation = "bottom"; try { __id4_["componentInspectorSetting"] = false; } catch(e:Error) { }; } function frame78(){ prevFrame(); } public function init(){ obj = this; soundCtrl.playMusic("_sound_mainscreen"); gotoAndPlay(2); gameportal.addEventListener(MouseEvent.MOUSE_DOWN, _onClick_spill); } private function _onClick_spill(_arg1:MouseEvent){ var _local2:gameEvent; _local2 = new gameEvent(gameEvent.url_spilgame); dispatchEvent(_local2); } function frame1(){ stop(); } private function init_chooleLevel(){ var _local1:int; var _local2:*; _local1 = 10; while (_local1 < 14) { _local2 = this[("bt" + _local1)]; _local2.moden = 1; _local2.alpha = 0; _local2.y = (_local2.y - 10); TweenMax.to(_local2, 0.25, {delay:(0.12 * (_local1 - 10)), y:(_local2.y + 10), alpha:1, ease:Back.easeOut}); if (_local1 == 11){ if (userData.level >= 5){ _local2.locked = false; _local2.lock.visible = false; } else { _local2.locked = true; _local2.lock.visible = true; }; }; if (_local1 == 12){ if (userData.level >= 10){ _local2.locked = false; _local2.lock.visible = false; } else { _local2.locked = true; _local2.lock.visible = true; }; }; _local2.addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; }; } function frame33(){ init_navigate(); } function frame47(){ init_chooleLevel(); } private function _onClick(_arg1:myButtonEvent){ var _local2:gameEvent; switch (_arg1.Button_name){ case "bt0": gotoAndPlay("chooselevel"); break; case "bt1": _local2 = new gameEvent(gameEvent.GOTO); _local2.to = "howtoplay"; dispatchEvent(_local2); break; case "bt2": if (Number(language.language_nr) != 2){ if (main.dd.O11111100()){ _local2 = new gameEvent(gameEvent.GOTO); _local2.to = "highscore"; dispatchEvent(_local2); } else { loader.addChild(main.dd); }; } else { _local2 = new gameEvent(gameEvent.url_highscore_china); dispatchEvent(_local2); }; break; case "bt3": wallofhairfame = new Wallofhairfame(); addChild(wallofhairfame); wallofhairfame.init(); break; case "bt4": _local2 = new gameEvent(gameEvent.url_main_more); dispatchEvent(_local2); break; case "bt10": case "bt11": case "bt12": _local2 = new gameEvent(gameEvent.GOTO); soundCtrl.playMusic("_sound_story"); if (userData.level == 0){ _local2.to = "story"; } else { _local2.to = "warning"; }; userData.level_current = -1; if (_arg1.Button_name == "bt10"){ _local2.difficulty = 0; dispatchEvent(_local2); }; if ((((_arg1.Button_name == "bt11")) && (!(_arg1.target.lock.visible)))){ _local2.difficulty = 1; dispatchEvent(_local2); }; if ((((_arg1.Button_name == "bt12")) && (!(_arg1.target.lock.visible)))){ _local2.difficulty = 2; dispatchEvent(_local2); }; break; case "bt13": gotoAndPlay(31); break; default: break; }; } function frame46(){ prevFrame(); } public function init_navigate(){ var _local1:int; var _local2:*; _local1 = 0; while (_local1 < 5) { _local2 = this[("bt" + _local1)]; _local2.moden = 1; _local2.alpha = 0; _local2.y = (_local2.y - 10); TweenMax.to(_local2, 0.25, {delay:(0.12 * _local1), y:(_local2.y + 10), alpha:1, ease:Back.easeOut}); _local2.addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; }; } public static function showtext(_arg1){ } } }//package lib
Section 251
//LevelComplete (lib.LevelComplete) package lib { import flash.display.*; import gs.*; import flash.utils.*; import gs.easing.*; public class LevelComplete extends MovieClip { private var id; private var s1; private var s0; private var s2; public var bg:MovieClip; private var mc1; public var plane:MovieClip; private var mc0; private var mc2:Object; private var frame:int; private var id_badge:int; public var char0:MovieClip; public var char1:MovieClip; public var showbadge:showBadgeunlock; private var unlockBadge:Array; private var badge_num; public function LevelComplete(){ var _local1:*; super(); mc0 = {}; mc1 = {}; mc2 = {}; mc0.x = plane.x; mc0.y = plane.y; mc1.x = char0.x; mc1.y = char0.y; mc2.x = char1.x; mc2.y = char1.y; _local1 = 0; while (_local1 < 3) { plane[("bt" + _local1)].moden = 1; plane[("bt" + _local1)].addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; }; } public function init(){ var _local1:*; var _local2:*; if (((!(main._tracker_level7)) && ((userData.level_current == 7)))){ trace("第7关完成"); main._tracker_level7 = true; main._tracker.trackEvent("hair mania", "Level 7 complete", "per session", 0); }; unlockBadge = []; _local1 = 0; while (_local1 < Game.tool_used.length) { if (userData.tool_used[Game.tool_used[_local1]] != -1){ var _local3 = userData.tool_used; var _local4 = Game.tool_used[_local1]; var _local5 = (_local3[_local4] + 1); _local3[_local4] = _local5; }; _local1++; }; unlockBadge = userData.unlockBadge(); if (unlockBadge.length > 0){ badge_num = 0; showbadge.setShow(unlockBadge[badge_num]); showbadge.gotoAndPlay(2); id_badge = setTimeout(nextBadge, 3000); } else { showbadge.gotoAndStop(1); }; y = 0; bg.alpha = 0; char0.alpha = 0; char1.alpha = 0; plane.alpha = 0; plane.txt0.text = ""; plane.txt1.text = ""; plane.txt2.text = ""; s0 = 10000; _local2 = 0; while (_local2 < userData.level_current) { s0 = (s0 * 1.05); _local2++; }; s0 = int(s0); s1 = int((Game.time * 10)); s2 = int(((userData.score + s0) + s1)); plane.txt.gotoAndStop((int((Math.random() * plane.txt.totalFrames)) + 1)); TweenMax.to(bg, 0.5, {alpha:1, onComplete:showchar}); frame = 1; id = setTimeout(showScore, 800); } private function levelmap(){ MovieClip(parent).goto("levelmap"); } private function nextBadge(){ badge_num++; if (badge_num < unlockBadge.length){ showbadge.setShow(unlockBadge[badge_num]); showbadge.gotoAndPlay(2); id_badge = setTimeout(nextBadge, 3000); } else { showbadge.gotoAndStop(1); }; } private function showScore(){ frame++; plane.gotoAndStop(frame); if (frame == 2){ plane.txt0.text = String(s0); id = setTimeout(showScore, 500); }; if (frame == 3){ plane.txt1.text = String(s1); id = setTimeout(showScore, 500); }; if (frame == 4){ plane.txt2.text = String(s2); userData.saveScore(s2); }; } private function _onClick(_arg1:myButtonEvent){ var _local2:*; if (_arg1.target.name == "bt0"){ soundCtrl.playMusic("_sound_story"); TweenMax.to(this, 0.5, {y:900, onComplete:levelmap, ease:Back.easeIn}); clearTimeout(id); }; if (_arg1.target.name == "bt1"){ addChild(main.mailsend); main.mailsend.init(); }; if (_arg1.target.name == "bt2"){ _local2 = new gameEvent(gameEvent.url_levelcomplete_more); dispatchEvent(_local2); }; } private function showchar(){ char0.alpha = 1; char1.alpha = 1; plane.alpha = 1; char0.x = (mc1.x - 50); char1.x = (mc2.x - 50); plane.x = (mc0.x + 100); TweenMax.to(char0, 0.5, {x:mc1.x, ease:Back.easeOut}); TweenMax.to(char1, 0.5, {x:mc2.x, ease:Back.easeOut}); TweenMax.to(plane, 0.5, {x:mc0.x, ease:Back.easeOut}); } } }//package lib
Section 252
//LevelCompleteEnd (lib.LevelCompleteEnd) package lib { import flash.display.*; import spill.localisation.*; import gs.*; import flash.utils.*; import gs.easing.*; import flash.external.*; public class LevelCompleteEnd extends MovieClip { private var s1; private var s0; private var s2; public var bg:MovieClip; private var mc1; public var plane:MovieClip; private var mc0; private var mc2:Object; private var id_badge:int; public var char0:MovieClip; public var char1:MovieClip; private var wallofhairfame:Wallofhairfame; public var showbadge:showBadgeunlock; private var unlockBadge:Array; private var badge_num; public function LevelCompleteEnd(){ addFrameScript(0, frame1, 1, frame2, 3, frame4, 108, frame109, 116, frame117); } private function showchar(){ char0.alpha = 1; char1.alpha = 1; plane.alpha = 1; char0.x = (mc1.x - 50); char1.x = (mc2.x - 50); plane.x = (mc0.x + 100); TweenMax.to(char0, 0.3, {x:mc1.x, ease:Back.easeOut}); TweenMax.to(char1, 0.3, {x:mc2.x, ease:Back.easeOut}); TweenMax.to(plane, 0.3, {x:mc0.x, ease:Back.easeOut}); } public function init(){ var _local1:*; mc0 = {}; mc1 = {}; mc2 = {}; mc0.x = plane.x; mc0.y = plane.y; mc1.x = char0.x; mc1.y = char0.y; mc2.x = char1.x; mc2.y = char1.y; _local1 = 0; while (_local1 < 6) { plane[("bt" + _local1)].moden = 1; plane[("bt" + _local1)].addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; }; plane.score.text = userData.score; plane.username.text = userData.T_username[(language.language_nr - 1)]; char0.alpha = 0; char1.alpha = 0; plane.alpha = 0; char0.x = mc1.x; char0.y = mc1.y; char1.x = mc2.x; char1.y = mc2.y; plane.x = mc0.x; plane.y = mc0.y; s0 = 10000; _local1 = 0; while (_local1 < userData.level_current) { s0 = (s0 * 1.05); _local1++; }; s0 = int(s0); s1 = int((Game.time * 10)); s2 = int(((userData.score + s0) + s1)); plane.score.text = String(s2); showchar(); if (!main._tracker_game_complete){ main._tracker_game_complete = true; main._tracker.trackEvent("hair mania", "Game complete", "per session", 0); }; } function frame109(){ init_2(); } private function nextBadge(){ badge_num++; if (badge_num < unlockBadge.length){ showbadge.setShow(unlockBadge[badge_num]); showbadge.gotoAndPlay(2); id_badge = setTimeout(nextBadge, 3000); } else { play(); showbadge.gotoAndStop(1); }; } function frame4(){ init_3(); } function frame1(){ stop(); } function frame117(){ init(); stop(); } private function regame(){ MovieClip(parent).goto("game"); } private function _onClick(_arg1:myButtonEvent){ var _local2:String; var _local3:*; var _local4:*; var _local5:*; var _local6:*; var _local7:*; var _local8:*; var _local9:*; if (_arg1.target.name == "bt0"){ _local2 = plane.username.text; if ((((plane.username.text == userData.T_username[(language.language_nr - 1)])) || ((_local2.replace(/ /g, "").length == 0)))){ plane.err.play(); } else { if (language.language_nr != 2){ if (main.dd.O11111100()){ main.dd.O11111O10(plane.score.text, plane.username.text); MovieClip(parent).goto("highscore"); } else { MovieClip(parent).loader.addChild(main.dd); MovieClip(parent).setChildIndex(MovieClip(parent).loader, (MovieClip(parent).numChildren - 1)); }; } else { _local3 = new Date(); _local4 = _local3.getTime(); _local5 = Random.SortT(); _local6 = Random.hex_average((((String(Random.gameID) + plane.score.text) + _local5) + _local4)); Random.DrawLine(_local6, _local5, 10, 10, 15, 15); _local7 = Random.strqq; Random.senturl(plane.score.text, _local5, _local7, _local4); setTimeout(resetPage, 1000); }; }; }; if (_arg1.target.name == "bt1"){ soundCtrl.playMusic("_level_music"); TweenMax.to(char0, 0.8, {y:(mc1.y + 700), ease:Back.easeInOut}); TweenMax.to(char1, 0.8, {y:(mc2.y + 700), ease:Back.easeInOut}); TweenMax.to(plane, 0.8, {y:(mc0.y + 700), ease:Back.easeInOut, onComplete:regame}); }; if (_arg1.target.name == "bt2"){ }; if (_arg1.target.name == "bt3"){ _local8 = new gameEvent(gameEvent.url_gamecomplete_more); dispatchEvent(_local8); }; if (_arg1.target.name == "bt4"){ _local9 = new Wallofhairfame(); MovieClip(root).addChild(_local9); _local9.init(); }; if (_arg1.target.name == "bt5"){ MovieClip(root).addChild(main.mailsend); main.mailsend.init(); }; } public function init_2(){ var _local1:*; unlockBadge = []; _local1 = 0; while (_local1 < Game.tool_used.length) { if (userData.tool_used[Game.tool_used[_local1]] != -1){ var _local2 = userData.tool_used; var _local3 = Game.tool_used[_local1]; var _local4 = (_local2[_local3] + 1); _local2[_local3] = _local4; }; _local1++; }; unlockBadge = userData.unlockBadge(); trace("unlockBadge.length", unlockBadge.length, unlockBadge); if (unlockBadge.length > 0){ badge_num = 0; trace("unlockBadge complete", unlockBadge); showbadge.setShow(unlockBadge[badge_num]); showbadge.gotoAndPlay(2); id_badge = setTimeout(nextBadge, 3000); stop(); } else { showbadge.gotoAndStop(1); }; y = 0; bg.alpha = 0; TweenMax.to(bg, 0.3, {alpha:1}); if (userData.level > 14){ userData.level = 14; userData.level_current = 14; userData.saveData(); }; } private function resetPage(){ ExternalInterface.call("function(){window.location.reload(true);}"); } public function init_3(){ soundCtrl.playMusic("_sound_mainscreen"); } function frame2(){ stop(); } } }//package lib
Section 253
//LevelFail (lib.LevelFail) package lib { import flash.display.*; import gs.*; import flash.utils.*; import gs.easing.*; import flash.external.*; public class LevelFail extends MovieClip { public var bg:MovieClip; private var mc1; public var plane:MovieClip; private var mc0; private var mc2:Object; public var char0:MovieClip; public var char1:MovieClip; public function LevelFail(){ var _local1:*; super(); mc0 = {}; mc1 = {}; mc2 = {}; mc0.x = plane.x; mc0.y = plane.y; mc1.x = char0.x; mc1.y = char0.y; mc2.x = char1.x; mc2.y = char1.y; _local1 = 0; while (_local1 < 4) { plane[("bt" + _local1)].moden = 1; plane[("bt" + _local1)].addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; }; plane.score.text = userData.score; plane.username.text = userData.T_username[(language.language_nr - 1)]; } public function init(){ y = 0; bg.alpha = 0; char0.alpha = 0; char1.alpha = 0; plane.alpha = 0; char0.x = mc1.x; char0.y = mc1.y; char1.x = mc2.x; char1.y = mc2.y; plane.x = mc0.x; plane.y = mc0.y; TweenMax.to(bg, 0.3, {alpha:1, onComplete:showchar}); } private function regame(){ MovieClip(parent).goto("game"); } private function _onClick(_arg1:myButtonEvent){ var _local2:String; var _local3:*; var _local4:*; var _local5:*; var _local6:*; var _local7:*; var _local8:*; if (_arg1.target.name == "bt0"){ _local2 = plane.username.text; if ((((plane.username.text == userData.T_username[(language.language_nr - 1)])) || ((_local2.replace(/ /g, "").length == 0)))){ plane.err.play(); } else { if (language.language_nr != 2){ if (main.dd.O11111100()){ main.dd.O11111O10(plane.score.text, plane.username.text); MovieClip(parent).goto("highscore"); } else { MovieClip(parent).loader.addChild(main.dd); MovieClip(parent).setChildIndex(MovieClip(parent).loader, (MovieClip(parent).numChildren - 1)); }; } else { _local3 = new Date(); _local4 = _local3.getTime(); _local5 = Random.SortT(); _local6 = Random.hex_average((((String(Random.gameID) + plane.score.text) + _local5) + _local4)); Random.DrawLine(_local6, _local5, 10, 10, 15, 15); _local7 = Random.strqq; Random.senturl(plane.score.text, _local5, _local7, _local4); setTimeout(resetPage, 1000); }; }; }; if (_arg1.target.name == "bt1"){ MovieClip(parent).goto("intro"); }; if (_arg1.target.name == "bt2"){ soundCtrl.playMusic("_level_music"); TweenMax.to(char0, 0.8, {y:(mc1.y + 700), ease:Back.easeInOut}); TweenMax.to(char1, 0.8, {y:(mc2.y + 700), ease:Back.easeInOut}); TweenMax.to(plane, 0.8, {y:(mc0.y + 700), ease:Back.easeInOut, onComplete:regame}); }; if (_arg1.target.name == "bt3"){ _local8 = new gameEvent(gameEvent.url_levelfail_more); dispatchEvent(_local8); }; } private function resetPage(){ ExternalInterface.call("function(){window.location.reload(true);}"); } private function showchar(){ plane.txt.gotoAndStop((int((Math.random() * plane.txt.totalFrames)) + 1)); char0.alpha = 1; char1.alpha = 1; plane.alpha = 1; char0.x = (mc1.x - 50); char1.x = (mc2.x - 50); plane.x = (mc0.x + 100); TweenMax.to(char0, 0.3, {x:mc1.x, ease:Back.easeOut}); TweenMax.to(char1, 0.3, {x:mc2.x, ease:Back.easeOut}); TweenMax.to(plane, 0.3, {x:mc0.x, ease:Back.easeOut}); } } }//package lib
Section 254
//LevelInfo (lib.LevelInfo) package lib { import flash.display.*; import flash.text.*; import gs.*; import gs.easing.*; public class LevelInfo extends MovieClip { public var bg:MovieClip; public var txt:TextField; private var _language:int; public var _num:MovieClip; public function LevelInfo(){ addFrameScript(0, frame1, 75, frame76, 100, frame101, 123, frame124, 147, frame148, 186, frame187); } public function init(){ _language = (Number(language.language_nr) - 1); gotoAndPlay(2); txt.text = (((((userData.data[userData.level_current][3] + "/") + userData.getToolUnlockedNum()) + " ") + userData.T_Tools[_language]) + "."); } function frame76(){ soundCtrl.playEffect("_sound_d1"); soundCtrl.playMusic("_level_music"); num(1); } function frame187(){ End(); } function frame1(){ stop(); } function frame101(){ soundCtrl.playEffect("_sound_d1"); num(2); } function frame124(){ soundCtrl.playEffect("_sound_d1"); num(3); } public function num(_arg1:int){ if (_arg1 != 5){ _num.gotoAndStop(_arg1); }; _num.scaleX = 0.1; _num.scaleY = 0.1; TweenMax.to(_num, 0.35, {scaleX:1, scaleY:1, ease:Back.easeOut}); } public function End(){ var e:gameEvent; try { stop(); MovieClip(parent).removeChild(this); } catch(err) { }; e = new gameEvent(gameEvent.GOTO); dispatchEvent(e); } function frame148(){ soundCtrl.playEffect("_sound_d2"); num(5); } } }//package lib
Section 255
//Levelmap (lib.Levelmap) package lib { import flash.events.*; import flash.display.*; import flash.text.*; public class Levelmap extends MovieClip { public var bt_more:按钮_moregame; public var bt:按钮_start; public var bt_back:按钮_back; public var txt1:TextField; public var txt2:TextField; public var img:_choose_相片; public var txt5:TextField; public var txt3:TextField; public var img0:_choose_相片; public var img1:_choose_相片; public var img2:_choose_相片; public var img3:_choose_相片; public var img4:_choose_相片; public var txt4:TextField; public var difficulty:int; public var txt0:TextField; public function Levelmap(){ bt.moden = 1; bt.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); bt_back.moden = 1; bt_back.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); bt_more.moden = 1; bt_more.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); } public function init(){ var _local1:int; var _local2:*; var _local3:int; if (userData.level > 14){ userData.level = 14; userData.saveData(); }; if ((((difficulty == 0)) && ((userData.level_current > 4)))){ difficulty = 1; }; if ((((difficulty == 1)) && ((userData.level_current > 9)))){ difficulty = 2; }; _local1 = 0; this["img"].lock.visible = false; _local2 = (difficulty * 5); while (_local2 < ((difficulty * 5) + 5)) { this[("img" + _local1)].gotoAndStop((_local2 + 1)); if (_local2 <= userData.level){ this[("img" + _local1)].lock.visible = false; this[("img" + _local1)].buttonMode = true; } else { this[("img" + _local1)].lock.visible = true; this[("img" + _local1)].buttonMode = false; }; this[("img" + _local1)].addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; _local2++; }; _local3 = 0; if (userData.level_current == -1){ if (difficulty == 0){ if (userData.level > 4){ _local3 = 4; } else { _local3 = userData.level; }; }; if (difficulty == 1){ if (userData.level > 9){ _local3 = 9; } else { _local3 = userData.level; }; }; if (difficulty == 2){ _local3 = userData.level; }; userData.level_current = _local3; } else { _local3 = userData.level_current; }; showData(_local3); } private function showData(_arg1:int){ var _local2:int; var _local3:String; userData.level_current = _arg1; this["img"].gotoAndStop((_arg1 + 1)); _local2 = (Number(language.language_nr) - 1); txt0.text = ((userData.T_LEVEL[_local2] + " ") + (_arg1 + 1)); txt1.text = userData[("T_Customer_name" + _arg1)][_local2]; txt2.text = ((userData.data[_arg1][3] + "/") + userData.getToolUnlockedNum()); _local3 = String((userData.data[_arg1][0] % 60)); if (_local3.length <= 1){ _local3 = ("0" + _local3); }; txt3.text = ((int((userData.data[_arg1][0] / 60)) + ":") + _local3); txt4.text = userData.data[_arg1][2]; txt5.text = userData[("T_Customer_name" + _arg1)][_local2]; } private function _mouseDown(_arg1:MouseEvent){ var _local2:gameEvent; var _local3:gameEvent; var _local4:*; if (_arg1.target.name == "bt"){ if (userData.level_current == userData.level){ userData.tool_unlocked = true; userData.unlockTool(); } else { userData.tool_unlocked = false; }; _local2 = new gameEvent(gameEvent.GOTO); _local2.to = "game"; dispatchEvent(_local2); }; if (_arg1.target.name == "bt_back"){ _local3 = new gameEvent(gameEvent.GOTO); _local3.to = "intro"; dispatchEvent(_local3); }; if (_arg1.target.name == "bt_more"){ _local4 = new gameEvent(gameEvent.url_level_target_more); dispatchEvent(_local4); }; } private function _onClick(_arg1:myButtonEvent){ if (!_arg1.target.lock.visible){ showData((_arg1.target.currentFrame - 1)); }; } } }//package lib
Section 256
//Loading (lib.Loading) package lib { import flash.events.*; import flash.display.*; import flash.text.*; public class Loading extends MovieClip { public var loadbar:MovieClip; public var bt_games:SimpleButton; public var loadingtxt:TextField; public function Loading(){ addFrameScript(0, frame1); addEventListener(Event.ENTER_FRAME, _onEnterFrame); bt_games.addEventListener(MouseEvent.MOUSE_DOWN, _down); } private function _onUnload(_arg1:Event){ removeEventListener(Event.ENTER_FRAME, _onEnterFrame); removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } function frame1(){ stop(); } private function _down(_arg1:MouseEvent){ var _local2:*; _local2 = new gameEvent(gameEvent.url_loading_more); dispatchEvent(_local2); } private function _onEnterFrame(_arg1:Event){ loadbar.scaleX = (loaderInfo.bytesLoaded / loaderInfo.bytesTotal); loadingtxt.text = (String(int((loadbar.scaleX * 100))) + "%"); if (loaderInfo.bytesLoaded == loaderInfo.bytesTotal){ trace("language.language_nr", language.language_nr); if (language.language_nr != 2){ MovieClip(parent).gotoAndPlay("game"); } else { gotoAndStop(2); }; this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); }; } } }//package lib
Section 257
//MailSend (lib.MailSend) package lib { import flash.events.*; import flash.display.*; import flash.text.*; import spill.localisation.*; import gs.easing.*; import flash.system.*; public class MailSend extends MovieClip { public var txt_name:TextField; public var urls:TextField; public var txt_imput:TextField; public var link:_link; public var Select:int; public var pageup:选择; public var bt_copy:按钮_copy; private var currentImg:int; public var pagedown:选择; private var _language:int; public var bt_back:按钮_返回; public var box0:MovieClip; private var _txt:String;// = "" public var img:_choose_相片; public var box1:MovieClip; public var img1:_choose_相片; public var img2:_choose_相片; public var bt_space:MovieClip; public var customer:TextField; public var img0:_choose_相片; public var BackTo:String; public function MailSend(){ _txt = ""; super(); } public function init(){ box0.gotoAndStop(1); box1.gotoAndStop(1); _language = (Number(language.language_nr) - 1); bt_copy.moden = 1; bt_copy.addEventListener(myButtonEvent.Button_Click, _onClick); bt_back.moden = 2; bt_back.addEventListener(myButtonEvent.Button_Click, _onClick); pageup.moden = 2; pageup.addEventListener(myButtonEvent.Button_Click, _onClick); pagedown.moden = 2; pagedown.addEventListener(myButtonEvent.Button_Click, _onClick); currentImg = 0; showImg(); txt_imput.text = userData.T_Enter_Text_Here[_language]; txt_imput.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); txt_imput.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); txt_name.text = userData.T_Enter_your_name_here[_language]; txt_name.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); bt_space.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); this.addEventListener(Event.ENTER_FRAME, _showLink); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function _onUnload(_arg1:Event){ this.removeEventListener(Event.ENTER_FRAME, _showLink); this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function checkText(_arg1:Boolean=false){ var _local2:*; if (_arg1){ if (txt_imput.text == userData.T_Enter_Text_Here[_language]){ box0.gotoAndPlay(2); return (false); }; if (txt_name.text == userData.T_Enter_your_name_here[_language]){ box1.gotoAndPlay(2); return (false); }; }; _local2 = String(txt_imput.text).replace(/ /g, ""); if (_local2.length == 0){ txt_imput.text = userData.T_Enter_Text_Here[_language]; if (_arg1){ box0.gotoAndPlay(2); return (false); }; }; _local2 = String(txt_name.text).replace(/ /g, ""); if (_local2.length == 0){ txt_name.text = userData.T_Enter_your_name_here[_language]; if (_arg1){ box1.gotoAndPlay(2); return (false); }; }; return (true); } private function _mouseDown(_arg1:MouseEvent){ if (_arg1.target.name == "txt_imput"){ if (txt_imput.text == userData.T_Enter_Text_Here[_language]){ txt_imput.text = ""; }; }; if (_arg1.target.name == "txt_name"){ if (txt_name.text == userData.T_Enter_your_name_here[_language]){ txt_name.text = ""; }; }; if (_arg1.target.name == "bt_space"){ checkText(); }; } private function showImg(){ var _local1:int; customer.text = userData[("T_Customer_name" + Select)][_language]; img.gotoAndStop((Select + 1)); img.lock.visible = false; img.buttonMode = false; _local1 = 0; while (_local1 < 3) { this[("img" + _local1)].gotoAndStop(((currentImg + _local1) + 1)); this[("img" + _local1)].moden = 2; if ((currentImg + _local1) <= userData.level){ this[("img" + _local1)].buttonMode = true; this[("img" + _local1)].locked = false; this[("img" + _local1)].lock.visible = false; } else { this[("img" + _local1)].buttonMode = false; this[("img" + _local1)].locked = true; this[("img" + _local1)].lock.visible = true; }; this[("img" + _local1)].addEventListener(myButtonEvent.Button_Click, _onClick); _local1++; }; } private function _onClick(_arg1:myButtonEvent){ if (_arg1.target.name == "bt_back"){ MovieClip(parent).removeChild(this); }; if (_arg1.target.name == "pageup"){ if (currentImg > 0){ currentImg--; showImg(); }; }; if (_arg1.target.name == "pagedown"){ if (currentImg < 12){ currentImg++; showImg(); }; }; if (String(_arg1.target.name).indexOf("img") != -1){ if (!_arg1.target.locked){ Select = (_arg1.target.currentFrame - 1); showImg(); }; }; if (_arg1.target.name == "bt_copy"){ if (checkText(true)){ System.setClipboard(urls.text); if (!main._tracker_linkcopy){ main._tracker_linkcopy = true; main._tracker.trackEvent("hair mania", "Send to friend link copy", "per session", 0); }; }; }; checkText(); } private function _showLink(_arg1:Event){ var _local2:int; var _local3:*; var _local4:*; _local2 = 0; _local3 = String(txt_imput.text).replace(/ /g, ""); if ((((_local3.length == 0)) || ((txt_imput.text == userData.T_Enter_Text_Here[_language])))){ _local2++; }; _local3 = String(txt_name.text).replace(/ /g, ""); if ((((_local3.length == 0)) || ((txt_name.text == userData.T_Enter_your_name_here[_language])))){ _local2++; }; if (_local2 == 0){ link.visible = false; if (_txt != ((((("msg=" + txt_imput.text) + "&name=") + txt_name.text) + "&img=") + img.currentFrame)){ _txt = ((((("msg=" + txt_imput.text) + "&name=") + txt_name.text) + "&img=") + img.currentFrame); _local4 = escape(((((("msg=" + txt_imput.text) + "&name=") + txt_name.text) + "&img=") + img.currentFrame)); if (SpilGame.currentLanguage.name != "cn"){ urls.text = ((language.send_to_friend_url + "&") + _local4); } else { urls.text = language.send_to_friend_url; }; }; } else { link.visible = true; urls.text = ""; }; } } }//package lib
Section 258
//MailShow (lib.MailShow) package lib { import flash.display.*; import flash.text.*; import gs.easing.*; public class MailShow extends MovieClip { public var txt_name:TextField; public var txt_imput:TextField; public var bt_more:按钮_moregame; public var bt_start:按钮_startgame; private var _language:int; public var box0:MovieClip; public var img:_choose_相片; public var box1:MovieClip; public var bt_space:MovieClip; public var customer:TextField; public static var _msg; public static var _img:String; public static var _name; public function MailShow(){ _language = (Number(language.language_nr) - 1); } public function init(){ soundCtrl.playMusic("_sound_wall_of_hair"); txt_imput.text = _msg; txt_name.text = _name; img.gotoAndStop(int(_img)); img.lock.visible = false; customer.text = userData[("T_Customer_name" + (int(_img) - 1))][_language]; bt_start.moden = 1; bt_more.moden = 1; bt_start.addEventListener(myButtonEvent.Button_Click, _onClick); bt_more.addEventListener(myButtonEvent.Button_Click, _onClick); } private function _onClick(_arg1:myButtonEvent){ var _local2:gameEvent; if (_arg1.target.name == "bt_start"){ soundCtrl.playMusic("_sound_mainscreen"); _local2 = new gameEvent(gameEvent.GOTO); _local2.to = "intro"; dispatchEvent(_local2); }; if (_arg1.target.name == "bt_more"){ _local2 = new gameEvent(gameEvent.url_sendtofriend_more); dispatchEvent(_local2); }; } } }//package lib
Section 259
//main (lib.main) package lib { import flash.events.*; import flash.display.*; import spill.localisation.*; import com.google.analytics.*; import flash.utils.*; import screen.*; import flash.external.*; public class main extends MovieClip { private var story:Story; private var __masks:_masks; private var highscore:Highscore; private var mailshow:MailShow; public var __setPropDict:Dictionary; private var levelmap:Levelmap; private var debug:Boolean;// = false private var intro:Intro; private var howtoplay:HowToPlay; private var dif:int;// = 0 private var test:TestCode; private var _soundCtrl:soundCtrl; private var warning:Warning; public var __id3_:LanguageSelectBox; private var game:Game; public static var dd:O11111OO11 = new O11111OO11(); public static var _where:String; public static var _tracker_level7:Boolean = false; public static var _userData:userData; public static var _tracker_linkcopy:Boolean = false; public static var _tracker_init:Boolean = false; public static var _tracker_game_complete:Boolean = false; public static var _tracker:AnalyticsTracker; public static var mailsend:MailSend; public function main(){ var _local1:*; __setPropDict = new Dictionary(true); debug = false; dif = 0; super(); addFrameScript(10, frame11, 23, frame24, 28, frame29, 0, frame1); _local1 = new language(); _userData = new userData(); SpilGame.initialize("Hair_Mania", PortalGroup.FAMILY, "Hair-Mania.html", this); userData._language = (Number(language.language_nr) - 1); dd.O111111O(this, "Hair_Mania", 1, "Hair-Mania", "0", "normal", 2); dd.addEventListener("000111000100", con); dd.addEventListener("00000100110", con); } function initProtection():void{ var _local1:*; _local1 = new Protection(this); } public function init(){ var d:Date; var _url:String; var show:Boolean; var url:String; var showMain:Boolean; var msg:String; var name:String; var img:String; if (!_tracker_init){ _tracker_init = true; _tracker = new GATracker(this, "UA-6695967-1", "AS3", false); _tracker.trackEvent("hair mania", "Main screen viewed", "per session", 0); }; mailsend = new MailSend(); _soundCtrl = new soundCtrl(); addChild(_soundCtrl); d = new Date(); _url = loaderInfo.url; show = true; if (show){ if (debug){ test = new TestCode(); addChild(test); test.addEventListener(gameEvent.GOTO, _goto); }; url = ""; try { url = ExternalInterface.call("function(){return location.href;}"); } catch(error) { }; showMain = false; if (url != null){ url = unescape(url); msg = getUrlData(url, "msg"); name = getUrlData(url, "name"); img = getUrlData(url, "img"); if (((((!((msg == ""))) && (!((name == ""))))) && (!((img == ""))))){ MailShow._img = img; MailShow._msg = msg; MailShow._name = name; showMain = true; }; }; if (showMain){ mailshow = new MailShow(); addChild(mailshow); mailshow.init(); mailshow.addEventListener(gameEvent.GOTO, _goto); } else { intro = new Intro(); addChild(intro); intro.init(); _where = "intro"; intro.addEventListener(gameEvent.GOTO, _goto); }; if (language.language_nr != 2){ }; if (debug){ try { setChildIndex(test, (numChildren - 1)); } catch(err) { }; }; }; } function __setProp___id3__loading__1(){ try { __id3_["componentInspectorSetting"] = true; } catch(e:Error) { }; __id3_.popupLocation = "bottom"; try { __id3_["componentInspectorSetting"] = false; } catch(e:Error) { }; } function frame24(){ init(); } function frame1(){ if ((((__setPropDict[__id3_] == undefined)) || (!((int(__setPropDict[__id3_]) == 1))))){ __setPropDict[__id3_] = currentFrame; __setProp___id3__loading__1(); }; } private function getUrlData(_arg1, _arg2){ var _local3:RegExp; var _local4:Array; _local3 = new RegExp((("[?|&]" + _arg2) + "=([^&]*)")); _local4 = _arg1.match(_local3); if (_local4 != null){ return (_local4[1]); }; return (""); } function con(_arg1:Event):void{ var e = _arg1; try { this[_where].loader.removeChild(dd); } catch(err) { }; } function frame29(){ prevFrame(); } private function _goto(_arg1:gameEvent){ var to:String; var i:int; var evt = _arg1; to = evt.to; _where = to; i = (numChildren - 1); while (i > -1) { if ((getChildAt(i) is TestCode)){ } else { if ((getChildAt(i) is _masks)){ } else { if ((getChildAt(i) is soundCtrl)){ } else { if ((getChildAt(i) is AnalyticsTracker)){ trace("GATracker1 不要删除"); } else { if ((getChildAt(i) is GATracker)){ trace("GATracker2 不要删除"); } else { removeChildAt(i); }; }; }; }; }; i = (i - 1); }; if (userData.level_current > 14){ userData.level_current = 14; userData.saveData(); }; if (userData.level > 14){ userData.level = 14; userData.saveData(); }; if (to == "howtoplay"){ this[to] = new HowToPlay(); this[to].target = "intro"; }; if (to == "intro"){ this[to] = new Intro(); }; if (to == "highscore"){ this[to] = new Highscore(); this[to].loader.addChild(dd); }; if (to == "highscore"){ this[to] = new Highscore(); }; if (to == "levelmap"){ this[to] = new Levelmap(); this[to].difficulty = dif; }; if (to == "game"){ this[to] = new Game(); }; if (to == "story"){ this[to] = new Story(); }; if (to == "warning"){ dif = evt.difficulty; this[to] = new Warning(); }; addChild(this[to]); this[to].y = 0; try { this[to].init(); } catch(err) { }; this[to].addEventListener(gameEvent.GOTO, _goto); if (debug){ setChildIndex(test, (numChildren - 1)); }; } function frame11(){ prevFrame(); } } }//package lib
Section 260
//myButton (lib.myButton) package lib { import flash.events.*; import flash.display.*; import gs.*; public class myButton extends MovieClip { private var y1:Number; public var locked:Boolean;// = false public var lock:MovieClip; public var moden:int; public var bt:MovieClip; public var jiangbei:MovieClip; public var txt:MovieClip; private var overEnd:Boolean;// = true private var x1; public function myButton(){ locked = false; overEnd = true; super(); overEnd = true; x1 = (y1 = 0); this.mouseChildren = false; this.buttonMode = true; this.addEventListener(MouseEvent.MOUSE_OVER, _mouseOver); this.addEventListener(MouseEvent.MOUSE_OUT, _mouseOut); this.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); } private function _mouseDown(_arg1:MouseEvent){ var _local2:myButtonEvent; if (moden == 1){ soundCtrl.playEffect("_button_click"); }; _local2 = new myButtonEvent(myButtonEvent.Button_Click); _local2.Button_name = this.name; dispatchEvent(_local2); } private function _mouseOver(_arg1:MouseEvent){ var _local2:*; if ((((((moden == 1)) && (!(locked)))) && (overEnd))){ soundCtrl.playEffect("_button_over"); _local2 = new button_huichen(); addChild(_local2); if ((((moden == 1)) && ((x1 == 0)))){ x1 = bt.x; y1 = bt.y; }; overEnd = false; TweenMax.to(bt, 0.5, {bezier:[{x:(x1 + 7), y:(y1 + 2)}, {x:(x1 - 6), y:(y1 - 3)}, {x:(x1 + 4), y:(y1 + 4)}, {x:x1, y:y1}, {x:x1, y:y1}], onComplete:End}); TweenMax.to(bt, 0.1, {colorMatrixFilter:{brightness:1.4}}); }; if ((((moden == 2)) && (!(locked)))){ TweenMax.to(this, 0.1, {colorMatrixFilter:{brightness:1.4, saturation:0.6}}); }; } private function End(){ overEnd = true; } private function _mouseOut(_arg1:MouseEvent){ if ((((moden == 1)) && (!(locked)))){ TweenMax.to(bt, 0.1, {colorMatrixFilter:{}}); }; if ((((moden == 2)) && (!(locked)))){ TweenMax.to(this, 0.1, {colorMatrixFilter:{}}); }; } } }//package lib
Section 261
//myButtonEvent (lib.myButtonEvent) package lib { import flash.events.*; public class myButtonEvent extends Event { public var Button_name:String;// = "" public static var Button_Click:String = "Button_Click"; public function myButtonEvent(_arg1:String){ Button_name = ""; super(_arg1); } } }//package lib
Section 262
//Pause (lib.Pause) package lib { import flash.display.*; import gs.*; import gs.easing.*; public class Pause extends MovieClip { public var bt0:按钮_MAINMENU; public var bt1:按钮_howtoplay; public var bt3:按钮_moregame; public var bt2:按钮_back; public var bg:MovieClip; public var howtoplay:HowToPlay; private function showHowtoplay(){ userData.showHowtoplay = true; howtoplay.y = -130; TweenMax.to(howtoplay, 0.35, {y:0, ease:Back.easeOut}); addChild(howtoplay); howtoplay.init(); howtoplay.bg.visible = false; howtoplay.addEventListener(gameEvent.GOTO, _disHowtoplay); } public function init(){ howtoplay = new HowToPlay(); Game.GameStart = false; bt0.moden = 1; bt1.moden = 1; bt2.moden = 1; bt3.moden = 1; bt0.addEventListener(myButtonEvent.Button_Click, _onClick); bt1.addEventListener(myButtonEvent.Button_Click, _onClick); bt2.addEventListener(myButtonEvent.Button_Click, _onClick); bt3.addEventListener(myButtonEvent.Button_Click, _onClick); } private function _disHowtoplay(_arg1:gameEvent){ TweenMax.to(howtoplay, 0.45, {y:600, onComplete:disHowtoplay, ease:Back.easeIn}); TweenMax.to(bg, 0.3, {delay:0.2, alpha:1}); } private function disHowtoplay(){ removeChild(howtoplay); } private function _onClick(_arg1:myButtonEvent){ var _local2:*; switch (_arg1.target.name){ case "bt0": soundCtrl.paused(false); MovieClip(parent).goto("intro"); break; case "bt1": TweenMax.to(bg, 0.3, {alpha:0}); showHowtoplay(); break; case "bt2": soundCtrl.paused(false); TweenMax.to(this, 0.4, {y:500, onComplete:End, ease:Back.easeIn}); break; case "bt3": _local2 = new gameEvent(gameEvent.url_pause_more); dispatchEvent(_local2); break; default: break; }; } private function End(){ Game.GameStart = true; MovieClip(parent).removeChild(this); } } }//package lib
Section 263
//setQuality (lib.setQuality) package lib { import flash.display.*; public class setQuality extends MovieClip { public var bt0:按钮_画面质量; public var bt1:按钮_声音; public static var quality:int = 1; public function setQuality(){ bt0.moden = 2; bt1.moden = 2; bt0.addEventListener(myButtonEvent.Button_Click, _onClick); bt1.addEventListener(myButtonEvent.Button_Click, _onClick); bt0.gotoAndStop(quality); if (!soundCtrl.soundOff){ bt1.gotoAndStop(1); } else { bt1.gotoAndStop(2); }; } private function _onClick(_arg1:myButtonEvent){ switch (_arg1.target.name){ case "bt0": quality++; if (quality > 3){ quality = 1; }; switch (quality){ case 1: stage.quality = StageQuality.HIGH; break; case 2: stage.quality = StageQuality.MEDIUM; break; case 3: stage.quality = StageQuality.LOW; break; default: break; }; bt0.gotoAndStop(quality); break; case "bt1": if (soundCtrl.soundOff){ bt1.gotoAndStop(1); soundCtrl.soundOff = false; } else { bt1.gotoAndStop(2); soundCtrl.soundOff = true; }; break; default: break; }; } } }//package lib
Section 264
//showBadgeunlock (lib.showBadgeunlock) package lib { import flash.display.*; public class showBadgeunlock extends MovieClip { private var f; public var img:Badge; public function showBadgeunlock(){ addFrameScript(0, frame1, 1, frame2, 57, frame58); } public function init(){ trace("要显示的帧数", (f + 1)); img.txt.gotoAndStop((f + 1)); img.jiangbei.gotoAndStop((f + 1)); } function frame1(){ stop(); } public function setShow(_arg1:int){ f = _arg1; } function frame2(){ init(); } function frame58(){ stop(); } } }//package lib
Section 265
//soundCtrl (lib.soundCtrl) package lib { import flash.display.*; import gs.*; import flash.media.*; import flash.utils.*; public class soundCtrl extends MovieClip { public var gougouChannel:SoundChannel; public var _sound_story; public var _sound22_yundou:sound22_yundou; public var _button_over:button_over; public var _sound1_shandian:sound1_shandian; public var _button_click:button_click; public var _sound28_shoukao:sound28_shoukao; public var _sound21_tixu:sound21_tixu; public var _sound15_jidan:sound15_jidan; public var _sound7_qiqiu:sound7_qiqiu; public var _sound11_shui:sound11_shui; public var _sound6_haixiao:sound6_haixiao; public var _sound24_kafei:sound24_kafei; public var _sound19_roushun:sound19_roushun; public var _sound13_yagao:sound13_yagao; public var _sound_complete; public var _sound8_pen:sound8_pen; public var _sound5_feng:sound5_feng; public var _sound20_yu:sound20_yu; public var _sound_d1:sound_d1; public var _sound_d2:sound_d2; public var _sound_d3:sound_d3; public var _sound_d4:sound_d4; public var _sound3_dadanqi:sound3_dadanqi; public var _sound_mainscreen; public var _sound10_pen:sound10_pen; public var _sound23_daxiang:sound23_daxiang; public var _sound29_huaibiao:sound29_huaibiao; public var _sound4_shasha:sound4_shasha; public var musicChannel:SoundChannel; public var soundChannel:SoundChannel; public var _sound_gold:sound_gold; private var levelmusic:Array; private var sound:String; public var _sound_failed; public var _sound_music_2; public var _sound_music_3; public var _sound_music_1; public var _sound14_fajuan:sound14_fajuan; public var _sound0_cuifengji:sound0_cuifengji; public var _sound25_zazhi:sound25_zazhi; public var _sound2_baozha:sound2_baozha; public var _sound_wall_of_hair:Sound; public var _gougou_jiao:gougou_jiao; public var _sound16_pijiu:sound16_pijiu; public static var musicTrans:SoundTransform; public static var _soundOff_int:int = 1; private static var musicnow:String; private static var soundonAfter:int; public static var obj; public static var soundTrans:SoundTransform; private static var _soundOff:Boolean = false; public function soundCtrl(){ levelmusic = [3, 1, 2, 3, 1, 2, 3, 1, 2, 3, 1, 2, 3, 1, 2, 3, 1, 2]; super(); obj = this; soundTrans = new SoundTransform(); musicTrans = new SoundTransform(); _button_over = new button_over(); _button_click = new button_click(); _sound0_cuifengji = new sound0_cuifengji(); _sound1_shandian = new sound1_shandian(); _sound2_baozha = new sound2_baozha(); _sound3_dadanqi = new sound3_dadanqi(); _sound4_shasha = new sound4_shasha(); _sound5_feng = new sound5_feng(); _sound6_haixiao = new sound6_haixiao(); _sound7_qiqiu = new sound7_qiqiu(); _sound8_pen = new sound8_pen(); _sound10_pen = new sound10_pen(); _sound11_shui = new sound11_shui(); _sound13_yagao = new sound13_yagao(); _sound14_fajuan = new sound14_fajuan(); _sound15_jidan = new sound15_jidan(); _sound16_pijiu = new sound16_pijiu(); _sound19_roushun = new sound19_roushun(); _sound20_yu = new sound20_yu(); _sound21_tixu = new sound21_tixu(); _sound22_yundou = new sound22_yundou(); _sound23_daxiang = new sound23_daxiang(); _sound24_kafei = new sound24_kafei(); _sound25_zazhi = new sound25_zazhi(); _sound28_shoukao = new sound28_shoukao(); _sound29_huaibiao = new sound29_huaibiao(); _gougou_jiao = new gougou_jiao(); _sound_gold = new sound_gold(); _sound_d1 = new sound_d1(); _sound_d2 = new sound_d2(); _sound_d3 = new sound_d3(); _sound_d4 = new sound_d4(); _sound_complete = new sound_complete(); _sound_failed = new sound_failed(); _sound_mainscreen = new sound_mainscreen(); _sound_music_1 = new sound_music_1(); _sound_music_2 = new sound_music_2(); _sound_music_3 = new sound_music_3(); _sound_story = new sound_story(); _sound_wall_of_hair = new sound_wall_of_hair(); } public function playEffect_delay(_arg1, _arg2){ sound = _arg1; setTimeout(_playEffect_delay, _arg2); } private function _playEffect_delay(){ obj[sound].play(); } private function _nextMusic(){ var truns:*; trace("前一个声音播放完毕", musicnow); try { musicChannel.stop(); } catch(err) { }; truns = 9999999; if (musicnow == "_sound_failed"){ truns = 1; }; if (musicnow != "_level_music"){ musicChannel = this[musicnow].play(0, truns); } else { trace("userData.level_current", userData.level_current); musicChannel = this[("_sound_music_" + levelmusic[userData.level_current])].play(0, truns); }; if (_soundOff_int != 0){ musicTrans.volume = 0.3; } else { musicTrans.volume = 0; }; musicChannel.soundTransform = musicTrans; if (_soundOff_int != 0){ TweenMax.to(musicChannel, 1, {volume:1}); }; } private function _playMusic(){ trace("musicChannel", musicChannel); if (musicChannel != null){ if (musicTrans.volume != 0){ musicChannel.soundTransform = musicTrans; TweenMax.to(musicChannel, 1, {volume:0, onComplete:_nextMusic}); } else { _nextMusic(); }; } else { _nextMusic(); }; } public static function set soundOff(_arg1){ var n = _arg1; _soundOff = n; if (n){ _soundOff_int = 0; soundTrans.volume = 0; musicTrans.volume = 0; } else { _soundOff_int = 1; soundTrans.volume = 1; musicTrans.volume = 1; }; try { obj.soundChannel.soundTransform = soundTrans; } catch(err) { }; try { obj.musicChannel.soundTransform = musicTrans; } catch(err) { }; } public static function get soundOff(){ return (_soundOff); } public static function playEffect(_arg1:String, _arg2:int=0, _arg3:int=0){ var s = _arg1; var n = _arg2; var delay = _arg3; if (((!(soundOff)) && ((n == 0)))){ if (delay == 0){ obj[s].play(); } else { obj.playEffect_delay(s, delay); }; }; if (n > 0){ try { obj.soundChannel.stop(); } catch(err) { }; obj.soundChannel = obj[s].play(0, 9999); obj.soundChannel.soundTransform = soundTrans; }; } public static function set soundTrans_vole(_arg1){ soundTrans.volume = _arg1; obj.soundChannel.soundTransform = soundTrans; } public static function stopEffect(){ try { obj.soundChannel.stop(); } catch(err) { }; } public static function playGouGou(_arg1:String){ obj.gougouChannel = obj[_arg1].play(0, 999999); obj.gougouChannel.soundTransform = soundTrans; } public static function playMusic(_arg1){ if (musicnow != _arg1){ musicnow = _arg1; obj._playMusic(); }; } public static function stopGouGou(_arg1:String){ obj.gougouChannel.stop(); } public static function paused(_arg1){ if (_arg1){ soundonAfter = _soundOff_int; soundOff = _arg1; }; if (((!(_arg1)) && ((soundonAfter == 1)))){ soundOff = _arg1; obj._nextMusic(); }; } } }//package lib
Section 266
//Space_Tishi (lib.Space_Tishi) package lib { import flash.events.*; import flash.display.*; public class Space_Tishi extends MovieClip { public var timebar:MovieClip; private var speed:Number;// = 0 private var time:int;// = 0 public function Space_Tishi(){ time = 0; speed = 0; super(); addFrameScript(0, frame1, 1, frame2, 34, frame35, 35, frame36, 71, frame72, 72, frame73, 108, frame109); } function frame72(){ end(); } function frame73(){ timebar.visible = false; } public function init(){ timebar.visible = true; timebar.bar.x = 0; gotoAndStop(1); time = (30 * 10); speed = 0; this.addEventListener(Event.ENTER_FRAME, _onEnterFrame); stage.addEventListener(KeyboardEvent.KEY_UP, _onKeyUp); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function _onUnload(_arg1:Event){ clear(); } function frame1(){ stop(); timebar.visible = true; } function frame109(){ end(); } private function _onKeyUp(_arg1:Event){ speed = (speed + 68); } function frame2(){ timebar.visible = false; } function frame36(){ timebar.visible = false; } private function clear(){ this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); this.removeEventListener(KeyboardEvent.KEY_UP, _onKeyUp); this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } function frame35(){ end(); } public function great(_arg1:int=1){ var _local2:*; clear(); _local2 = int((Math.random() * 2)); if (_arg1 == 1){ gotoAndPlay(2); } else { gotoAndPlay(("bad" + _local2)); }; } private function _onEnterFrame(_arg1:Event){ var _local2:gameEvent; timebar.bar.x = (timebar.bar.x - 0.7); time--; speed = (speed + ((0 - speed) * 0.2)); Game.mouseSpeed = speed; if (timebar.bar.x < (timebar.bar.width * -1)){ clear(); end(); _local2 = new gameEvent(gameEvent.timeBar_timeout); dispatchEvent(_local2); }; } public function end(){ try { MovieClip(parent).removeChild(this); } catch(err) { }; } } }//package lib
Section 267
//Story (lib.Story) package lib { import flash.events.*; import flash.display.*; import flash.text.*; import flash.utils.*; public class Story extends MovieClip { private var id:int; public var txt:TextField; private var _txt:String; private var _language; public var bt_start_game:按钮_startgame; public function Story(){ addFrameScript(31, frame32); } public function init(){ var _local1:TextFormat; _language = (Number(language.language_nr) - 1); _txt = userData.T_wellcom[_language]; _local1 = new TextFormat(); if (language.language_nr == 2){ _local1.size = 16; _local1.italic = false; } else { _local1.size = 13; _local1.italic = true; }; txt.defaultTextFormat = _local1; id = setInterval(showTxt, 30); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); bt_start_game.moden = 1; bt_start_game.addEventListener(myButtonEvent.Button_Click, _onClick); } private function _onUnload(_arg1:Event){ var _local2:*; var _local3:*; var _local4:*; clearInterval(id); _local2 = (numChildren - 1); while (_local2 > -1) { _local3 = getChildAt(_local2); if ((((_local3 is MovieClip)) || ((_local3 is Sprite)))){ _local4 = (_local3.numChildren - 1); while (_local4 > -1) { _local3.removeChildAt(_local4); _local4--; }; }; removeChildAt(_local2); _local2--; }; this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function showTxt(){ if (_txt.length > txt.text.length){ txt.appendText(_txt.charAt(txt.text.length)); } else { clearInterval(id); }; } private function _onClick(_arg1:myButtonEvent){ var _local2:gameEvent; _local2 = new gameEvent(gameEvent.GOTO); if (!userData.showWarning){ userData.showWarning = true; _local2.to = "warning"; } else { _local2.to = "levelmap"; }; dispatchEvent(_local2); } function frame32(){ stop(); } } }//package lib
Section 268
//TestCode (lib.TestCode) package lib { import flash.events.*; import flash.display.*; import fl.controls.*; import flash.text.*; import fl.data.*; import flash.utils.*; public class TestCode extends MovieClip { public var j1; public var bt0:MovieClip; public var collObj1:DataProvider; public var __setPropDict:Dictionary; public var txt:String; public var reset:Button; public var txt_show:TextField; public var combobox:ComboBox; public var mianban:MovieClip; public var __id2_:UIScrollBar; public var collProp1:Object; public var setLevel:Button; public var itemObj1:SimpleCollectionItem; public var bt_unlock:Button; public var bt_close:MovieClip; public var collProps1:Array; public var i1:int; public var bt_lock:Button; private static var _load:Boolean = false; public static var obj; public function TestCode(){ __setPropDict = new Dictionary(true); super(); addFrameScript(0, frame1, 1, frame2); stop(); obj = this; txt = ""; mouseEnabled = false; addEventListener(Event.ADDED_TO_STAGE, _onLoad); } private function init(_arg1){ var _local2:*; if (_arg1 == 2){ bt_unlock.addEventListener(MouseEvent.MOUSE_DOWN, _down); bt_lock.addEventListener(MouseEvent.MOUSE_DOWN, _down); reset.addEventListener(MouseEvent.MOUSE_DOWN, _onClick); txt_show.text = txt; bt_close.buttonMode = true; txt_show.mouseEnabled = false; bt_close.addEventListener(MouseEvent.MOUSE_DOWN, _onClick); _local2 = 0; while (_local2 < 15) { combobox.addItem({label:("Leve" + (_local2 + 1)), type:_local2}); _local2++; }; combobox.addEventListener(Event.CHANGE, _change); setLevel.addEventListener(MouseEvent.MOUSE_DOWN, _onClick); }; if (_arg1 == 1){ bt0.buttonMode = true; bt0.addEventListener(MouseEvent.MOUSE_DOWN, _onClick); }; } function __setProp___id2___2(){ try { __id2_["componentInspectorSetting"] = true; } catch(e:Error) { }; __id2_.direction = "vertical"; __id2_.scrollTargetName = "txt_show"; __id2_.visible = true; try { __id2_["componentInspectorSetting"] = false; } catch(e:Error) { }; } function frame1(){ init(1); } function frame2(){ if ((((__setPropDict[combobox] == undefined)) || (!((int(__setPropDict[combobox]) == 2))))){ __setPropDict[combobox] = currentFrame; __setProp_combobox__2(); }; if ((((__setPropDict[reset] == undefined)) || (!((int(__setPropDict[reset]) == 2))))){ __setPropDict[reset] = currentFrame; __setProp_reset__2(); }; if ((((__setPropDict[setLevel] == undefined)) || (!((int(__setPropDict[setLevel]) == 2))))){ __setPropDict[setLevel] = currentFrame; __setProp_setLevel__2(); }; if ((((__setPropDict[bt_unlock] == undefined)) || (!((int(__setPropDict[bt_unlock]) == 2))))){ __setPropDict[bt_unlock] = currentFrame; __setProp_bt_unlock__2(); }; if ((((__setPropDict[__id2_] == undefined)) || (!((int(__setPropDict[__id2_]) == 2))))){ __setPropDict[__id2_] = currentFrame; __setProp___id2___2(); }; if ((((__setPropDict[bt_lock] == undefined)) || (!((int(__setPropDict[bt_lock]) == 2))))){ __setPropDict[bt_lock] = currentFrame; __setProp_bt_lock__2(); }; init(2); } function __setProp_combobox__2(){ try { combobox["componentInspectorSetting"] = true; } catch(e:Error) { }; collObj1 = new DataProvider(); collProps1 = []; i1 = 0; while (i1 < collProps1.length) { itemObj1 = new SimpleCollectionItem(); collProp1 = collProps1[i1]; for (j1 in collProp1) { itemObj1[j1] = collProp1[j1]; }; collObj1.addItem(itemObj1); i1++; }; combobox.dataProvider = collObj1; combobox.editable = false; combobox.enabled = true; combobox.prompt = ""; combobox.restrict = ""; combobox.rowCount = 5; combobox.visible = true; try { combobox["componentInspectorSetting"] = false; } catch(e:Error) { }; } private function _down(_arg1:MouseEvent){ if (_arg1.target.name == "bt_unlock"){ userData.unlockAllTool(); }; if (_arg1.target.name == "bt_lock"){ userData.lockAllTool(); }; Game.showTool(); } function __setProp_reset__2(){ try { reset["componentInspectorSetting"] = true; } catch(e:Error) { }; reset.emphasized = false; reset.enabled = true; reset.label = "Reset All Data"; reset.labelPlacement = "right"; reset.selected = false; reset.toggle = false; reset.visible = true; try { reset["componentInspectorSetting"] = false; } catch(e:Error) { }; } private function _onClick(_arg1:MouseEvent){ var _local2:gameEvent; var _local3:gameEvent; if (_arg1.target.name == "setLevel"){ userData.level = combobox.selectedItem.type; userData.saveData(); _local2 = new gameEvent(gameEvent.GOTO); _local2.to = "intro"; dispatchEvent(_local2); }; if (_arg1.target.name == "reset"){ userData.reset(); _local3 = new gameEvent(gameEvent.GOTO); _local3.to = "intro"; dispatchEvent(_local3); }; if (_arg1.target.name == "bt0"){ gotoAndStop(2); }; if (_arg1.target.name == "bt_close"){ gotoAndStop(1); }; } function __setProp_setLevel__2(){ try { setLevel["componentInspectorSetting"] = true; } catch(e:Error) { }; setLevel.emphasized = false; setLevel.enabled = true; setLevel.label = "set Level"; setLevel.labelPlacement = "right"; setLevel.selected = false; setLevel.toggle = false; setLevel.visible = true; try { setLevel["componentInspectorSetting"] = false; } catch(e:Error) { }; } private function _onLoad(_arg1:Event){ _load = true; } private function _change(_arg1:Event){ } function __setProp_bt_lock__2(){ try { bt_lock["componentInspectorSetting"] = true; } catch(e:Error) { }; bt_lock.emphasized = false; bt_lock.enabled = true; bt_lock.label = "Lock Tools"; bt_lock.labelPlacement = "right"; bt_lock.selected = false; bt_lock.toggle = false; bt_lock.visible = true; try { bt_lock["componentInspectorSetting"] = false; } catch(e:Error) { }; } function __setProp_bt_unlock__2(){ try { bt_unlock["componentInspectorSetting"] = true; } catch(e:Error) { }; bt_unlock.emphasized = false; bt_unlock.enabled = true; bt_unlock.label = "Unlock All Tools"; bt_unlock.labelPlacement = "right"; bt_unlock.selected = false; bt_unlock.toggle = false; bt_unlock.visible = true; try { bt_unlock["componentInspectorSetting"] = false; } catch(e:Error) { }; } public static function traces(... _args){ var _local2:*; if (_load){ _local2 = 0; while (_local2 < _args.length) { obj.txt = (obj.txt + (_args[_local2] + " ")); _local2++; }; obj.txt = (obj.txt + "\n"); if (obj.currentFrame == 2){ obj.txt_show.text = obj.txt; }; }; } } }//package lib
Section 269
//textShow (lib.textShow) package lib { import flash.events.*; import flash.display.*; import spill.localisation.*; public class textShow extends MovieClip { public function textShow(){ addEventListener(Event.ADDED_TO_STAGE, _onLoad); } private function _onUnload(_arg1:Event){ removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); SpilGame.removeEventListener("languageChanged", languageChanged); } private function languageChanged(_arg1:Event=null){ gotoAndStop(language.language_nr); } private function _onLoad(_arg1:Event){ languageChanged(); addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); SpilGame.addEventListener("languageChanged", languageChanged, false, 0, true); } } }//package lib
Section 270
//tool (lib.tool) package lib { import flash.events.*; import flash.display.*; import gs.*; public class tool extends MovieClip { private var friction:Number;// = 0.7 private var y1:Number; private var spring:Number;// = 0.12 public var id:int; private var moveList:Array; public var lock:MovieClip; public var moden; public var _mc:MovieClip; public var shadow:MovieClip; private var gravity:Number;// = 7.5 private var num:int; public var mc:MovieClip; private var soundList; public var type:int; private var x1; private var vx:Number;// = 0 private var vy:Number;// = 0 private var mouseLast:Array; private var mouseDown:Boolean; private var mousedown_b:Boolean; public static var mouseSpeed:int; public function tool(){ soundList = ["", "_sound0_cuifengji", "", "", "_sound3_dadanqi", "_sound4_shasha", "", "", "_sound7_qiqiu", "_sound8_pen", "", "", "_sound11_shui", "", "_sound13_yagao", "_sound14_fajuan", "", "_sound16_pijiu", "", "", "_sound19_roushun", "", "_sound21_tixu", "_sound22_yundou", "", "", "", "", "", "", "_sound29_huaibiao"]; vx = 0; vy = 0; friction = 0.7; gravity = (5 * 1.5); spring = 0.12; super(); } public function mouseUP(){ var _local1:gameEvent; var _local2:gameEvent; if (mousedown_b){ if (currentFrame != 29){ soundCtrl.stopEffect(); }; if (currentFrame == 25){ }; if (currentFrame == 26){ }; if (currentFrame == 29){ }; Game.mouseSpeed = 0; if (mouseDown){ mouseDown = false; stopDrag(); mc.gotoAndStop(1); _local1 = new gameEvent(gameEvent.Dis_tool_intro); _local1.tool_moden = moden; _local1.tool_id = (currentFrame - 1); dispatchEvent(_local1); }; _mc.x = 0; _mc.y = 0; _mc.visible = false; graphics.clear(); moveList = []; this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); if (type == 3){ _local2 = new gameEvent(gameEvent.Release_fack_tool); dispatchEvent(_local2); }; mousedown_b = false; }; } public function init(){ moveList = []; this.mouseChildren = false; x1 = x; y1 = y; this.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); stage.addEventListener(MouseEvent.MOUSE_UP, _mouseUp); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); stage.addEventListener(Event.MOUSE_LEAVE, _mouseLeave); _mc.visible = false; } private function _onUnload(_arg1:Event){ this.removeEventListener(Event.REMOVED_FROM_STAGE, _onUnload); this.removeEventListener(Event.ENTER_FRAME, _onEnterFrame); } private function _mouseDown(_arg1:MouseEvent){ var _local2:gameEvent; var _local3:gameEvent; if (((((((!(lock.visible)) && (!(Game.spaceTime)))) && (!(Game.tool_effecting)))) && (!(mousedown_b)))){ if (soundList[this.currentFrame] != ""){ soundCtrl.playEffect(soundList[this.currentFrame], 1); }; mousedown_b = true; Sprite(parent).setChildIndex(this, (Sprite(parent).numChildren - 1)); mouseLast = []; if (moden != 5){ moveList = []; this.addEventListener(Event.ENTER_FRAME, _onEnterFrame); }; _local2 = new gameEvent(gameEvent.Show_tool_intro); _local2.tool_moden = moden; _local2.tool_id = (this.currentFrame - 1); dispatchEvent(_local2); shadow.visible = false; mc.gotoAndStop(2); if ((currentFrame - 1) != 29){ startDrag(false); }; if ((currentFrame - 1) == 29){ _mc.visible = true; }; mouseDown = true; if (type == 3){ _local3 = new gameEvent(gameEvent.Press_fack_tool); dispatchEvent(_local3); }; }; } private function _mouseOver(_arg1:MouseEvent){ } public function dis(){ mouseUP(); stopDrag(); Game.mouseSpeed = 0; mc.gotoAndStop(1); mouseDown = false; visible = false; x = x1; y = y1; TweenMax.to(this, 0.3, {delay:1, visible:true}); shadow.visible = true; } private function _mouseLeave(_arg1:Event){ if (((!((x1 == x))) && (!((y1 == y))))){ dis(); }; } private function _onEnterFrame(_arg1:Event){ var _local2:Boolean; var _local3:*; var _local4:Number; var _local5:Number; var _local6:Number; var _local7:Number; var _local8:Number; var _local9:*; var _local10:Number; var _local11:*; var _local12:*; var _local13:Boolean; var _local14:*; if ((currentFrame - 1) == 29){ _local4 = (mouseX - _mc.x); _local5 = (mouseY - _mc.y); _local6 = (_local4 * spring); _local7 = (_local5 * spring); vx = (vx + _local6); vy = (vy + _local7); vy = (vy + gravity); vx = (vx * friction); vy = (vy * friction); _mc.x = (_mc.x + vx); _mc.y = (_mc.y + vy); _local8 = Math.atan2((_mc.y - mouseY), (_mc.x - mouseX)); _mc.rotation = (((_local8 * 180) / Math.PI) - 90); this.graphics.clear(); this.graphics.lineStyle(2); this.graphics.moveTo(_mc.x, _mc.y); this.graphics.lineTo(mouseX, mouseY); }; _local2 = false; _local3 = (moveList.length - 1); if (moveList.length == 0){ moveList.push([Sprite(parent).mouseX, Sprite(parent).mouseY, 0, 0]); _local2 = true; } else { _local9 = getL(moveList[_local3][0], moveList[_local3][1], Sprite(parent).mouseX, Sprite(parent).mouseY); if (_local9 > 8){ _local2 = true; }; }; if (moden != 5){ _local10 = getL(MovieClip(root).mouseX, MovieClip(root).mouseY, Game.bollx, Game.bolly); if (_local10 < 240){ if (mc.currentFrame != 3){ mc.gotoAndStop(3); }; if (!soundCtrl.soundOff){ if (soundList[this.currentFrame] != ""){ soundCtrl.soundTrans_vole = 1; }; }; } else { if (soundList[this.currentFrame] != ""){ soundCtrl.soundTrans_vole = 0; }; if (mc.currentFrame != 2){ mc.gotoAndStop(2); }; }; }; if ((((moveList.length > 0)) && (_local2))){ if (_local3 == -1){ _local3 = 0; }; _local11 = ((getA(moveList[_local3][0], moveList[_local3][1], Sprite(parent).mouseX, Sprite(parent).mouseY) / Math.PI) * 180); _local12 = 1; if (moden == 4){ if ((((_local11 > 0)) && ((_local11 < 90)))){ _local12 = 1; }; if ((((_local11 >= 90)) && ((_local11 < 180)))){ _local12 = 2; }; if ((((_local11 >= -180)) && ((_local11 < -90)))){ _local12 = 3; }; if ((((_local11 >= -90)) && ((_local11 < -1)))){ _local12 = 4; }; }; if (moden == 2){ _local12 = 0; if ((((_local11 > -130)) && ((_local11 < -70)))){ _local12 = 1; }; if ((((_local11 < 130)) && ((_local11 > 70)))){ _local12 = 2; }; }; if (moden == 1){ _local12 = 0; if (Math.abs(_local11) < 30){ _local12 = 1; }; if (Math.abs(_local11) > 160){ _local12 = 2; }; }; _local13 = false; moveList.push([Sprite(parent).mouseX, Sprite(parent).mouseY, _local11, _local12]); if (moden == 3){ if ((((_local10 > 160)) && ((moveList.length > 0)))){ moveList.shift(); }; if (moveList.length > 4){ moveList = []; _local13 = true; }; }; if ((((_local12 == 4)) && ((moden == 4)))){ clear_moveList(); if (moveList.length > 3){ _local14 = (moveList.length - 1); if ((((((((moveList[_local14][3] == 4)) && ((moveList[(_local14 - 1)][3] == 3)))) && ((moveList[(_local14 - 2)][3] == 2)))) && ((moveList[(_local14 - 3)][3] == 1)))){ _local13 = true; }; }; moveList = []; }; if ((((_local12 == 2)) && ((((moden == 2)) || ((moden == 1)))))){ if (moveList.length > 1){ _local14 = (moveList.length - 1); if ((((moveList[_local14][3] == 2)) && ((moveList[(_local14 - 1)][3] == 1)))){ if (moden == 2){ moveList = []; _local13 = true; } else { if (moden == 1){ moveList = []; _local13 = true; }; }; }; }; }; }; if ((((((mouseLast.length > 0)) && (_local13))) && ((((mc.currentFrame == 3)) || ((this.currentFrame == 30)))))){ num = 15; if ((((moden == 2)) || ((moden == 1)))){ Game.mouseSpeed = (getL(mouseLast[0], mouseLast[1], Sprite(parent).mouseX, Sprite(parent).mouseY) * 0.95); } else { if (moden == 4){ Game.mouseSpeed = (getL(mouseLast[0], mouseLast[1], Sprite(parent).mouseX, Sprite(parent).mouseY) * 1.3); } else { Game.mouseSpeed = (getL(mouseLast[0], mouseLast[1], Sprite(parent).mouseX, Sprite(parent).mouseY) * 0.85); }; }; }; if (!_local13){ num--; }; if (num < 0){ Game.mouseSpeed = 0; }; mouseLast = [Sprite(parent).mouseX, Sprite(parent).mouseY]; } private function getA(_arg1, _arg2, _arg3, _arg4){ return (Math.atan2((_arg4 - _arg2), (_arg3 - _arg1))); } private function clear_moveList(){ var _local1:*; _local1 = 0; while (_local1 < moveList.length) { if (_local1 < (moveList.length - 1)){ if (moveList[_local1][3] == moveList[(_local1 + 1)][3]){ moveList.splice((_local1 + 1), 1); _local1--; }; }; _local1++; }; } private function getL(_arg1, _arg2, _arg3, _arg4){ return (Math.sqrt((((_arg3 - _arg1) * (_arg3 - _arg1)) + ((_arg4 - _arg2) * (_arg4 - _arg2))))); } private function _mouseOut(_arg1:MouseEvent){ } private function _mouseUp(_arg1:MouseEvent){ mouseUP(); } public function back(){ TweenMax.to(this, 0.3, {x:x1, y:y1}); shadow.visible = true; } } }//package lib
Section 271
//Translate (lib.Translate) package lib { import flash.display.*; public class Translate extends MovieClip { public static var You_unlocked_x_new_tools:Array = ["", "You've unlocked xxx new tools!", "您解锁了xxx个新工具!", "Je hebt xxx nieuwe gereedschappen vrijgespeeld!", "Tu as déverrouillé xxx nouveaux outils !", "Du hast xxx neue Gegenstände freigeschaltet!", "¡Has desbloqueado xxx utensilios nuevos!", "Você desbloqueou xxx novos instrumentos!", "Desbloqueaste xxx novas ferramentas!", "Hai sbloccato xxx nuovi utensili!", "Du har låst upp xxx nya verktyg!", "Odblokowano xxx nowych narzędzi!", "Разблокированы xxx новых инструмента!", "Anda telah membuka xxx peralatan baru!", "", "", "You have unlocked xxx new tools!", "新しい道具のロックがxxx 個解除されました!"]; public static var You_unlocked_x_new_tool:Array = ["", "You've unlocked 1 new tool!", "您解锁了1个新工具!", "Je hebt 1 nieuw gereedschap vrijgespeeld!", "Tu as déverrouillé 1 nouvel outil !", "Du hast 1 neuen Gegenstand freigeschaltet!", "¡Has desbloqueado 1 utensilio nuevo!", "Você desbloqueou 1 novo instrumento!", "Desbloqueaste 1 nova ferramenta!", "Hai sbloccato 1 nuovo utensile!", "Du har låst upp 1 nytt verktyg!", "Odblokowano 1 nowe narzędzie!", "Разблокирован 1 новый инструмент!", "Anda telah membuka 1 peralatan baru!", "", "", "You have unlocked 1 new tool!", "新しい道具のロックが1個解除されました!"]; } }//package lib
Section 272
//userData (lib.userData) package lib { import flash.net.*; import flash.display.*; public class userData extends MovieClip { public static var showHowtoplay:Boolean; public static var T_Customer:Array = ["Customer:", "顾客:", "Klant:", "Client :", "Kunde:", "Cliente:", "Freguês:", "Cliente:", "Cliente:", "Kund:", "Klient:", "Посетитель:", "Tamu:", "", "", "Client:", "お客様:"]; public static var T_Enter_your_name_here:Array = ["Enter your name here:", "输入您的名字:", "Je naam:", "Entre ton nom ici :", "Gib hier deinen Namen ein:", "Escribe aquí tu nombre:", "Digite seu nome aqui:", "Introduz aqui o teu nome:", "Digita qui il tuo nome: ", "Skriv ditt namn här:", "Tu wpisz swoje imię:", "Здесь введи свое имя:", "Masukkan nama anda disini:", "", "", "Enter your name here:", "ここに名前を入力してね:"]; public static var tool_used:Array; public static var tool_station:Array; public static var T_ToolToUse:Array = ["Tools to use:", "使用工具数量:", "Gereedschappen:", "Outils à utiliser :", "Zu verwendende Gegenstände:", "Utensilios que usar:", "Instrumentos a serem usados:", "Ferramentas a usar:", "Utensili da usare:", "Verktyg som krävs:", "Narzędzia do użycia:", "Инструменты для использования:", "Alat untuk dipergunakan:", "", "", "Tools you have to use:", "使用した道具:"]; public static var score:Object; public static var level:int; public static var T_Enter_Text_Here:Array = ["Enter text here:", "输入文字:", "Jouw bericht:", "Entre ton texte ici :", "Gib hier den Text ein:", "Escribe el texto aquí:", "Digite o texto aqui:", "Introduz o texto aqui:", "Digita qui il testo: ", "Skriv text här:", "Tu wpisz tekst:", "Здесь введи текст:", "Masukkan teks disini:", "", "", "Enter text here:", "ここにメッセージを入力してね:"]; public static var T_Tools:Array = ["tools", "工具", "gereedschappen gebruiken", "outils", "Gegenstände", "utensilios", "instrumentos", "ferramentas", "utensili", "verktyg", "narzędzi", "инструментов", "peralatan-peralatan", "", "", "tools", "道具"]; public static var data:Array; public static var T_wellcom:Array = ["Welcome to the one salon where no scissors can be found! The nutty Miss Bea Hive and her dog Frizz just LOVE big hair. Help them achieve their crazy dream of a city full of big hair. No client leaves without it!", "欢迎来到一个没有剪刀的理发店!疯狂的毕伊海威小姐和她的狗狗卷毛喜欢爆炸头。为了实现他们的疯狂梦想,让城里面每个人都是爆炸头。不理爆炸头,任何一个顾客都不能离开。", "Welkom in de enige kapsalon zonder schaar! De maffe mevrouw Suikerspin en haar hondje Pluis zijn GEK op grote kapsels. Het liefst zien ze de hele stad vol enorme kapsels, dus zorg dat iedere klant er een krijgt!", "Bienvenue au salon sans ciseaux ! Cette folle de Chantale Choucroute et son chien Bouclette ADORENT les grandes coiffures. Aide-les à réussir leur rêve farfelu d'une ville pleine de grandes coiffures. Pas un client doit repartir sans en avoir une ! ", "Willkommen im einzigen Frisörsalon, in dem es keine Scheren gibt! Das verrückte Fräulein Hedda Haarig und ihr Hund Kräusel LIEBEN dicke Haare. Hilf ihnen, ihren Traum von einer Stadt voller dicker Haare zu verwirklichen. Keine Kunden verlassen den Salon ohne exklusive Frisur!", "¡Bienvenido al único salón en el que no hay tijeras! A la chiflada Bea Colmenar y a su perro Rizo les ENCANTA el pelo voluminoso. Ayúdales a cumplir su sueño de ver una ciudad llena de pelos voluminosos. ¡Ningún cliente se marcha sin él!", "Bem-vindo ao salão onde não existem tesouras! A maluca Srta. Cabelão e seu cachorro Frizado ADORAM cabelos grandes. Ajude-os a realizar o sonho de ver a cidade toda com cabelão. O freguês não pode ir embora sem ele!", "Bem-vinda ao salão em que não há tesouras! A maluca Miss Bea Hive e o seu cão Frizz ADORAM cabelos grandes. Ajuda-os a cumprir o seu sonho maluco de encherem a cidade de cabelos grandes. Nenhum cliente sai sem ele!", "Benvenuti nell'unico salone in cui non esistono le forbici! La svitata signorina Bea Chioma ed il suo cane Frizz semplicemente ADORANO i capelli voluminosi. Aiutali a realizzare il loro folle sogno di avere una città piena di gente con i capelli voluminosi. Nessun cliente esce dal salone senza averli!", "Välkommen till en frisörsalong som saknar saxar! Den galna fru Frilla och hennes hund Frizzan ÄLSKAR stora hår. Hjälp dem att uppfylla sin galna dröm om stora hår. Ingen kund får gå utan ett!", "Witajcie w jedynym salonie fryzjerskim, gdzie nożyczek nie uświadczysz! Zwariowana Panna Ul i jej pies Fryz wprost UWIELBIAJĄ wysokie uczesania. Pomóż im wprowadzić w życie szalone marzenie o mieście pełnym wysokich fryzur. Żaden klient nie może opuścić salonu bez takiego uczesania!", "Добро пожаловать в парикмахерскую, в которой вообще нет ножниц! Сумасшедшая госпожа Гнездо и ее собачка Макарошка просто ОБОЖАЮТ большие прически. Помоги им осуществить их безумную мечту о городе больших причесок. Ни один клиент не уйдет из парикмахерской без такой прически!", "Selamat datang di salon tanpa gunting! Nona Inem Hura-hura dan anjingnya Ucok yang sangat MENYUKAI tatanan rambut kembang. Bantulah mereka untuk mencapai impian tidak waras mereka di kota yang penuh dengan rambut kembang. Tidak ada seorang tamu pun yang pergi meninggalkan salon tanpa tatanan rambut kembang!", "", "", "Welcome to the one salon where you will not find a single pair of scissors! The nutty Miss Bea Hive and her dog Frizz just LOVE big hair. Help them achieve their crazy dream of a city full of big hair. No client can leave the salon without it!", "ヘアドレッサーショップへようこそ!そう、ここは、はさみのない美容室。ちょっと変わったビーハイブさんと彼女の愛犬フリッズは、なんでも“大きな”ヘアスタイルが好きだとか…さぁ彼らと一緒にクレイジーなヘアスタイルをつくっちゃおう!ビッグヘアスタイルなしでお客様を帰してしまうことなんてありえません!"]; public static var _language:int; public static var tool_unlocked:Boolean; public static var T_LEVEL:Array = ["LEVEL", "关卡", "LEVEL", "NIVEAU", "LEVEL", "NIVEL", "NÍVEL", "NÍVEL Nº", "LIVELLO", "NIVÅ", "POZIOM", "УРОВЕНЬ", "LEVEL", "", "", "LEVEL", "レベル"]; public static var level_current:int; public static var badgeUnlock:Array; public static var toolUnlock_order:Array; public static var T_Customer_name0:Array = ["Angie Azure", "蓝色安琦", "Hannah Blauwboom", "Angèle Azure", "Bertha Blau", "Marimar Celeste", "Angélica Azula", "Celeste Azul", "Angie Celeste", "Anna Azur", "Agata Lazur", "Анжела Лазурная", "Lia Sitompel", "", "", "Angie Azure", "アンジーアズール"]; public static var T_Customer_name1:Array = ["Percy Pinpin", "珀西尔嫔嫔", "Victor Vetkuif", "Pierre Pinpin", "Peter Plüsch", "Borjita Pincel", "Pedro Pirralho", "Pedro Pincel", "Guido Pinpin", "Per Pinpin", "Piotr Laluś", "Петя Булавкин", "Dewi Berliansari", "", "", "Percy Pinpin", "ピンピン"]; public static var T_Customer_name2:Array = ["Baby Badness", "坏孩子", "Bartje Bengel", "Bébé Malheur", "Baby Boshaft", "Bebé Malaleche", "Bebê Terrível", "Bebé Terrível", "Pargolo Crescichioma", "Bebisen Bert", "Mały Gniewny", "Малыш Вреднуля", "Nita Puspita", "", "", "Baby Badness", "ハチャメチャビリー"]; public static var T_Customer_name3:Array = ["Tubby Tabby", "条纹猫", "Poes Piraat", "Mistrigri", "Kätzchen Kugelrund", "Gato Gordi", "Boludo", "Gato Gordi", "Gatto Birbante", "Tjocka Tisse", "Gruby Pimpek", "Стервоза Заноза", "Dini Dono", "", "", "Tubby Tabby", "ずんぐりタビー"]; public static var T_Customer_name4:Array = ["Granny Smith", "史密斯奶奶", "Oma Krul", "Mémé Martin", "Oma Schmitz", "Abuelita Pasa", "Vovó Sônia", "Avó Catarina", "Nonna Smith", "Mormor Moa", "Babcia Goździkowa", "Семеновна", "Rosida", "", "", "Granny Smith", "おせっかいスミス"]; public static var T_Customer_name6:Array = ["Mustang Unibrow", "浓眉海军", "Menno Monobrauw", "Marcel Sourcils", "Emil Einebraue", "Mustang Uniceja", "João Monocelha", "João Unicelha", "Monociglione Verace", "Örjan Ögonbrynja", "Fabian Brewka", "Матрос Густобрововский", "Jutek Ceres", "", "", "Mustang Unibrow", "まゆげムスタング"]; public static var toolList:Array; public static var T_Customer_name8:Array = ["Maria Marigold", "玛丽亚", "Belle Bloem", "Marie Boucledor", "Rita Ringelblume", "María Marioro", "Maria Madalena", "Maria Margarida", "Maria Pelodorato", "Söta Sue", "Maria Słoneczna", "Марья Златовласая", "Meri Mari", "", "", "Maria Marigold", "マリア"]; public static var T_Customer_name9:Array = ["Xzzybe Smith", "外星人史密斯", "Xzzybe Krul", "Xzzybe Martin", "Ali En", "Xzzybe García", "Zibe Estevez", "Zibe Silva", "Alieno Chiomato", "Xzzybe Svensson", "Zigi Nowak", "Бзик Петров", "Cecep Sumedang", "", "", "Xzzybe Smith", "シジービー"]; public static var so:SharedObject; public static var T_Customer_name7:Array = ["Slim Pickins", "苗条的琵金斯", "Terry Teckel", "Toutou", "Knuddel Clever", "Esbelto Quisquilloso", "Magrelo", "Esbelto Magrela", "Cane Spelacchiato", "Gunnar Glesfjun", "Zawadiaka", "Агент Нюх", "Kutilang Sip", "", "", "Slim Pickins", "スレンダーピキンズ"]; public static var showWarning:Boolean = false; public static var T_Customer_name10:Array = ["Marco ", "马可", "Marco", "Marc", "Marco ", "Marco ", "Marquinho", "Marco", "Marco ", "Markus", "Mareczek", "Максимка", "Ucil", "", "", "Marco ", "マルコ"]; public static var T_Customer_name11:Array = ["Clint Crumbeard", "克林特卡博得", "Karel Kruimelbaard", "Bertrand Barbe", "Karl Krummbart", "Benito Barbamigosa", "Caio Barbudo", "Caio Barbudo", "Clint Barbabriciolosa", "Sam Storskägg", "Jan Broda", "Олег Бородачев", "Yanti Bogem", "", "", "Clint Crumbeard", "おひげクリント"]; public static var T_Customer_name5:Array = ["Henry Ironstache", "亨利艾恩斯塔赫", "Harry Staalsnor", "Henri Moustachenfer", "Henry Eisenbart", "Enrique Mostachón", "Henrique Bigode-de-Ferro", "Henrique Bigodão", "Enrico Baffodiferro", "Henry Järnmusche", "Henryk Wąsowicz", "Николай Усатиков", "Inang Fauzi", "", "", "Henry Ironstache", "ヘンリーアイロンスタック"]; public static var T_Customer_name14:Array = ["Big Bertha", "大贝莎", "Dikke Bertha", "Grosse Bertha", "Dicke Doris", "Teresa Obesa", "Betona", "Berta Grande", "Grande Bertha", "Mulliga Maj", "Gruba Berta", "Ульяна Толстых", "Ogi Ogah", "", "", "Big Bertha", "ビッグなバーサ"]; public static var T_username:Array = ["Player", "玩家", "Speler", "Joueur", "Spieler", "Jugador", "Jogador", "Jogador", "Giocatore", "Spelare", "Gracz", "Игрок", "Pemain", "", "", "Player", "プレイヤー"]; public static var T_Customer_name12:Array = ["Daisy the Sheep", "绵羊黛西", "Saskia 't Schaap", "Marguerite le Mouton", "Daisy das Schaf", "La ovejita Margarita", "Ovelha Denise", "Ovelha Margarida", "Pecora Daisy", "Fåret Fia", "Owca Dorotka", "Овца Роза", "Desi ", "", "", "Daisy the Sheep", "眠りのマーガレット"]; public static var T_Customer_name13:Array = ["Dozer Dog", "瞌睡狗", "Dribbol de Hond", "Wouf le chien", "Dösiger Dobermann", "Perro Cabezaditas", "Dorminhoco", "Cão Dorminhoco", "Cane Sonnacchioso", "Sam Slappo", "Pies Śpioch", "Пес Бульдозер", "Lisa Bonet", "", "", "Dozer Dog", "ねぼすけ"]; public static var T_Time:Array = ["Time:", "时间:", "Tijd:", "Temps :", "Zeit:", "Tiempo:", "Tempo:", "Tempo:", "Tempo:", "Tid:", "Czas:", "Время:", "Waktu:", "", "", "Time:", "タイム:"]; public static var T_HairTarget:Array = ["Hair target: ", "头发目标:", "Haardoel: ", "Coiffure cible : ", "Haarziel: ", "Objetivo de altura: ", "Altura do cabelo: ", "Cabelo-alvo: ", "Obiettivo capelli: ", "Hårmål: ", "Wysokość docelowa: ", "Необходимая прическа: ", "Target rambut: ", "", "", "Hair target: ", "ボリューム目標ライン:"]; public function userData(){ so = SharedObject.getLocal("hairmania0828-5"); if (so.data.initialize == null){ _data(); }; showHowtoplay = so.data.showHowtoplay; tool_station = so.data.tool_station; level = so.data.level; badgeUnlock = so.data.badgeUnlock; score = so.data.score; data = so.data.data; toolList = so.data.toolList; toolUnlock_order = so.data.toolUnlock_order; tool_used = so.data.tool_used; unlockTool(); } public static function saveScore(_arg1:int){ score = _arg1; saveData(); } private static function _data(){ so.data.initialize = true; randomTool(); so.data.level = 0; so.data.badgeUnlock = [["Big hair badge", 0], ["Great hair badge", 0], ["Huge hair badge", 0], ["Blowdry specialist", 0], ["Hair Mousse Master", 0], ["Peanut butter buttercup", 0], ["Wallpaper Warrior", 0], ["Crafty Curler", 0], ["Allergic Reaction", 0], ["Unlawful arrest", 0], ["Eggtacy", 0], ["Toxins-R-us", 0], ["Hypnotizing hairstylist", 0]]; so.data.score = 0; so.data.data = [[60, "", "4\"", 2, 5], [90, "", "4\"", 3, 9], [120, "", "4\"", 4, 11], [150, "", "4\"", 5, 15], [180, "", "4\"", 6, 17], [180, "", "4\"", 8, 20], [195, "", "4\"", 9, 21], [210, "", "4\"", 10, 22], [225, "", "4\"", 12, 25], [240, "", "4\"", 14, 28], [240, "", "4\"", 16, 29], [0xFF, "", "4\"", 18, 30], [270, "", "4\"", 20, 30], [285, "", "4\"", 20, 30], [300, "", "4\"", 20, 30]]; so.data.toolList = [[1, true, 3, "电吹风", "1", "", false], [2, true, 5, "电刑", "1", "", false], [3, true, 5, "炸弹", "1", "", false], [4, true, 4, "打蛋器", "1", "", false], [5, true, 4, "胡椒 ", "1", "", false], [6, true, 5, "龙卷风", "1", "", false], [7, true, 5, "海啸", "1", "", false], [8, true, 1, "气球", "1", "", false], [9, true, 3, "定型液", "1", "", false], [10, true, 2, "墙面交", "1", "", false], [11, true, 5, "摩丝", "1", "", false], [12, true, 2, "糖水", "1", "", false], [13, true, 2, "花生酱", "1", "", false], [14, true, 1, "牙膏", "1", "", false], [15, true, 1, "发卷", "1", "", false], [16, true, 5, "鸡蛋", "1", "", false], [17, true, 2, "啤酒", "1", "", false], [18, true, 2, "枕头", "1", "", false], [19, true, 5, "帽子", "3", "", false], [20, true, 3, "定型液", "3", "", false], [21, true, 5, "下雨", "3", "", false], [22, true, 4, "剃须", "3", "", false], [23, true, 3, "熨斗", "3", "", false], [24, true, 5, "大象", "3", "", false], [25, true, 5, "咖啡", "1", "", false], [26, true, 5, "杂志", "1", "", false], [27, true, 5, "药片", "1", "", false], [28, true, 5, "眼罩", "1", "", false], [29, true, 5, "手铐", "1", "", false], [30, true, 1, "手表", "1", "", false]]; tool_unlocked = true; so.data.showHowtoplay = false; so.data.tool_used = [0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0, 0]; } public static function getToolUnlockedNum():int{ var _local1:int; var _local2:*; _local1 = 0; _local2 = 0; while (_local2 < toolList.length) { if (toolList[_local2][6]){ _local1++; }; _local2++; }; return (_local1); } public static function lockAllTool(){ var _local1:*; _local1 = 0; while (_local1 < toolList.length) { toolList[_local1][6] = false; _local1++; }; unlockTool(); } public static function unlockBadge():Array{ var _local1:Array; _local1 = []; if (tool_used[0] >= 3){ tool_used[0] = -1; if (badgeUnlock[3][1] == 0){ badgeUnlock[3][1] = 1; _local1.push(3); }; }; if (tool_used[12] >= 3){ tool_used[12] = -1; if (badgeUnlock[5][1] == 0){ badgeUnlock[5][1] = 1; _local1.push(5); }; }; if (tool_used[10] >= 3){ tool_used[10] = -1; if (badgeUnlock[4][1] == 0){ badgeUnlock[4][1] = 1; _local1.push(4); }; }; if (tool_used[9] >= 2){ tool_used[9] = -1; if (badgeUnlock[6][1] == 0){ badgeUnlock[6][1] = 1; _local1.push(6); }; }; if (tool_used[14] >= 2){ tool_used[14] = -1; if (badgeUnlock[7][1] == 0){ badgeUnlock[7][1] = 1; _local1.push(7); }; }; if (tool_used[4] >= 2){ tool_used[4] = -1; if (badgeUnlock[8][1] == 0){ badgeUnlock[8][1] = 1; _local1.push(8); }; }; if (tool_used[28] >= 2){ tool_used[28] = -1; if (badgeUnlock[9][1] == 0){ badgeUnlock[9][1] = 1; _local1.push(9); }; }; if (tool_used[15] >= 3){ tool_used[15] = -1; if (badgeUnlock[10][1] == 0){ badgeUnlock[10][1] = 1; _local1.push(10); }; }; if (tool_used[26] >= 3){ tool_used[26] = -1; if (badgeUnlock[11][1] == 0){ badgeUnlock[11][1] = 1; _local1.push(11); }; }; if (tool_used[29] >= 3){ tool_used[29] = -1; if (badgeUnlock[12][1] == 0){ badgeUnlock[12][1] = 1; _local1.push(12); }; }; if ((((badgeUnlock[0][1] == 0)) && ((level > 4)))){ badgeUnlock[0][1] = 1; _local1.push(0); }; if ((((badgeUnlock[1][1] == 0)) && ((level > 9)))){ badgeUnlock[1][1] = 1; _local1.push(1); }; if ((((badgeUnlock[2][1] == 0)) && ((level > 14)))){ badgeUnlock[2][1] = 1; _local1.push(2); }; saveData(); trace("badgeUnlock", _local1); return (_local1); } public static function saveData(){ so.data.showHowtoplay = showHowtoplay; so.data.level = level; so.data.badgeUnlock = badgeUnlock; so.data.score = score; so.data.data = data; so.data.toolList = toolList; so.data.toolUnlock_order = toolUnlock_order; so.data.tool_used = tool_used; so.flush(); } public static function reset(){ _data(); showHowtoplay = so.data.showHowtoplay; tool_station = so.data.tool_station; level = so.data.level; badgeUnlock = so.data.badgeUnlock; score = so.data.score; data = so.data.data; toolList = so.data.toolList; toolUnlock_order = so.data.toolUnlock_order; tool_used = so.data.tool_used; unlockTool(); saveData(); } public static function unlockTool():Array{ var _local1:Array; _local1 = []; if (((tool_unlocked) && ((level == 0)))){ toolList[toolUnlock_order[0]][6] = true; toolList[toolUnlock_order[1]][6] = true; toolList[toolUnlock_order[2]][6] = true; toolList[18][6] = true; toolList[24][6] = true; _local1.push(toolUnlock_order[0], toolUnlock_order[1], toolUnlock_order[2], 18, 24); }; if (((tool_unlocked) && ((level == 1)))){ toolList[toolUnlock_order[3]][6] = true; toolList[toolUnlock_order[4]][6] = true; toolList[19][6] = true; toolList[25][6] = true; _local1.push(toolUnlock_order[3], toolUnlock_order[4], 19, 25); }; if (((tool_unlocked) && ((level == 2)))){ toolList[toolUnlock_order[5]][6] = true; toolList[toolUnlock_order[6]][6] = true; _local1.push(toolUnlock_order[5], toolUnlock_order[6]); }; if (((tool_unlocked) && ((level == 3)))){ toolList[toolUnlock_order[7]][6] = true; toolList[toolUnlock_order[8]][6] = true; toolList[20][6] = true; toolList[26][6] = true; _local1.push(toolUnlock_order[7], toolUnlock_order[8], 20, 26); }; if (((tool_unlocked) && ((level == 4)))){ toolList[toolUnlock_order[9]][6] = true; toolList[toolUnlock_order[10]][6] = true; _local1.push(toolUnlock_order[9], toolUnlock_order[10]); }; if (((tool_unlocked) && ((level == 5)))){ toolList[toolUnlock_order[11]][6] = true; toolList[21][6] = true; toolList[27][6] = true; _local1.push(toolUnlock_order[11], 21, 27); }; if (((tool_unlocked) && ((level == 6)))){ toolList[toolUnlock_order[12]][6] = true; _local1.push(toolUnlock_order[12]); }; if (((tool_unlocked) && ((level == 7)))){ toolList[toolUnlock_order[13]][6] = true; _local1.push(toolUnlock_order[13]); }; if (((tool_unlocked) && ((level == 8)))){ toolList[toolUnlock_order[14]][6] = true; toolList[22][6] = true; toolList[28][6] = true; _local1.push(toolUnlock_order[14], 22, 28); }; if (((tool_unlocked) && ((level == 10)))){ toolList[toolUnlock_order[15]][6] = true; toolList[23][6] = true; toolList[29][6] = true; _local1.push(toolUnlock_order[15], 23, 29); }; if (((tool_unlocked) && ((level == 11)))){ toolList[toolUnlock_order[16]][6] = true; _local1.push(toolUnlock_order[16]); }; if (((tool_unlocked) && ((level == 12)))){ toolList[toolUnlock_order[17]][6] = true; _local1.push(toolUnlock_order[17]); }; saveData(); return (_local1); } public static function randomStation(){ var _local1:Array; var _local2:int; var _local3:*; var _local4:int; _local1 = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17, 18, 19, 20, 21, 22, 23, 24, 25, 26, 27, 28, 29]; _local2 = _local1.length; tool_station = []; _local3 = 0; while (_local3 < _local2) { _local4 = int((Math.random() * _local1.length)); tool_station[_local3] = _local1[_local4]; _local1.splice(_local4, 1); _local3++; }; so.data.tool_station = tool_station; } public static function unlockAllTool(){ var _local1:*; _local1 = 0; while (_local1 < toolList.length) { toolList[_local1][6] = true; _local1++; }; } public static function randomTool(){ var _local1:Array; var _local2:int; var _local3:*; var _local4:int; _local1 = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9, 10, 11, 12, 13, 14, 15, 16, 17]; _local2 = _local1.length; toolUnlock_order = []; _local3 = 0; while (_local3 < _local2) { _local4 = int((Math.random() * _local1.length)); toolUnlock_order[_local3] = _local1[_local4]; _local1.splice(_local4, 1); _local3++; }; so.data.toolUnlock_order = toolUnlock_order; randomStation(); } } }//package lib
Section 273
//Wallofhairfame (lib.Wallofhairfame) package lib { import flash.display.*; import gs.easing.*; public class Wallofhairfame extends MovieClip { public var bt0:按钮_返回; public var bt_more:按钮_moregame; public var bt1:按钮SENDTOFRIEND; public var target:String; public var wall:Wallofhairfame_badge; public function Wallofhairfame(){ bt0.moden = 2; bt0.addEventListener(myButtonEvent.Button_Click, _onClick); bt1.moden = 1; bt1.addEventListener(myButtonEvent.Button_Click, _onClick); bt_more.moden = 1; bt_more.addEventListener(myButtonEvent.Button_Click, _onClick); } public function init(){ wall.init(); } public function SendMail(){ MovieClip(parent).addChild(main.mailsend); main.mailsend.init(); } private function _onClick(_arg1:myButtonEvent){ var _local2:*; if (_arg1.target.name == "bt_more"){ _local2 = new gameEvent(gameEvent.url_wallofhair_more); dispatchEvent(_local2); }; if (_arg1.target.name == "bt1"){ SendMail(); }; if (_arg1.target.name == "bt0"){ MovieClip(parent).removeChild(this); }; } } }//package lib
Section 274
//Wallofhairfame_badge (lib.Wallofhairfame_badge) package lib { import flash.events.*; import flash.display.*; import gs.*; import gs.easing.*; public class Wallofhairfame_badge extends MovieClip { public var bar:BarCtrl; private var badgeLoader:Sprite; public function init(){ var _local1:int; var _local2:int; var _local3:int; var _local4:Sprite; var _local5:Badge; badgeLoader = new Sprite(); addChild(badgeLoader); _local1 = 0; _local2 = 0; badgeLoader.x = 60; badgeLoader.y = 59; _local3 = 0; while (_local3 < 13) { _local5 = new Badge(); _local5.jiangbei.gotoAndStop((_local3 + 1)); _local5.txt.gotoAndStop((_local3 + 1)); _local5.moden = 2; _local5.addEventListener(myButtonEvent.Button_Click, _onClick); if (userData.badgeUnlock[_local3][1] == 0){ _local5.locked = true; TweenMax.to(_local5.jiangbei, 0.01, {tint:4532504}); } else { _local5.locked = false; TweenMax.to(_local5.jiangbei, 0.01, {removeTint:true}); }; badgeLoader.addChild(_local5); _local5.x = (_local1 * 162); _local5.y = (_local2 * 162); _local1++; if (_local1 == 3){ _local1 = 0; _local2++; }; _local3++; }; _local4 = new Sprite(); addChild(_local4); _local4.x = 60; _local4.y = 60; _local4.graphics.beginFill(0xFFFFFF); _local4.graphics.drawRect(0, 0, 490, 320); badgeLoader.mask = _local4; bar.init(badgeLoader); this.addEventListener(Event.REMOVED_FROM_STAGE, _onUnload); } private function _onUnload(_arg1:Event){ var _local2:*; _local2 = (badgeLoader.numChildren - 1); while (_local2 > -1) { badgeLoader.removeChildAt(_local2); _local2--; }; } private function _onClick(_arg1:myButtonEvent){ if (!_arg1.target.locked){ MovieClip(parent).SendMail(); }; } } }//package lib
Section 275
//Warning (lib.Warning) package lib { import flash.display.*; public class Warning extends MovieClip { public function Warning(){ addFrameScript(0, frame1, 107, frame108); } public function init(){ soundCtrl.playMusic("_sound_story"); gotoAndPlay(2); } function frame1(){ stop(); } function frame108(){ stop(); end(); } public function end(){ var _local1:gameEvent; _local1 = new gameEvent(gameEvent.GOTO); _local1.to = "levelmap"; dispatchEvent(_local1); } } }//package lib
Section 276
//O1111111l (O11111110.O1111111l) package O11111110 { import flash.net.*; public class O1111111l { private var O1111100O1:int; private var O11111l1l:String; private var O11111l1O:Array; private var O111111Ol:String; public var O11111OOO:int;// = 1 private var O111111O0:String; private static var O11111l11:O1111111l; public function O1111111l():void{ O11111OOO = 1; super(); O11111l1O = new Array(); } private function O11111l10():void{ O11111l1O.push(new O11111O00(1, 1, (((((("http://www.agame.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(17, 1, (((((("http://www.gamesgames.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(29, 1, (((((("http://www.girlsgogames.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(45, 2, (((((("http://www.a10.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(2, 19, "http://www.game.com.cn/downloads")); O11111l1O.push(new O11111O00(2, 19, "http://www.game.com.cn/downloads")); O11111l1O.push(new O11111O00(2, 19, "http://www.game.com.cn/downloads")); O11111l1O.push(new O11111O00(2, 19, "http://www.game.com.cn/downloads")); O11111l1O.push(new O11111O00(4, 5, (((((("http://www.spel.nl/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(18, 5, (((((("http://www.spelletjes.nl/spel/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(30, 5, (((((("http://www.girlsgogames.nl/spel/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(3, 5, (((((("http://www.spel.nl/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(5, 6, (((((("http://www.jeu.fr/jeu/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(19, 6, (((((("http://www.jeux.fr/jeu/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(31, 6, (((((("http://www.girlsgogames.fr/jeu/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(4, 6, (((((("http://www.jeu.fr/jeu/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(6, 7, (((((("http://www.spielen.com/spiel/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(20, 7, (((((("http://www.jetztspielen.de/spiel/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(32, 7, (((((("http://www.girlsgogames.de/spiel/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(5, 7, (((((("http://www.spielen.com/spiel/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(14, 13, (((((("http://www.minigry.pl/gra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(21, 13, (((((("http://www.gry.pl/gra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(33, 13, (((((("http://www.girlsgogames.pl/gra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(6, 13, (((((("http://www.minigry.pl/gra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(9, 12, (((((("http://www.spel.eu/spel_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(22, 12, (((((("http://www.spela.se/spel_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(34, 12, (((((("http://www.girlsgogames.se/spel_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(7, 12, (((((("http://www.spel.eu/spel_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(8, 11, (((((("http://www.giocaregratis.it/gioco/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(23, 11, (((((("http://www.gioco.it/gioco/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(35, 11, (((((("http://www.girlsgogames.it/gioco/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(8, 11, (((((("http://www.giocaregratis.it/gioco/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(5, 8, (((((("http://www.zapjuegos.com/juego/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(24, 8, (((((("http://www.juegos.com/juego/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(36, 8, (((((("http://www.juegosdechicas.com/juego/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(9, 8, (((((("http://www.zapjuegos.com/juego/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(7, 9, (((((("http://www.clickjogos.com/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(25, 9, (((((("http://www.ojogos.com.br/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(38, 9, (((((("http://www.girlsgogames.com.br/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(10, 9, (((((("http://www.clickjogos.com/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(13, 16, (((((("http://www.games.co.id/permainanme/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(13, 16, (((((("http://www.games.co.id/permainanme/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(13, 16, (((((("http://www.games.co.id/permainanme/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(13, 16, (((((("http://www.games.co.id/permainanme/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(11, 14, (((((("http://www.flashgames.ru/igra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(26, 14, (((((("http://www.ourgames.ru/igra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(39, 14, (((((("http://www.girlsgogames.ru/igra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(12, 14, (((((("http://www.flashgames.ru/igra/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(10, 2, (((((("http://www.mygames.co.uk/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(27, 2, (((((("http://www.games.co.uk/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(37, 2, (((((("http://www.girlsgogames.co.uk/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(13, 2, (((((("http://www.mygames.co.uk/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(12, 3, (((((("http://www.game.co.in/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(12, 3, (((((("http://www.game.co.in/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(40, 3, (((((("http://www.girlsgogames.in/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(14, 3, (((((("http://www.game.co.in/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(15, 15, (((((("http://www.asoyun.com/oyun/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(28, 15, (((((("http://www.oyunlar123.com/oyun/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(41, 15, (((((("http://www.girlsgogamestr.com/oyun/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(15, 15, (((((("http://www.asoyun.com/oyun/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(16, 17, (((((("http://www.game.com.my/permainan_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(16, 17, (((((("http://www.game.com.my/permainan_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(16, 17, (((((("http://www.game.com.my/permainan_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(16, 17, (((((("http://www.game.com.my/permainan_/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(42, 10, (((((("http://www.ojogos.pt/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(42, 10, (((((("http://www.ojogos.pt/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(42, 10, (((((("http://www.ojogos.pt/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(42, 10, (((((("http://www.ojogos.pt/jogo/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(43, 4, (((((("http://www.laro.com.ph/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(43, 4, (((((("http://www.laro.com.ph/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(43, 4, (((((("http://www.laro.com.ph/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(43, 4, (((((("http://www.laro.com.ph/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(44, 18, (((((("http://www.egames.jp/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(44, 18, (((((("http://www.egames.jp/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(44, 18, (((((("http://www.egames.jp/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(44, 18, (((((("http://www.egames.jp/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(45, 2, (((((("http://www.a10.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(45, 2, (((((("http://www.a10.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(45, 2, (((((("http://www.a10.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); O11111l1O.push(new O11111O00(45, 2, (((((("http://www.a10.com/game/" + O111111O0) + ".html?utm_medium=brandedgames_external&utm_campaign=") + O111111Ol) + "&utm_source=") + O11111l1l) + "&utm_content=play_with_highscore"))); } public function O11111O0l():void{ navigateToURL(new URLRequest(O11111l1O[((((O11111OOO - 1) * 4) + O1111100O1) - 1)].O11111Ol1), "_blank"); } public function O11111Oll(_arg1:String, _arg2:String, _arg3:String, _arg4:int):void{ O1111100O1 = _arg4; O11111l1l = _arg1; O111111Ol = _arg2; O111111O0 = _arg3; O11111l10(); } public function O11111O01():int{ return (O11111l1O[((((O11111OOO - 1) * 4) + O1111100O1) - 1)].O11111OOl); } public function O11111Ol0(_arg1:int=1):void{ O11111OOO = _arg1; } public function O11111O0O():int{ return (O11111l1O[((((O11111OOO - 1) * 4) + O1111100O1) - 1)].O11111OO0); } public static function O11111OlO():O1111111l{ if (O11111l11 == null){ O11111l11 = new (O1111111l); }; return (O11111l11); } } }//package O11111110 class O11111O00 { public var O11111Ol1:String; public var O11111OOl:int; public var O11111OO0:int; private function O11111O00(_arg1:int, _arg2:int, _arg3:String):void{ O11111OOl = _arg1; O11111OO0 = _arg2; O11111Ol1 = _arg3; } }
Section 277
//O1111111O (O11111110.O1111111O) package O11111110 { import flash.net.*; import flash.external.*; public class O1111111O { private static const O11111OOO:Array = ["www.zlonggamestest.com", "gamedev.dev.spilgames.com", "gamedev.dev.spillgroup.com", "www.agame.com", "www.girlsgogames.com", "www.games.co.uk", "www.mygames.co.uk", "www.girlsgogames.co.uk", "www.spel.nl", "www.spelletjes.nl", "www.girlsgogames.nl", "www.jetztspielen.de", "www.spielen.com", "www.girlsgogames.de", "www.jeux.fr", "www.jeu.fr", "www.girlsgogames.fr", "www.juegos.com", "www.zapjuegos.com", "www.juegosdechicas.com", "www.gioco.it", "www.giocaregratis.it", "www.girlsgogames.it", "www.gry.pl", "www.minigry.pl", "www.girlsgogames.pl", "www.spela.se", "www.spel.eu", "www.girlsgogames.se", "www.ojogos.pt", "www.ourgames.ru", "www.flashgames.ru", "www.girlsgogames.ru", "www.oyunlar123.com", "www.asoyun.com", "www.girlsgogamestr.com", "www.gamesgames.com", "www.agame.com", "www.girlsgogames.com", "www.juegos.com", "www.zapjuegos.com", "www.juegosdechicas.com", "www.ojogos.com.br", "www.clickjogos.com", "www.girlsgogames.com.br", "www.game.com.cn", "www.xiaoyouxi.com", "www.egames.jp", "www.game.co.in", "www.game.co.in", "www.girlsgogames.in", "www.games.co.id", "www.laro.com.ph", "www.game.com.my", "www.onrpg.com", "www.zlonggames.com", "www.a10.com"]; private static var O11111OOl:URLRequest; private static var O11111OO0; public function O1111111O():void{ super(); try { O11111OO0 = ExternalInterface.call("window.location.href.toString"); } catch(e) { O11111OO0 = "error"; }; if ((((O11111OO0 == null)) || ((O11111OO0 == "")))){ O11111OO0 = "error"; }; if (String(O11111OO0).indexOf(".swf") != -1){ O11111OO0 = "error"; }; } public function O11111OO1():Boolean{ if (((!((O11111Ol0(O11111O01(O11111OO0)) == -1))) && (!((O11111OO0 == "error"))))){ return (true); }; return (false); } private static function O11111O01(_arg1:String):String{ var _local2:String; var _local3:uint; _local2 = new String(); _local3 = 7; while (_local3 < _arg1.length) { if (_arg1.charAt(_local3) == "/"){ break; }; _local2 = (_local2 + _arg1.charAt(_local3)); _local3++; }; return (_local2); } private static function O11111Ol0(_arg1:String):Number{ var _local2:uint; if (((O11111OOO) && (_arg1))){ _local2 = 0; while (_local2 < O11111OOO.length) { if (_arg1 == O11111OOO[_local2]){ return (_local2); }; _local2++; }; return (-1); } else { trace("cannot find site name"); }; return (-1); } } }//package O11111110
Section 278
//Protection (screen.Protection) package screen { import flash.display.*; import tool.*; public class Protection extends MovieClip { private var _mc:Sprite; public function Protection(_arg1:Sprite){ initDis(_arg1); } public function del():void{ delDis(); } private function initDis(_arg1:Sprite):void{ _mc = Attach.getSprite("ProtectionMC"); _arg1.addChild(_mc); } private function delDis():void{ _mc.parent.removeChild(_mc); } } }//package screen
Section 279
//Brand (spill.localisation.Brand) package spill.localisation { import lib.*; public class Brand { public var domain:String; public var useGoogleAnalitics:Boolean;// = true public var emailPage:String; public var name:String; public var site_id:uint; public var isExternal:Boolean;// = false public var id:Number; public var hostingDomain:String;// = "" public var preferedLanguage:String;// = "" public var moreLink:String;// = "/moregames/" public var hasSendToFriendLink:Boolean;// = true public var portalGroup:uint; public var emailLink:String;// = "/game/" private static const topLevelDoubles:String = (((((((((((((("ac.cn,ac.jp,ac.uk,ad.jp,adm.br,adv.br,agr.br," + "ah.cn,am.br,arq.br,art.br,asn.au,ato.br,av.tr,bel.tr,bio.br,biz.tr,bj.cn,bmd.br,") + "cim.br,cng.br,cnt.br,co.at,co.jp,co.uk,com.au,com.br,com.cn,com.eg,com.hk,com.mx,") + "com.ru,com.tr,com.tw,conf.au,cq.cn,csiro.au,dr.tr,ecn.br,edu.au,edu.br,edu.tr,") + "emu.id.au,eng.br,esp.br,etc.br,eti.br,eun.eg,far.br,fj.cn,fm.br,fnd.br,fot.br,") + "fst.br,g12.br,gb.com,gb.net,gd.cn,gen.tr,ggf.br,gob.mx,gov.au,gov.br,gov.cn,") + "gov.hk,gov.tr,gr.jp,gs.cn,gx.cn,gz.cn,ha.cn,hb.cn,he.cn,hi.cn,hk.cn,hl.cn,hn.cn,") + "id.au,idv.tw,imb.br,ind.br,inf.br,info.au,info.tr,jl.cn,jor.br,js.cn,jx.cn,k12.tr,") + "lel.br,ln.cn,ltd.uk,mat.br,me.uk,med.br,mil.br,mil.tr,mo.cn,mus.br,name.tr,ne.jp,") + "net.au,net.br,net.cn,net.eg,net.hk,net.lu,net.mx,net.ru,net.tr,net.tw,net.uk,") + "nm.cn,no.com,nom.br,not.br,ntr.br,nx.cn,odo.br,oop.br,or.at,or.jp,org.au,org.br,") + "org.cn,org.hk,org.lu,org.ru,org.tr,org.tw,org.uk,plc.uk,pol.tr,pp.ru,ppg.br,pro.br,") + "psc.br,psi.br,qh.cn,qsl.br,rec.br,sc.cn,sd.cn,se.com,se.net,sh.cn,slg.br,sn.cn,") + "srv.br,sx.cn,tel.tr,tj.cn,tmp.br,trd.br,tur.br,tv.br,tw.cn,uk.com,uk.net,vet.br,") + "wattle.id.au,web.tr,xj.cn,xz.cn,yn.cn,zj.cn,zlg.br,co.nr,co.nz,com.fr,com.ph,"); public function Brand(){ moreLink = "/moregames/"; emailLink = "/game/"; useGoogleAnalitics = true; hasSendToFriendLink = true; preferedLanguage = ""; isExternal = false; hostingDomain = ""; super(); } private function get utm_source():String{ return (("utm_source=brandedgames_" + (isExternal) ? "external" : "internal")); } public function getMoreGamesLink(_arg1:String, _arg2:Boolean, _arg3:String="", _arg4:String=""):String{ var _local5:String; _local5 = ("http://" + domain); _local5 = (_local5 + moreLink); if (useGoogleAnalitics){ _local5 = (_local5 + ("?utm_medium=brandedgames_" + (_arg2) ? "external" : "internal")); _local5 = (_local5 + ("&utm_campaign=" + _arg1)); TestCode.traces("+++soure1+++", _arg2, _arg3); if (_arg3 != ""){ _local5 = (_local5 + ("&utm_source=" + stripSubDomain(_arg3))); }; if (((!((_arg4 == ""))) && (!((_arg4 == null))))){ _local5 = (_local5 + ("&utm_content=" + _arg4)); }; }; return (_local5); } private function get utm_campaign():String{ if (isExternal){ return (("utm_campaign=" + hostingDomain)); }; return (""); } private function get utm_term():String{ return ("utm_term="); } public function getSendToFriendLink(_arg1:String, _arg2:String, _arg3:Boolean, _arg4:String=""):String{ var _local5:String; if (!hasSendToFriendLink){ return (getMoreGamesLink(_arg1, _arg3)); }; _local5 = ("http://" + domain); _local5 = (_local5 + (emailLink + _arg2)); if (useGoogleAnalitics){ _local5 = (_local5 + ("?utm_medium=brandedgames_" + (_arg3) ? "external" : "internal")); _local5 = (_local5 + ("&utm_campaign=" + _arg1)); TestCode.traces("+++soure2+++", _arg3, _arg4); if (_arg4 != ""){ _local5 = (_local5 + ("&utm_source=" + stripSubDomain(_arg4))); }; _local5 = (_local5 + "&utm_content=send_to_friend"); }; return (_local5); } private static function stripSubDomain(_arg1:String):String{ var _local2:Array; if (!_arg1){ return (""); }; _local2 = _arg1.split("."); if (_local2.length <= 2){ return ("offline_play"); }; _local2 = _local2.reverse(); if (topLevelDoubles.indexOf((((_local2[1] + ".") + _local2[0]) + ",")) > 0){ return (((((_local2[2] + ".") + _local2[1]) + ".") + _local2[0])); }; return (((_local2[1] + ".") + _local2[0])); } } }//package spill.localisation
Section 280
//BrandingLogo (spill.localisation.BrandingLogo) package spill.localisation { import flash.events.*; import flash.display.*; public class BrandingLogo extends MovieClip { public function BrandingLogo(){ addFrameScript(0, frame1); super(); stop(); mouseEnabled = false; mouseChildren = false; addEventListener(Event.ADDED_TO_STAGE, added, false, 0, true); addEventListener(Event.REMOVED_FROM_STAGE, removed, false, 0, true); if (stage){ added(); }; brandingChanged(); } private function added(_arg1:Event=null):void{ brandingChanged(); SpilGame.addEventListener("brandingChanged", brandingChanged, false, 0, true); } private function brandingChanged(_arg1:Event=null):void{ if (SpilGame.currentBranding){ gotoAndStop(SpilGame.currentBranding.domain); }; } function frame1(){ stop(); } private function removed(_arg1:Event):void{ SpilGame.removeEventListener("brandingChanged", brandingChanged); } } }//package spill.localisation
Section 281
//Brandings (spill.localisation.Brandings) package spill.localisation { public class Brandings { private static var brands_by_id:Object = new Object(); private static var brands_by_domain:Object = new Object(); public static function getBrandByID(_arg1:Number):Brand{ return (brands_by_id[_arg1]); } public static function getBrandsArray():Array{ var _local1:Array; var _local2:Brand; _local1 = new Array(); for each (_local2 in brands_by_domain) { _local1.push(_local2); }; return (_local1); } private static function addBrand(_arg1:Brand):Brand{ if (brands_by_domain[_arg1.domain]){ trace(("ERROR: Attempting to add duplicate brand by domain: " + _arg1.domain)); } else { brands_by_domain[_arg1.domain] = _arg1; }; if (brands_by_id[_arg1.site_id]){ trace(("ERROR: Attempting to add duplicate brand by id: " + _arg1.site_id)); } else { brands_by_id[_arg1.site_id] = _arg1; }; return (_arg1); } public static function initialize():void{ var _local1:Brand; _local1 = new Brand(); _local1.site_id = 79; _local1.domain = "www.agame.com"; _local1.preferedLanguage = "en_us"; _local1.portalGroup = PortalGroup.TWEEN; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 88; _local1.domain = "www.gamesgames.com"; _local1.preferedLanguage = "en_us"; _local1.portalGroup = PortalGroup.FAMILY; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 90; _local1.domain = "www.girlsgogames.com"; _local1.preferedLanguage = "en_us"; _local1.portalGroup = PortalGroup.GIRL; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 45; _local1.domain = "www.a10.com"; _local1.moreLink = "/moregames/"; _local1.preferedLanguage = "en_us"; _local1.portalGroup = PortalGroup.TEEN; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 92; _local1.domain = "www.games.co.uk"; _local1.preferedLanguage = "en_uk"; _local1.portalGroup = PortalGroup.FAMILY; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 107; _local1.domain = "www.mygames.co.uk"; _local1.preferedLanguage = "en_uk"; _local1.portalGroup = PortalGroup.TWEEN; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 102; _local1.domain = "www.girlsgogames.co.uk"; _local1.preferedLanguage = "en_uk"; _local1.portalGroup = PortalGroup.GIRL; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 2; _local1.domain = "www.game.com.cn"; _local1.preferedLanguage = "cn"; _local1.portalGroup = PortalGroup.NONE; _local1.useGoogleAnalitics = false; _local1.hasSendToFriendLink = false; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 25; _local1.domain = "www.spel.nl"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "nl"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 1; _local1.domain = "www.spelletjes.nl"; _local1.emailLink = "/spel/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "nl"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 93; _local1.domain = "www.girlsgogames.nl"; _local1.emailLink = "/spel/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "nl"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 12; _local1.domain = "www.jeu.fr"; _local1.emailLink = "/jeu/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "fr"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 95; _local1.domain = "www.girlsgogames.fr"; _local1.emailLink = "/jeu/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "fr"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 11; _local1.domain = "www.jeux.fr"; _local1.emailLink = "/jeu/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "fr"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 26; _local1.domain = "www.spielen.com"; _local1.emailLink = "/spiel/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "de"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 94; _local1.domain = "www.girlsgogames.de"; _local1.emailLink = "/spiel/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "de"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 5; _local1.domain = "www.jetztspielen.de"; _local1.emailLink = "/spiel/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "de"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 109; _local1.domain = "www.minigry.pl"; _local1.emailLink = "/gra/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "pl"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 16; _local1.domain = "www.gry.pl"; _local1.emailLink = "/gra/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "pl"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 98; _local1.domain = "www.girlsgogames.pl"; _local1.emailLink = "/gra/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "pl"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 108; _local1.domain = "www.spel.eu"; _local1.emailLink = "/spel_/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "se"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 100; _local1.domain = "www.girlsgogames.se"; _local1.emailLink = "/spel_/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "se"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 44; _local1.domain = "www.spela.se"; _local1.emailLink = "/spel_/"; _local1.preferedLanguage = "se"; _local1.portalGroup = PortalGroup.FAMILY; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 106; _local1.domain = "www.giocaregratis.it"; _local1.emailLink = "/gioco/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "it"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 15; _local1.domain = "www.gioco.it"; _local1.emailLink = "/gioco/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "it"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 99; _local1.domain = "www.girlsgogames.it"; _local1.emailLink = "/gioco/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "it"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 97; _local1.domain = "www.zapjuegos.com"; _local1.emailLink = "/juego/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "es"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 86; _local1.domain = "www.juegos.com"; _local1.emailLink = "/juego/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "es"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 96; _local1.domain = "www.juegosdechicas.com"; _local1.emailLink = "/juego/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "es"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 122; _local1.domain = "www.girlsgogames.es"; _local1.emailLink = "/juego/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "es"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 91; _local1.domain = "www.clickjogos.com"; _local1.emailLink = "/jogo/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "br"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 101; _local1.domain = "www.girlsgogames.com.br"; _local1.emailLink = "/jogo/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "br"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 50; _local1.domain = "www.ojogos.com.br"; _local1.emailLink = "/jogo/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "br"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 55; _local1.domain = "www.games.co.id"; _local1.emailLink = "/permainanme/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "id"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 105; _local1.domain = "www.flashgames.ru"; _local1.emailLink = "/igra/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "ru"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 104; _local1.domain = "www.girlsgogames.ru"; _local1.emailLink = "/igra/"; _local1.portalGroup = PortalGroup.GIRL; _local1.preferedLanguage = "ru"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 103; _local1.domain = "www.ourgames.ru"; _local1.emailLink = "/igra/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "ru"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 24; _local1.domain = "www.game.co.in"; _local1.emailLink = "/game/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "in"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 87; _local1.domain = "www.ojogos.pt"; _local1.emailLink = "/jogo/"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = "pt"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 120; _local1.domain = "www.egames.jp"; _local1.emailLink = "/game/"; _local1.portalGroup = PortalGroup.TWEEN; _local1.preferedLanguage = "jp"; addBrand(_local1); _local1 = new Brand(); _local1.site_id = 0; _local1.domain = "gamedev.dev.spilgames.com"; _local1.portalGroup = PortalGroup.FAMILY; _local1.preferedLanguage = null; addBrand(_local1); } public static function getBrandByDomain(_arg1:String):Brand{ return (brands_by_domain[_arg1]); } public static function hasDomain(_arg1:String):Boolean{ return (!((brands_by_domain[_arg1] == null))); } } }//package spill.localisation
Section 282
//Language (spill.localisation.Language) package spill.localisation { public class Language { public var name:String; public var forceFont:String;// = null public var id:uint; public var portal_groups:Array; public var textLanguage:String; public var bwcId:int; public var embedFonts:Boolean;// = true public var displayName:String;// = "" public var dname:String; public function Language(_arg1:String, _arg2:String=null){ embedFonts = true; forceFont = null; displayName = ""; super(); name = _arg1; dname = _arg2; portal_groups = new Array(); } public function get p_teen():String{ return (portal_groups[PortalGroup.TEEN]); } public function get p_family():String{ return (portal_groups[PortalGroup.FAMILY]); } public function set p_teen(_arg1:String):void{ portal_groups[PortalGroup.TEEN] = _arg1; } public function get p_tween():String{ return (portal_groups[PortalGroup.TWEEN]); } public function get p_girl():String{ return (portal_groups[PortalGroup.GIRL]); } public function set p_family(_arg1:String):void{ portal_groups[PortalGroup.FAMILY] = _arg1; } public function set p_girl(_arg1:String):void{ portal_groups[PortalGroup.GIRL] = _arg1; } public function get displayAcronim():String{ return ((dname) ? dname : name); } public function set p_tween(_arg1:String):void{ portal_groups[PortalGroup.TWEEN] = _arg1; } } }//package spill.localisation
Section 283
//Languages (spill.localisation.Languages) package spill.localisation { public class Languages { public static var languages:Object = new Object(); private static var _init:Boolean = false; public static function initialize():void{ var _local1:Language; if (_init){ return; }; _init = true; _local1 = new Language("nl"); _local1.displayName = "Nederlands"; _local1.p_family = "www.spelletjes.nl"; _local1.p_tween = "www.spel.nl"; _local1.p_girl = "www.girlsgogames.nl"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 3; addLanguage(_local1); _local1 = new Language("es"); _local1.displayName = "Español"; _local1.p_family = "www.juegos.com"; _local1.p_tween = "www.zapjuegos.com"; _local1.p_girl = "www.girlsgogames.es"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 9; addLanguage(_local1); _local1 = new Language("pl"); _local1.displayName = "Polski"; _local1.p_family = "www.gry.pl"; _local1.p_tween = "www.minigry.pl"; _local1.p_girl = "www.girlsgogames.pl"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 6; addLanguage(_local1); _local1 = new Language("fr"); _local1.displayName = "Français"; _local1.p_family = "www.jeux.fr"; _local1.p_tween = "www.jeu.fr"; _local1.p_girl = "www.girlsgogames.fr"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 4; addLanguage(_local1); _local1 = new Language("en_us", "us"); _local1.displayName = "English (US)"; _local1.p_family = "www.gamesgames.com"; _local1.p_tween = "www.agame.com"; _local1.p_girl = "www.girlsgogames.com"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 1; addLanguage(_local1); addReference(_local1, "en"); _local1 = new Language("id"); _local1.displayName = "Bahasa Ind."; _local1.p_family = "www.games.co.id"; _local1.p_tween = "www.games.co.id"; _local1.p_girl = "www.games.co.id"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 11; addLanguage(_local1); _local1 = new Language("ru"); _local1.displayName = "Русский язык"; _local1.p_family = "www.ourgames.ru"; _local1.p_tween = "www.flashgames.ru"; _local1.p_girl = "www.girlsgogames.ru"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 12; addLanguage(_local1); _local1 = new Language("se"); _local1.displayName = "Svenska"; _local1.p_family = "www.spela.se"; _local1.p_tween = "www.spel.eu"; _local1.p_girl = "www.girlsgogames.se"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 7; addLanguage(_local1); addReference(_local1, "sv"); _local1 = new Language("it"); _local1.displayName = "Italiano"; _local1.p_family = "www.gioco.it"; _local1.p_tween = "www.giocaregratis.it"; _local1.p_girl = "www.girlsgogames.it"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 8; addLanguage(_local1); _local1 = new Language("en_uk", "uk"); _local1.displayName = "English (UK)"; _local1.p_family = "www.games.co.uk"; _local1.p_tween = "www.mygames.co.uk"; _local1.p_girl = "www.girlsgogames.co.uk"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 13; addLanguage(_local1); _local1 = new Language("cn"); _local1.displayName = "中文"; _local1.p_family = "www.game.com.cn"; _local1.p_tween = "www.game.com.cn"; _local1.p_girl = "www.game.com.cn"; _local1.p_teen = "www.game.com.cn"; _local1.bwcId = 2; _local1.embedFonts = false; _local1.forceFont = "_sans"; addLanguage(_local1); addReference(_local1, "zh-CN"); addReference(_local1, "zh-TW"); _local1 = new Language("pt"); _local1.displayName = "Português"; _local1.p_family = "www.ojogos.pt"; _local1.p_tween = "www.ojogos.pt"; _local1.p_girl = "www.ojogos.pt"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 17; addLanguage(_local1); _local1 = new Language("in"); _local1.displayName = "India"; _local1.p_family = "www.game.co.in"; _local1.p_tween = "www.game.co.in"; _local1.p_girl = "www.game.co.in"; _local1.p_teen = "www.a10.com"; _local1.textLanguage = "en_uk"; _local1.bwcId = 14; addLanguage(_local1); _local1 = new Language("de"); _local1.displayName = "Deutsch"; _local1.p_family = "www.jetztspielen.de"; _local1.p_tween = "www.spielen.com"; _local1.p_girl = "www.girlsgogames.de"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 5; addLanguage(_local1); _local1 = new Language("br"); _local1.displayName = "PortuguêsBR"; _local1.p_family = "www.ojogos.com.br"; _local1.p_tween = "www.clickjogos.com"; _local1.p_girl = "www.girlsgogames.com.br"; _local1.p_teen = "www.a10.com"; _local1.bwcId = 10; addLanguage(_local1); _local1 = new Language("jp"); _local1.displayName = "日本語"; _local1.p_family = "www.egames.jp"; _local1.p_tween = "www.egames.jp"; _local1.p_girl = "www.egames.jp"; _local1.p_teen = "www.a10.com"; _local1.embedFonts = false; _local1.forceFont = "_sans"; _local1.bwcId = 19; addLanguage(_local1); addReference(_local1, "ja"); } public static function getLanguagesArray():Array{ var _local1:Array; var _local2:Object; var _local3:Language; _local1 = new Array(); _local2 = new Object(); for each (_local3 in languages) { if (!_local2[_local3.name]){ _local1.push(_local3); _local2[_local3.name] = true; }; }; return (_local1); } public static function getLanguage(_arg1:String):Language{ return (languages[_arg1]); } private static function addLanguage(_arg1:Language):void{ languages[_arg1.name] = _arg1; } private static function addReference(_arg1:Language, _arg2:String):void{ languages[_arg2] = _arg1; } public static function getLanguageByOldID(_arg1:int):Language{ var _local2:Language; for each (_local2 in languages) { if (_local2.bwcId == _arg1){ return (_local2); }; }; return (null); } } }//package spill.localisation
Section 284
//LanguageSelectBox (spill.localisation.LanguageSelectBox) package spill.localisation { import flash.events.*; import flash.display.*; public class LanguageSelectBox extends MovieClip { private var flag:MovieClip; private var mc:MovieClip; private var popup:MovieClip; public function LanguageSelectBox(){ if (numChildren > 0){ removeChildAt(0); }; addEventListener(Event.ADDED_TO_STAGE, added, false, 0, true); addEventListener(Event.REMOVED_FROM_STAGE, removed, false, 0, true); addEventListener(MouseEvent.MOUSE_OVER, mouseOver, false, 0, true); addEventListener(MouseEvent.MOUSE_OUT, mouseOut, false, 0, true); Languages.initialize(); popup = new LanguageSelectPopup_mc(); x = Math.round(x); y = Math.round(y); popup.y = (-(Math.floor(popup.height)) + 1); popup.visible = false; addChild(popup); mc = new LanguageSelectBox_mc(); addChild(mc); flag = mc.flag; mc._language_show.mouseEnabled = false; if (stage){ added(); }; init(); languageChanged(); } private function added(_arg1:Event=null):void{ SpilGame.addEventListener("languageChanged", languageChanged, false, 0, true); } public function set popupLocation(_arg1:String):void{ trace(("popupLocation = " + _arg1)); if (_arg1 == "bottom"){ popup.y = (Math.floor(mc.height) - 2); } else { popup.y = (-(Math.floor(popup.height)) + 1); }; } private function init():void{ var _local1:int; var _local2:MovieClip; var _local3:Language; _local1 = 0; while (_local1 < popup.numChildren) { _local2 = MovieClip(popup.getChildAt(_local1)); _local2.addEventListener(MouseEvent.CLICK, itemClicked, true, 0, true); _local2.flag.gotoAndStop(_local2.name.substr(2)); _local2.flag.mouseEnabled = false; _local2.text.mouseEnabled = false; _local3 = Languages.getLanguage(_local2.name.substr(2)); if (_local3){ _local2.text.text = _local3.displayAcronim; } else { trace((("Error, '" + _local2.name.substr(2)) + "' language not found")); }; _local1++; }; } private function mouseOver(_arg1:MouseEvent):void{ popup.visible = true; } private function languageChanged(_arg1:Event=null):void{ if (SpilGame.currentLanguage){ flag.gotoAndStop(SpilGame.currentLanguage.name); mc._language_show.gotoAndStop(SpilGame.currentLanguage.displayName); }; } private function mouseOut(_arg1:MouseEvent):void{ popup.visible = false; } private function removed(_arg1:Event):void{ SpilGame.removeEventListener("languageChanged", languageChanged); } private function itemClicked(_arg1:MouseEvent):void{ SpilGame.changeLanguage(_arg1.currentTarget.name.substr(2)); popup.visible = false; } } }//package spill.localisation
Section 285
//LanguageSelectBox_mc (spill.localisation.LanguageSelectBox_mc) package spill.localisation { import flash.display.*; public dynamic class LanguageSelectBox_mc extends MovieClip { public var flag:MovieClip; public var _language_show:MovieClip; } }//package spill.localisation
Section 286
//LanguageSelectPopup_mc (spill.localisation.LanguageSelectPopup_mc) package spill.localisation { import flash.display.*; public dynamic class LanguageSelectPopup_mc extends MovieClip { public var l_in:MovieClip; public var l_br:MovieClip; public var l_cn:MovieClip; public var l_se:MovieClip; public var l_de:MovieClip; public var l_es:MovieClip; public var l_en_uk:MovieClip; public var l_fr:MovieClip; public var l_en_us:MovieClip; public var l_pl:MovieClip; public var l_pt:MovieClip; public var l_nl:MovieClip; public var l_id:MovieClip; public var l_it:MovieClip; public var l_jp:MovieClip; public var l_ru:MovieClip; } }//package spill.localisation
Section 287
//PortalGroup (spill.localisation.PortalGroup) package spill.localisation { public class PortalGroup { public static const FAMILY:uint = 0; public static const NONE:uint = 4; public static const TEEN:uint = 3; public static const TWEEN:uint = 1; public static const GIRL:uint = 2; } }//package spill.localisation
Section 288
//spil_internal (spill.localisation.spil_internal) package spill.localisation { public namespace spil_internal = "spill.localisation"; }//package spill.localisation
Section 289
//SpilGame (spill.localisation.SpilGame) package spill.localisation { import flash.net.*; import flash.events.*; import flash.display.*; import flash.text.*; import lib.*; import flash.ui.*; import flash.external.*; import flash.system.*; public class SpilGame { private static const cookiePath:String = "/"; private static const cookieLanguageVar:String = "savedLang"; public static const LANGUAGE_CHANGED:String = "languageChanged"; private static const cookieName:String = "spilgames_language_v100"; public static const BRANDING_CHANGED:String = "brandingChanged"; private static var strings:Object = new Object(); public static var currentBranding:Brand; private static var contexMenuItem:ContextMenuItem; spil_internal static var gameName:String; spil_internal static var debugEmbedDomain:String = ""; spil_internal static var debugHostDomain:String = ""; private static var localDomains:Object = new Object(); private static var iii = 0; spil_internal static var emailPage:String; private static var eventDispatcher:EventDispatcher; private static var _init:Boolean = false; public static var currentLanguage:Language; spil_internal static var portalGroup:uint; public static function getSpilCompanyLink():String{ if (currentLanguage.name == "cn"){ return ("http://www.game.com.cn/downloads/"); }; return ("http://www.gameportal.net"); } public static function getString(_arg1:String):String{ var _local2:Object; _local2 = strings[_arg1]; if (_local2){ if (currentLanguage.textLanguage){ return (_local2[currentLanguage.textLanguage]); }; return (_local2[currentLanguage.name]); //unresolved jump }; return (""); } public static function traceAllBrands():void{ trace(outputAllBrands()); } public static function initialize(_arg1:String, _arg2:int, _arg3:String, _arg4:Sprite):void{ if (_init){ trace("ERROR: LocalisationManager already initialised"); return; }; _init = true; localDomains["localhost"] = true; localDomains["www8.agame.com"] = true; localDomains["gamedev.dev.spilgames.com"] = true; Brandings.initialize(); Languages.initialize(); initContexMenu(_arg4); gameName = _arg1.replace(" ", "_"); portalGroup = _arg2; emailPage = _arg3; chooseLanguage(); setBrandingFromLanguage(); } private static function get isExternal():Boolean{ var _local1:*; trace("getIsEvternal"); iii++; _local1 = ((!(Brandings.hasDomain(embedDomain))) && (!(localDomains[embedDomain]))); Intro.showtext((((iii + ":") + _local1) + " | ")); return (_local1); } private static function initContexMenu(_arg1:Sprite):void{ contexMenuItem = new ContextMenuItem(""); _arg1.contextMenu = new ContextMenu(); _arg1.contextMenu.customItems.push(contexMenuItem); contexMenuItem.addEventListener(ContextMenuEvent.MENU_ITEM_SELECT, contexMenuClicked); } private static function replaceFn():String{ var _local2:String; _local2 = SpilGame.getString(arguments[1]); if (((!(_local2)) || ((_local2 == "")))){ return ((("{" + arguments[1]) + "}")); }; return (_local2); } private static function contexMenuClicked(_arg1:ContextMenuEvent):void{ navigateToURL(new URLRequest(getMoreGamesLink("Contex_Menu"))); } public static function initTextField(_arg1:TextField):void{ var _local2:TextFormat; trace(_arg1.text); _arg1.text = _arg1.text.replace(/{([^{}]*)}/g, replaceFn); trace(_arg1.text); _arg1.embedFonts = currentLanguage.embedFonts; if (currentLanguage.forceFont != ""){ _local2 = new TextFormat(); _local2.font = currentLanguage.forceFont; _arg1.setTextFormat(_local2); }; } spil_internal static function get hostingDomain():String{ var _local1:LocalConnection; if (debugHostDomain != ""){ return (debugHostDomain); }; _local1 = new LocalConnection(); return (_local1.domain); } spil_internal static function chooseLanguage():void{ if (cookieLanguage != null){ currentLanguage = cookieLanguage; } else { if (isExternal){ currentLanguage = systemLanguage; } else { currentLanguage = portalLanguage; if (!currentLanguage){ currentLanguage = systemLanguage; }; }; }; if (!currentLanguage){ trace("Unable to determine language, using 'English US'"); currentLanguage = Languages.getLanguage("en_us"); }; TextFieldFit.embedFonts = currentLanguage.embedFonts; TextFieldFit.forceFont = currentLanguage.forceFont; dispatchEvent(new Event(LANGUAGE_CHANGED)); } public static function importXMLv2(_arg1:XML):void{ var _local2:XML; var _local3:Object; var _local4:XML; for each (_local2 in _arg1.children()) { _local3 = (strings[_local2.attribute("identifier")] = new Object()); for each (_local4 in _local2.children()) { if (_local4.children().length() > 0){ _local3[_local4.name()] = _local4.children()[0].toString(); } else { _local3[_local4.name()] = ""; }; }; }; } spil_internal static function changeLanguage(_arg1:String):void{ var _local2:Language; _local2 = Languages.getLanguage(_arg1); if (!_local2){ trace("ERROR: Supplied language string does not have a matching language"); } else { cookieLanguage = _local2; currentLanguage = _local2; }; TextFieldFit.embedFonts = currentLanguage.embedFonts; TextFieldFit.forceFont = currentLanguage.forceFont; setBrandingFromLanguage(); dispatchEvent(new Event(LANGUAGE_CHANGED)); } public static function getSendToFriendLink():String{ return (currentBranding.getSendToFriendLink(gameName, emailPage, isExternal, embedDomain)); } public static function importXML(_arg1:XML):void{ var _local2:XML; var _local3:Object; var _local4:XML; for each (_local2 in _arg1.children()) { _local3 = (strings[_local2.identifier] = new Object()); for each (_local4 in _local2.children()) { _local3[_local4.name()] = _local4.children()[0].toString(); }; }; } spil_internal static function get systemLanguage():Language{ return (Languages.getLanguage(Capabilities.language)); } spil_internal static function set cookieLanguage(_arg1:Language):void{ var _local2:SharedObject; _local2 = SharedObject.getLocal(cookieName, cookiePath); if (_arg1 == null){ _local2.data[cookieLanguageVar] = null; } else { _local2.data[cookieLanguageVar] = _arg1.name; }; _local2.flush(); } spil_internal static function dispatchEvent(_arg1:Event):void{ if (!eventDispatcher){ eventDispatcher = new EventDispatcher(); }; eventDispatcher.dispatchEvent(_arg1); } private static function getDomain(_arg1:String):String{ var _local2:String; var _local3:uint; if (_arg1.indexOf("file") == 0){ return ("localhost"); }; _local2 = new String(); _local3 = 7; while (_local3 < _arg1.length) { if (_arg1.charAt(_local3) == "/"){ break; }; _local2 = (_local2 + _arg1.charAt(_local3)); _local3++; }; return (_local2); } spil_internal static function setBrandingFromLanguage():void{ var _local1:Brand; var _local2:uint; if (!isExternal){ _local1 = Brandings.getBrandByDomain(embedDomain); if (_local1){ if (currentLanguage.name == _local1.preferedLanguage){ currentBranding = _local1; } else { _local2 = 0; if (_local1.portalGroup == PortalGroup.NONE){ _local2 = portalGroup; } else { _local2 = _local1.portalGroup; }; currentBranding = Brandings.getBrandByDomain(currentLanguage.portal_groups[_local2]); }; } else { currentBranding = Brandings.getBrandByDomain(currentLanguage.portal_groups[portalGroup]); }; } else { currentBranding = Brandings.getBrandByDomain(currentLanguage.portal_groups[portalGroup]); }; if ((!(currentBranding) is Brand)){ currentBranding = Brandings.getBrandByDomain("www.agame.com"); }; contexMenuItem.caption = ("More Games: " + currentBranding.domain); dispatchEvent(new Event(BRANDING_CHANGED)); } public static function removeEventListener(_arg1:String, _arg2:Function, _arg3:Boolean=false):void{ if (!eventDispatcher){ eventDispatcher = new EventDispatcher(); }; eventDispatcher.removeEventListener(_arg1, _arg2, _arg3); } public static function outputAllBrands():String{ var _local1:Array; var _local2:String; var _local3:Brand; _local1 = Brandings.getBrandsArray(); _local2 = ""; for each (_local3 in _local1) { _local2 = (_local2 + (_local3.getSendToFriendLink(gameName, emailPage, isExternal, embedDomain) + "\n")); }; return (_local2); } public static function addEventListener(_arg1:String, _arg2:Function, _arg3:Boolean=false, _arg4:int=0, _arg5:Boolean=false):void{ if (!eventDispatcher){ eventDispatcher = new EventDispatcher(); }; eventDispatcher.addEventListener(_arg1, _arg2, _arg3, _arg4, _arg5); } public static function getMoreGamesLink(_arg1:String=""):String{ var _local2:String; _local2 = (embedDomain) ? embedDomain : hostingDomain; return (currentBranding.getMoreGamesLink(gameName, isExternal, _local2, _arg1)); } spil_internal static function get cookieLanguage():Language{ var _local1:SharedObject; var _local2:String; _local1 = SharedObject.getLocal(cookieName, cookiePath); _local2 = String(_local1.data[cookieLanguageVar]); return (Languages.getLanguage(_local2)); } private static function get portalLanguage():Language{ var _local1:Brand; var _local2:String; var _local3:Language; if (isExternal){ return (null); }; if (!embedDomain){ return (null); }; _local1 = Brandings.getBrandByDomain(embedDomain); if (!_local1){ return (null); }; _local2 = _local1.preferedLanguage; if (!_local2){ return (null); }; _local3 = Languages.getLanguage(_local2); if (!_local3){ return (null); }; return (_local3); } spil_internal static function get embedDomain():String{ var loc:String; if (debugEmbedDomain != ""){ return (debugEmbedDomain); }; if (ExternalInterface.available){ try { loc = ExternalInterface.call("window.location.href.toString"); if (((!((loc == ""))) && (!((loc == null))))){ trace(("embed domain = " + getDomain(loc))); return (getDomain(loc)); }; } catch(e:SecurityError) { trace(("Security Error connecting to external interface, error = " + e)); } catch(e:Error) { trace(("Error connecting to external interface, error = " + e)); }; }; return (null); } } }//package spill.localisation
Section 290
//SpilGamesLink (spill.localisation.SpilGamesLink) package spill.localisation { import flash.net.*; import flash.events.*; import flash.display.*; public class SpilGamesLink extends SimpleButton { public function SpilGamesLink(){ addEventListener(MouseEvent.CLICK, buttonClicked); } private function buttonClicked(_arg1:MouseEvent):void{ navigateToURL(new URLRequest(SpilGame.getSpilCompanyLink()), "_blank"); } } }//package spill.localisation
Section 291
//TextFieldFit (spill.localisation.TextFieldFit) package spill.localisation { import flash.events.*; import flash.display.*; import flash.text.*; import flash.filters.*; public class TextFieldFit extends MovieClip { protected var _text:String;// = "default" protected var _textSize:Number;// = 12 protected var _embedFonts:Boolean;// = true protected var _glowColor:uint;// = 0 private var h:Number; protected var _antiAliasType:String;// = "advanced" private var w:Number; protected var _useGlowFilter:Boolean;// = false protected var _hAlign:String;// = "left" protected var _textColor:uint;// = 0 protected var _glowStrength:Number;// = 5 protected var _glowBlur:Number;// = 3 private var field:TextField; protected var _gridFitType:String;// = "pixel" protected var _glowQuality:Number;// = 1 private var debugBounding:Sprite; protected var _multiline:Boolean;// = false protected var _font:String;// = "" protected var _underline:Boolean;// = false protected var _vAlign:String;// = "top" protected var _italic:Boolean;// = false protected var _bold:Boolean;// = false private var sizeChanged:Boolean;// = true private var embeddedFonts:Array; protected var _selectable:Boolean;// = false private var format:TextFormat; private var valid:Boolean;// = true private static const gutter:Number = 2; spil_internal static var embedFonts:Boolean = true; spil_internal static var forceAAType:String = null; spil_internal static var forceFont:String = null; public function TextFieldFit(){ var _local1:Number; var _local2:Number; sizeChanged = true; valid = true; _text = "default"; _textColor = 0; _textSize = 12; _multiline = false; _hAlign = "left"; _vAlign = "top"; _bold = false; _underline = false; _italic = false; _selectable = false; _font = ""; _embedFonts = true; _antiAliasType = "advanced"; _gridFitType = "pixel"; _useGlowFilter = false; _glowBlur = 3; _glowColor = 0; _glowStrength = 5; _glowQuality = 1; super(); _local1 = width; _local2 = height; if (numChildren > 0){ removeChildAt(0); }; if (!field){ field = new TextField(); addChild(field); }; field.border = false; field.background = false; field.type = TextFieldType.DYNAMIC; mouseEnabled = false; mouseChildren = false; format = new TextFormat(); embeddedFonts = Font.enumerateFonts(false); setSize(_local1, _local2); validate(); visible = false; if (stage){ addEventListener(Event.RENDER, init); stage.invalidate(); } else { init(); }; } private function resizeText(_arg1:Boolean=false):void{ if (!doesTextFit()){ format.size = Object((Number(format.size) - 1)); if (format.size <= 3){ trace("WARNING: Text resised to 3px, either an error occured or the text just wont fit"); return; }; field.setTextFormat(format); resizeText(true); } else { if (_arg1 == false){ while (doesTextFit()) { if (format.size <= textSize){ format.size = Object((Number(format.size) + 1)); field.setTextFormat(format); if (!doesTextFit()){ format.size = Object((Number(format.size) - 1)); field.setTextFormat(format); break; }; } else { break; }; }; }; }; } public function get italic():Boolean{ return (_italic); } public function get textColor():uint{ return (_textColor); } public function get vAlign():String{ return (_vAlign); } public function get useGlowFilter():Boolean{ return (_useGlowFilter); } public function get selectable():Boolean{ return (_selectable); } public function set italic(_arg1:Boolean):void{ _italic = _arg1; invalidate(); } public function set text(_arg1:String):void{ _text = _arg1; invalidate(); } public function set vAlign(_arg1:String):void{ _vAlign = _arg1; invalidate(); } public function get font():String{ return (_font); } public function set textColor(_arg1:uint):void{ _textColor = _arg1; invalidate(); } public function get antiAliasType():String{ return (_antiAliasType); } public function get bold():Boolean{ return (_bold); } public function set useGlowFilter(_arg1:Boolean):void{ _useGlowFilter = _arg1; invalidate(); } public function set font(_arg1:String):void{ _font = _arg1; invalidate(); } public function get embedFonts():Boolean{ return (_embedFonts); } public function set selectable(_arg1:Boolean):void{ _selectable = _arg1; invalidate(); } public function get multiline():Boolean{ return (_multiline); } public function get glowQuality():Number{ return (_glowQuality); } public function get gridFitType():String{ return (_gridFitType); } public function get underline():Boolean{ return (_underline); } public function get textSize():Number{ return (_textSize); } public function set antiAliasType(_arg1:String):void{ _antiAliasType = _arg1; invalidate(); } protected function updateProperties():void{ var _local1:Boolean; var _local2:Font; field.text = _text; field.multiline = ((((_text.indexOf(" ") < 0)) && ((_text.length < 14)))) ? false : _multiline; field.wordWrap = field.multiline; field.selectable = _selectable; field.antiAliasType = (forceAAType) ? forceAAType : _antiAliasType; field.gridFitType = _gridFitType; embeddedFonts = Font.enumerateFonts(false); if (((((_embedFonts) && (!((_font == ""))))) && (TextFieldFit.embedFonts))){ _local1 = false; for each (_local2 in embeddedFonts) { if (_font == _local2.fontName){ _local1 = true; break; }; }; field.embedFonts = _local1; if (!_local1){ trace(((("WARNING: Embedded font '" + _font) + "' not found, disabling embedding of fonts, text = ") + _text)); }; } else { field.embedFonts = false; }; if (TextFieldFit.forceFont){ format.font = TextFieldFit.forceFont; } else { if (_font != ""){ format.font = _font; }; }; if (sizeChanged){ format.size = _textSize; }; format.color = _textColor; format.align = _hAlign; format.bold = _bold; format.italic = _italic; format.underline = _underline; format.leftMargin = 0; format.rightMargin = 0; field.setTextFormat(format); if (_useGlowFilter){ filters = [new GlowFilter(_glowColor, 1, _glowBlur, _glowBlur, _glowStrength, _glowQuality)]; } else { filters = []; }; } private function doesTextFit():Boolean{ if (((((field.textHeight + (gutter * 2)) > h)) || (((((field.textWidth + (gutter * 2)) > w)) && (!(multiline)))))){ return (false); }; return (true); } public function get glowStrength():Number{ return (_glowStrength); } public function set hAlign(_arg1:String):void{ _hAlign = _arg1; invalidate(); } private function init(_arg1:Event=null):void{ removeEventListener(Event.RENDER, init); updateProperties(); layoutText(); } public function set bold(_arg1:Boolean):void{ _bold = _arg1; invalidate(); } private function validate(_arg1:Event=null):void{ visible = true; updateProperties(); layoutText(); removeEventListener(Event.ENTER_FRAME, validate); valid = true; } public function get text():String{ return (_text); } public function set glowBlur(_arg1:Number):void{ _glowBlur = _arg1; invalidate(); } private function invalidate():void{ if (valid){ addEventListener(Event.ENTER_FRAME, validate); if (stage){ stage.invalidate(); }; valid = false; }; } public function set embedFonts(_arg1:Boolean):void{ _embedFonts = _arg1; invalidate(); } public function set multiline(_arg1:Boolean):void{ _multiline = _arg1; invalidate(); } public function set glowQuality(_arg1:Number):void{ _glowQuality = _arg1; invalidate(); } private function layoutText():void{ resizeText(); field.height = (field.textHeight + (gutter * 2)); if (vAlign == "top"){ field.y = 0; } else { if (vAlign == "middle"){ field.y = ((h - field.height) / 2); } else { if (vAlign == "bottom"){ field.y = (h - field.height); }; }; }; } public function get hAlign():String{ return (_hAlign); } public function setSize(_arg1:Number, _arg2:Number):void{ w = _arg1; h = _arg2; scaleX = (scaleY = 1); field.width = w; field.height = h; invalidate(); } public function set gridFitType(_arg1:String):void{ _gridFitType = _arg1; invalidate(); } public function set underline(_arg1:Boolean):void{ _underline = _arg1; invalidate(); } public function get glowBlur():Number{ return (_glowBlur); } public function set textSize(_arg1:Number):void{ _textSize = _arg1; sizeChanged = true; invalidate(); } public function set glowColor(_arg1:uint):void{ _glowColor = _arg1; invalidate(); } public function get glowColor():uint{ return (_glowColor); } public function set glowStrength(_arg1:Number):void{ _glowStrength = _arg1; invalidate(); } } }//package spill.localisation
Section 292
//Attach (tool.Attach) package tool { import flash.display.*; import flash.media.*; import flash.utils.*; public class Attach { public static function getSound(_arg1:String):Sound{ var _local2:Class; var _local3:Sound; _local2 = (getDefinitionByName(_arg1) as Class); _local3 = new (_local2); return (_local3); } public static function getMovieClip(_arg1:String):MovieClip{ var _local2:Class; var _local3:MovieClip; _local2 = (getDefinitionByName(_arg1) as Class); _local3 = new (_local2); return (_local3); } public static function getSprite(_arg1:String):Sprite{ var _local2:Class; var _local3:Sprite; _local2 = (getDefinitionByName(_arg1) as Class); _local3 = new (_local2); return (_local3); } public static function getBitmapData(_arg1:String):BitmapData{ var _local2:Class; var _local3:BitmapData; _local2 = (getDefinitionByName(_arg1) as Class); _local3 = new _local2(null, null); return (_local3); } } }//package tool
Section 293
//_choose_2 (_choose_2) package { import flash.display.*; public dynamic class _choose_2 extends MovieClip { public var lock:MovieClip; public function _choose_2(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 294
//_choose_相片 (_choose_相片) package { import lib.*; public dynamic class _choose_相片 extends myButton { public function _choose_相片(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 295
//_dog (_dog) package { import lib.*; public dynamic class _dog extends Dog { public function _dog(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 296
//_levelShow (_levelShow) package { import flash.display.*; public dynamic class _levelShow extends MovieClip { } }//package
Section 297
//_link (_link) package { import lib.*; public dynamic class _link extends textShow { } }//package
Section 298
//_masks (_masks) package { import flash.display.*; public dynamic class _masks extends MovieClip { } }//package
Section 299
//_tool_14 (_tool_14) package { import flash.display.*; public dynamic class _tool_14 extends MovieClip { public function _tool_14(){ addFrameScript(0, frame1, 44, frame45); } function frame1(){ stop(); } function frame45(){ stop(); } } }//package
Section 300
//_tool_17 (_tool_17) package { import flash.display.*; public dynamic class _tool_17 extends MovieClip { public var mc:MovieClip; public function _tool_17(){ addFrameScript(0, frame1, 12, frame13); } function frame1(){ stop(); } function frame13(){ stop(); } } }//package
Section 301
//_tool_19 (_tool_19) package { import flash.display.*; public dynamic class _tool_19 extends MovieClip { public function _tool_19(){ addFrameScript(42, frame43); } function frame43(){ stop(); } } }//package
Section 302
//_tool_2 (_tool_2) package { import flash.display.*; public dynamic class _tool_2 extends MovieClip { public var mc:MovieClip; public function _tool_2(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 303
//_tool_24 (_tool_24) package { import flash.display.*; public dynamic class _tool_24 extends MovieClip { public var mc:MovieClip; public function _tool_24(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 304
//_tool_3 (_tool_3) package { import flash.display.*; public dynamic class _tool_3 extends MovieClip { public function _tool_3(){ addFrameScript(0, frame1, 25, frame26); } function frame1(){ stop(); } function frame26(){ stop(); } } }//package
Section 305
//_tool_6 (_tool_6) package { import flash.display.*; public dynamic class _tool_6 extends MovieClip { } }//package
Section 306
//_tool_7 (_tool_7) package { import flash.display.*; public dynamic class _tool_7 extends MovieClip { public function _tool_7(){ addFrameScript(0, frame1, 41, frame42); } function frame1(){ stop(); } function frame42(){ stop(); } } }//package
Section 307
//_tool_9 (_tool_9) package { import flash.display.*; public dynamic class _tool_9 extends MovieClip { public function _tool_9(){ addFrameScript(0, frame1, 54, frame55); } function frame1(){ stop(); } function frame55(){ stop(); } } }//package
Section 308
//_unlockNewTool (_unlockNewTool) package { import flash.display.*; import flash.text.*; public dynamic class _unlockNewTool extends MovieClip { public var bt0:按钮_continue; public var bg:MovieClip; public var txt:TextField; } }//package
Section 309
//BACK (BACK) package { import lib.*; public dynamic class BACK extends textShow { } }//package
Section 310
//Badge (Badge) package { import lib.*; public dynamic class Badge extends myButton { } }//package
Section 311
//badge_AllergicReaction (badge_AllergicReaction) package { import lib.*; public dynamic class badge_AllergicReaction extends textShow { } }//package
Section 312
//badge_Bighairbadge (badge_Bighairbadge) package { import lib.*; public dynamic class badge_Bighairbadge extends textShow { } }//package
Section 313
//badge_Blowdryspecialist (badge_Blowdryspecialist) package { import lib.*; public dynamic class badge_Blowdryspecialist extends textShow { } }//package
Section 314
//badge_CraftyCurler (badge_CraftyCurler) package { import lib.*; public dynamic class badge_CraftyCurler extends textShow { } }//package
Section 315
//badge_Eggtacy (badge_Eggtacy) package { import lib.*; public dynamic class badge_Eggtacy extends textShow { } }//package
Section 316
//badge_Greathairbadge (badge_Greathairbadge) package { import lib.*; public dynamic class badge_Greathairbadge extends textShow { } }//package
Section 317
//badge_HairMousseMaster (badge_HairMousseMaster) package { import lib.*; public dynamic class badge_HairMousseMaster extends textShow { } }//package
Section 318
//badge_Hugehairbadge (badge_Hugehairbadge) package { import lib.*; public dynamic class badge_Hugehairbadge extends textShow { } }//package
Section 319
//badge_Hypnotizinghairstylist (badge_Hypnotizinghairstylist) package { import lib.*; public dynamic class badge_Hypnotizinghairstylist extends textShow { } }//package
Section 320
//badge_Peanutbutterbuttercup (badge_Peanutbutterbuttercup) package { import lib.*; public dynamic class badge_Peanutbutterbuttercup extends textShow { } }//package
Section 321
//badge_ToxinsRus (badge_ToxinsRus) package { import lib.*; public dynamic class badge_ToxinsRus extends textShow { } }//package
Section 322
//badge_Unlawfularrest (badge_Unlawfularrest) package { import lib.*; public dynamic class badge_Unlawfularrest extends textShow { } }//package
Section 323
//badge_WallpaperWarrior (badge_WallpaperWarrior) package { import lib.*; public dynamic class badge_WallpaperWarrior extends textShow { } }//package
Section 324
//BIGHAIR (BIGHAIR) package { import lib.*; public dynamic class BIGHAIR extends textShow { } }//package
Section 325
//BONUSPOINTS (BONUSPOINTS) package { import lib.*; public dynamic class BONUSPOINTS extends textShow { } }//package
Section 326
//button_click (button_click) package { import flash.media.*; public dynamic class button_click extends Sound { } }//package
Section 327
//Button_disabledSkin (Button_disabledSkin) package { import flash.display.*; public dynamic class Button_disabledSkin extends MovieClip { } }//package
Section 328
//Button_downSkin (Button_downSkin) package { import flash.display.*; public dynamic class Button_downSkin extends MovieClip { } }//package
Section 329
//Button_emphasizedSkin (Button_emphasizedSkin) package { import flash.display.*; public dynamic class Button_emphasizedSkin extends MovieClip { } }//package
Section 330
//button_huichen (button_huichen) package { import flash.display.*; public dynamic class button_huichen extends MovieClip { public function button_huichen(){ addFrameScript(25, frame26); } function frame26(){ try { MovieClip(parent).removeChild(this); } catch(err) { }; } } }//package
Section 331
//button_over (button_over) package { import flash.media.*; public dynamic class button_over extends Sound { } }//package
Section 332
//Button_overSkin (Button_overSkin) package { import flash.display.*; public dynamic class Button_overSkin extends MovieClip { } }//package
Section 333
//Button_selectedDisabledSkin (Button_selectedDisabledSkin) package { import flash.display.*; public dynamic class Button_selectedDisabledSkin extends MovieClip { } }//package
Section 334
//Button_selectedDownSkin (Button_selectedDownSkin) package { import flash.display.*; public dynamic class Button_selectedDownSkin extends MovieClip { } }//package
Section 335
//Button_selectedOverSkin (Button_selectedOverSkin) package { import flash.display.*; public dynamic class Button_selectedOverSkin extends MovieClip { } }//package
Section 336
//Button_selectedUpSkin (Button_selectedUpSkin) package { import flash.display.*; public dynamic class Button_selectedUpSkin extends MovieClip { } }//package
Section 337
//Button_upSkin (Button_upSkin) package { import flash.display.*; public dynamic class Button_upSkin extends MovieClip { } }//package
Section 338
//CellRenderer_disabledSkin (CellRenderer_disabledSkin) package { import flash.display.*; public dynamic class CellRenderer_disabledSkin extends MovieClip { } }//package
Section 339
//CellRenderer_downSkin (CellRenderer_downSkin) package { import flash.display.*; public dynamic class CellRenderer_downSkin extends MovieClip { } }//package
Section 340
//CellRenderer_overSkin (CellRenderer_overSkin) package { import flash.display.*; public dynamic class CellRenderer_overSkin extends MovieClip { } }//package
Section 341
//CellRenderer_selectedDisabledSkin (CellRenderer_selectedDisabledSkin) package { import flash.display.*; public dynamic class CellRenderer_selectedDisabledSkin extends MovieClip { } }//package
Section 342
//CellRenderer_selectedDownSkin (CellRenderer_selectedDownSkin) package { import flash.display.*; public dynamic class CellRenderer_selectedDownSkin extends MovieClip { } }//package
Section 343
//CellRenderer_selectedOverSkin (CellRenderer_selectedOverSkin) package { import flash.display.*; public dynamic class CellRenderer_selectedOverSkin extends MovieClip { } }//package
Section 344
//CellRenderer_selectedUpSkin (CellRenderer_selectedUpSkin) package { import flash.display.*; public dynamic class CellRenderer_selectedUpSkin extends MovieClip { } }//package
Section 345
//CellRenderer_upSkin (CellRenderer_upSkin) package { import flash.display.*; public dynamic class CellRenderer_upSkin extends MovieClip { } }//package
Section 346
//Clicdragandmovemousein (Clicdragandmovemousein) package { import lib.*; public dynamic class Clicdragandmovemousein extends textShow { } }//package
Section 347
//Click11 (Click11) package { import lib.*; public dynamic class Click11 extends textShow { } }//package
Section 348
//Clickdragand (Clickdragand) package { import lib.*; public dynamic class Clickdragand extends textShow { } }//package
Section 349
//Clickdraganddrop111 (Clickdraganddrop111) package { import lib.*; public dynamic class Clickdraganddrop111 extends textShow { } }//package
Section 350
//Clickdragandm (Clickdragandm) package { import lib.*; public dynamic class Clickdragandm extends textShow { } }//package
Section 351
//COM_LoadingBar (COM_LoadingBar) package { import flash.display.*; public dynamic class COM_LoadingBar extends MovieClip { } }//package
Section 352
//COM_LoadingProgress (COM_LoadingProgress) package { import flash.display.*; public dynamic class COM_LoadingProgress extends MovieClip { } }//package
Section 353
//ComboBox_disabledSkin (ComboBox_disabledSkin) package { import flash.display.*; public dynamic class ComboBox_disabledSkin extends MovieClip { } }//package
Section 354
//ComboBox_downSkin (ComboBox_downSkin) package { import flash.display.*; public dynamic class ComboBox_downSkin extends MovieClip { } }//package
Section 355
//ComboBox_overSkin (ComboBox_overSkin) package { import flash.display.*; public dynamic class ComboBox_overSkin extends MovieClip { } }//package
Section 356
//ComboBox_upSkin (ComboBox_upSkin) package { import flash.display.*; public dynamic class ComboBox_upSkin extends MovieClip { } }//package
Section 357
//CONTINUE (CONTINUE) package { import lib.*; public dynamic class CONTINUE extends textShow { } }//package
Section 358
//copy (copy) package { import lib.*; public dynamic class copy extends textShow { } }//package
Section 359
//Copythiscodebyclickingt (Copythiscodebyclickingt) package { import lib.*; public dynamic class Copythiscodebyclickingt extends textShow { } }//package
Section 360
//createasmanybig (createasmanybig) package { import lib.*; public dynamic class createasmanybig extends textShow { } }//package
Section 361
//Doyouknowthe (Doyouknowthe) package { import lib.*; public dynamic class Doyouknowthe extends textShow { } }//package
Section 362
//DragaTooltousetheh (DragaTooltousetheh) package { import lib.*; public dynamic class DragaTooltousetheh extends textShow { } }//package
Section 363
//DragaTooltousethehair (DragaTooltousethehair) package { import lib.*; public dynamic class DragaTooltousethehair extends textShow { } }//package
Section 364
//drop2 (drop2) package { import lib.*; public dynamic class drop2 extends textShow { } }//package
Section 365
//Faketoolss (Faketoolss) package { import lib.*; public dynamic class Faketoolss extends textShow { } }//package
Section 366
//Fastworkforalooktha (Fastworkforalooktha) package { import lib.*; public dynamic class Fastworkforalooktha extends textShow { } }//package
Section 367
//FINALSCORE (FINALSCORE) package { import lib.*; public dynamic class FINALSCORE extends textShow { } }//package
Section 368
//FINALSCOREtt (FINALSCOREtt) package { import lib.*; public dynamic class FINALSCOREtt extends textShow { } }//package
Section 369
//focusRectSkin (focusRectSkin) package { import flash.display.*; public dynamic class focusRectSkin extends MovieClip { } }//package
Section 370
//GAMECOMPLETEtt (GAMECOMPLETEtt) package { import lib.*; public dynamic class GAMECOMPLETEtt extends textShow { } }//package
Section 371
//GAMECOMPLETEttt (GAMECOMPLETEttt) package { import lib.*; public dynamic class GAMECOMPLETEttt extends textShow { } }//package
Section 372
//GAMEOVERYOULOSE (GAMEOVERYOULOSE) package { import lib.*; public dynamic class GAMEOVERYOULOSE extends textShow { } }//package
Section 373
//GOMAKEIRtt (GOMAKEIRtt) package { import lib.*; public dynamic class GOMAKEIRtt extends textShow { } }//package
Section 374
//gougou_jiao (gougou_jiao) package { import flash.media.*; public dynamic class gougou_jiao extends Sound { } }//package
Section 375
//GREATHAIR (GREATHAIR) package { import lib.*; public dynamic class GREATHAIR extends textShow { } }//package
Section 376
//HAHA (HAHA) package { import lib.*; public dynamic class HAHA extends textShow { } }//package
Section 377
//hairmanialogo (hairmanialogo) package { import lib.*; public dynamic class hairmanialogo extends textShow { } }//package
Section 378
//HAIRSCOR (HAIRSCOR) package { import lib.*; public dynamic class HAIRSCOR extends textShow { } }//package
Section 379
//Hand (Hand) package { import flash.display.*; public dynamic class Hand extends MovieClip { } }//package
Section 380
//highscore (highscore) package { import lib.*; public dynamic class highscore extends textShow { } }//package
Section 381
//howtoplay (howtoplay) package { import lib.*; public dynamic class howtoplay extends textShow { } }//package
Section 382
//HUGEHAIRss (HUGEHAIRss) package { import lib.*; public dynamic class HUGEHAIRss extends textShow { } }//package
Section 383
//IaskedforaGreatD (IaskedforaGreatD) package { import lib.*; public dynamic class IaskedforaGreatD extends textShow { } }//package
Section 384
//Ifanycustomersl (Ifanycustomersl) package { import lib.*; public dynamic class Ifanycustomersl extends textShow { } }//package
Section 385
//Isyourmousedisconnecte (Isyourmousedisconnecte) package { import lib.*; public dynamic class Isyourmousedisconnecte extends textShow { } }//package
Section 386
//language (language) package { import flash.events.*; import spill.localisation.*; public class language { public static var send_to_friend:Object = {}; private static var textList:Array = [["0", "0"], ["en_us", "1"], ["cn", "2"], ["nl", "3"], ["fr", "4"], ["de", "5"], ["es", "6"], ["br", "7"], ["pt", "8"], ["it", "9"], ["se", "10"], ["pl", "11"], ["ru", "12"], ["id", "13"], ["14", "14"], ["my", "15"], ["ph", "en_uk", "in"], ["jp", "17"], ["18", "18"], ["19", "19"], ["20", "20"], ["21", "21"], ["22", "22"], ["23", "23"], ["24", "24"], ["25", "25"], ["26", "26"], ["27", "27"], ["28", "28"], ["29", "29"]]; public function language(){ SpilGame.addEventListener("languageChanged", languageChanged, false, 0, true); send_to_friend["en_us"] = "http://www.gamesgames.com/game/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["cn"] = "http://www.game.com.cn/moregames/"; send_to_friend["nl"] = "http://www.spelletjes.nl/spel/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["fr"] = "http://www.jeux.fr/jeu/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["de"] = "http://www.jetztspielen.de/spiel/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["pl"] = "http://www.gry.pl/gra/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["se"] = "http://www.spela.se/spel_/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["it"] = "http://www.gioco.it/gioco/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["es"] = "http://www.juegos.com/juego/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["pt"] = "http://www.ojogos.pt/jogo/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["br"] = "http://www.ojogos.com.br/jogo/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["ru"] = "http://www.ourgames.ru/igra/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["id"] = "http://www.games.co.id/permainanme/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["en_uk"] = "http://www.games.co.uk/game/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["in"] = "http://www.game.co.in/game/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; send_to_friend["jp"] = "http://www.egames.jp/game/Hair-Mania.html?utm_medium=brandedgames_external&utm_campaign=Hair_Mania&utm_source=&utm_content=send_to_friend"; } public static function get language_nr():int{ var _local1:*; var _local2:*; if (SpilGame.currentBranding){ _local1 = 0; while (_local1 < textList.length) { _local2 = 0; while (_local2 < textList[_local1].length) { if (SpilGame.currentLanguage.name == textList[_local1][_local2]){ return (_local1); }; _local2++; }; _local1++; }; return (1); //unresolved jump }; return (1); } public static function get send_to_friend_url(){ return (send_to_friend[SpilGame.currentLanguage.name]); } private static function languageChanged(_arg1:Event=null){ if (SpilGame.currentLanguage){ trace("自己的 Language.as: languageChanged", SpilGame.currentLanguage.name, SpilGame.currentLanguage.displayName, SpilGame.currentLanguage.embedFonts); trace("当前语言版本:", SpilGame.currentLanguage.name, "数字:", language.language_nr); }; } } }//package
Section 387
//Lethe_Alert_Page (Lethe_Alert_Page) package { import flash.display.*; public dynamic class Lethe_Alert_Page extends MovieClip { } }//package
Section 388
//Lethe_All_Logo (Lethe_All_Logo) package { import flash.display.*; public dynamic class Lethe_All_Logo extends MovieClip { } }//package
Section 389
//Lethe_BackGround (Lethe_BackGround) package { import flash.display.*; public dynamic class Lethe_BackGround extends MovieClip { } }//package
Section 390
//Lethe_Button_Back (Lethe_Button_Back) package { import flash.display.*; public dynamic class Lethe_Button_Back extends MovieClip { } }//package
Section 391
//Lethe_Button_Down (Lethe_Button_Down) package { import flash.display.*; public dynamic class Lethe_Button_Down extends MovieClip { public var _txt:MovieClip; } }//package
Section 392
//Lethe_Button_Down2 (Lethe_Button_Down2) package { import flash.display.*; public dynamic class Lethe_Button_Down2 extends MovieClip { public var _txt:MovieClip; } }//package
Section 393
//Lethe_Button_Down3 (Lethe_Button_Down3) package { import flash.display.*; public dynamic class Lethe_Button_Down3 extends MovieClip { public var _txt:MovieClip; } }//package
Section 394
//Lethe_Button_Up (Lethe_Button_Up) package { import flash.display.*; public dynamic class Lethe_Button_Up extends MovieClip { public var _txt:Lethe_Day_Text; } }//package
Section 395
//Lethe_Button_Up2 (Lethe_Button_Up2) package { import flash.display.*; public dynamic class Lethe_Button_Up2 extends MovieClip { public var _txt:Lethe_Week_Text; } }//package
Section 396
//Lethe_Button_Up3 (Lethe_Button_Up3) package { import flash.display.*; public dynamic class Lethe_Button_Up3 extends MovieClip { public var _txt:Lethe_Month_Text; } }//package
Section 397
//Lethe_Continue_Button (Lethe_Continue_Button) package { import flash.display.*; public dynamic class Lethe_Continue_Button extends MovieClip { public function Lethe_Continue_Button(){ addFrameScript(0, frame1); } function frame1(){ } } }//package
Section 398
//Lethe_Day_Text (Lethe_Day_Text) package { import lib.*; public dynamic class Lethe_Day_Text extends textShow { } }//package
Section 399
//Lethe_Drag_Block (Lethe_Drag_Block) package { import flash.display.*; public dynamic class Lethe_Drag_Block extends MovieClip { } }//package
Section 400
//Lethe_DragArea (Lethe_DragArea) package { import flash.display.*; public dynamic class Lethe_DragArea extends MovieClip { } }//package
Section 401
//Lethe_FocusLine (Lethe_FocusLine) package { import flash.display.*; public dynamic class Lethe_FocusLine extends MovieClip { } }//package
Section 402
//Lethe_LineBack (Lethe_LineBack) package { import flash.display.*; public dynamic class Lethe_LineBack extends MovieClip { } }//package
Section 403
//Lethe_LineBack2 (Lethe_LineBack2) package { import flash.display.*; public dynamic class Lethe_LineBack2 extends MovieClip { } }//package
Section 404
//Lethe_Link_Button (Lethe_Link_Button) package { import flash.display.*; public dynamic class Lethe_Link_Button extends MovieClip { public function Lethe_Link_Button(){ addFrameScript(0, frame1); } function frame1(){ } } }//package
Section 405
//Lethe_Loading_Text (Lethe_Loading_Text) package { import flash.display.*; public dynamic class Lethe_Loading_Text extends MovieClip { } }//package
Section 406
//Lethe_Month_Text (Lethe_Month_Text) package { import lib.*; public dynamic class Lethe_Month_Text extends textShow { } }//package
Section 407
//Lethe_PreviewMc (Lethe_PreviewMc) package { import flash.display.*; public dynamic class Lethe_PreviewMc extends MovieClip { } }//package
Section 408
//Lethe_Scroll_Bar (Lethe_Scroll_Bar) package { import flash.display.*; public dynamic class Lethe_Scroll_Bar extends MovieClip { } }//package
Section 409
//Lethe_Scroll_Down (Lethe_Scroll_Down) package { import flash.display.*; public dynamic class Lethe_Scroll_Down extends MovieClip { } }//package
Section 410
//Lethe_Scroll_Up (Lethe_Scroll_Up) package { import flash.display.*; public dynamic class Lethe_Scroll_Up extends MovieClip { } }//package
Section 411
//Lethe_Text1 (Lethe_Text1) package { import lib.*; public dynamic class Lethe_Text1 extends textShow { } }//package
Section 412
//Lethe_Text2 (Lethe_Text2) package { import lib.*; public dynamic class Lethe_Text2 extends textShow { } }//package
Section 413
//Lethe_Text3 (Lethe_Text3) package { import flash.display.*; public dynamic class Lethe_Text3 extends MovieClip { } }//package
Section 414
//Lethe_Week_Text (Lethe_Week_Text) package { import lib.*; public dynamic class Lethe_Week_Text extends textShow { } }//package
Section 415
//LevelComplete_show (LevelComplete_show) package { import flash.display.*; public dynamic class LevelComplete_show extends MovieClip { public function LevelComplete_show(){ addFrameScript(0, frame1, 96, frame97); } function frame97(){ stop(); } function frame1(){ stop(); } } }//package
Section 416
//LEVELCOMPLETEt (LEVELCOMPLETEt) package { import lib.*; public dynamic class LEVELCOMPLETEt extends textShow { } }//package
Section 417
//LEVELFAILED (LEVELFAILED) package { import lib.*; public dynamic class LEVELFAILED extends textShow { } }//package
Section 418
//LevelMap (LevelMap) package { import lib.*; public dynamic class LevelMap extends textShow { } }//package
Section 419
//levelmapinfo (levelmapinfo) package { import lib.*; public dynamic class levelmapinfo extends textShow { } }//package
Section 420
//List_skin (List_skin) package { import flash.display.*; public dynamic class List_skin extends MovieClip { } }//package
Section 421
//loadingtt (loadingtt) package { import lib.*; public dynamic class loadingtt extends textShow { } }//package
Section 422
//MAINMENU (MAINMENU) package { import lib.*; public dynamic class MAINMENU extends textShow { } }//package
Section 423
//Maybeyouneedtoreadtheinstr (Maybeyouneedtoreadtheinstr) package { import lib.*; public dynamic class Maybeyouneedtoreadtheinstr extends textShow { } }//package
Section 424
//morecrazygamesat (morecrazygamesat) package { import lib.*; public dynamic class morecrazygamesat extends textShow { } }//package
Section 425
//MyHairManiatt (MyHairManiatt) package { import lib.*; public dynamic class MyHairManiatt extends textShow { } }//package
Section 426
//O11111111 (O11111111) package { import flash.net.*; import flash.events.*; import flash.display.*; import flash.text.*; import O11111110.*; import flash.utils.*; import flash.system.*; public class O11111111 extends MovieClip { private const O11111OO1:Array; private var O11111OO0:Number; private var O11111OOO:MovieClip; private var O11111OOl; private var O11111O01:Boolean;// = false private var O11111O00; private var O11111O0O:Loader; private var O11111O0l; private var O111111l1:String; private var O111111lO:int; private var O111111ll:Number; private var O11111l11; private var oddLineColor:Number; private var O111111O0:String; private var O111111O1:String; private var O11111l1O; private var O11111Ol0:MovieClip; private var O11111Ol1:Array; private var O111111OO:String; private var O111111Ol:String; private var O11111OlO:String; private var O1111100O1:int; private var O11111Oll:Boolean; private var evenLineColor:Number; private var noticeLineColor:Number; private var selfLineColor:Number; public function O11111111():void{ var O11111l1l:int; var O11111l10:*; O11111O01 = false; O11111OO1 = ["Failed to get highscores.", "Failed to get highscores.", "Failed to get highscores.", "Failed to get highscores.", "Ophalen van de highscores mislukt", "Classement échoué.", "Highscores konnten nicht geladen werden.", "Error al cargar las puntuaciones máximas.", "Os recordes não foram recebidos.", "Não conseguiu obter uma das melhores pontuações", "Impossibile recuperare dati sui record.", "Kunde ej hämta toppoäng.", "Pobieranie rankingu nie powiodło się.", "Ошибка! Получить данные о рекордах не удалось!", "Yüksek skorlar alınamadı.", "Gagal untuk mendapatkan skor tertinggi", "Gagal mendapatkan skor tertinggi.", "ハイスコア情報の取得に失敗しました", "获取排行榜失败"]; super(); Security.allowDomain("*"); O11111OOl = this.parent; O11111OOl.stop(); O11111l1l = 0; while (true) { try { O11111l10 = O11111OOl.getChildAt(O11111l1l); if ((O11111l10 is MovieClip)){ O11111l10.visible = false; } else { O11111OOl.removeChild(O11111l10); }; O11111l1l = (O11111l1l + 1); } catch(O11111llO:Error) { break; }; }; try { O11111OOl["O111111O"] = O111110lO; } catch(O11111llO:Error) { }; } private function O1111100O(_arg1:MouseEvent):void{ _arg1.currentTarget.gotoAndStop(1); } private function O1111O1l1(_arg1):void{ removeEventListener(Event.ENTER_FRAME, O111110ll); O11111l11.visible = true; O11111O00.text = O11111OO1[(O1111111l.O11111OlO().O11111O0O() - 1)]; } private function O1111100l(_arg1:MouseEvent):void{ _arg1.currentTarget.gotoAndStop(3); } private function O1111O1lO(_arg1:Event):void{ O11111OOl.dispatchEvent(_arg1); } public function O11111O11():void{ if (O11111l1O != null){ O11111l1O.O11111l0O(); }; } public function get O11111O10():Boolean{ return (O11111O01); } private function O1111O1O0(_arg1:String){ return (getDefinitionByName(_arg1)); } public function O11111O1O():void{ if (O11111l1O != null){ O11111l1O.O11111l1l(); }; } public function O11111O1l(_arg1:int, _arg2:String):void{ if (O11111l1O != null){ O11111l1O.O11111l10(_arg1, _arg2); }; } private function O1111O1OO(_arg1:MouseEvent):void{ this.O1111O1lO(new Event("00000100110")); } private function O1111O1O1():void{ var O111110O1:*; var O111110OO:*; var O111110Ol:*; var O111110O0:*; var O11111l1l:int; var O11111l01:int; var O1111101l:*; var O11111l10:*; var O111110l1:*; O111110O1 = getDefinitionByName("Lethe_Button_Back"); O111110OO = getDefinitionByName("Lethe_Loading_Text"); O111110Ol = getDefinitionByName("COM_LoadingProgress"); O111110O0 = getDefinitionByName("Lethe_Text3"); O11111l1l = 0; O11111l01 = 0; while (true) { try { O11111l10 = O11111OOO.getChildAt(O11111l1l); if ((O11111l10 is O111110O1)){ O11111l11 = O11111l10; O11111001(O11111l11); O11111l01 = 0; while (true) { try { O1111101l = O11111l11.getChildAt(O11111l01); if ((O1111101l is O111110O0)){ O1111101l.gotoAndStop(O1111111l.O11111OlO().O11111O0O()); break; }; O11111l01 = (O11111l01 + 1); } catch(O11111llO:Error) { break; }; }; O11111l11.visible = false; try { O11111l10.removeEventListener(MouseEvent.CLICK, O1111O1OO); } catch(e:Error) { }; O11111l10.addEventListener(MouseEvent.CLICK, O1111O1OO, false, 0, true); } else { if ((O11111l10 is O111110OO)){ O11111l01 = 0; while (true) { try { O111110l1 = O11111l10.getChildAt(O11111l01); if ((O111110l1 is TextField)){ O11111O00 = O111110l1; break; }; O11111l01 = (O11111l01 + 1); } catch(O11111llO:Error) { break; }; }; } else { if ((O11111l10 is O111110Ol)){ O11111O0l = O11111l10; O11111O0l.stop(); }; }; }; O11111l1l = (O11111l1l + 1); } catch(O11111llO:Error) { break; }; }; } private function O1111O1Ol(_arg1:Event):void{ this.dispatchEvent(new Event(Event.COMPLETE)); O11111l1O = _arg1.currentTarget.content; O11111l1O.addEventListener("000111000100", O1111O1lO); O11111l1O.addEventListener("00111111000", O1111O1lO); O11111l1O.addEventListener("000000000000", O1111O1lO); O11111l1O.addEventListener("010101010100", O1111O1lO); O11111l1O.addEventListener("000001111111", O1111O1lO); O11111l1O.O11111l1O(O11111OO0, O111111lO, O111111ll, O111111Ol, O11111O10, O1111111l.O11111OlO().O11111OOO, O111111O1, evenLineColor, oddLineColor, noticeLineColor, selfLineColor); O11111l1O.O11111l11(O1111O1O0("Lethe_BackGround"), O1111O1O0("Lethe_Button_Down"), O1111O1O0("Lethe_Button_Down2"), O1111O1O0("Lethe_Button_Down3"), O1111O1O0("Lethe_Button_Up"), O1111O1O0("Lethe_Button_Up2"), O1111O1O0("Lethe_Button_Up3"), O1111O1O0("Lethe_FocusLine"), O1111O1O0("Lethe_LineBack"), O1111O1O0("Lethe_LineBack2"), O1111O1O0("Lethe_Scroll_Bar"), O1111O1O0("Lethe_Drag_Block"), O1111O1O0("Lethe_Scroll_Up"), O1111O1O0("Lethe_Scroll_Down"), O1111O1O0("Lethe_DragArea")); O11111O1O(); } public function set O11111O10(_arg1:Boolean):void{ var _local2:LocalConnection; var _local3:String; var _local4:Array; var _local5:int; var _local6:int; var _local7:O1111111O; O11111O01 = _arg1; O11111Ol1 = ["www8.agame.com", "www.zlonggames.com", "gamedev.dev.spillgroup.com", "gamedev.dev.spilgames.com", "www.zlonggamestest.com"]; _local2 = new LocalConnection(); if (_local2.domain != "localhost"){ _local4 = _local2.domain.split("."); _local5 = (_local4.length - 1); _local6 = (_local4.length - 2); O11111OlO = ((_local4[_local6] + ".") + _local4[_local5]); } else { O11111OlO = "localhost"; }; O1111111l.O11111OlO().O11111Oll(O11111OlO, O111111Ol, O111111O0, O1111100O1); if (((isNaN(O11111OO0)) || (isNaN(O111111lO)))){ O111110l0(); return; }; for each (_local3 in O11111Ol1) { if (_local2.domain == _local3){ _local7 = new O1111111O(); if (_local7.O11111OO1()){ O11111Oll = true; O1111O110(); return; }; O111110l0(); return; }; }; O111110l0(); } private function O1111O110():void{ var _local1:*; stop(); O11111O0O = new Loader(); O11111O0O.load(new URLRequest(O111111l1)); O11111OOl.addChildAt(O11111O0O, 0); this.addEventListener(Event.ENTER_FRAME, O111110ll); O11111O0O.contentLoaderInfo.addEventListener(Event.COMPLETE, O1111O1Ol); O11111O0O.contentLoaderInfo.addEventListener(IOErrorEvent.IO_ERROR, O1111O1l1); O11111O0O.contentLoaderInfo.addEventListener(SecurityErrorEvent.SECURITY_ERROR, O1111O1l1); _local1 = getDefinitionByName("COM_LoadingBar"); if (_local1 != null){ O11111OOO = new (_local1); O11111OOl.addChild(O11111OOO); O1111O1O1(); }; } private function O1111O111():void{ var O11111l1l:int; var O11111l01:int; var O11111l0O:*; var O11111l0l:*; var O11111l00:*; var O11111011:*; var O1111101O:*; var O1111101l:*; var O11111l10:*; O11111l1l = 0; O11111l01 = 0; O11111l0O = getDefinitionByName("Lethe_Continue_Button"); O11111l0l = getDefinitionByName("Lethe_Link_Button"); O11111l00 = getDefinitionByName("Lethe_Text1"); O11111011 = getDefinitionByName("Lethe_Text2"); O1111101O = getDefinitionByName("Lethe_All_Logo"); while (true) { try { O11111l10 = O11111Ol0.getChildAt(O11111l1l); if ((O11111l10 is O11111l0O)){ O11111001(O11111l10); try { O11111l10.removeEventListener(MouseEvent.CLICK, O1111O11l); } catch(e:Error) { }; O11111l10.addEventListener(MouseEvent.CLICK, O1111O11l, false, 0, true); O11111l01 = 0; while (true) { try { O1111101l = O11111l10.getChildAt(O11111l01); if ((((O1111101l is O11111l00)) || ((O1111101l is O11111011)))){ O1111101l.gotoAndStop(O1111111l.O11111OlO().O11111O0O()); }; O11111l01 = (O11111l01 + 1); } catch(O11111llO:Error) { break; }; }; } else { if ((O11111l10 is O11111l0l)){ try { O11111l10.removeEventListener(MouseEvent.CLICK, O1111O11O); } catch(e:Error) { }; O11111l10.addEventListener(MouseEvent.CLICK, O1111O11O, false, 0, true); O11111001(O11111l10); O11111l01 = 0; while (true) { try { O1111101l = O11111l10.getChildAt(O11111l01); if ((((O1111101l is O11111l00)) || ((O1111101l is O11111011)))){ O1111101l.gotoAndStop(O1111111l.O11111OlO().O11111O0O()); } else { if ((O1111101l is O1111101O)){ O1111101l.gotoAndStop(O1111111l.O11111OlO().O11111O01()); }; }; O11111l01 = (O11111l01 + 1); } catch(O11111llO:Error) { break; }; }; }; }; O11111l1l = (O11111l1l + 1); } catch(O11111llO:Error) { break; }; }; } public function O111111l0():Boolean{ return (O11111Oll); } private function O1111O11l(_arg1:MouseEvent):void{ this.O1111O1lO(new Event("000111000100")); } private function O1111O11O(_arg1:MouseEvent):void{ O1111111l.O11111OlO().O11111O0l(); this.O1111O1lO(new Event("00111111000")); } private function O111110l0():void{ var O11111ll0:*; if (O11111OOO != null){ O11111OOl.removeChild(O11111OOO); O11111OOO = null; }; if (O11111Ol0 == null){ try { O11111ll0 = getDefinitionByName("Lethe_Alert_Page"); O11111Ol0 = new (O11111ll0); O11111OOl.addChild(O11111Ol0); O1111O111(); } catch(O11111llO:Error) { }; }; } private function O111110lO(_arg1=null, _arg2:String="default", _arg3=1, _arg4="", _arg5:int=0, _arg6:String="normal", _arg7:int=1, _arg8:Number=0x515151, _arg9:Number=0x515151, _arg10:Number=0x515151, _arg11:Number=0x515151):void{ O11111OOl["O11111O10"] = O11111O1l; O11111OOl["O11111O11"] = O11111O1O; O11111OOl["O11111100"] = O111111l0; O11111OOl["O11111101"] = O11111101; O11111OOl["O1100000l"] = O10000101; O11111OOl["O1111110l"] = O1111110l; O11111OOl["O111111001"] = O11111100; O11111OOl["O111111010"] = O11111O11; O1111111l.O11111OlO().O11111Ol0(_arg3); evenLineColor = _arg8; oddLineColor = _arg9; selfLineColor = _arg11; noticeLineColor = _arg10; O1111100O1 = _arg7; O111111O1 = _arg6; O111111Ol = _arg2; if (_arg4 == ""){ O111111O0 = O111111Ol; } else { O111111O0 = _arg4; }; O111111ll = _arg5; if (((!((_arg1 == null))) && (!((_arg1.loaderInfo == null))))){ O11111OO0 = Number(_arg1.loaderInfo.parameters["id"]); O111111lO = Number(_arg1.loaderInfo.parameters["s"]); O111111l1 = "http://www8.agame.com/games/flash/highscore/Submiter.swf?v=111"; O11111O10 = true; }; } private function O111110ll(_arg1:Event):void{ var _local2:int; _local2 = (((O11111O0O.contentLoaderInfo.bytesLoaded / O11111O0O.contentLoaderInfo.bytesTotal) * 100) >> 0); if (_local2 == 0){ O11111O0l.gotoAndStop(1); } else { O11111O0l.gotoAndStop(_local2); }; O11111O00.text = (String(_local2) + "%"); if (_local2 >= 100){ O11111l11 = null; O11111O0l = null; O11111O00 = null; removeEventListener(Event.ENTER_FRAME, O111110ll); O11111OOl.removeChild(O11111OOO); O11111OOO = null; }; } public function O11111100():void{ if (O11111l1O != null){ O11111l1O.O11111l0l(); }; } public function O11111101():Boolean{ return (!((O11111l1O == null))); } public function O1111110O(_arg1:Number, _arg2:Number):void{ if (O11111O0O){ O11111O0O.scaleX = (_arg1 / 460); O11111O0O.scaleY = (_arg2 / 300); }; } public function O1111110l():void{ if (O11111l1O != null){ O11111l1O.O11111l00(); }; } private function O11111000(_arg1:MouseEvent):void{ _arg1.currentTarget.gotoAndStop(2); } private function O11111001(_arg1):void{ var _btn = _arg1; _btn.stop(); _btn.mouseChildren = false; _btn.buttonMode = true; try { _btn.removeEventListener(MouseEvent.MOUSE_OVER, O11111000); _btn.removeEventListener(MouseEvent.MOUSE_DOWN, O1111100l); _btn.removeEventListener(MouseEvent.MOUSE_OUT, O1111100O); _btn.removeEventListener(MouseEvent.MOUSE_UP, O1111100O); } catch(e:Error) { }; _btn.addEventListener(MouseEvent.MOUSE_OVER, O11111000, false, 0, true); _btn.addEventListener(MouseEvent.MOUSE_DOWN, O1111100l, false, 0, true); _btn.addEventListener(MouseEvent.MOUSE_OUT, O1111100O, false, 0, true); _btn.addEventListener(MouseEvent.MOUSE_UP, O1111100O, false, 0, true); } public function O10000101(_arg1:int):void{ var _langType = _arg1; O1111111l.O11111OlO().O11111Ol0(_langType); try { O1111O111(); } catch(e:Error) { }; try { O1111O1O1(); } catch(e:Error) { }; try { O11111O00.text = O11111OO1[(O1111111l.O11111OlO().O11111O0O() - 1)]; } catch(e:Error) { }; try { O11111l1O.O0100010(_langType); } catch(e:Error) { }; } } }//package
Section 427
//O11111OO11 (O11111OO11) package { import flash.display.*; public dynamic class O11111OO11 extends MovieClip { } }//package
Section 428
//PAUSE (PAUSE) package { import lib.*; public dynamic class PAUSE extends textShow { } }//package
Section 429
//PerfectIthinkabi (PerfectIthinkabi) package { import lib.*; public dynamic class PerfectIthinkabi extends textShow { } }//package
Section 430
//Pickapicture (Pickapicture) package { import lib.*; public dynamic class Pickapicture extends textShow { } }//package
Section 431
//ProtectionMC (ProtectionMC) package { import flash.events.*; import flash.display.*; import lib.*; public dynamic class ProtectionMC extends MovieClip { public var playgame:SimpleButton; public function ProtectionMC(){ addFrameScript(0, frame1); } function frame1(){ playgame.addEventListener(MouseEvent.MOUSE_DOWN, _mouseDown); } public function _mouseDown(_arg1:MouseEvent){ var _local2:gameEvent; _local2 = new gameEvent(gameEvent.url_protection); dispatchEvent(_local2); } } }//package
Section 432
//Random (Random) package { import flash.net.*; import flash.display.*; public class Random { var randomStr; private static var hexcase = 0; public static var gameID = 107; public static var strqq:String; private static var chrsz = 8; private static var b64pad = ""; public function Random(){ randomStr = Randoms(10); super(); } public static function average_ii(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7){ return (average_cmn((_arg3 ^ (_arg2 | ~(_arg4))), _arg1, _arg2, _arg5, _arg6, _arg7)); } public static function SortT(){ var _local1:*; var _local2:*; var _local3:*; _local1 = "0123456789abcdefghijklmnopqrstuvwxyzABCDEFGHIJKLMNOPQRSTUVWXYZ"; _local2 = ""; trace((_local1 + "###")); _local3 = 0; while (_local3 < 10) { _local2 = (_local2 + _local1.substr(Math.floor((Math.random() * _local1.length)), 1)); _local3++; }; trace(_local2); return (_local2); } public static function b64_hmac_average(_arg1, _arg2){ return (binl2b64(core_hmac_average(_arg1, _arg2))); } public static function md5(_arg1:String){ var _local2:*; var _local3:*; var _local4:*; var _local5:*; var _local6:*; var _local7:*; var _local8:*; var _local9:*; var _local10:*; var _local11:*; var _local12:*; var _local13:*; var _local14:*; var _local15:*; var _local16:*; var _local17:*; var _local18:*; var _local19:*; _local2[(_local3 >> 5)] = (_local2[(_local3 >> 5)] | (128 << (_local3 % 32))); _local2[((((_local3 + 64) >>> 9) << 4) + 14)] = _local3; _local5 = 1732584193; _local6 = -271733879; _local7 = -1732584194; _local8 = 271733878; _local9 = str2binl(_local4); if (_local9.length > 16){ _local9 = core_average(_local9, (_local4.length * chrsz)); }; _local10 = new Array(16); _local11 = new Array(16); _local12 = 0; while (_local12 < 16) { _local10[_local12] = (_local9[_local12] ^ 909522486); _local11[_local12] = (_local9[_local12] ^ 1549556828); _local12++; }; _local14 = core_average(_local10.concat(str2binl(_local13)), (0x0200 + (_local13.length * chrsz))); return (core_average(_local11.concat(_local14), (0x0200 + 128))); return (new Array(_local5, _local6, _local7, _local8)); } public static function average_gg(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7){ return (average_cmn(((_arg2 & _arg4) | (_arg3 & ~(_arg4))), _arg1, _arg2, _arg5, _arg6, _arg7)); } public static function average_hh(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7){ return (average_cmn(((_arg2 ^ _arg3) ^ _arg4), _arg1, _arg2, _arg5, _arg6, _arg7)); } public static function binl2b64(_arg1){ var _local2:*; var _local3:*; var _local4:*; var _local5:*; var _local6:*; _local2 = "ABCDEFGHIJKLMNOPQRSTUVWXYZabcdefghijklmnopqrstuvwxyz0123456789+/"; _local3 = ""; _local4 = 0; while (_local4 < (_arg1.length * 4)) { _local5 = (((((_arg1[(_local4 >> 2)] >> (8 * (_local4 % 4))) & 0xFF) << 16) | (((_arg1[((_local4 + 1) >> 2)] >> (8 * ((_local4 + 1) % 4))) & 0xFF) << 8)) | ((_arg1[((_local4 + 2) >> 2)] >> (8 * ((_local4 + 2) % 4))) & 0xFF)); _local6 = 0; while (_local6 < 4) { if (((_local4 * 8) + (_local6 * 6)) > (_arg1.length * 32)){ _local3 = (_local3 + b64pad); } else { _local3 = (_local3 + _local2.charAt(((_local5 >> (6 * (3 - _local6))) & 63))); }; _local6++; }; _local4 = (_local4 + 3); }; return (_local3); } public static function senturl(_arg1, _arg2, _arg3, _arg4):void{ var _local5:String; var _local6:URLRequest; _local5 = ((((((((("http://user.game.com.cn/game/?action=highscore&id=" + gameID) + "&s=") + _arg1) + "&a=") + _arg2) + "&t=") + _arg4) + "&r=") + _arg3); _local6 = new URLRequest(_local5); navigateToURL(_local6, "_blank"); } public static function geturl():void{ var _local1:String; var _local2:URLRequest; _local1 = ("http://user.game.com.cn/game/?action=highscore&id=" + gameID); _local2 = new URLRequest(_local1); navigateToURL(_local2, "_blank"); } public static function bit_rol(_arg1, _arg2){ return (((_arg1 << _arg2) | (_arg1 >>> (32 - _arg2)))); } public static function core_hmac_average(_arg1, _arg2){ var _local3:*; var _local4:*; var _local5:*; var _local6:*; var _local7:*; _local3 = str2binl(_arg1); if (_local3.length > 16){ _local3 = core_average(_local3, (_arg1.length * chrsz)); }; _local4 = new Array(16); _local5 = new Array(16); _local6 = 0; while (_local6 < 16) { _local4[_local6] = (_local3[_local6] ^ 909522486); _local5[_local6] = (_local3[_local6] ^ 1549556828); _local6++; }; _local7 = core_average(_local4.concat(str2binl(_arg2)), (0x0200 + (_arg2.length * chrsz))); return (core_average(_local5.concat(_local7), (0x0200 + 128))); } public static function average_ff(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6, _arg7){ return (average_cmn(((_arg2 & _arg3) | (~(_arg2) & _arg4)), _arg1, _arg2, _arg5, _arg6, _arg7)); } public static function str2binl(_arg1){ var _local2:*; var _local3:*; var _local4:*; _local2 = new Array(); _local3 = ((1 << chrsz) - 1); _local4 = 0; while (_local4 < (_arg1.length * chrsz)) { _local2[(_local4 >> 5)] = (_local2[(_local4 >> 5)] | ((_arg1.charCodeAt((_local4 / chrsz)) & _local3) << (_local4 % 32))); _local4 = (_local4 + chrsz); }; return (_local2); } public static function binl2hex(_arg1){ var _local2:*; var _local3:*; var _local4:*; _local2 = (hexcase) ? "0123456789ABCDEF" : "0123456789abcdef"; _local3 = ""; _local4 = 0; while (_local4 < (_arg1.length * 4)) { _local3 = (_local3 + (_local2.charAt(((_arg1[(_local4 >> 2)] >> (((_local4 % 4) * 8) + 4)) & 15)) + _local2.charAt(((_arg1[(_local4 >> 2)] >> ((_local4 % 4) * 8)) & 15)))); _local4++; }; return (_local3); } public static function calcaverage(_arg1){ return (binl2hex(core_average(str2binl(_arg1), (_arg1.length * chrsz)))); } public static function hex_hmac_average(_arg1, _arg2){ return (binl2hex(core_hmac_average(_arg1, _arg2))); } public static function safe_add(_arg1, _arg2){ var _local3:*; var _local4:*; _local3 = ((_arg1 & 0xFFFF) + (_arg2 & 0xFFFF)); _local4 = (((_arg1 >> 16) + (_arg2 >> 16)) + (_local3 >> 16)); return (((_local4 << 16) | (_local3 & 0xFFFF))); } public static function Randoms(_arg1:Number){ var _local2:*; var _local3:*; var _local4:String; var _local5:*; _local2 = "123098938487634asdflskafgpoipALKGAISFH:LKHAODG"; _local3 = ""; _local4 = ""; _local5 = 0; while (_local5 < _arg1) { _local3 = (_local3 + _local2.substr(Math.floor((Math.random() * _local2.length)), 1)); _local5++; }; return (_local3); } public static function average_vm_test(){ return ((hex_average("abc") == "900150983cd24fb0d6963f7d28e17f72")); } public static function hex_average(_arg1){ return (binl2hex(core_average(str2binl(_arg1), (_arg1.length * chrsz)))); } public static function average_cmn(_arg1, _arg2, _arg3, _arg4, _arg5, _arg6){ return (safe_add(bit_rol(safe_add(safe_add(_arg2, _arg1), safe_add(_arg4, _arg6)), _arg5), _arg3)); } public static function core_average(_arg1, _arg2){ var _local3:*; var _local4:*; var _local5:*; var _local6:*; var _local7:*; var _local8:*; var _local9:*; var _local10:*; var _local11:*; _arg1[(_arg2 >> 5)] = (_arg1[(_arg2 >> 5)] | (128 << (_arg2 % 32))); _arg1[((((_arg2 + 64) >>> 9) << 4) + 14)] = _arg2; _local3 = 1732584193; _local4 = -271733879; _local5 = -1732584194; _local6 = 271733878; _local7 = 0; while (_local7 < _arg1.length) { _local8 = _local3; _local9 = _local4; _local10 = _local5; _local11 = _local6; _local3 = average_ff(_local3, _local4, _local5, _local6, _arg1[(_local7 + 0)], 7, -680876936); _local6 = average_ff(_local6, _local3, _local4, _local5, _arg1[(_local7 + 1)], 12, -389564586); _local5 = average_ff(_local5, _local6, _local3, _local4, _arg1[(_local7 + 2)], 17, 606105819); _local4 = average_ff(_local4, _local5, _local6, _local3, _arg1[(_local7 + 3)], 22, -1044525330); _local3 = average_ff(_local3, _local4, _local5, _local6, _arg1[(_local7 + 4)], 7, -176418897); _local6 = average_ff(_local6, _local3, _local4, _local5, _arg1[(_local7 + 5)], 12, 1200080426); _local5 = average_ff(_local5, _local6, _local3, _local4, _arg1[(_local7 + 6)], 17, -1473231341); _local4 = average_ff(_local4, _local5, _local6, _local3, _arg1[(_local7 + 7)], 22, -45705983); _local3 = average_ff(_local3, _local4, _local5, _local6, _arg1[(_local7 + 8)], 7, 1770035416); _local6 = average_ff(_local6, _local3, _local4, _local5, _arg1[(_local7 + 9)], 12, -1958414417); _local5 = average_ff(_local5, _local6, _local3, _local4, _arg1[(_local7 + 10)], 17, -42063); _local4 = average_ff(_local4, _local5, _local6, _local3, _arg1[(_local7 + 11)], 22, -1990404162); _local3 = average_ff(_local3, _local4, _local5, _local6, _arg1[(_local7 + 12)], 7, 1804603682); _local6 = average_ff(_local6, _local3, _local4, _local5, _arg1[(_local7 + 13)], 12, -40341101); _local5 = average_ff(_local5, _local6, _local3, _local4, _arg1[(_local7 + 14)], 17, -1502002290); _local4 = average_ff(_local4, _local5, _local6, _local3, _arg1[(_local7 + 15)], 22, 1236535329); _local3 = average_gg(_local3, _local4, _local5, _local6, _arg1[(_local7 + 1)], 5, -165796510); _local6 = average_gg(_local6, _local3, _local4, _local5, _arg1[(_local7 + 6)], 9, -1069501632); _local5 = average_gg(_local5, _local6, _local3, _local4, _arg1[(_local7 + 11)], 14, 643717713); _local4 = average_gg(_local4, _local5, _local6, _local3, _arg1[(_local7 + 0)], 20, -373897302); _local3 = average_gg(_local3, _local4, _local5, _local6, _arg1[(_local7 + 5)], 5, -701558691); _local6 = average_gg(_local6, _local3, _local4, _local5, _arg1[(_local7 + 10)], 9, 38016083); _local5 = average_gg(_local5, _local6, _local3, _local4, _arg1[(_local7 + 15)], 14, -660478335); _local4 = average_gg(_local4, _local5, _local6, _local3, _arg1[(_local7 + 4)], 20, -405537848); _local3 = average_gg(_local3, _local4, _local5, _local6, _arg1[(_local7 + 9)], 5, 568446438); _local6 = average_gg(_local6, _local3, _local4, _local5, _arg1[(_local7 + 14)], 9, -1019803690); _local5 = average_gg(_local5, _local6, _local3, _local4, _arg1[(_local7 + 3)], 14, -187363961); _local4 = average_gg(_local4, _local5, _local6, _local3, _arg1[(_local7 + 8)], 20, 1163531501); _local3 = average_gg(_local3, _local4, _local5, _local6, _arg1[(_local7 + 13)], 5, -1444681467); _local6 = average_gg(_local6, _local3, _local4, _local5, _arg1[(_local7 + 2)], 9, -51403784); _local5 = average_gg(_local5, _local6, _local3, _local4, _arg1[(_local7 + 7)], 14, 1735328473); _local4 = average_gg(_local4, _local5, _local6, _local3, _arg1[(_local7 + 12)], 20, -1926607734); _local3 = average_hh(_local3, _local4, _local5, _local6, _arg1[(_local7 + 5)], 4, -378558); _local6 = average_hh(_local6, _local3, _local4, _local5, _arg1[(_local7 + 8)], 11, -2022574463); _local5 = average_hh(_local5, _local6, _local3, _local4, _arg1[(_local7 + 11)], 16, 1839030562); _local4 = average_hh(_local4, _local5, _local6, _local3, _arg1[(_local7 + 14)], 23, -35309556); _local3 = average_hh(_local3, _local4, _local5, _local6, _arg1[(_local7 + 1)], 4, -1530992060); _local6 = average_hh(_local6, _local3, _local4, _local5, _arg1[(_local7 + 4)], 11, 1272893353); _local5 = average_hh(_local5, _local6, _local3, _local4, _arg1[(_local7 + 7)], 16, -155497632); _local4 = average_hh(_local4, _local5, _local6, _local3, _arg1[(_local7 + 10)], 23, -1094730640); _local3 = average_hh(_local3, _local4, _local5, _local6, _arg1[(_local7 + 13)], 4, 681279174); _local6 = average_hh(_local6, _local3, _local4, _local5, _arg1[(_local7 + 0)], 11, -358537222); _local5 = average_hh(_local5, _local6, _local3, _local4, _arg1[(_local7 + 3)], 16, -722521979); _local4 = average_hh(_local4, _local5, _local6, _local3, _arg1[(_local7 + 6)], 23, 76029189); _local3 = average_hh(_local3, _local4, _local5, _local6, _arg1[(_local7 + 9)], 4, -640364487); _local6 = average_hh(_local6, _local3, _local4, _local5, _arg1[(_local7 + 12)], 11, -421815835); _local5 = average_hh(_local5, _local6, _local3, _local4, _arg1[(_local7 + 15)], 16, 530742520); _local4 = average_hh(_local4, _local5, _local6, _local3, _arg1[(_local7 + 2)], 23, -995338651); _local3 = average_ii(_local3, _local4, _local5, _local6, _arg1[(_local7 + 0)], 6, -198630844); _local6 = average_ii(_local6, _local3, _local4, _local5, _arg1[(_local7 + 7)], 10, 1126891415); _local5 = average_ii(_local5, _local6, _local3, _local4, _arg1[(_local7 + 14)], 15, -1416354905); _local4 = average_ii(_local4, _local5, _local6, _local3, _arg1[(_local7 + 5)], 21, -57434055); _local3 = average_ii(_local3, _local4, _local5, _local6, _arg1[(_local7 + 12)], 6, 1700485571); _local6 = average_ii(_local6, _local3, _local4, _local5, _arg1[(_local7 + 3)], 10, -1894986606); _local5 = average_ii(_local5, _local6, _local3, _local4, _arg1[(_local7 + 10)], 15, -1051523); _local4 = average_ii(_local4, _local5, _local6, _local3, _arg1[(_local7 + 1)], 21, -2054922799); _local3 = average_ii(_local3, _local4, _local5, _local6, _arg1[(_local7 + 8)], 6, 1873313359); _local6 = average_ii(_local6, _local3, _local4, _local5, _arg1[(_local7 + 15)], 10, -30611744); _local5 = average_ii(_local5, _local6, _local3, _local4, _arg1[(_local7 + 6)], 15, -1560198380); _local4 = average_ii(_local4, _local5, _local6, _local3, _arg1[(_local7 + 13)], 21, 1309151649); _local3 = average_ii(_local3, _local4, _local5, _local6, _arg1[(_local7 + 4)], 6, -145523070); _local6 = average_ii(_local6, _local3, _local4, _local5, _arg1[(_local7 + 11)], 10, -1120210379); _local5 = average_ii(_local5, _local6, _local3, _local4, _arg1[(_local7 + 2)], 15, 718787259); _local4 = average_ii(_local4, _local5, _local6, _local3, _arg1[(_local7 + 9)], 21, -343485551); _local3 = safe_add(_local3, _local8); _local4 = safe_add(_local4, _local9); _local5 = safe_add(_local5, _local10); _local6 = safe_add(_local6, _local11); _local7 = (_local7 + 16); }; return (new Array(_local3, _local4, _local5, _local6)); } public static function b64_average(_arg1){ return (binl2b64(core_average(str2binl(_arg1), (_arg1.length * chrsz)))); } public static function DrawLine(_arg1, _arg2, _arg3:Number, _arg4:Number, _arg5:Number, _arg6:Number){ var point1:Vector; var point:Vector; var current:*; var nextdot:*; var minX:Number; var minY:Number; var maxX:Number; var maxY:Number; var verts:Array; var center:Vector; var normal:Vector; var dmc:MovieClip; var isVisible:Boolean; var isActivated:Boolean; var AbstractTile:Function; var initializeContainer:Function; var createBoundingRect:Function; var testIntervals:Function; var k:*; var i:*; var point2:Vector; var point3:Vector; var point4:Vector; var point5:Vector; var b:*; var j:*; var l:*; var c:*; var position = _arg1; var line = _arg2; var x1 = _arg3; var x2 = _arg4; var y1 = _arg5; var y2 = _arg6; AbstractTile = function (_arg1:Number, _arg2:Number){ center = new Vector(_arg1, _arg2); verts = new Array(); normal = new Vector(0, 0); isVisible = true; isActivated = true; initializeContainer(); }; initializeContainer = function (){ var _local1:String; _local1 = "_oooo"; dmc = new MovieClip(); dmc.name = _local1; }; createBoundingRect = function (_arg1:Number, _arg2:Number){ var _local3:Number; var _local4:Number; var _local5:Number; var _local6:Number; _local3 = (center.y - (_arg2 / 2)); _local4 = (center.y + (_arg2 / 2)); _local5 = (center.x - (_arg1 / 2)); _local6 = (center.x + (_arg1 / 2)); verts.push(new Vector(_local6, _local4)); verts.push(new Vector(_local6, _local3)); verts.push(new Vector(_local5, _local3)); verts.push(new Vector(_local5, _local4)); }; testIntervals = function (_arg1:Number, _arg2:Number, _arg3:Number, _arg4:Number){ var _local5:Number; var _local6:Number; if (_arg2 < _arg3){ return (0); }; if (_arg4 < _arg1){ return (0); }; _local5 = (_arg4 - _arg1); _local6 = (_arg3 - _arg2); if (Math.abs(_local5) < Math.abs(_local6)){ return (_local5); }; return (_local6); }; point1 = new Vector(x1, y1); point = new Vector(x2, y2); current = point1.dot(point); nextdot = point1.cross(point); current = (current + nextdot); k = []; strqq = ""; i = 0; while (i < 8) { b = 0; j = 0; while (j < 10) { c = line.substr(j, 1).charCodeAt(); c = String(c).substr((String(c).length - 2), 1); b = (b + Number(c)); j = (j + 1); }; trace(b); if (b > 10){ b = (b % 10); }; k[i] = Math.round((((i + b) * (i + b)) - ((b * b) / 2))); while (k[i] >= 32) { k[i] = Math.round((k[i] / 2)); }; l = 0; l = 0; while (l < (k.length - 1)) { if (k[i] == k[l]){ k[i] = (k[i] + 1); }; l = (l + 1); }; trace(k[i]); strqq = (strqq + position.substr(k[i], 1)); i = (i + 1); }; point2 = new Vector(x1, y1); current = point2.dot(point); nextdot = point2.cross(point); current = (current + nextdot); point3 = new Vector(x1, y1); current = point3.dot(point); nextdot = point3.cross(point); current = (current + nextdot); point4 = new Vector(x1, y1); current = point4.dot(point); nextdot = point4.cross(point); current = (current + nextdot); point5 = new Vector(x1, y1); current = point5.dot(point); nextdot = point5.cross(point); current = (current + nextdot); current = Math.round(Math.sqrt((current * 2))); if (current > 20){ current = Math.round(Math.sqrt(current)); }; return (current); } } }//package
Section 433
//ScrollArrowDown_disabledSkin (ScrollArrowDown_disabledSkin) package { import flash.display.*; public dynamic class ScrollArrowDown_disabledSkin extends MovieClip { } }//package
Section 434
//ScrollArrowDown_downSkin (ScrollArrowDown_downSkin) package { import flash.display.*; public dynamic class ScrollArrowDown_downSkin extends MovieClip { } }//package
Section 435
//ScrollArrowDown_overSkin (ScrollArrowDown_overSkin) package { import flash.display.*; public dynamic class ScrollArrowDown_overSkin extends MovieClip { } }//package
Section 436
//ScrollArrowDown_upSkin (ScrollArrowDown_upSkin) package { import flash.display.*; public dynamic class ScrollArrowDown_upSkin extends MovieClip { } }//package
Section 437
//ScrollArrowUp_disabledSkin (ScrollArrowUp_disabledSkin) package { import flash.display.*; public dynamic class ScrollArrowUp_disabledSkin extends MovieClip { } }//package
Section 438
//ScrollArrowUp_downSkin (ScrollArrowUp_downSkin) package { import flash.display.*; public dynamic class ScrollArrowUp_downSkin extends MovieClip { } }//package
Section 439
//ScrollArrowUp_overSkin (ScrollArrowUp_overSkin) package { import flash.display.*; public dynamic class ScrollArrowUp_overSkin extends MovieClip { } }//package
Section 440
//ScrollArrowUp_upSkin (ScrollArrowUp_upSkin) package { import flash.display.*; public dynamic class ScrollArrowUp_upSkin extends MovieClip { } }//package
Section 441
//ScrollBar_thumbIcon (ScrollBar_thumbIcon) package { import flash.display.*; public dynamic class ScrollBar_thumbIcon extends MovieClip { } }//package
Section 442
//ScrollThumb_downSkin (ScrollThumb_downSkin) package { import flash.display.*; public dynamic class ScrollThumb_downSkin extends MovieClip { } }//package
Section 443
//ScrollThumb_overSkin (ScrollThumb_overSkin) package { import flash.display.*; public dynamic class ScrollThumb_overSkin extends MovieClip { } }//package
Section 444
//ScrollThumb_upSkin (ScrollThumb_upSkin) package { import flash.display.*; public dynamic class ScrollThumb_upSkin extends MovieClip { } }//package
Section 445
//ScrollTrack_skin (ScrollTrack_skin) package { import flash.display.*; public dynamic class ScrollTrack_skin extends MovieClip { } }//package
Section 446
//sendtofriend (sendtofriend) package { import lib.*; public dynamic class sendtofriend extends textShow { } }//package
Section 447
//sound_complete (sound_complete) package { import flash.media.*; public dynamic class sound_complete extends Sound { } }//package
Section 448
//sound_d1 (sound_d1) package { import flash.media.*; public dynamic class sound_d1 extends Sound { } }//package
Section 449
//sound_d2 (sound_d2) package { import flash.media.*; public dynamic class sound_d2 extends Sound { } }//package
Section 450
//sound_d3 (sound_d3) package { import flash.media.*; public dynamic class sound_d3 extends Sound { } }//package
Section 451
//sound_d4 (sound_d4) package { import flash.media.*; public dynamic class sound_d4 extends Sound { } }//package
Section 452
//sound_failed (sound_failed) package { import flash.media.*; public dynamic class sound_failed extends Sound { } }//package
Section 453
//sound_gold (sound_gold) package { import flash.media.*; public dynamic class sound_gold extends Sound { } }//package
Section 454
//sound_mainscreen (sound_mainscreen) package { import flash.media.*; public dynamic class sound_mainscreen extends Sound { } }//package
Section 455
//sound_music_1 (sound_music_1) package { import flash.media.*; public dynamic class sound_music_1 extends Sound { } }//package
Section 456
//sound_music_2 (sound_music_2) package { import flash.media.*; public dynamic class sound_music_2 extends Sound { } }//package
Section 457
//sound_music_3 (sound_music_3) package { import flash.media.*; public dynamic class sound_music_3 extends Sound { } }//package
Section 458
//sound_story (sound_story) package { import flash.media.*; public dynamic class sound_story extends Sound { } }//package
Section 459
//sound_wall_of_hair (sound_wall_of_hair) package { import flash.media.*; public dynamic class sound_wall_of_hair extends Sound { } }//package
Section 460
//sound0_cuifengji (sound0_cuifengji) package { import flash.media.*; public dynamic class sound0_cuifengji extends Sound { } }//package
Section 461
//sound1_shandian (sound1_shandian) package { import flash.media.*; public dynamic class sound1_shandian extends Sound { } }//package
Section 462
//sound10_pen (sound10_pen) package { import flash.media.*; public dynamic class sound10_pen extends Sound { } }//package
Section 463
//sound11_shui (sound11_shui) package { import flash.media.*; public dynamic class sound11_shui extends Sound { } }//package
Section 464
//sound13_yagao (sound13_yagao) package { import flash.media.*; public dynamic class sound13_yagao extends Sound { } }//package
Section 465
//sound14_fajuan (sound14_fajuan) package { import flash.media.*; public dynamic class sound14_fajuan extends Sound { } }//package
Section 466
//sound15_jidan (sound15_jidan) package { import flash.media.*; public dynamic class sound15_jidan extends Sound { } }//package
Section 467
//sound16_pijiu (sound16_pijiu) package { import flash.media.*; public dynamic class sound16_pijiu extends Sound { } }//package
Section 468
//sound19_roushun (sound19_roushun) package { import flash.media.*; public dynamic class sound19_roushun extends Sound { } }//package
Section 469
//sound2_baozha (sound2_baozha) package { import flash.media.*; public dynamic class sound2_baozha extends Sound { } }//package
Section 470
//sound20_yu (sound20_yu) package { import flash.media.*; public dynamic class sound20_yu extends Sound { } }//package
Section 471
//sound21_tixu (sound21_tixu) package { import flash.media.*; public dynamic class sound21_tixu extends Sound { } }//package
Section 472
//sound22_yundou (sound22_yundou) package { import flash.media.*; public dynamic class sound22_yundou extends Sound { } }//package
Section 473
//sound23_daxiang (sound23_daxiang) package { import flash.media.*; public dynamic class sound23_daxiang extends Sound { } }//package
Section 474
//sound24_kafei (sound24_kafei) package { import flash.media.*; public dynamic class sound24_kafei extends Sound { } }//package
Section 475
//sound25_zazhi (sound25_zazhi) package { import flash.media.*; public dynamic class sound25_zazhi extends Sound { } }//package
Section 476
//sound28_shoukao (sound28_shoukao) package { import flash.media.*; public dynamic class sound28_shoukao extends Sound { } }//package
Section 477
//sound29_huaibiao (sound29_huaibiao) package { import flash.media.*; public dynamic class sound29_huaibiao extends Sound { } }//package
Section 478
//sound3_dadanqi (sound3_dadanqi) package { import flash.media.*; public dynamic class sound3_dadanqi extends Sound { } }//package
Section 479
//sound4_shasha (sound4_shasha) package { import flash.media.*; public dynamic class sound4_shasha extends Sound { } }//package
Section 480
//sound5_feng (sound5_feng) package { import flash.media.*; public dynamic class sound5_feng extends Sound { } }//package
Section 481
//sound6_haixiao (sound6_haixiao) package { import flash.media.*; public dynamic class sound6_haixiao extends Sound { } }//package
Section 482
//sound7_qiqiu (sound7_qiqiu) package { import flash.media.*; public dynamic class sound7_qiqiu extends Sound { } }//package
Section 483
//sound8_pen (sound8_pen) package { import flash.media.*; public dynamic class sound8_pen extends Sound { } }//package
Section 484
//startgame (startgame) package { import lib.*; public dynamic class startgame extends textShow { } }//package
Section 485
//SUBMITSCORE (SUBMITSCORE) package { import lib.*; public dynamic class SUBMITSCORE extends textShow { } }//package
Section 486
//targetss (targetss) package { import lib.*; public dynamic class targetss extends textShow { } }//package
Section 487
//TextInput_disabledSkin (TextInput_disabledSkin) package { import flash.display.*; public dynamic class TextInput_disabledSkin extends MovieClip { } }//package
Section 488
//TextInput_upSkin (TextInput_upSkin) package { import flash.display.*; public dynamic class TextInput_upSkin extends MovieClip { } }//package
Section 489
//Thehairistakingover (Thehairistakingover) package { import lib.*; public dynamic class Thehairistakingover extends textShow { } }//package
Section 490
//Thehairtargetisset (Thehairtargetisset) package { import lib.*; public dynamic class Thehairtargetisset extends textShow { } }//package
Section 491
//TheToolstargetforthislevelis (TheToolstargetforthislevelis) package { import lib.*; public dynamic class TheToolstargetforthislevelis extends textShow { } }//package
Section 492
//Toobad (Toobad) package { import lib.*; public dynamic class Toobad extends textShow { } }//package
Section 493
//TOTALSCORE (TOTALSCORE) package { import lib.*; public dynamic class TOTALSCORE extends textShow { } }//package
Section 494
//TRYAGAIN (TRYAGAIN) package { import lib.*; public dynamic class TRYAGAIN extends textShow { } }//package
Section 495
//txt_great (txt_great) package { import lib.*; public dynamic class txt_great extends textShow { } }//package
Section 496
//txt_levelComplete (txt_levelComplete) package { import lib.*; public dynamic class txt_levelComplete extends textShow { } }//package
Section 497
//txt_levelfail (txt_levelfail) package { import lib.*; public dynamic class txt_levelfail extends textShow { } }//package
Section 498
//txt_space (txt_space) package { import lib.*; public dynamic class txt_space extends textShow { } }//package
Section 499
//usedss (usedss) package { import lib.*; public dynamic class usedss extends textShow { } }//package
Section 500
//Vector (Vector) package { public class Vector { public var x:Number; public var y:Number; public function Vector(_arg1:Number, _arg2:Number){ x = _arg1; y = _arg2; } public function cross(_arg1:Vector):Number{ return (((x * _arg1.y) - (y * _arg1.x))); } public function magnitude():Number{ return (Math.sqrt(((x * x) + (y * y)))); } public function plusNew(_arg1:Vector):Vector{ return (new Vector((x + _arg1.x), (y + _arg1.y))); } public function mult(_arg1:Number):Vector{ x = (x * _arg1); y = (y * _arg1); return (this); } public function dot(_arg1:Vector):Number{ return (((x * _arg1.x) + (y * _arg1.y))); } public function normalize():Vector{ var _local1:Number; _local1 = Math.sqrt(((x * x) + (y * y))); x = (x / _local1); y = (y / _local1); return (this); } public function project(_arg1:Vector):Vector{ var _local2:Number; var _local3:Number; var _local4:Vector; _local2 = this.dot(_arg1); _local3 = ((_arg1.x * _arg1.x) + (_arg1.y * _arg1.y)); _local4 = new Vector(0, 0); _local4.x = ((_local2 / _local3) * _arg1.x); _local4.y = ((_local2 / _local3) * _arg1.y); return (_local4); } public function copy(_arg1:Vector):void{ x = _arg1.x; y = _arg1.y; } public function multNew(_arg1:Number):Vector{ return (new Vector((x * _arg1), (y * _arg1))); } public function minus(_arg1:Vector):Vector{ x = (x - _arg1.x); y = (y - _arg1.y); return (this); } public function plus(_arg1:Vector):Vector{ x = (x + _arg1.x); y = (y + _arg1.y); return (this); } public function distance(_arg1:Vector):Number{ var _local2:Number; var _local3:Number; _local2 = (x - _arg1.x); _local3 = (y - _arg1.y); return (Math.sqrt(((_local2 * _local2) + (_local3 * _local3)))); } public function setTo(_arg1:Number, _arg2:Number):void{ x = _arg1; y = _arg2; } public function minusNew(_arg1:Vector):Vector{ return (new Vector((x - _arg1.x), (y - _arg1.y))); } } }//package
Section 501
//wallofhair (wallofhair) package { import lib.*; public dynamic class wallofhair extends textShow { } }//package
Section 502
//WARNING (WARNING) package { import lib.*; public dynamic class WARNING extends textShow { } }//package
Section 503
//wet (wet) package { import lib.*; public dynamic class wet extends textShow { } }//package
Section 504
//YAYwelldontt (YAYwelldontt) package { import lib.*; public dynamic class YAYwelldontt extends textShow { } }//package
Section 505
//Yourcl (Yourcl) package { import lib.*; public dynamic class Yourcl extends textShow { } }//package
Section 506
//YOURNAME (YOURNAME) package { import lib.*; public dynamic class YOURNAME extends textShow { } }//package
Section 507
//Yourstylingskillsarerigh (Yourstylingskillsarerigh) package { import lib.*; public dynamic class Yourstylingskillsarerigh extends textShow { } }//package
Section 508
//按钮_back (按钮_back) package { import lib.*; public dynamic class 按钮_back extends myButton { } }//package
Section 509
//按钮_Big_hair (按钮_Big_hair) package { import lib.*; public dynamic class 按钮_Big_hair extends myButton { } }//package
Section 510
//按钮_continue (按钮_continue) package { import lib.*; public dynamic class 按钮_continue extends myButton { } }//package
Section 511
//按钮_copy (按钮_copy) package { import lib.*; public dynamic class 按钮_copy extends myButton { } }//package
Section 512
//按钮_Great_hair (按钮_Great_hair) package { import lib.*; public dynamic class 按钮_Great_hair extends myButton { } }//package
Section 513
//按钮_highScore (按钮_highScore) package { import lib.*; public dynamic class 按钮_highScore extends myButton { } }//package
Section 514
//按钮_howtoplay (按钮_howtoplay) package { import lib.*; public dynamic class 按钮_howtoplay extends myButton { } }//package
Section 515
//按钮_huge_hair (按钮_huge_hair) package { import lib.*; public dynamic class 按钮_huge_hair extends myButton { } }//package
Section 516
//按钮_MAINMENU (按钮_MAINMENU) package { import lib.*; public dynamic class 按钮_MAINMENU extends myButton { } }//package
Section 517
//按钮_moregame (按钮_moregame) package { import lib.*; public dynamic class 按钮_moregame extends myButton { } }//package
Section 518
//按钮_start (按钮_start) package { import lib.*; public dynamic class 按钮_start extends myButton { } }//package
Section 519
//按钮_startgame (按钮_startgame) package { import lib.*; public dynamic class 按钮_startgame extends myButton { } }//package
Section 520
//按钮_subscore (按钮_subscore) package { import lib.*; public dynamic class 按钮_subscore extends myButton { } }//package
Section 521
//按钮_tryagain (按钮_tryagain) package { import lib.*; public dynamic class 按钮_tryagain extends myButton { } }//package
Section 522
//按钮_wallofhair (按钮_wallofhair) package { import lib.*; public dynamic class 按钮_wallofhair extends myButton { } }//package
Section 523
//按钮_声音 (按钮_声音) package { import lib.*; public dynamic class 按钮_声音 extends myButton { } }//package
Section 524
//按钮_暂停 (按钮_暂停) package { import lib.*; public dynamic class 按钮_暂停 extends myButton { public function 按钮_暂停(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 525
//按钮_画面质量 (按钮_画面质量) package { import lib.*; public dynamic class 按钮_画面质量 extends myButton { } }//package
Section 526
//按钮_返回 (按钮_返回) package { import lib.*; public dynamic class 按钮_返回 extends myButton { } }//package
Section 527
//按钮_音量 (按钮_音量) package { import lib.*; public dynamic class 按钮_音量 extends myButton { public function 按钮_音量(){ addFrameScript(0, frame1); } function frame1(){ stop(); } } }//package
Section 528
//按钮SENDTOFRIEND (按钮SENDTOFRIEND) package { import lib.*; public dynamic class 按钮SENDTOFRIEND extends myButton { } }//package
Section 529
//选择 (选择) package { import lib.*; public dynamic class 选择 extends myButton { } }//package

Library Items

Symbol 1 GraphicUsed by:5
Symbol 2 GraphicUsed by:5
Symbol 3 GraphicUsed by:5
Symbol 4 GraphicUsed by:5
Symbol 5 MovieClip {Hand}Uses:1 2 3 4
Symbol 6 GraphicUsed by:9 2293 2696 2716 3643
Symbol 7 GraphicUsed by:9
Symbol 8 GraphicUsed by:9 250 2278
Symbol 9 ButtonUses:6 7 8Used by:33
Symbol 10 GraphicUsed by:33 53 517 2417 2735 3007 3187 3427 3509 3591 3640
Symbol 11 GraphicUsed by:30
Symbol 12 GraphicUsed by:30
Symbol 13 GraphicUsed by:30
Symbol 14 GraphicUsed by:30
Symbol 15 GraphicUsed by:30
Symbol 16 GraphicUsed by:30
Symbol 17 GraphicUsed by:30
Symbol 18 GraphicUsed by:30
Symbol 19 GraphicUsed by:30
Symbol 20 GraphicUsed by:30
Symbol 21 GraphicUsed by:30
Symbol 22 GraphicUsed by:30
Symbol 23 GraphicUsed by:30
Symbol 24 GraphicUsed by:30
Symbol 25 GraphicUsed by:30
Symbol 26 GraphicUsed by:30
Symbol 27 GraphicUsed by:30
Symbol 28 GraphicUsed by:30
Symbol 29 GraphicUsed by:30
Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833}Uses:11 12 13 14 15 16 17 18 19 20 21 22 23 24 25 26 27 28 29Used by:33 53
Symbol 31 FontUsed by:32
Symbol 32 EditableTextUses:31Used by:33
Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}Uses:9 10 30 32Used by:34
Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc}Uses:33
Symbol 35 GraphicUsed by:53
Symbol 36 GraphicUsed by:52
Symbol 37 GraphicUsed by:52
Symbol 38 GraphicUsed by:52
Symbol 39 GraphicUsed by:52
Symbol 40 GraphicUsed by:52
Symbol 41 GraphicUsed by:52
Symbol 42 GraphicUsed by:52
Symbol 43 GraphicUsed by:52
Symbol 44 GraphicUsed by:52
Symbol 45 GraphicUsed by:52
Symbol 46 GraphicUsed by:52
Symbol 47 GraphicUsed by:52
Symbol 48 GraphicUsed by:52
Symbol 49 GraphicUsed by:52
Symbol 50 GraphicUsed by:52
Symbol 51 GraphicUsed by:52
Symbol 52 MovieClipUses:36 37 38 39 40 41 42 43 44 45 46 47 48 49 50 51Used by:53
Symbol 53 MovieClip {spill.localisation.LanguageSelectBox_mc}Uses:35 52 10 30
Symbol 54 GraphicUsed by:55
Symbol 55 MovieClipUses:54Used by:58
Symbol 56 GraphicUsed by:57
Symbol 57 MovieClipUses:56Used by:58
Symbol 58 MovieClip {button_huichen}Uses:55 57
Symbol 59 GraphicUsed by:60
Symbol 60 MovieClipUses:59Used by:112 117 126 145 146
Symbol 61 MovieClip {fl.core.ComponentShim}Used by:80 111 112 117 126 145 146
Symbol 62 GraphicUsed by:63
Symbol 63 MovieClip {List_skin}Uses:62Used by:112
Symbol 64 GraphicUsed by:65
Symbol 65 MovieClip {CellRenderer_upSkin}Uses:64Used by:80
Symbol 66 GraphicUsed by:67
Symbol 67 MovieClip {CellRenderer_disabledSkin}Uses:66Used by:80
Symbol 68 GraphicUsed by:69
Symbol 69 MovieClip {CellRenderer_downSkin}Uses:68Used by:80
Symbol 70 GraphicUsed by:71
Symbol 71 MovieClip {CellRenderer_overSkin}Uses:70Used by:80
Symbol 72 GraphicUsed by:73
Symbol 73 MovieClip {CellRenderer_selectedDisabledSkin}Uses:72Used by:80
Symbol 74 GraphicUsed by:75
Symbol 75 MovieClip {CellRenderer_selectedDownSkin}Uses:74Used by:80
Symbol 76 GraphicUsed by:77
Symbol 77 MovieClip {CellRenderer_selectedOverSkin}Uses:76Used by:80
Symbol 78 GraphicUsed by:79
Symbol 79 MovieClip {CellRenderer_selectedUpSkin}Uses:78Used by:80
Symbol 80 MovieClip {fl.controls.listClasses.CellRenderer}Uses:65 61 67 69 71 73 75 77 79Used by:112
Symbol 81 GraphicUsed by:82
Symbol 82 MovieClip {focusRectSkin}Uses:81Used by:111 112 117 126 145 146
Symbol 83 GraphicUsed by:84
Symbol 84 MovieClip {ScrollTrack_skin}Uses:83Used by:111 146
Symbol 85 GraphicUsed by:88
Symbol 86 GraphicUsed by:87 90 94 104
Symbol 87 MovieClipUses:86Used by:88 98 100
Symbol 88 MovieClip {ScrollArrowUp_downSkin}Uses:85 87Used by:111 146
Symbol 89 GraphicUsed by:90
Symbol 90 MovieClip {ScrollArrowDown_downSkin}Uses:89 86Used by:111 146
Symbol 91 GraphicUsed by:92
Symbol 92 MovieClip {ScrollThumb_downSkin}Uses:91Used by:111 146
Symbol 93 GraphicUsed by:94
Symbol 94 MovieClip {ScrollArrowDown_overSkin}Uses:93 86Used by:111 146
Symbol 95 GraphicUsed by:96
Symbol 96 MovieClip {ScrollThumb_overSkin}Uses:95Used by:111 146
Symbol 97 GraphicUsed by:98
Symbol 98 MovieClip {ScrollArrowUp_overSkin}Uses:97 87Used by:111 146
Symbol 99 GraphicUsed by:100
Symbol 100 MovieClip {ScrollArrowUp_upSkin}Uses:99 87Used by:111 146
Symbol 101 GraphicUsed by:102
Symbol 102 MovieClip {ScrollThumb_upSkin}Uses:101Used by:111 146
Symbol 103 GraphicUsed by:104
Symbol 104 MovieClip {ScrollArrowDown_upSkin}Uses:103 86Used by:111 146
Symbol 105 GraphicUsed by:106
Symbol 106 MovieClip {ScrollArrowDown_disabledSkin}Uses:105Used by:111 146
Symbol 107 GraphicUsed by:108
Symbol 108 MovieClip {ScrollArrowUp_disabledSkin}Uses:107Used by:111 146
Symbol 109 GraphicUsed by:110
Symbol 110 MovieClip {ScrollBar_thumbIcon}Uses:109Used by:111 146
Symbol 111 MovieClip {fl.controls.ScrollBar}Uses:84 61 82 88 90 92 94 96 98 100 102 104 106 108 110Used by:112
Symbol 112 MovieClip {fl.controls.List}Uses:60 61 63 80 82 111Used by:126
Symbol 113 GraphicUsed by:114
Symbol 114 MovieClip {TextInput_disabledSkin}Uses:113Used by:117
Symbol 115 GraphicUsed by:116
Symbol 116 MovieClip {TextInput_upSkin}Uses:115Used by:117
Symbol 117 MovieClip {fl.controls.TextInput}Uses:60 61 114 116 82Used by:126
Symbol 118 GraphicUsed by:119
Symbol 119 MovieClip {ComboBox_upSkin}Uses:118Used by:126
Symbol 120 GraphicUsed by:121
Symbol 121 MovieClip {ComboBox_disabledSkin}Uses:120Used by:126
Symbol 122 GraphicUsed by:123
Symbol 123 MovieClip {ComboBox_overSkin}Uses:122Used by:126
Symbol 124 GraphicUsed by:125
Symbol 125 MovieClip {ComboBox_downSkin}Uses:124Used by:126
Symbol 126 MovieClip {fl.controls.ComboBox}Uses:60 61 82 119 121 123 125 117 112Used by:164
Symbol 127 GraphicUsed by:128
Symbol 128 MovieClip {Button_disabledSkin}Uses:127Used by:145
Symbol 129 GraphicUsed by:130
Symbol 130 MovieClip {Button_downSkin}Uses:129Used by:145
Symbol 131 GraphicUsed by:132
Symbol 132 MovieClip {Button_emphasizedSkin}Uses:131Used by:145
Symbol 133 GraphicUsed by:134
Symbol 134 MovieClip {Button_overSkin}Uses:133Used by:145
Symbol 135 GraphicUsed by:136
Symbol 136 MovieClip {Button_selectedDisabledSkin}Uses:135Used by:145
Symbol 137 GraphicUsed by:138
Symbol 138 MovieClip {Button_selectedDownSkin}Uses:137Used by:145
Symbol 139 GraphicUsed by:140
Symbol 140 MovieClip {Button_selectedOverSkin}Uses:139Used by:145
Symbol 141 GraphicUsed by:142
Symbol 142 MovieClip {Button_selectedUpSkin}Uses:141Used by:145
Symbol 143 GraphicUsed by:144
Symbol 144 MovieClip {Button_upSkin}Uses:143Used by:145
Symbol 145 MovieClip {fl.controls.Button}Uses:60 61 128 130 132 134 136 138 140 142 144 82Used by:164
Symbol 146 MovieClip {fl.controls.UIScrollBar}Uses:60 61 82 84 88 90 92 94 96 98 100 102 104 106 108 110Used by:164
Symbol 147 GraphicUsed by:150
Symbol 148 FontUsed by:149 154 161 162 163 424 425 428 429 430 431 432 433 434 435 436 437 438 839 841 842 843 844 845 846 847 848 849 850 851 854 856 857 858 859 860 861 862 863 864 865 866 867 870 872 873 874 875 876 877 878 879 880 881 882 883 914 916 917 918 919 920 921 922 923 924 925 926 927 932 933 934 935 936 942 943 944 945 946 947 948 949 950 951 952 953 954 955 956 957 958 959 960 961 962 963 964 965 966 967 968 969 970 971 972 973 974 975 976 977 978 979 980 981 982 983 984 985 986 987 988 989 990 991 992 993 994 995 996 997 998 999 1000 1001 1013 1015 1016 1017 1018 1019 1020 1021 1022 1023 1024 1025 2294 2297 2298 2299 2300 2301 2302 2303 2304 2305 2306 2309 2311 2312 2313 2314 2315 2316 2317 2318 2319 2320 2782 2784 2785 2786 2787 2788 2789 2790 2791 2792 2793 2794 2853 2855 2856 2857 2858 2859 2860 2861 2862 2863 2864 2865 2986 3025 3526 3527 3528 3529 3530 3531 3533 3534 3535 3536 3541 3542 3543 3544 3545 3546 3547 3548 3549 3550 3551 3552 3553 3554 3555 3556 3557 3558 3559 3560 3561 3562 3563 3564 3565 3566 3567 3568 3569 3570 3571 3572 3573 3574 3575 3576 3577 3578 3579 3580 3581 3582 3583 3584 3585 3594 3595 3601 3602 3604 3605 3607 3608 3610 3611 3613 3614 3616 3617 3619 3620 3622 3623 3625 3626 3628 3629 3631 3632 3663 3665 3666 3667 3668 3669 3670 3671 3672 3673 3674 3675 3681 3686 3688 3689 3690 3691 3692 3693 3694 3695 3696 3697 3698 3705 3707 3708 3709 3710 3711 3712 3713 3714 3715 3716 3717 3728 3730 3731 3732 3733 3734 3735 3736 3737 3738 3739 3740 3741 3744 3746 3747 3748 3749 3750 3751 3752 3753 3754 3755 3756 3757 3893 3905 3906
Symbol 149 TextUses:148Used by:150
Symbol 150 MovieClipUses:147 149Used by:164
Symbol 151 GraphicUsed by:152
Symbol 152 MovieClip {hair_mania_0827_fla.test_mianban_779}Uses:151Used by:164
Symbol 153 GraphicUsed by:155
Symbol 154 TextUses:148Used by:155
Symbol 155 MovieClipUses:153 154Used by:164
Symbol 156 FontUsed by:157 2717 3024 3231 3249 3444
Symbol 157 EditableTextUses:156Used by:164
Symbol 158 FontUsed by:159 2452 2453 2454 2455 2456 2457 2458 2459 2460 2461 2462 2463
Symbol 159 EditableTextUses:158Used by:164
Symbol 160 GraphicUsed by:164
Symbol 161 TextUses:148Used by:164
Symbol 162 TextUses:148Used by:164
Symbol 163 TextUses:148Used by:164
Symbol 164 MovieClip {lib.TestCode}Uses:150 152 155 157 159 160 146 145 126 161 162 163
Symbol 165 GraphicUsed by:166 469
Symbol 166 MovieClip {_masks}Uses:165
Symbol 167 GraphicUsed by:182
Symbol 168 GraphicUsed by:182
Symbol 169 GraphicUsed by:182
Symbol 170 GraphicUsed by:182
Symbol 171 GraphicUsed by:182
Symbol 172 GraphicUsed by:182
Symbol 173 GraphicUsed by:182
Symbol 174 GraphicUsed by:182
Symbol 175 GraphicUsed by:182
Symbol 176 GraphicUsed by:182
Symbol 177 GraphicUsed by:182
Symbol 178 GraphicUsed by:182
Symbol 179 GraphicUsed by:182
Symbol 180 GraphicUsed by:182
Symbol 181 GraphicUsed by:182
Symbol 182 MovieClip {Lethe_Text1}Uses:167 168 169 170 171 172 173 174 175 176 177 178 179 180 181Used by:397
Symbol 183 GraphicUsed by:198
Symbol 184 GraphicUsed by:198
Symbol 185 GraphicUsed by:198
Symbol 186 GraphicUsed by:198
Symbol 187 GraphicUsed by:198
Symbol 188 GraphicUsed by:198
Symbol 189 GraphicUsed by:198
Symbol 190 GraphicUsed by:198
Symbol 191 GraphicUsed by:198
Symbol 192 GraphicUsed by:198
Symbol 193 GraphicUsed by:198
Symbol 194 GraphicUsed by:198
Symbol 195 GraphicUsed by:198
Symbol 196 GraphicUsed by:198
Symbol 197 GraphicUsed by:198
Symbol 198 MovieClip {Lethe_Text2}Uses:183 184 185 186 187 188 189 190 191 192 193 194 195 196 197Used by:313
Symbol 199 GraphicUsed by:213
Symbol 200 GraphicUsed by:213
Symbol 201 GraphicUsed by:213
Symbol 202 GraphicUsed by:213
Symbol 203 GraphicUsed by:213
Symbol 204 GraphicUsed by:213
Symbol 205 GraphicUsed by:213
Symbol 206 GraphicUsed by:213
Symbol 207 GraphicUsed by:213
Symbol 208 GraphicUsed by:213
Symbol 209 GraphicUsed by:213
Symbol 210 GraphicUsed by:213
Symbol 211 GraphicUsed by:213
Symbol 212 GraphicUsed by:213
Symbol 213 MovieClip {Lethe_Month_Text}Uses:199 200 201 202 203 204 205 206 207 208 209 210 211 212Used by:269 275
Symbol 214 GraphicUsed by:227
Symbol 215 GraphicUsed by:227
Symbol 216 GraphicUsed by:227
Symbol 217 GraphicUsed by:227
Symbol 218 GraphicUsed by:227
Symbol 219 GraphicUsed by:227
Symbol 220 GraphicUsed by:227
Symbol 221 GraphicUsed by:227
Symbol 222 GraphicUsed by:227
Symbol 223 GraphicUsed by:227
Symbol 224 GraphicUsed by:227
Symbol 225 GraphicUsed by:227
Symbol 226 GraphicUsed by:227
Symbol 227 MovieClip {Lethe_Week_Text}Uses:214 215 216 217 218 219 220 221 222 223 224 225 226Used by:268 274
Symbol 228 GraphicUsed by:241
Symbol 229 GraphicUsed by:241
Symbol 230 GraphicUsed by:241
Symbol 231 GraphicUsed by:241
Symbol 232 GraphicUsed by:241
Symbol 233 GraphicUsed by:241
Symbol 234 GraphicUsed by:241
Symbol 235 GraphicUsed by:241
Symbol 236 GraphicUsed by:241
Symbol 237 GraphicUsed by:241
Symbol 238 GraphicUsed by:241
Symbol 239 GraphicUsed by:241
Symbol 240 GraphicUsed by:241
Symbol 241 MovieClip {Lethe_Day_Text}Uses:228 229 230 231 232 233 234 235 236 237 238 239 240Used by:243 273
Symbol 242 GraphicUsed by:243 268 269
Symbol 243 MovieClip {Lethe_Button_Up}Uses:242 241Used by:399
Symbol 244 GraphicUsed by:245 3509
Symbol 245 MovieClip {Lethe_DragArea}Uses:244Used by:267
Symbol 246 GraphicUsed by:247
Symbol 247 MovieClip {Lethe_Scroll_Down}Uses:246Used by:267
Symbol 248 FontUsed by:249 276 277 278 307
Symbol 249 EditableTextUses:248Used by:250
Symbol 250 MovieClip {Lethe_PreviewMc}Uses:8 249Used by:399
Symbol 251 MovieClip {O11111111}Used by:399
Symbol 252 GraphicUsed by:253
Symbol 253 MovieClipUses:252Used by:254
Symbol 254 MovieClip {Lethe_BackGround}Uses:253Used by:399
Symbol 255 GraphicUsed by:256
Symbol 256 MovieClip {Lethe_FocusLine}Uses:255Used by:399
Symbol 257 GraphicUsed by:258
Symbol 258 MovieClip {Lethe_LineBack}Uses:257Used by:399
Symbol 259 GraphicUsed by:260
Symbol 260 MovieClip {Lethe_LineBack2}Uses:259Used by:399
Symbol 261 GraphicUsed by:262
Symbol 262 MovieClipUses:261Used by:267
Symbol 263 GraphicUsed by:264
Symbol 264 MovieClip {Lethe_Scroll_Up}Uses:263Used by:267
Symbol 265 GraphicUsed by:266
Symbol 266 MovieClip {Lethe_Drag_Block}Uses:265Used by:267
Symbol 267 MovieClip {Lethe_Scroll_Bar}Uses:262 264 247 245 266Used by:399
Symbol 268 MovieClip {Lethe_Button_Up2}Uses:242 227Used by:399
Symbol 269 MovieClip {Lethe_Button_Up3}Uses:242 213Used by:399
Symbol 270 GraphicUsed by:273 274 275
Symbol 271 GraphicUsed by:272
Symbol 272 MovieClipUses:271Used by:273 274 275
Symbol 273 MovieClip {Lethe_Button_Down}Uses:270 241 272Used by:399
Symbol 274 MovieClip {Lethe_Button_Down2}Uses:270 227 272Used by:399
Symbol 275 MovieClip {Lethe_Button_Down3}Uses:270 213 272Used by:399
Symbol 276 EditableTextUses:248Used by:399
Symbol 277 EditableTextUses:248Used by:399
Symbol 278 EditableTextUses:248Used by:399
Symbol 279 GraphicUsed by:302
Symbol 280 FontUsed by:281 282 283 284 285 286 287 288 289 290 291 292 293 294 3892
Symbol 281 EditableTextUses:280Used by:299
Symbol 282 EditableTextUses:280Used by:299
Symbol 283 EditableTextUses:280Used by:299
Symbol 284 EditableTextUses:280Used by:299
Symbol 285 EditableTextUses:280Used by:299
Symbol 286 EditableTextUses:280Used by:299
Symbol 287 EditableTextUses:280Used by:299
Symbol 288 EditableTextUses:280Used by:299
Symbol 289 EditableTextUses:280Used by:299
Symbol 290 EditableTextUses:280Used by:299
Symbol 291 EditableTextUses:280Used by:299
Symbol 292 EditableTextUses:280Used by:299
Symbol 293 EditableTextUses:280Used by:299
Symbol 294 EditableTextUses:280Used by:299
Symbol 295 FontUsed by:296
Symbol 296 TextUses:295Used by:299
Symbol 297 FontUsed by:298
Symbol 298 EditableTextUses:297Used by:299
Symbol 299 MovieClip {Lethe_Text3}Uses:281 282 283 284 285 286 287 288 289 290 291 292 293 294 296 298Used by:302
Symbol 300 GraphicUsed by:302
Symbol 301 GraphicUsed by:302
Symbol 302 MovieClip {Lethe_Button_Back}Uses:279 299 300 301Used by:309
Symbol 303 GraphicUsed by:309
Symbol 304 ShapeTweeningUsed by:306
Symbol 305 GraphicUsed by:306
Symbol 306 MovieClip {COM_LoadingProgress}Uses:304 305Used by:309
Symbol 307 EditableTextUses:248Used by:308
Symbol 308 MovieClip {Lethe_Loading_Text}Uses:307Used by:309
Symbol 309 MovieClip {COM_LoadingBar}Uses:302 303 306 308Used by:399
Symbol 310 GraphicUsed by:398
Symbol 311 GraphicUsed by:313 397
Symbol 312 GraphicUsed by:313
Symbol 313 MovieClip {Lethe_Continue_Button}Uses:311 198 312Used by:398
Symbol 314 GraphicUsed by:315
Symbol 315 MovieClipUses:314Used by:394 395
Symbol 316 GraphicUsed by:327
Symbol 317 GraphicUsed by:327
Symbol 318 GraphicUsed by:327
Symbol 319 GraphicUsed by:327 781 3186
Symbol 320 GraphicUsed by:327
Symbol 321 GraphicUsed by:327
Symbol 322 GraphicUsed by:327
Symbol 323 GraphicUsed by:327
Symbol 324 GraphicUsed by:327
Symbol 325 GraphicUsed by:326
Symbol 326 MovieClipUses:325Used by:327
Symbol 327 MovieClipUses:316 317 318 319 320 321 322 323 324 326Used by:394 395
Symbol 328 GraphicUsed by:329
Symbol 329 MovieClipUses:328Used by:394 395
Symbol 330 GraphicUsed by:331
Symbol 331 MovieClipUses:330Used by:394 395
Symbol 332 GraphicUsed by:333
Symbol 333 MovieClipUses:332Used by:394 395
Symbol 334 GraphicUsed by:335
Symbol 335 MovieClipUses:334Used by:394 395
Symbol 336 GraphicUsed by:337
Symbol 337 MovieClipUses:336Used by:394 395
Symbol 338 GraphicUsed by:339
Symbol 339 MovieClipUses:338Used by:394 395
Symbol 340 GraphicUsed by:341
Symbol 341 MovieClipUses:340Used by:394 395
Symbol 342 GraphicUsed by:343
Symbol 343 MovieClipUses:342Used by:394 395
Symbol 344 GraphicUsed by:345
Symbol 345 MovieClipUses:344Used by:394 395
Symbol 346 GraphicUsed by:347
Symbol 347 MovieClipUses:346Used by:394 395
Symbol 348 GraphicUsed by:349
Symbol 349 MovieClipUses:348Used by:394 395
Symbol 350 GraphicUsed by:351
Symbol 351 MovieClipUses:350Used by:394 395
Symbol 352 GraphicUsed by:353
Symbol 353 MovieClipUses:352Used by:394 395
Symbol 354 GraphicUsed by:355
Symbol 355 MovieClipUses:354Used by:394 395
Symbol 356 GraphicUsed by:359
Symbol 357 GraphicUsed by:358
Symbol 358 MovieClipUses:357Used by:359 373
Symbol 359 MovieClipUses:356 358Used by:394 395
Symbol 360 GraphicUsed by:361
Symbol 361 MovieClipUses:360Used by:394 395
Symbol 362 GraphicUsed by:363
Symbol 363 MovieClipUses:362Used by:394 395
Symbol 364 GraphicUsed by:365
Symbol 365 MovieClipUses:364Used by:394 395
Symbol 366 GraphicUsed by:367
Symbol 367 MovieClipUses:366Used by:394 395
Symbol 368 GraphicUsed by:369
Symbol 369 MovieClipUses:368Used by:394 395
Symbol 370 GraphicUsed by:371
Symbol 371 MovieClipUses:370Used by:394 395
Symbol 372 GraphicUsed by:373
Symbol 373 MovieClipUses:372 358Used by:394 395
Symbol 374 GraphicUsed by:375
Symbol 375 MovieClipUses:374Used by:394 395
Symbol 376 GraphicUsed by:377
Symbol 377 MovieClipUses:376Used by:394 395
Symbol 378 GraphicUsed by:379
Symbol 379 MovieClipUses:378Used by:394 395
Symbol 380 GraphicUsed by:381
Symbol 381 MovieClipUses:380Used by:394 395
Symbol 382 GraphicUsed by:383
Symbol 383 MovieClipUses:382Used by:394 395
Symbol 384 GraphicUsed by:385
Symbol 385 MovieClipUses:384Used by:394 395
Symbol 386 GraphicUsed by:387
Symbol 387 MovieClipUses:386Used by:394 395
Symbol 388 GraphicUsed by:389
Symbol 389 MovieClipUses:388Used by:394 395
Symbol 390 GraphicUsed by:391
Symbol 391 MovieClipUses:390Used by:394 395
Symbol 392 GraphicUsed by:393
Symbol 393 MovieClipUses:392Used by:394 395
Symbol 394 MovieClip {spill.localisation.BrandingLogo}Uses:315 327 329 331 333 335 337 339 341 343 345 347 349 351 353 355 359 361 363 365 367 369 371 373 375 377 379 381 383 385 387 389 391 393Used by:397 519 1045 2346 2667
Symbol 395 MovieClip {Lethe_All_Logo}Uses:315 327 329 331 333 335 337 339 341 343 345 347 349 351 353 355 359 361 363 365 367 369 371 373 375 377 379 381 383 385 387 389 391 393Used by:397
Symbol 396 GraphicUsed by:397
Symbol 397 MovieClip {Lethe_Link_Button}Uses:311 394 182 395 396Used by:398
Symbol 398 MovieClip {Lethe_Alert_Page}Uses:310 313 397Used by:399
Symbol 399 MovieClip {O11111OO11}Uses:250 251 254 256 258 260 267 243 268 269 273 274 275 276 277 278 309 398Used by:Timeline
Symbol 400 FontUsed by:401 403
Symbol 401 TextUses:400Used by:404
Symbol 402 GraphicUsed by:404 3442 3661 3760
Symbol 403 TextUses:400Used by:404
Symbol 404 Button {spill.localisation.SpilGamesLink}Uses:401 402 403Used by:3509
Symbol 405 GraphicUsed by:519  Timeline
Symbol 406 GraphicUsed by:407
Symbol 407 MovieClipUses:406Used by:519 836
Symbol 408 GraphicUsed by:409
Symbol 409 MovieClipUses:408Used by:519 836 2756 2875 3680
Symbol 410 GraphicUsed by:519
Symbol 411 BitmapUsed by:412
Symbol 412 GraphicUses:411Used by:423
Symbol 413 GraphicUsed by:423
Symbol 414 GraphicUsed by:415
Symbol 415 MovieClipUses:414Used by:423
Symbol 416 GraphicUsed by:422
Symbol 417 GraphicUsed by:422
Symbol 418 GraphicUsed by:422
Symbol 419 GraphicUsed by:422
Symbol 420 GraphicUsed by:421
Symbol 421 MovieClipUses:420Used by:422
Symbol 422 MovieClipUses:416 417 418 419 421Used by:423
Symbol 423 MovieClip {hairmanialogo}Uses:412 413 415 422Used by:519 2417 2670 2735 2797 3250 3509  Timeline
Symbol 424 EditableTextUses:148Used by:519
Symbol 425 TextUses:148Used by:439
Symbol 426 FontUsed by:427 840 852 855 868 871 884 915 928 937 938 939 940 941 1002 1003 1004 1005 1006 1014 1026 3537 3538 3539 3540 3586 3587 3588 3589 3641
Symbol 427 TextUses:426Used by:439
Symbol 428 TextUses:148Used by:439
Symbol 429 TextUses:148Used by:439
Symbol 430 TextUses:148Used by:439
Symbol 431 TextUses:148Used by:439
Symbol 432 TextUses:148Used by:439
Symbol 433 TextUses:148Used by:439
Symbol 434 TextUses:148Used by:439
Symbol 435 TextUses:148Used by:439
Symbol 436 TextUses:148Used by:439
Symbol 437 TextUses:148Used by:439
Symbol 438 TextUses:148Used by:439
Symbol 439 MovieClip {loadingtt}Uses:425 427 428 429 430 431 432 433 434 435 436 437 438Used by:519
Symbol 440 FontUsed by:441 444 445 446 447 448 449 450 451 452 453 897 899 900 901 902 903 904 905 906 907 908 2403 2405 2406 2407 2408 2409 2410 2411 2412 2413 2467 2470 2471 2472 2473 2474 2475 2476 2477 2478 2479 2480 2483 2485 2486 2487 2488 2489 2490 2491 2492 2493 2494 2495 2498 2500 2501 2502 2503 2504 2505 2506 2507 2508 2509 2510 2513 2515 2516 2517 2518 2519 2520 2521 2522 2523 2524 2525 2528 2530 2531 2532 2533 2534 2535 2536 2537 2538 2539 2540 2543 2545 2546 2547 2548 2549 2550 2551 2552 2553 2554 2555 2558 2560 2561 2562 2563 2564 2565 2566 2567 2568 2569 2570 2573 2575 2576 2577 2578 2579 2580 2581 2582 2583 2584 2585 2588 2590 2591 2592 2593 2594 2595 2596 2597 2598 2599 2600 2603 2605 2606 2607 2608 2609 2610 2611 2612 2613 2614 2615 2618 2620 2621 2622 2623 2624 2625 2626 2627 2628 2629 2630 2633 2635 2636 2637 2638 2639 2640 2641 2642 2643 2644 2647 2649 2650 2651 2652 2653 2654 2655 2656 2657 2658 2659 2660 2697 2698 2700 2701 2702 2703 2704 2705 2706 2707 2708 2709 2710 2718 2719 2721 2722 2723 2724 2725 2726 2727 2728 2729 2730 2731 2757 2766 2768 2769 2770 2771 2772 2773 2774 2775 2776 2777 2778 2798 2799 2801 2802 2803 2804 2805 2806 2807 2808 2809 2810 2811 2814 2816 2817 2818 2819 2820 2821 2822 2823 2824 2825 2826 2827 2830 2831 2832 2834 2836 2837 2838 2839 2840 2841 2842 2843 2844 2845 2846 2876 2878 2879 2880 2881 2882 2883 2884 2885 2886 2887 2891 2893 2894 2895 2896 2897 2898 2899 2900 2901 2902 2903 2907 2909 2910 2911 2912 2913 2914 2915 2916 2917 2918 2919 2920 2924 2926 2927 2928 2929 2930 2931 2932 2933 2934 2935 2938 2940 2941 2942 2943 2944 2945 2946 2947 2948 2949 2950 2954 2956 2957 2958 2959 2960 2961 2962 2963 2964 2965 2966 2967 2970 2972 2973 2974 2975 2976 2977 2978 2979 2980 2981 2982 2988 2990 2991 2992 2993 2994 2995 2996 2997 2998 2999 3000 3008 3010 3011 3012 3013 3014 3015 3016 3017 3018 3019 3020 3026 3028 3029 3030 3031 3032 3033 3034 3035 3036 3037 3038 3041 3043 3044 3045 3046 3047 3048 3049 3050 3051 3052 3053 3056 3058 3059 3060 3061 3062 3063 3064 3065 3066 3067 3068 3069 3072 3074 3075 3076 3077 3078 3079 3080 3081 3082 3083 3084 3087 3089 3090 3091 3092 3093 3094 3095 3096 3097 3098 3099 3102 3104 3105 3106 3107 3108 3109 3110 3111 3112 3113 3114 3118 3120 3121 3122 3123 3124 3125 3126 3127 3128 3129 3130 3189 3190 3192 3193 3194 3195 3196 3197 3200 3202 3203 3204 3205 3206 3207 3208 3209 3210 3211 3212 3215 3217 3218 3219 3220 3221 3222 3223 3224 3225 3226 3227 3228 3234 3235 3237 3238 3239 3240 3241 3242 3243 3244 3245 3251 3253 3254 3255 3256 3257 3258 3259 3260 3261 3265 3267 3268 3269 3270 3271 3272 3273 3274 3275 3276 3277 3280 3282 3283 3284 3285 3286 3287 3288 3289 3290 3291 3292 3296 3298 3299 3300 3301 3302 3303 3304 3305 3306 3307 3308 3312 3314 3315 3316 3317 3318 3319 3320 3321 3322 3323 3324 3327 3329 3330 3331 3332 3333 3334 3335 3336 3337 3338 3339 3342 3344 3345 3346 3347 3348 3349 3350 3351 3352 3353 3354 3355 3358 3360 3361 3362 3363 3364 3365 3366 3367 3368 3369 3370 3371 3379 3381 3382 3383 3384 3385 3386 3387 3388 3389 3390 3391 3395 3397 3398 3399 3400 3401 3402 3403 3404 3405 3406 3407 3411 3413 3414 3415 3416 3417 3418 3419 3420 3421 3422 3423 3445 3447 3448 3449 3450 3451 3452 3453 3454 3455 3456 3457 3461 3463 3464 3465 3466 3467 3468 3469 3470 3471 3472 3476 3478 3479 3480 3481 3482 3483 3484 3485 3486 3487 3493 3495 3496 3497 3498 3499 3500 3501 3502 3503 3504 3505 3510 3512 3513 3514 3515 3516 3517 3518 3519 3520 3521 3522 3896 3897 3898 3899 3900 3908 3910 3912 3914 3916 3920 3922 3924 3926
Symbol 441 TextUses:440Used by:455
Symbol 442 FontUsed by:443 454 898 909 2404 2414 2699 2711 2720 2732 2767 2779 2800 2812 2815 2828 2835 2847 2877 2888 2892 2904 2908 2921 2925 2936 2939 2951 2955 2968 2971 2983 2989 3001 3009 3021 3027 3039 3042 3054 3057 3070 3073 3085 3088 3100 3103 3115 3119 3131 3191 3198 3201 3213 3216 3229 3236 3246 3252 3262 3266 3278 3281 3293 3297 3309 3313 3325 3328 3340 3343 3356 3359 3372 3380 3392 3396 3408 3412 3424 3446 3458 3462 3473 3477 3488 3494 3506 3511 3523
Symbol 443 TextUses:442Used by:455
Symbol 444 TextUses:440Used by:455
Symbol 445 TextUses:440Used by:455
Symbol 446 TextUses:440Used by:455
Symbol 447 TextUses:440Used by:455
Symbol 448 TextUses:440Used by:455
Symbol 449 TextUses:440Used by:455
Symbol 450 TextUses:440Used by:455
Symbol 451 TextUses:440Used by:455
Symbol 452 TextUses:440Used by:455
Symbol 453 TextUses:440Used by:455
Symbol 454 TextUses:442Used by:455
Symbol 455 MovieClip {morecrazygamesat}Uses:441 443 444 445 446 447 448 449 450 451 452 453 454Used by:519 1045 2346 2667  Timeline
Symbol 456 GraphicUsed by:457
Symbol 457 MovieClipUses:456Used by:519
Symbol 458 GraphicUsed by:459
Symbol 459 ButtonUses:458Used by:519 2346
Symbol 460 GraphicUsed by:518
Symbol 461 GraphicUsed by:517
Symbol 462 GraphicUsed by:517
Symbol 463 GraphicUsed by:517
Symbol 464 ShapeTweeningUsed by:517
Symbol 465 GraphicUsed by:466
Symbol 466 MovieClipUses:465Used by:517
Symbol 467 GraphicUsed by:469
Symbol 468 GraphicUsed by:469
Symbol 469 MovieClipUses:165 467 468Used by:517
Symbol 470 ShapeTweeningUsed by:517
Symbol 471 GraphicUsed by:517
Symbol 472 ShapeTweeningUsed by:517
Symbol 473 GraphicUsed by:517
Symbol 474 GraphicUsed by:517
Symbol 475 GraphicUsed by:478 517
Symbol 476 GraphicUsed by:477
Symbol 477 MovieClipUses:476Used by:478 481 487 517
Symbol 478 MovieClipUses:475 477Used by:517
Symbol 479 GraphicUsed by:517
Symbol 480 GraphicUsed by:481
Symbol 481 MovieClipUses:480 477Used by:517
Symbol 482 ShapeTweeningUsed by:517
Symbol 483 GraphicUsed by:517
Symbol 484 ShapeTweeningUsed by:517
Symbol 485 GraphicUsed by:517
Symbol 486 GraphicUsed by:487
Symbol 487 MovieClipUses:486 477Used by:517
Symbol 488 GraphicUsed by:489 496
Symbol 489 MovieClipUses:488Used by:517
Symbol 490 GraphicUsed by:491
Symbol 491 MovieClipUses:490Used by:517
Symbol 492 GraphicUsed by:493
Symbol 493 MovieClipUses:492Used by:517
Symbol 494 GraphicUsed by:495
Symbol 495 MovieClipUses:494Used by:517
Symbol 496 MovieClipUses:488Used by:517
Symbol 497 GraphicUsed by:498
Symbol 498 MovieClipUses:497Used by:517
Symbol 499 GraphicUsed by:500
Symbol 500 MovieClipUses:499Used by:517
Symbol 501 GraphicUsed by:517
Symbol 502 ShapeTweeningUsed by:517
Symbol 503 GraphicUsed by:517
Symbol 504 GraphicUsed by:517
Symbol 505 GraphicUsed by:517
Symbol 506 GraphicUsed by:517
Symbol 507 GraphicUsed by:517
Symbol 508 GraphicUsed by:517
Symbol 509 GraphicUsed by:517
Symbol 510 GraphicUsed by:517
Symbol 511 GraphicUsed by:517
Symbol 512 GraphicUsed by:517
Symbol 513 GraphicUsed by:517
Symbol 514 GraphicUsed by:516 517
Symbol 515 GraphicUsed by:516 517
Symbol 516 MovieClip {hair_mania_0827_fla.Timeline_66}Uses:514 515Used by:517
Symbol 517 MovieClip {hair_mania_0827_fla.logoani1_52}Uses:461 462 463 464 466 469 470 471 472 473 474 478 479 481 482 483 484 485 487 475 477 489 491 493 495 496 498 500 501 502 503 504 505 506 10 507 508 509 510 511 512 513 514 515 516Used by:518
Symbol 518 MovieClip {hair_mania_0827_fla.logologo_51}Uses:460 517 SS1Used by:519
Symbol 519 MovieClip {lib.Loading}Uses:405 407 409 410 423 424 439 455 394 457 459 518Used by:Timeline
Symbol 520 GraphicUsed by:521
Symbol 521 MovieClipUses:520Used by:522
Symbol 522 MovieClip {spill.localisation.LanguageSelectBox}Uses:521Used by:3509  Timeline
Symbol 523 GraphicUsed by:524
Symbol 524 MovieClipUses:523Used by:528
Symbol 525 BitmapUsed by:526
Symbol 526 GraphicUses:525Used by:527
Symbol 527 MovieClip {com.google.analytics.components.Icon}Uses:526Used by:528
Symbol 528 MovieClip {com.google.analytics.components.FlashTracker}Uses:524 527
Symbol 529 FontUsed by:531
Symbol 530 Font
Symbol 531 EditableTextUses:529Used by:540
Symbol 532 Sound {sound_complete}Used by:540
Symbol 533 Sound {sound_failed}Used by:540
Symbol 534 Sound {sound_mainscreen}Used by:540
Symbol 535 Sound {sound_music_1}Used by:540
Symbol 536 Sound {sound_music_2}Used by:540
Symbol 537 Sound {sound_music_3}Used by:540
Symbol 538 Sound {sound_story}Used by:540
Symbol 539 Sound {sound_wall_of_hair}Used by:540
Symbol 540 MovieClip {hair_mania_0827_fla.Timeline_67}Uses:531 532 533 534 535 536 537 538 539Used by:Timeline
Symbol 541 GraphicUsed by:830
Symbol 542 BitmapUsed by:543
Symbol 543 GraphicUses:542Used by:544
Symbol 544 MovieClipUses:543Used by:553 555 1029
Symbol 545 GraphicUsed by:552
Symbol 546 GraphicUsed by:552
Symbol 547 GraphicUsed by:552
Symbol 548 GraphicUsed by:552
Symbol 549 GraphicUsed by:552
Symbol 550 GraphicUsed by:552
Symbol 551 GraphicUsed by:552
Symbol 552 MovieClipUses:545 546 547 548 549 550 551Used by:553
Symbol 553 MovieClipUses:544 552Used by:554
Symbol 554 MovieClipUses:553Used by:555
Symbol 555 MovieClip {hair_mania_0827_fla.Timeline_69}Uses:544 554Used by:830
Symbol 556 GraphicUsed by:557
Symbol 557 MovieClipUses:556Used by:830 2681 3491
Symbol 558 BitmapUsed by:559
Symbol 559 GraphicUses:558Used by:560
Symbol 560 MovieClipUses:559Used by:561 829
Symbol 561 MovieClip {hair_mania_0827_fla.Timeline_75}Uses:560Used by:830
Symbol 562 GraphicUsed by:830
Symbol 563 GraphicUsed by:564
Symbol 564 MovieClipUses:563Used by:830 3435
Symbol 565 GraphicUsed by:566
Symbol 566 MovieClipUses:565Used by:830 1029
Symbol 567 BitmapUsed by:568
Symbol 568 GraphicUses:567Used by:569
Symbol 569 MovieClipUses:568Used by:577
Symbol 570 BitmapUsed by:571
Symbol 571 GraphicUses:570Used by:576
Symbol 572 BitmapUsed by:573
Symbol 573 GraphicUses:572Used by:576
Symbol 574 BitmapUsed by:575
Symbol 575 GraphicUses:574Used by:576
Symbol 576 MovieClipUses:571 573 575Used by:577
Symbol 577 MovieClip {hair_mania_0827_fla.Timeline_79}Uses:569 576Used by:830
Symbol 578 GraphicUsed by:579
Symbol 579 MovieClipUses:578Used by:594 830 1029
Symbol 580 GraphicUsed by:581
Symbol 581 MovieClipUses:580Used by:584 594
Symbol 582 GraphicUsed by:583
Symbol 583 MovieClipUses:582Used by:584
Symbol 584 MovieClipUses:581 583Used by:593 594
Symbol 585 GraphicUsed by:588
Symbol 586 GraphicUsed by:588
Symbol 587 GraphicUsed by:588
Symbol 588 MovieClipUses:585 586 587Used by:592
Symbol 589 GraphicUsed by:592
Symbol 590 GraphicUsed by:592
Symbol 591 GraphicUsed by:592
Symbol 592 MovieClipUses:588 589 590 591Used by:594 607 630
Symbol 593 MovieClipUses:584Used by:594
Symbol 594 MovieClip {hair_mania_0827_fla.Timeline_83}Uses:579 581 584 592 593Used by:830
Symbol 595 GraphicUsed by:596
Symbol 596 MovieClipUses:595Used by:830
Symbol 597 GraphicUsed by:598
Symbol 598 MovieClipUses:597Used by:830
Symbol 599 GraphicUsed by:607
Symbol 600 GraphicUsed by:601
Symbol 601 MovieClipUses:600Used by:605 607
Symbol 602 GraphicUsed by:607
Symbol 603 GraphicUsed by:604
Symbol 604 MovieClipUses:603Used by:605
Symbol 605 MovieClipUses:604 601Used by:606 607
Symbol 606 MovieClipUses:605Used by:607
Symbol 607 MovieClip {hair_mania_0827_fla.Timeline_92}Uses:599 601 602 605 592 606Used by:830 1029
Symbol 608 GraphicUsed by:630
Symbol 609 GraphicUsed by:630
Symbol 610 GraphicUsed by:615
Symbol 611 GraphicUsed by:615
Symbol 612 GraphicUsed by:615
Symbol 613 GraphicUsed by:614
Symbol 614 MovieClipUses:613Used by:615
Symbol 615 MovieClipUses:610 611 612 614Used by:629
Symbol 616 BitmapUsed by:617
Symbol 617 GraphicUses:616Used by:628
Symbol 618 BitmapUsed by:619
Symbol 619 GraphicUses:618Used by:628
Symbol 620 BitmapUsed by:621
Symbol 621 GraphicUses:620Used by:628
Symbol 622 BitmapUsed by:623
Symbol 623 GraphicUses:622Used by:628
Symbol 624 BitmapUsed by:625
Symbol 625 GraphicUses:624Used by:628
Symbol 626 BitmapUsed by:627
Symbol 627 GraphicUses:626Used by:628
Symbol 628 MovieClipUses:617 619 621 623 625 627Used by:629 799
Symbol 629 MovieClipUses:615 628Used by:630
Symbol 630 MovieClip {hair_mania_0827_fla.Timeline_97}Uses:608 609 629 592Used by:830 1029
Symbol 631 BitmapUsed by:632 675
Symbol 632 GraphicUses:631Used by:633
Symbol 633 MovieClipUses:632Used by:677 830
Symbol 634 GraphicUsed by:635
Symbol 635 MovieClipUses:634Used by:676 755
Symbol 636 ShapeTweeningUsed by:674
Symbol 637 ShapeTweeningUsed by:674
Symbol 638 ShapeTweeningUsed by:674
Symbol 639 ShapeTweeningUsed by:674
Symbol 640 ShapeTweeningUsed by:674
Symbol 641 ShapeTweeningUsed by:674
Symbol 642 ShapeTweeningUsed by:674
Symbol 643 ShapeTweeningUsed by:674
Symbol 644 ShapeTweeningUsed by:674
Symbol 645 ShapeTweeningUsed by:674
Symbol 646 ShapeTweeningUsed by:674
Symbol 647 ShapeTweeningUsed by:674
Symbol 648 ShapeTweeningUsed by:674
Symbol 649 ShapeTweeningUsed by:674
Symbol 650 GraphicUsed by:674 744
Symbol 651 ShapeTweeningUsed by:674
Symbol 652 ShapeTweeningUsed by:674
Symbol 653 ShapeTweeningUsed by:674
Symbol 654 ShapeTweeningUsed by:674
Symbol 655 ShapeTweeningUsed by:674
Symbol 656 ShapeTweeningUsed by:674
Symbol 657 GraphicUsed by:674 744
Symbol 658 GraphicUsed by:674
Symbol 659 GraphicUsed by:674
Symbol 660 GraphicUsed by:674
Symbol 661 GraphicUsed by:674
Symbol 662 ShapeTweeningUsed by:674
Symbol 663 ShapeTweeningUsed by:674
Symbol 664 ShapeTweeningUsed by:674
Symbol 665 ShapeTweeningUsed by:674
Symbol 666 ShapeTweeningUsed by:674
Symbol 667 ShapeTweeningUsed by:674
Symbol 668 ShapeTweeningUsed by:674
Symbol 669 GraphicUsed by:674
Symbol 670 GraphicUsed by:674
Symbol 671 GraphicUsed by:674
Symbol 672 GraphicUsed by:674
Symbol 673 GraphicUsed by:674
Symbol 674 MovieClipUses:636 637 638 639 640 641 642 643 644 645 646 647 648 649 650 651 652 653 654 655 656 657 658 659 660 661 662 663 664 665 666 667 668 669 670 671 672 673Used by:676 755
Symbol 675 GraphicUses:631Used by:676
Symbol 676 MovieClipUses:635 674 675Used by:677
Symbol 677 MovieClip {hair_mania_0827_fla.Timeline_103}Uses:633 676Used by:830
Symbol 678 GraphicUsed by:679 3802
Symbol 679 MovieClipUses:678Used by:830
Symbol 680 GraphicUsed by:698
Symbol 681 GraphicUsed by:698
Symbol 682 GraphicUsed by:697
Symbol 683 GraphicUsed by:697
Symbol 684 GraphicUsed by:697
Symbol 685 GraphicUsed by:697 779
Symbol 686 GraphicUsed by:697 779
Symbol 687 GraphicUsed by:697 779
Symbol 688 GraphicUsed by:697 779
Symbol 689 GraphicUsed by:697 780
Symbol 690 GraphicUsed by:697 780
Symbol 691 GraphicUsed by:697 779
Symbol 692 GraphicUsed by:697 779
Symbol 693 GraphicUsed by:697 779
Symbol 694 GraphicUsed by:697 779
Symbol 695 GraphicUsed by:697 779
Symbol 696 GraphicUsed by:697 779
Symbol 697 MovieClip {hair_mania_0827_fla.Timeline_109}Uses:682 683 684 685 686 687 688 689 690 691 692 693 694 695 696Used by:698
Symbol 698 MovieClip {hair_mania_0827_fla.Timeline_108}Uses:680 681 697Used by:830
Symbol 699 BitmapUsed by:700 702
Symbol 700 GraphicUses:699Used by:701
Symbol 701 MovieClipUses:700Used by:745
Symbol 702 GraphicUses:699Used by:744
Symbol 703 GraphicUsed by:744
Symbol 704 ShapeTweeningUsed by:744
Symbol 705 ShapeTweeningUsed by:744
Symbol 706 ShapeTweeningUsed by:744
Symbol 707 ShapeTweeningUsed by:744
Symbol 708 ShapeTweeningUsed by:744
Symbol 709 ShapeTweeningUsed by:744
Symbol 710 ShapeTweeningUsed by:744
Symbol 711 ShapeTweeningUsed by:744
Symbol 712 ShapeTweeningUsed by:744
Symbol 713 ShapeTweeningUsed by:744
Symbol 714 ShapeTweeningUsed by:744
Symbol 715 ShapeTweeningUsed by:744
Symbol 716 ShapeTweeningUsed by:744
Symbol 717 ShapeTweeningUsed by:744
Symbol 718 ShapeTweeningUsed by:744
Symbol 719 ShapeTweeningUsed by:744
Symbol 720 ShapeTweeningUsed by:744
Symbol 721 ShapeTweeningUsed by:744
Symbol 722 ShapeTweeningUsed by:744
Symbol 723 ShapeTweeningUsed by:744
Symbol 724 ShapeTweeningUsed by:744
Symbol 725 ShapeTweeningUsed by:744
Symbol 726 GraphicUsed by:744
Symbol 727 GraphicUsed by:744
Symbol 728 GraphicUsed by:744
Symbol 729 GraphicUsed by:744
Symbol 730 ShapeTweeningUsed by:744
Symbol 731 ShapeTweeningUsed by:744
Symbol 732 ShapeTweeningUsed by:744
Symbol 733 ShapeTweeningUsed by:744
Symbol 734 ShapeTweeningUsed by:744
Symbol 735 ShapeTweeningUsed by:744
Symbol 736 ShapeTweeningUsed by:744
Symbol 737 GraphicUsed by:744
Symbol 738 GraphicUsed by:744
Symbol 739 GraphicUsed by:744
Symbol 740 GraphicUsed by:744
Symbol 741 GraphicUsed by:744
Symbol 742 ShapeTweeningUsed by:744
Symbol 743 GraphicUsed by:744
Symbol 744 MovieClip {hair_mania_0827_fla.Timeline_112}Uses:702 703 704 705 706 707 708 709 710 711 712 713 714 715 716 717 718 719 650 720 721 722 723 724 725 657 726 727 728 729 730 731 732 733 734 735 736 737 738 739 740 741 742 743Used by:745
Symbol 745 MovieClip {hair_mania_0827_fla.Timeline_110}Uses:701 744Used by:830 1029
Symbol 746 BitmapUsed by:747
Symbol 747 GraphicUses:746Used by:748
Symbol 748 MovieClipUses:747Used by:756
Symbol 749 BitmapUsed by:750
Symbol 750 GraphicUses:749Used by:751
Symbol 751 MovieClipUses:750Used by:756
Symbol 752 BitmapUsed by:753
Symbol 753 GraphicUses:752Used by:754
Symbol 754 MovieClipUses:753Used by:755
Symbol 755 MovieClipUses:754 635 674Used by:756
Symbol 756 MovieClip {hair_mania_0827_fla.Timeline_113}Uses:748 751 755Used by:830 1029
Symbol 757 GraphicUsed by:773
Symbol 758 GraphicUsed by:773
Symbol 759 GraphicUsed by:771
Symbol 760 GraphicUsed by:761
Symbol 761 MovieClipUses:760Used by:771
Symbol 762 BitmapUsed by:763
Symbol 763 GraphicUses:762Used by:771
Symbol 764 GraphicUsed by:771
Symbol 765 BitmapUsed by:766
Symbol 766 GraphicUses:765Used by:771
Symbol 767 BitmapUsed by:768
Symbol 768 GraphicUses:767Used by:771
Symbol 769 BitmapUsed by:770
Symbol 770 GraphicUses:769Used by:771
Symbol 771 MovieClipUses:759 761 763 764 766 768 770Used by:772
Symbol 772 MovieClipUses:771Used by:773
Symbol 773 MovieClip {hair_mania_0827_fla.Timeline_118}Uses:757 758 772Used by:830 1029
Symbol 774 GraphicUsed by:775
Symbol 775 MovieClipUses:774Used by:830
Symbol 776 BitmapUsed by:777
Symbol 777 GraphicUses:776Used by:778
Symbol 778 MovieClipUses:777Used by:783 784 830 1029
Symbol 779 MovieClipUses:685 686 687 688 691 692 693 694 695 696Used by:783
Symbol 780 MovieClipUses:689 690Used by:783
Symbol 781 MovieClipUses:319Used by:782
Symbol 782 MovieClipUses:781Used by:783
Symbol 783 MovieClip {hair_mania_0827_fla.Timeline_125}Uses:779 780 782 778Used by:784
Symbol 784 MovieClip {hair_mania_0827_fla.Timeline_124}Uses:778 783Used by:830
Symbol 785 GraphicUsed by:793
Symbol 786 GraphicUsed by:787
Symbol 787 MovieClipUses:786Used by:792 793
Symbol 788 GraphicUsed by:791
Symbol 789 GraphicUsed by:790
Symbol 790 MovieClipUses:789Used by:791
Symbol 791 MovieClipUses:788 790Used by:793
Symbol 792 MovieClipUses:787Used by:793
Symbol 793 MovieClip {hair_mania_0827_fla.Timeline_130}Uses:785 787 791 792Used by:830 1029
Symbol 794 GraphicUsed by:795
Symbol 795 MovieClipUses:794Used by:830 3784
Symbol 796 BitmapUsed by:797
Symbol 797 GraphicUses:796Used by:798
Symbol 798 MovieClipUses:797Used by:799
Symbol 799 MovieClip {hair_mania_0827_fla.Timeline_136}Uses:798 628Used by:830 1029
Symbol 800 BitmapUsed by:801
Symbol 801 GraphicUses:800Used by:802
Symbol 802 MovieClipUses:801Used by:830 1029
Symbol 803 GraphicUsed by:808
Symbol 804 GraphicUsed by:808
Symbol 805 GraphicUsed by:806
Symbol 806 MovieClipUses:805Used by:807
Symbol 807 MovieClipUses:806Used by:808
Symbol 808 MovieClip {hair_mania_0827_fla.Timeline_139}Uses:803 804 807Used by:830 1029
Symbol 809 GraphicUsed by:813
Symbol 810 GraphicUsed by:811
Symbol 811 MovieClipUses:810Used by:812
Symbol 812 MovieClipUses:811Used by:813
Symbol 813 MovieClip {hair_mania_0827_fla.Timeline_142}Uses:809 812Used by:830 1029
Symbol 814 GraphicUsed by:815
Symbol 815 MovieClipUses:814Used by:830 1029 3846
Symbol 816 GraphicUsed by:817
Symbol 817 MovieClipUses:816Used by:830
Symbol 818 GraphicUsed by:819
Symbol 819 MovieClipUses:818Used by:830 911
Symbol 820 GraphicUsed by:821
Symbol 821 MovieClipUses:820Used by:830 911
Symbol 822 GraphicUsed by:825
Symbol 823 GraphicUsed by:824
Symbol 824 MovieClip {hair_mania_0827_fla.Timeline_150}Uses:823Used by:825 2161
Symbol 825 MovieClipUses:822 824Used by:830 911
Symbol 826 BitmapUsed by:827
Symbol 827 GraphicUses:826Used by:828
Symbol 828 MovieClipUses:827Used by:830 911
Symbol 829 MovieClip {hair_mania_0827_fla.Timeline_152}Uses:560Used by:830 911
Symbol 830 MovieClip {lib.tool}Uses:541 555 557 561 562 564 566 577 579 594 596 598 607 630 633 677 679 698 745 756 773 775 778 784 793 795 799 802 808 813 815 817 819 821 825 828 829Used by:Timeline
Symbol 831 GraphicUsed by:1046
Symbol 832 BitmapUsed by:833
Symbol 833 GraphicUses:832Used by:834
Symbol 834 MovieClipUses:833Used by:1046 2761 3591 3640 3643
Symbol 835 GraphicUsed by:836
Symbol 836 MovieClipUses:407 835 409Used by:1029 2417 2735 2797 3250 3591 3639
Symbol 837 BitmapUsed by:838
Symbol 838 GraphicUses:837Used by:1029
Symbol 839 TextUses:148Used by:853
Symbol 840 TextUses:426Used by:853
Symbol 841 TextUses:148Used by:853
Symbol 842 TextUses:148Used by:853
Symbol 843 TextUses:148Used by:853
Symbol 844 TextUses:148Used by:853
Symbol 845 TextUses:148Used by:853
Symbol 846 TextUses:148Used by:853
Symbol 847 TextUses:148Used by:853
Symbol 848 TextUses:148Used by:853
Symbol 849 TextUses:148Used by:853
Symbol 850 TextUses:148Used by:853
Symbol 851 TextUses:148Used by:853
Symbol 852 TextUses:426Used by:853
Symbol 853 MovieClip {DragaTooltousethehair}Uses:839 840 841 842 843 844 845 846 847 848 849 850 851 852Used by:1029  Timeline
Symbol 854 TextUses:148Used by:869
Symbol 855 TextUses:426Used by:869
Symbol 856 TextUses:148Used by:869
Symbol 857 TextUses:148Used by:869
Symbol 858 TextUses:148Used by:869
Symbol 859 TextUses:148Used by:869
Symbol 860 TextUses:148Used by:869
Symbol 861 TextUses:148Used by:869
Symbol 862 TextUses:148Used by:869
Symbol 863 TextUses:148Used by:869
Symbol 864 TextUses:148Used by:869
Symbol 865 TextUses:148Used by:869
Symbol 866 TextUses:148Used by:869
Symbol 867 TextUses:148Used by:869
Symbol 868 TextUses:426Used by:869
Symbol 869 MovieClip {DragaTooltousetheh}Uses:854 855 856 857 858 859 860 861 862 863 864 865 866 867 868Used by:1029  Timeline
Symbol 870 TextUses:148Used by:885
Symbol 871 TextUses:426Used by:885
Symbol 872 TextUses:148Used by:885
Symbol 873 TextUses:148Used by:885
Symbol 874 TextUses:148Used by:885
Symbol 875 TextUses:148Used by:885
Symbol 876 TextUses:148Used by:885
Symbol 877 TextUses:148Used by:885
Symbol 878 TextUses:148Used by:885
Symbol 879 TextUses:148Used by:885
Symbol 880 TextUses:148Used by:885
Symbol 881 TextUses:148Used by:885
Symbol 882 TextUses:148Used by:885
Symbol 883 TextUses:148Used by:885
Symbol 884 TextUses:426Used by:885
Symbol 885 MovieClip {createasmanybig}Uses:870 871 872 873 874 875 876 877 878 879 880 881 882 883 884Used by:1029  Timeline
Symbol 886 GraphicUsed by:887
Symbol 887 MovieClipUses:886Used by:890 1008
Symbol 888 GraphicUsed by:889
Symbol 889 MovieClipUses:888Used by:890 1008 1009 1012 1028
Symbol 890 MovieClipUses:887 889Used by:1029 2327
Symbol 891 GraphicUsed by:1029
Symbol 892 GraphicUsed by:893
Symbol 893 MovieClipUses:892Used by:894
Symbol 894 MovieClipUses:893Used by:1029
Symbol 895 GraphicUsed by:896
Symbol 896 MovieClipUses:895Used by:1029 2416 2734 2765 2781 2890 2906 2923 2953 3006 3133 3248 3264 3426 3460 3475 3492 3508 3532 3591 3639
Symbol 897 TextUses:440Used by:910
Symbol 898 TextUses:442Used by:910
Symbol 899 TextUses:440Used by:910
Symbol 900 TextUses:440Used by:910
Symbol 901 TextUses:440Used by:910
Symbol 902 TextUses:440Used by:910
Symbol 903 TextUses:440Used by:910
Symbol 904 TextUses:440Used by:910
Symbol 905 TextUses:440Used by:910
Symbol 906 TextUses:440Used by:910
Symbol 907 TextUses:440Used by:910
Symbol 908 TextUses:440Used by:910
Symbol 909 TextUses:442Used by:910
Symbol 910 MovieClip {howtoplay}Uses:897 898 899 900 901 902 903 904 905 906 907 908 909Used by:1029 2765  Timeline
Symbol 911 MovieClip {hair_mania_0827_fla.Timeline_167}Uses:829 828 825 821 819Used by:1029
Symbol 912 BitmapUsed by:913
Symbol 913 GraphicUses:912Used by:1029
Symbol 914 TextUses:148Used by:929
Symbol 915 TextUses:426Used by:929
Symbol 916 TextUses:148Used by:929
Symbol 917 TextUses:148Used by:929
Symbol 918 TextUses:148Used by:929
Symbol 919 TextUses:148Used by:929
Symbol 920 TextUses:148Used by:929
Symbol 921 TextUses:148Used by:929
Symbol 922 TextUses:148Used by:929
Symbol 923 TextUses:148Used by:929
Symbol 924 TextUses:148Used by:929
Symbol 925 TextUses:148Used by:929
Symbol 926 TextUses:148Used by:929
Symbol 927 TextUses:148Used by:929
Symbol 928 TextUses:426Used by:929
Symbol 929 MovieClip {Ifanycustomersl}Uses:914 915 916 917 918 919 920 921 922 923 924 925 926 927 928Used by:1029  Timeline
Symbol 930 GraphicUsed by:931
Symbol 931 MovieClipUses:930Used by:1029
Symbol 932 TextUses:148Used by:1007
Symbol 933 TextUses:148Used by:1007 3894
Symbol 934 TextUses:148Used by:1007 3919
Symbol 935 TextUses:148Used by:1007 3918
Symbol 936 TextUses:148Used by:1007 3895
Symbol 937 TextUses:426Used by:1007
Symbol 938 TextUses:426Used by:1007 3894
Symbol 939 TextUses:426Used by:1007 3919
Symbol 940 TextUses:426Used by:1007 3918
Symbol 941 TextUses:426Used by:1007 3895
Symbol 942 TextUses:148Used by:1007
Symbol 943 TextUses:148Used by:1007 3894
Symbol 944 TextUses:148Used by:1007 3919
Symbol 945 TextUses:148Used by:1007 3918
Symbol 946 TextUses:148Used by:1007 3895
Symbol 947 TextUses:148Used by:1007
Symbol 948 TextUses:148Used by:1007 3894
Symbol 949 TextUses:148Used by:1007 3919
Symbol 950 TextUses:148Used by:1007 3918
Symbol 951 TextUses:148Used by:1007 3895
Symbol 952 TextUses:148Used by:1007
Symbol 953 TextUses:148Used by:1007 3894
Symbol 954 TextUses:148Used by:1007 3919
Symbol 955 TextUses:148Used by:1007 3918
Symbol 956 TextUses:148Used by:1007 3895
Symbol 957 TextUses:148Used by:1007
Symbol 958 TextUses:148Used by:1007 3894
Symbol 959 TextUses:148Used by:1007 3919
Symbol 960 TextUses:148Used by:1007 3918
Symbol 961 TextUses:148Used by:1007 3895
Symbol 962 TextUses:148Used by:1007
Symbol 963 TextUses:148Used by:1007 3894
Symbol 964 TextUses:148Used by:1007 3919
Symbol 965 TextUses:148Used by:1007 3918
Symbol 966 TextUses:148Used by:1007 3895
Symbol 967 TextUses:148Used by:1007
Symbol 968 TextUses:148Used by:1007 3894
Symbol 969 TextUses:148Used by:1007 3919
Symbol 970 TextUses:148Used by:1007 3918
Symbol 971 TextUses:148Used by:1007 3895
Symbol 972 TextUses:148Used by:1007
Symbol 973 TextUses:148Used by:1007 3894
Symbol 974 TextUses:148Used by:1007 3919
Symbol 975 TextUses:148Used by:1007 3918
Symbol 976 TextUses:148Used by:1007 3895
Symbol 977 TextUses:148Used by:1007
Symbol 978 TextUses:148Used by:1007 3894
Symbol 979 TextUses:148Used by:1007 3919
Symbol 980 TextUses:148Used by:1007 3918
Symbol 981 TextUses:148Used by:1007 3895
Symbol 982 TextUses:148Used by:1007
Symbol 983 TextUses:148Used by:1007 3894
Symbol 984 TextUses:148Used by:1007 3919
Symbol 985 TextUses:148Used by:1007 3918
Symbol 986 TextUses:148Used by:1007 3895
Symbol 987 TextUses:148Used by:1007
Symbol 988 TextUses:148Used by:1007 3894
Symbol 989 TextUses:148Used by:1007 3919
Symbol 990 TextUses:148Used by:1007 3918
Symbol 991 TextUses:148Used by:1007 3895
Symbol 992 TextUses:148Used by:1007
Symbol 993 TextUses:148Used by:1007 3894
Symbol 994 TextUses:148Used by:1007 3919
Symbol 995 TextUses:148Used by:1007 3918
Symbol 996 TextUses:148Used by:1007 3895
Symbol 997 TextUses:148Used by:1007
Symbol 998 TextUses:148Used by:1007 3894
Symbol 999 TextUses:148Used by:1007 3919
Symbol 1000 TextUses:148Used by:1007 3918
Symbol 1001 TextUses:148Used by:1007 3895
Symbol 1002 TextUses:426Used by:1007
Symbol 1003 TextUses:426Used by:1007 3894
Symbol 1004 TextUses:426Used by:1007 3919
Symbol 1005 TextUses:426Used by:1007 3918
Symbol 1006 TextUses:426Used by:1007 3895
Symbol 1007 MovieClip {Clickdragand}Uses:932 933 934 935 936 937 938 939 940 941 942 943 944 945 946 947 948 949 950 951 952 953 954 955 956 957 958 959 960 961 962 963 964 965 966 967 968 969 970 971 972 973 974 975 976 977 978 979 980 981 982 983 984 985 986 987 988 989 990 991 992 993 994 995 996 997 998 999 1000 1001 1002 1003 1004 1005 1006Used by:1029  Timeline
Symbol 1008 MovieClipUses:887 889Used by:1029 2327
Symbol 1009 MovieClipUses:889Used by:1029 2326
Symbol 1010 GraphicUsed by:1011
Symbol 1011 MovieClipUses:1010Used by:1012
Symbol 1012 MovieClip {hair_mania_0827_fla.__173}Uses:1011 889Used by:1029 2327
Symbol 1013 TextUses:148Used by:1027
Symbol 1014 TextUses:426Used by:1027
Symbol 1015 TextUses:148Used by:1027
Symbol 1016 TextUses:148Used by:1027
Symbol 1017 TextUses:148Used by:1027
Symbol 1018 TextUses:148Used by:1027
Symbol 1019 TextUses:148Used by:1027
Symbol 1020 TextUses:148Used by:1027
Symbol 1021 TextUses:148Used by:1027
Symbol 1022 TextUses:148Used by:1027
Symbol 1023 TextUses:148Used by:1027
Symbol 1024 TextUses:148Used by:1027
Symbol 1025 TextUses:148Used by:1027
Symbol 1026 TextUses:426Used by:1027
Symbol 1027 MovieClip {drop2}Uses:1013 1014 1015 1016 1017 1018 1019 1020 1021 1022 1023 1024 1025 1026Used by:1028  Timeline
Symbol 1028 MovieClipUses:889 1027Used by:1029 2327
Symbol 1029 MovieClip {hair_mania_0827_fla._howtoplay__155}Uses:836 838 853 869 885 890 891 894 896 910 911 913 929 931 1007 1008 1009 1012 1028 566 544 579 607 630 808 813 802 815 799 756 745 778 793 773Used by:1046
Symbol 1030 GraphicUsed by:1033
Symbol 1031 GraphicUsed by:1033
Symbol 1032 GraphicUsed by:1033
Symbol 1033 ButtonUses:1030 1031 1032Used by:1046
Symbol 1034 GraphicUsed by:1037
Symbol 1035 GraphicUsed by:1037
Symbol 1036 GraphicUsed by:1037
Symbol 1037 ButtonUses:1034 1035 1036Used by:1046
Symbol 1038 GraphicUsed by:1039
Symbol 1039 MovieClipUses:1038Used by:1042 2288 2293 2346
Symbol 1040 GraphicUsed by:1041
Symbol 1041 MovieClipUses:1040Used by:1042
Symbol 1042 MovieClip {按钮_返回}Uses:1039 1041Used by:1046 3250 3640
Symbol 1043 GraphicUsed by:1044
Symbol 1044 MovieClipUses:1043Used by:1045
Symbol 1045 MovieClip {按钮_moregame}Uses:1044 394 455Used by:1046 2417 2735 2797 3006 3133 3426 3509 3591 3640
Symbol 1046 MovieClip {lib.HowToPlay}Uses:831 834 1029 1033 1037 1042 1045Used by:Timeline
Symbol 1047 GraphicUsed by:2346
Symbol 1048 BitmapUsed by:1049
Symbol 1049 GraphicUses:1048Used by:1050
Symbol 1050 MovieClipUses:1049Used by:2346
Symbol 1051 BitmapUsed by:1052
Symbol 1052 GraphicUses:1051Used by:1091
Symbol 1053 BitmapUsed by:1054
Symbol 1054 GraphicUses:1053Used by:1091
Symbol 1055 BitmapUsed by:1056
Symbol 1056 GraphicUses:1055Used by:1091
Symbol 1057 BitmapUsed by:1058
Symbol 1058 GraphicUses:1057Used by:1091
Symbol 1059 BitmapUsed by:1060
Symbol 1060 GraphicUses:1059Used by:1091
Symbol 1061 BitmapUsed by:1062
Symbol 1062 GraphicUses:1061Used by:1091
Symbol 1063 BitmapUsed by:1064
Symbol 1064 GraphicUses:1063Used by:1091
Symbol 1065 BitmapUsed by:1066
Symbol 1066 GraphicUses:1065Used by:1091
Symbol 1067 BitmapUsed by:1068
Symbol 1068 GraphicUses:1067Used by:1091
Symbol 1069 BitmapUsed by:1070
Symbol 1070 GraphicUses:1069Used by:1091
Symbol 1071 BitmapUsed by:1072
Symbol 1072 GraphicUses:1071Used by:1091
Symbol 1073 BitmapUsed by:1074
Symbol 1074 GraphicUses:1073Used by:1091
Symbol 1075 BitmapUsed by:1076
Symbol 1076 GraphicUses:1075Used by:1091
Symbol 1077 BitmapUsed by:1078
Symbol 1078 GraphicUses:1077Used by:1091
Symbol 1079 BitmapUsed by:1080
Symbol 1080 GraphicUses:1079Used by:1091
Symbol 1081 BitmapUsed by:1082
Symbol 1082 GraphicUses:1081Used by:1091
Symbol 1083 BitmapUsed by:1084
Symbol 1084 GraphicUses:1083Used by:1091
Symbol 1085 BitmapUsed by:1086
Symbol 1086 GraphicUses:1085Used by:1091
Symbol 1087 BitmapUsed by:1088
Symbol 1088 GraphicUses:1087Used by:1091
Symbol 1089 BitmapUsed by:1090
Symbol 1090 GraphicUses:1089Used by:1091
Symbol 1091 MovieClipUses:1052 1054 1056 1058 1060 1062 1064 1066 1068 1070 1072 1074 1076 1078 1080 1082 1084 1086 1088 1090Used by:1105
Symbol 1092 GraphicUsed by:1105
Symbol 1093 BitmapUsed by:1094
Symbol 1094 GraphicUses:1093Used by:1105
Symbol 1095 BitmapUsed by:1096
Symbol 1096 GraphicUses:1095Used by:1105
Symbol 1097 BitmapUsed by:1098
Symbol 1098 GraphicUses:1097Used by:1105
Symbol 1099 BitmapUsed by:1100
Symbol 1100 GraphicUses:1099Used by:1105
Symbol 1101 BitmapUsed by:1102
Symbol 1102 GraphicUses:1101Used by:1105
Symbol 1103 BitmapUsed by:1104
Symbol 1104 GraphicUses:1103Used by:1105
Symbol 1105 MovieClip {hair_mania_0827_fla.__187}Uses:1091 1092 1094 1096 1098 1100 1102 1104Used by:1343
Symbol 1106 BitmapUsed by:1107
Symbol 1107 GraphicUses:1106Used by:1152
Symbol 1108 BitmapUsed by:1109
Symbol 1109 GraphicUses:1108Used by:1152
Symbol 1110 BitmapUsed by:1111
Symbol 1111 GraphicUses:1110Used by:1152
Symbol 1112 BitmapUsed by:1113
Symbol 1113 GraphicUses:1112Used by:1152
Symbol 1114 BitmapUsed by:1115
Symbol 1115 GraphicUses:1114Used by:1152
Symbol 1116 BitmapUsed by:1117
Symbol 1117 GraphicUses:1116Used by:1152
Symbol 1118 BitmapUsed by:1119
Symbol 1119 GraphicUses:1118Used by:1152
Symbol 1120 BitmapUsed by:1121
Symbol 1121 GraphicUses:1120Used by:1152
Symbol 1122 BitmapUsed by:1123
Symbol 1123 GraphicUses:1122Used by:1152
Symbol 1124 BitmapUsed by:1125
Symbol 1125 GraphicUses:1124Used by:1152
Symbol 1126 BitmapUsed by:1127
Symbol 1127 GraphicUses:1126Used by:1152
Symbol 1128 BitmapUsed by:1129
Symbol 1129 GraphicUses:1128Used by:1152
Symbol 1130 BitmapUsed by:1131
Symbol 1131 GraphicUses:1130Used by:1152
Symbol 1132 BitmapUsed by:1133
Symbol 1133 GraphicUses:1132Used by:1152
Symbol 1134 BitmapUsed by:1135
Symbol 1135 GraphicUses:1134Used by:1152
Symbol 1136 BitmapUsed by:1137
Symbol 1137 GraphicUses:1136Used by:1152
Symbol 1138 BitmapUsed by:1139
Symbol 1139 GraphicUses:1138Used by:1152
Symbol 1140 BitmapUsed by:1141
Symbol 1141 GraphicUses:1140Used by:1152
Symbol 1142 BitmapUsed by:1143
Symbol 1143 GraphicUses:1142Used by:1152
Symbol 1144 BitmapUsed by:1145
Symbol 1145 GraphicUses:1144Used by:1152
Symbol 1146 BitmapUsed by:1147
Symbol 1147 GraphicUses:1146Used by:1152
Symbol 1148 BitmapUsed by:1149
Symbol 1149 GraphicUses:1148Used by:1152
Symbol 1150 BitmapUsed by:1151
Symbol 1151 GraphicUses:1150Used by:1152
Symbol 1152 MovieClipUses:1107 1109 1111 1113 1115 1117 1119 1121 1123 1125 1127 1129 1131 1133 1135 1137 1139 1141 1143 1145 1147 1149 1151Used by:1343 2753 3007 3427
Symbol 1153 BitmapUsed by:1154
Symbol 1154 GraphicUses:1153Used by:1239
Symbol 1155 BitmapUsed by:1156
Symbol 1156 GraphicUses:1155Used by:1239
Symbol 1157 BitmapUsed by:1158
Symbol 1158 GraphicUses:1157Used by:1239
Symbol 1159 BitmapUsed by:1160
Symbol 1160 GraphicUses:1159Used by:1239
Symbol 1161 BitmapUsed by:1162
Symbol 1162 GraphicUses:1161Used by:1239
Symbol 1163 BitmapUsed by:1164
Symbol 1164 GraphicUses:1163Used by:1239
Symbol 1165 BitmapUsed by:1166
Symbol 1166 GraphicUses:1165Used by:1239
Symbol 1167 BitmapUsed by:1168
Symbol 1168 GraphicUses:1167Used by:1239
Symbol 1169 BitmapUsed by:1170
Symbol 1170 GraphicUses:1169Used by:1239
Symbol 1171 BitmapUsed by:1172
Symbol 1172 GraphicUses:1171Used by:1239
Symbol 1173 BitmapUsed by:1174
Symbol 1174 GraphicUses:1173Used by:1239
Symbol 1175 BitmapUsed by:1176
Symbol 1176 GraphicUses:1175Used by:1239
Symbol 1177 BitmapUsed by:1178
Symbol 1178 GraphicUses:1177Used by:1239
Symbol 1179 BitmapUsed by:1180
Symbol 1180 GraphicUses:1179Used by:1239
Symbol 1181 BitmapUsed by:1182
Symbol 1182 GraphicUses:1181Used by:1239
Symbol 1183 BitmapUsed by:1184
Symbol 1184 GraphicUses:1183Used by:1239
Symbol 1185 BitmapUsed by:1186
Symbol 1186 GraphicUses:1185Used by:1239
Symbol 1187 BitmapUsed by:1188
Symbol 1188 GraphicUses:1187Used by:1239
Symbol 1189 BitmapUsed by:1190
Symbol 1190 GraphicUses:1189Used by:1239
Symbol 1191 BitmapUsed by:1192
Symbol 1192 GraphicUses:1191Used by:1239
Symbol 1193 BitmapUsed by:1194
Symbol 1194 GraphicUses:1193Used by:1239
Symbol 1195 BitmapUsed by:1196
Symbol 1196 GraphicUses:1195Used by:1239
Symbol 1197 BitmapUsed by:1198
Symbol 1198 GraphicUses:1197Used by:1239
Symbol 1199 BitmapUsed by:1200
Symbol 1200 GraphicUses:1199Used by:1239
Symbol 1201 BitmapUsed by:1202
Symbol 1202 GraphicUses:1201Used by:1239
Symbol 1203 BitmapUsed by:1204
Symbol 1204 GraphicUses:1203Used by:1239
Symbol 1205 BitmapUsed by:1206
Symbol 1206 GraphicUses:1205Used by:1239
Symbol 1207 BitmapUsed by:1208
Symbol 1208 GraphicUses:1207Used by:1239
Symbol 1209 BitmapUsed by:1210
Symbol 1210 GraphicUses:1209Used by:1239
Symbol 1211 BitmapUsed by:1212
Symbol 1212 GraphicUses:1211Used by:1239
Symbol 1213 BitmapUsed by:1214
Symbol 1214 GraphicUses:1213Used by:1239
Symbol 1215 BitmapUsed by:1216
Symbol 1216 GraphicUses:1215Used by:1239
Symbol 1217 BitmapUsed by:1218
Symbol 1218 GraphicUses:1217Used by:1239
Symbol 1219 BitmapUsed by:1220
Symbol 1220 GraphicUses:1219Used by:1239
Symbol 1221 BitmapUsed by:1222
Symbol 1222 GraphicUses:1221Used by:1239
Symbol 1223 BitmapUsed by:1224
Symbol 1224 GraphicUses:1223Used by:1239
Symbol 1225 BitmapUsed by:1226
Symbol 1226 GraphicUses:1225Used by:1239
Symbol 1227 BitmapUsed by:1228
Symbol 1228 GraphicUses:1227Used by:1239
Symbol 1229 BitmapUsed by:1230
Symbol 1230 GraphicUses:1229Used by:1239
Symbol 1231 BitmapUsed by:1232
Symbol 1232 GraphicUses:1231Used by:1239
Symbol 1233 BitmapUsed by:1234
Symbol 1234 GraphicUses:1233Used by:1239
Symbol 1235 BitmapUsed by:1236
Symbol 1236 GraphicUses:1235Used by:1239
Symbol 1237 BitmapUsed by:1238
Symbol 1238 GraphicUses:1237Used by:1239
Symbol 1239 MovieClipUses:1154 1156 1158 1160 1162 1164 1166 1168 1170 1172 1174 1176 1178 1180 1182 1184 1186 1188 1190 1192 1194 1196 1198 1200 1202 1204 1206 1208 1210 1212 1214 1216 1218 1220 1222 1224 1226 1228 1230 1232 1234 1236 1238Used by:1342
Symbol 1240 BitmapUsed by:1241
Symbol 1241 GraphicUses:1240Used by:1316
Symbol 1242 BitmapUsed by:1243
Symbol 1243 GraphicUses:1242Used by:1316
Symbol 1244 BitmapUsed by:1245
Symbol 1245 GraphicUses:1244Used by:1316
Symbol 1246 BitmapUsed by:1247
Symbol 1247 GraphicUses:1246Used by:1316
Symbol 1248 BitmapUsed by:1249
Symbol 1249 GraphicUses:1248Used by:1316
Symbol 1250 BitmapUsed by:1251
Symbol 1251 GraphicUses:1250Used by:1316
Symbol 1252 BitmapUsed by:1253
Symbol 1253 GraphicUses:1252Used by:1316
Symbol 1254 BitmapUsed by:1255
Symbol 1255 GraphicUses:1254Used by:1316
Symbol 1256 BitmapUsed by:1257
Symbol 1257 GraphicUses:1256Used by:1316
Symbol 1258 BitmapUsed by:1259
Symbol 1259 GraphicUses:1258Used by:1316
Symbol 1260 BitmapUsed by:1261
Symbol 1261 GraphicUses:1260Used by:1316
Symbol 1262 BitmapUsed by:1263
Symbol 1263 GraphicUses:1262Used by:1316
Symbol 1264 BitmapUsed by:1265
Symbol 1265 GraphicUses:1264Used by:1316
Symbol 1266 BitmapUsed by:1267
Symbol 1267 GraphicUses:1266Used by:1316
Symbol 1268 BitmapUsed by:1269
Symbol 1269 GraphicUses:1268Used by:1316
Symbol 1270 BitmapUsed by:1271
Symbol 1271 GraphicUses:1270Used by:1316
Symbol 1272 BitmapUsed by:1273
Symbol 1273 GraphicUses:1272Used by:1316
Symbol 1274 BitmapUsed by:1275
Symbol 1275 GraphicUses:1274Used by:1316
Symbol 1276 BitmapUsed by:1277
Symbol 1277 GraphicUses:1276Used by:1316
Symbol 1278 BitmapUsed by:1279
Symbol 1279 GraphicUses:1278Used by:1316
Symbol 1280 BitmapUsed by:1281
Symbol 1281 GraphicUses:1280Used by:1316
Symbol 1282 BitmapUsed by:1283
Symbol 1283 GraphicUses:1282Used by:1316
Symbol 1284 BitmapUsed by:1285
Symbol 1285 GraphicUses:1284Used by:1316
Symbol 1286 BitmapUsed by:1287
Symbol 1287 GraphicUses:1286Used by:1316
Symbol 1288 BitmapUsed by:1289
Symbol 1289 GraphicUses:1288Used by:1316
Symbol 1290 BitmapUsed by:1291
Symbol 1291 GraphicUses:1290Used by:1316
Symbol 1292 BitmapUsed by:1293
Symbol 1293 GraphicUses:1292Used by:1316
Symbol 1294 BitmapUsed by:1295
Symbol 1295 GraphicUses:1294Used by:1316
Symbol 1296 BitmapUsed by:1297
Symbol 1297 GraphicUses:1296Used by:1316
Symbol 1298 BitmapUsed by:1299
Symbol 1299 GraphicUses:1298Used by:1316
Symbol 1300 BitmapUsed by:1301
Symbol 1301 GraphicUses:1300Used by:1316
Symbol 1302 BitmapUsed by:1303
Symbol 1303 GraphicUses:1302Used by:1316
Symbol 1304 BitmapUsed by:1305
Symbol 1305 GraphicUses:1304Used by:1316
Symbol 1306 BitmapUsed by:1307
Symbol 1307 GraphicUses:1306Used by:1316
Symbol 1308 BitmapUsed by:1309
Symbol 1309 GraphicUses:1308Used by:1316
Symbol 1310 BitmapUsed by:1311
Symbol 1311 GraphicUses:1310Used by:1316
Symbol 1312 BitmapUsed by:1313
Symbol 1313 GraphicUses:1312Used by:1316
Symbol 1314 BitmapUsed by:1315
Symbol 1315 GraphicUses:1314Used by:1316
Symbol 1316 MovieClipUses:1241 1243 1245 1247 1249 1251 1253 1255 1257 1259 1261 1263 1265 1267 1269 1271 1273 1275 1277 1279 1281 1283 1285 1287 1289 1291 1293 1295 1297 1299 1301 1303 1305 1307 1309 1311 1313 1315Used by:1342
Symbol 1317 BitmapUsed by:1318
Symbol 1318 GraphicUses:1317Used by:1341
Symbol 1319 BitmapUsed by:1320
Symbol 1320 GraphicUses:1319Used by:1341
Symbol 1321 BitmapUsed by:1322
Symbol 1322 GraphicUses:1321Used by:1341
Symbol 1323 BitmapUsed by:1324
Symbol 1324 GraphicUses:1323Used by:1341
Symbol 1325 BitmapUsed by:1326
Symbol 1326 GraphicUses:1325Used by:1341
Symbol 1327 BitmapUsed by:1328
Symbol 1328 GraphicUses:1327Used by:1341
Symbol 1329 BitmapUsed by:1330
Symbol 1330 GraphicUses:1329Used by:1341
Symbol 1331 BitmapUsed by:1332
Symbol 1332 GraphicUses:1331Used by:1341
Symbol 1333 BitmapUsed by:1334
Symbol 1334 GraphicUses:1333Used by:1341
Symbol 1335 BitmapUsed by:1336
Symbol 1336 GraphicUses:1335Used by:1341
Symbol 1337 BitmapUsed by:1338
Symbol 1338 GraphicUses:1337Used by:1341
Symbol 1339 BitmapUsed by:1340
Symbol 1340 GraphicUses:1339Used by:1341
Symbol 1341 MovieClipUses:1318 1320 1322 1324 1326 1328 1330 1332 1334 1336 1338 1340Used by:1342
Symbol 1342 MovieClip {hair_mania_0827_fla.Timeline_190}Uses:1239 1316 1341Used by:1343
Symbol 1343 MovieClip {_dog}Uses:1105 1152 1342Used by:2346  Timeline
Symbol 1344 BitmapUsed by:1345
Symbol 1345 GraphicUses:1344Used by:1346
Symbol 1346 MovieClipUses:1345Used by:2346
Symbol 1347 BitmapUsed by:1348
Symbol 1348 GraphicUses:1347Used by:1414
Symbol 1349 GraphicUsed by:1366
Symbol 1350 GraphicUsed by:1351
Symbol 1351 MovieClipUses:1350Used by:1361 1490 1587
Symbol 1352 GraphicUsed by:1361
Symbol 1353 GraphicUsed by:1361
Symbol 1354 GraphicUsed by:1361
Symbol 1355 GraphicUsed by:1361
Symbol 1356 GraphicUsed by:1361
Symbol 1357 GraphicUsed by:1361
Symbol 1358 GraphicUsed by:1361
Symbol 1359 GraphicUsed by:1361
Symbol 1360 GraphicUsed by:1361
Symbol 1361 MovieClip {hair_mania_0827_fla.char0_hair__198}Uses:1351 1352 1353 1354 1355 1356 1357 1358 1359 1360Used by:1366
Symbol 1362 GraphicUsed by:1366
Symbol 1363 GraphicUsed by:1366
Symbol 1364 GraphicUsed by:1366
Symbol 1365 GraphicUsed by:1366
Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197}Uses:1349 1361 1362 1363 1364 1365Used by:1414
Symbol 1367 GraphicUsed by:1382
Symbol 1368 GraphicUsed by:1382
Symbol 1369 GraphicUsed by:1382
Symbol 1370 GraphicUsed by:1371
Symbol 1371 MovieClipUses:1370Used by:1382
Symbol 1372 GraphicUsed by:1373
Symbol 1373 MovieClipUses:1372Used by:1382
Symbol 1374 GraphicUsed by:1375
Symbol 1375 MovieClipUses:1374Used by:1382
Symbol 1376 GraphicUsed by:1377
Symbol 1377 MovieClipUses:1376Used by:1382 1397
Symbol 1378 GraphicUsed by:1379
Symbol 1379 MovieClipUses:1378Used by:1382
Symbol 1380 GraphicUsed by:1381
Symbol 1381 MovieClipUses:1380Used by:1382 1397
Symbol 1382 MovieClipUses:1367 1368 1369 1371 1373 1375 1377 1379 1381Used by:1397
Symbol 1383 GraphicUsed by:1397
Symbol 1384 GraphicUsed by:1397
Symbol 1385 GraphicUsed by:1397
Symbol 1386 GraphicUsed by:1397
Symbol 1387 GraphicUsed by:1391
Symbol 1388 GraphicUsed by:1391
Symbol 1389 GraphicUsed by:1390
Symbol 1390 MovieClipUses:1389Used by:1391
Symbol 1391 MovieClipUses:1387 1388 1390Used by:1397
Symbol 1392 GraphicUsed by:1397
Symbol 1393 GraphicUsed by:1394
Symbol 1394 MovieClipUses:1393Used by:1395
Symbol 1395 MovieClipUses:1394Used by:1396
Symbol 1396 MovieClipUses:1395Used by:1397 1453 1517 1572 1613 1684 1735 1791 1836 1891 1952 1996 2055 2102 2143
Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200}Uses:1382 1383 1384 1385 1386 1391 1392 1381 1377 1396Used by:1414
Symbol 1398 GraphicUsed by:1413
Symbol 1399 GraphicUsed by:1400
Symbol 1400 MovieClipUses:1399Used by:1413
Symbol 1401 GraphicUsed by:1402
Symbol 1402 MovieClipUses:1401Used by:1413 1466 1526 1580 1626 1696 1747 1799 1848 1903 1934 2009 2068 2111 2157
Symbol 1403 GraphicUsed by:1404
Symbol 1404 MovieClipUses:1403Used by:1413
Symbol 1405 GraphicUsed by:1406
Symbol 1406 MovieClipUses:1405Used by:1413
Symbol 1407 GraphicUsed by:1408
Symbol 1408 MovieClipUses:1407Used by:1413
Symbol 1409 GraphicUsed by:1410
Symbol 1410 MovieClipUses:1409Used by:1413
Symbol 1411 GraphicUsed by:1412
Symbol 1412 MovieClipUses:1411Used by:1413
Symbol 1413 MovieClip {hair_mania_0827_fla.C1_213}Uses:1398 1400 1402 1404 1406 1408 1410 1412Used by:1414
Symbol 1414 MovieClip {hair_mania_0827_fla.C1_196}Uses:1348 1366 1397 1413Used by:2161
Symbol 1415 GraphicUsed by:1416
Symbol 1416 MovieClipUses:1415Used by:2161
Symbol 1417 GraphicUsed by:1418
Symbol 1418 MovieClipUses:1417Used by:1419
Symbol 1419 MovieClipUses:1418Used by:2161
Symbol 1420 GraphicUsed by:1421
Symbol 1421 MovieClipUses:1420Used by:1467
Symbol 1422 GraphicUsed by:1432
Symbol 1423 GraphicUsed by:1427
Symbol 1424 GraphicUsed by:1425
Symbol 1425 MovieClipUses:1424Used by:1427
Symbol 1426 GraphicUsed by:1427
Symbol 1427 MovieClipUses:1423 1425 1426Used by:1432
Symbol 1428 GraphicUsed by:1432
Symbol 1429 GraphicUsed by:1432
Symbol 1430 GraphicUsed by:1432
Symbol 1431 GraphicUsed by:1432
Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226}Uses:1422 1427 1428 1429 1430 1431Used by:1467
Symbol 1433 GraphicUsed by:1446
Symbol 1434 GraphicUsed by:1446
Symbol 1435 GraphicUsed by:1436
Symbol 1436 MovieClipUses:1435Used by:1446 1453
Symbol 1437 GraphicUsed by:1438
Symbol 1438 MovieClipUses:1437Used by:1446 1453
Symbol 1439 GraphicUsed by:1440
Symbol 1440 MovieClipUses:1439Used by:1446 1453
Symbol 1441 GraphicUsed by:1446
Symbol 1442 GraphicUsed by:1443
Symbol 1443 MovieClipUses:1442Used by:1446
Symbol 1444 GraphicUsed by:1445
Symbol 1445 MovieClipUses:1444Used by:1446 1453
Symbol 1446 MovieClipUses:1433 1434 1436 1438 1440 1441 1443 1445Used by:1453
Symbol 1447 GraphicUsed by:1453
Symbol 1448 GraphicUsed by:1453
Symbol 1449 GraphicUsed by:1453
Symbol 1450 GraphicUsed by:1453
Symbol 1451 GraphicUsed by:1453
Symbol 1452 GraphicUsed by:1453
Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229}Uses:1446 1447 1448 1449 1450 1451 1452 1396 1436 1438 1445 1440Used by:1467
Symbol 1454 GraphicUsed by:1466
Symbol 1455 GraphicUsed by:1456
Symbol 1456 MovieClipUses:1455Used by:1466
Symbol 1457 GraphicUsed by:1458
Symbol 1458 MovieClipUses:1457Used by:1466
Symbol 1459 GraphicUsed by:1460
Symbol 1460 MovieClipUses:1459Used by:1466
Symbol 1461 GraphicUsed by:1462
Symbol 1462 MovieClipUses:1461Used by:1466
Symbol 1463 GraphicUsed by:1464
Symbol 1464 MovieClipUses:1463Used by:1466 1526 1580 1626 1696 1747 1799 1848 1903 1934 2009 2068 2111 2157
Symbol 1465 GraphicUsed by:1466
Symbol 1466 MovieClip {hair_mania_0827_fla.c2_236}Uses:1454 1456 1402 1458 1460 1462 1464 1465Used by:1467
Symbol 1467 MovieClip {hair_mania_0827_fla.C2__224}Uses:1421 1432 1453 1466Used by:2161
Symbol 1468 GraphicUsed by:1469
Symbol 1469 MovieClipUses:1468Used by:2161
Symbol 1470 BitmapUsed by:1471
Symbol 1471 GraphicUses:1470Used by:1472
Symbol 1472 MovieClipUses:1471Used by:1527
Symbol 1473 GraphicUsed by:1490
Symbol 1474 GraphicUsed by:1490
Symbol 1475 GraphicUsed by:1476
Symbol 1476 MovieClipUses:1475Used by:1490
Symbol 1477 GraphicUsed by:1478
Symbol 1478 MovieClipUses:1477Used by:1490
Symbol 1479 GraphicUsed by:1480
Symbol 1480 MovieClipUses:1479Used by:1490
Symbol 1481 GraphicUsed by:1482
Symbol 1482 MovieClipUses:1481Used by:1490
Symbol 1483 GraphicUsed by:1484
Symbol 1484 MovieClipUses:1483Used by:1490
Symbol 1485 GraphicUsed by:1486
Symbol 1486 MovieClipUses:1485Used by:1490
Symbol 1487 GraphicUsed by:1488
Symbol 1488 MovieClipUses:1487Used by:1490
Symbol 1489 GraphicUsed by:1490
Symbol 1490 MovieClip {hair_mania_0827_fla.hair3__246}Uses:1351 1473 1474 1476 1478 1480 1482 1484 1486 1488 1489Used by:1496
Symbol 1491 GraphicUsed by:1496
Symbol 1492 GraphicUsed by:1496
Symbol 1493 GraphicUsed by:1496
Symbol 1494 GraphicUsed by:1496
Symbol 1495 GraphicUsed by:1496
Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245}Uses:1490 1491 1492 1493 1494 1495Used by:1527
Symbol 1497 GraphicUsed by:1510
Symbol 1498 GraphicUsed by:1510
Symbol 1499 GraphicUsed by:1500 1501
Symbol 1500 MovieClipUses:1499Used by:1510 1517
Symbol 1501 MovieClipUses:1499Used by:1510 1517
Symbol 1502 GraphicUsed by:1503
Symbol 1503 MovieClipUses:1502Used by:1510
Symbol 1504 GraphicUsed by:1505
Symbol 1505 MovieClipUses:1504Used by:1510 1517
Symbol 1506 GraphicUsed by:1507
Symbol 1507 MovieClipUses:1506Used by:1510
Symbol 1508 GraphicUsed by:1509
Symbol 1509 MovieClipUses:1508Used by:1510 1517
Symbol 1510 MovieClipUses:1497 1498 1500 1501 1503 1505 1507 1509Used by:1517
Symbol 1511 GraphicUsed by:1517
Symbol 1512 GraphicUsed by:1517
Symbol 1513 GraphicUsed by:1517
Symbol 1514 GraphicUsed by:1517
Symbol 1515 GraphicUsed by:1517
Symbol 1516 GraphicUsed by:1517
Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254}Uses:1510 1511 1512 1513 1514 1515 1516 1500 1501 1509 1505 1396Used by:1527
Symbol 1518 GraphicUsed by:1526
Symbol 1519 GraphicUsed by:1520
Symbol 1520 MovieClipUses:1519Used by:1526
Symbol 1521 GraphicUsed by:1522
Symbol 1522 MovieClipUses:1521Used by:1526
Symbol 1523 GraphicUsed by:1524
Symbol 1524 MovieClipUses:1523Used by:1526
Symbol 1525 GraphicUsed by:1526
Symbol 1526 MovieClip {hair_mania_0827_fla.c3_262}Uses:1518 1402 1520 1522 1524 1464 1525Used by:1527
Symbol 1527 MovieClip {hair_mania_0827_fla.C3__243}Uses:1472 1496 1517 1526Used by:2161
Symbol 1528 GraphicUsed by:1529
Symbol 1529 MovieClipUses:1528Used by:2161
Symbol 1530 GraphicUsed by:1531
Symbol 1531 MovieClipUses:1530Used by:1581
Symbol 1532 ShapeTweeningUsed by:1548
Symbol 1533 GraphicUsed by:1548
Symbol 1534 ShapeTweeningUsed by:1548
Symbol 1535 ShapeTweeningUsed by:1548
Symbol 1536 ShapeTweeningUsed by:1548
Symbol 1537 ShapeTweeningUsed by:1548
Symbol 1538 ShapeTweeningUsed by:1548
Symbol 1539 ShapeTweeningUsed by:1548
Symbol 1540 ShapeTweeningUsed by:1548
Symbol 1541 ShapeTweeningUsed by:1548
Symbol 1542 ShapeTweeningUsed by:1548
Symbol 1543 GraphicUsed by:1548
Symbol 1544 GraphicUsed by:1548
Symbol 1545 GraphicUsed by:1548
Symbol 1546 ShapeTweeningUsed by:1548
Symbol 1547 GraphicUsed by:1548
Symbol 1548 MovieClipUses:1532 1533 1534 1535 1536 1537 1538 1539 1540 1541 1542 1543 1544 1545 1546 1547Used by:1554
Symbol 1549 GraphicUsed by:1554
Symbol 1550 GraphicUsed by:1554
Symbol 1551 GraphicUsed by:1554
Symbol 1552 GraphicUsed by:1554
Symbol 1553 GraphicUsed by:1554
Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269}Uses:1548 1549 1550 1551 1552 1553Used by:1581
Symbol 1555 GraphicUsed by:1565
Symbol 1556 GraphicUsed by:1565
Symbol 1557 GraphicUsed by:1558
Symbol 1558 MovieClipUses:1557Used by:1565
Symbol 1559 GraphicUsed by:1560
Symbol 1560 MovieClipUses:1559Used by:1565
Symbol 1561 GraphicUsed by:1562
Symbol 1562 MovieClipUses:1561Used by:1565
Symbol 1563 GraphicUsed by:1564
Symbol 1564 MovieClipUses:1563Used by:1565
Symbol 1565 MovieClipUses:1555 1556 1558 1560 1562 1564Used by:1572
Symbol 1566 GraphicUsed by:1572
Symbol 1567 GraphicUsed by:1572
Symbol 1568 GraphicUsed by:1572
Symbol 1569 GraphicUsed by:1572
Symbol 1570 GraphicUsed by:1572
Symbol 1571 GraphicUsed by:1572
Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271}Uses:1565 1566 1567 1568 1569 1570 1571 1396Used by:1581
Symbol 1573 GraphicUsed by:1580
Symbol 1574 GraphicUsed by:1575
Symbol 1575 MovieClipUses:1574Used by:1580
Symbol 1576 GraphicUsed by:1577
Symbol 1577 MovieClipUses:1576Used by:1580
Symbol 1578 GraphicUsed by:1579
Symbol 1579 MovieClipUses:1578Used by:1580
Symbol 1580 MovieClip {hair_mania_0827_fla.c4_277}Uses:1573 1402 1575 1577 1464 1579Used by:1581
Symbol 1581 MovieClip {hair_mania_0827_fla.C4_267}Uses:1531 1554 1572 1580Used by:2161
Symbol 1582 GraphicUsed by:1583
Symbol 1583 MovieClipUses:1582Used by:2161
Symbol 1584 GraphicUsed by:1585
Symbol 1585 MovieClipUses:1584Used by:1627
Symbol 1586 GraphicUsed by:1587
Symbol 1587 MovieClip {hair_mania_0827_fla.char5_1_285}Uses:1351 1586Used by:1593
Symbol 1588 GraphicUsed by:1593
Symbol 1589 GraphicUsed by:1593
Symbol 1590 GraphicUsed by:1593
Symbol 1591 GraphicUsed by:1593
Symbol 1592 GraphicUsed by:1593
Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284}Uses:1587 1588 1589 1590 1591 1592Used by:1627
Symbol 1594 GraphicUsed by:1604
Symbol 1595 GraphicUsed by:1604
Symbol 1596 GraphicUsed by:1597
Symbol 1597 MovieClipUses:1596Used by:1604 1613
Symbol 1598 GraphicUsed by:1599
Symbol 1599 MovieClipUses:1598Used by:1604 1613
Symbol 1600 GraphicUsed by:1601
Symbol 1601 MovieClipUses:1600Used by:1604
Symbol 1602 GraphicUsed by:1603
Symbol 1603 MovieClipUses:1602Used by:1604 1613
Symbol 1604 MovieClipUses:1594 1595 1597 1599 1601 1603Used by:1613
Symbol 1605 GraphicUsed by:1606
Symbol 1606 MovieClipUses:1605Used by:1613 2696
Symbol 1607 GraphicUsed by:1613
Symbol 1608 GraphicUsed by:1613
Symbol 1609 GraphicUsed by:1613
Symbol 1610 GraphicUsed by:1613
Symbol 1611 GraphicUsed by:1613
Symbol 1612 GraphicUsed by:1613
Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286}Uses:1604 1606 1607 1608 1609 1610 1611 1612 1597 1599 1603 1396Used by:1627
Symbol 1614 GraphicUsed by:1615
Symbol 1615 MovieClipUses:1614Used by:1626
Symbol 1616 GraphicUsed by:1617
Symbol 1617 MovieClipUses:1616Used by:1626
Symbol 1618 GraphicUsed by:1619
Symbol 1619 MovieClipUses:1618Used by:1626
Symbol 1620 GraphicUsed by:1621
Symbol 1621 MovieClipUses:1620Used by:1626
Symbol 1622 GraphicUsed by:1623
Symbol 1623 MovieClipUses:1622Used by:1626
Symbol 1624 GraphicUsed by:1625
Symbol 1625 MovieClipUses:1624Used by:1626
Symbol 1626 MovieClip {hair_mania_0827_fla.c5_293}Uses:1615 1617 1402 1619 1621 1623 1464 1625Used by:1627
Symbol 1627 MovieClip {hair_mania_0827_fla.C5__282}Uses:1585 1593 1613 1626Used by:2161
Symbol 1628 GraphicUsed by:1629
Symbol 1629 MovieClipUses:1628Used by:2161
Symbol 1630 GraphicUsed by:1631
Symbol 1631 MovieClipUses:1630Used by:1697
Symbol 1632 ShapeTweeningUsed by:1664
Symbol 1633 GraphicUsed by:1664
Symbol 1634 ShapeTweeningUsed by:1664
Symbol 1635 GraphicUsed by:1664
Symbol 1636 ShapeTweeningUsed by:1664
Symbol 1637 ShapeTweeningUsed by:1664
Symbol 1638 ShapeTweeningUsed by:1664
Symbol 1639 ShapeTweeningUsed by:1664
Symbol 1640 ShapeTweeningUsed by:1664
Symbol 1641 ShapeTweeningUsed by:1664
Symbol 1642 ShapeTweeningUsed by:1664
Symbol 1643 ShapeTweeningUsed by:1664
Symbol 1644 GraphicUsed by:1664
Symbol 1645 GraphicUsed by:1664
Symbol 1646 GraphicUsed by:1664
Symbol 1647 ShapeTweeningUsed by:1664
Symbol 1648 GraphicUsed by:1664
Symbol 1649 GraphicUsed by:1664
Symbol 1650 ShapeTweeningUsed by:1664
Symbol 1651 GraphicUsed by:1664
Symbol 1652 ShapeTweeningUsed by:1664
Symbol 1653 ShapeTweeningUsed by:1664
Symbol 1654 ShapeTweeningUsed by:1664
Symbol 1655 ShapeTweeningUsed by:1664
Symbol 1656 GraphicUsed by:1664
Symbol 1657 GraphicUsed by:1664
Symbol 1658 GraphicUsed by:1664
Symbol 1659 GraphicUsed by:1664
Symbol 1660 GraphicUsed by:1664
Symbol 1661 GraphicUsed by:1664
Symbol 1662 GraphicUsed by:1664
Symbol 1663 GraphicUsed by:1664
Symbol 1664 MovieClipUses:1632 1633 1634 1635 1636 1637 1638 1639 1640 1641 1642 1643 1644 1645 1646 1647 1648 1649 1650 1651 1652 1653 1654 1655 1656 1657 1658 1659 1660 1661 1662 1663Used by:1673
Symbol 1665 GraphicUsed by:1673
Symbol 1666 GraphicUsed by:1667
Symbol 1667 MovieClipUses:1666Used by:1673
Symbol 1668 GraphicUsed by:1673
Symbol 1669 GraphicUsed by:1673
Symbol 1670 GraphicUsed by:1673
Symbol 1671 GraphicUsed by:1673
Symbol 1672 GraphicUsed by:1673
Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303}Uses:1664 1665 1667 1668 1669 1670 1671 1672Used by:1697
Symbol 1674 GraphicUsed by:1677
Symbol 1675 GraphicUsed by:1676
Symbol 1676 MovieClipUses:1675Used by:1677
Symbol 1677 MovieClipUses:1674 1676Used by:1684
Symbol 1678 GraphicUsed by:1684
Symbol 1679 GraphicUsed by:1684
Symbol 1680 GraphicUsed by:1684
Symbol 1681 GraphicUsed by:1684
Symbol 1682 GraphicUsed by:1684
Symbol 1683 GraphicUsed by:1684
Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306}Uses:1677 1678 1679 1680 1681 1682 1683 1396Used by:1697
Symbol 1685 GraphicUsed by:1696
Symbol 1686 GraphicUsed by:1687
Symbol 1687 MovieClipUses:1686Used by:1696
Symbol 1688 GraphicUsed by:1689
Symbol 1689 MovieClipUses:1688Used by:1696
Symbol 1690 GraphicUsed by:1691
Symbol 1691 MovieClipUses:1690Used by:1696
Symbol 1692 GraphicUsed by:1693
Symbol 1693 MovieClipUses:1692Used by:1696
Symbol 1694 GraphicUsed by:1695
Symbol 1695 MovieClipUses:1694Used by:1696
Symbol 1696 MovieClip {hair_mania_0827_fla.C6_309}Uses:1685 1687 1402 1689 1691 1693 1464 1695Used by:1697
Symbol 1697 MovieClip {hair_mania_0827_fla.C6__301}Uses:1631 1673 1684 1696Used by:2161
Symbol 1698 GraphicUsed by:1699
Symbol 1699 MovieClipUses:1698Used by:2161
Symbol 1700 GraphicUsed by:1701
Symbol 1701 MovieClipUses:1700Used by:1748
Symbol 1702 ShapeTweeningUsed by:1708
Symbol 1703 GraphicUsed by:1708
Symbol 1704 ShapeTweeningUsed by:1708
Symbol 1705 ShapeTweeningUsed by:1708
Symbol 1706 ShapeTweeningUsed by:1708
Symbol 1707 GraphicUsed by:1708
Symbol 1708 MovieClipUses:1702 1703 1704 1705 1706 1707Used by:1714
Symbol 1709 GraphicUsed by:1714
Symbol 1710 GraphicUsed by:1714
Symbol 1711 GraphicUsed by:1714
Symbol 1712 GraphicUsed by:1714
Symbol 1713 GraphicUsed by:1714
Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318}Uses:1708 1709 1710 1711 1712 1713Used by:1748
Symbol 1715 GraphicUsed by:1727
Symbol 1716 GraphicUsed by:1727
Symbol 1717 GraphicUsed by:1718
Symbol 1718 MovieClipUses:1717Used by:1727
Symbol 1719 GraphicUsed by:1720
Symbol 1720 MovieClipUses:1719Used by:1727
Symbol 1721 GraphicUsed by:1722
Symbol 1722 MovieClipUses:1721Used by:1727 1735
Symbol 1723 GraphicUsed by:1724
Symbol 1724 MovieClipUses:1723Used by:1727
Symbol 1725 GraphicUsed by:1726
Symbol 1726 MovieClipUses:1725Used by:1727
Symbol 1727 MovieClipUses:1715 1716 1718 1720 1722 1724 1726Used by:1735
Symbol 1728 GraphicUsed by:1735
Symbol 1729 GraphicUsed by:1735
Symbol 1730 GraphicUsed by:1735
Symbol 1731 GraphicUsed by:1735
Symbol 1732 GraphicUsed by:1735
Symbol 1733 GraphicUsed by:1735
Symbol 1734 GraphicUsed by:1735
Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320}Uses:1727 1728 1729 1730 1731 1732 1733 1722 1734 1396Used by:1748
Symbol 1736 GraphicUsed by:1747
Symbol 1737 GraphicUsed by:1738
Symbol 1738 MovieClipUses:1737Used by:1747
Symbol 1739 GraphicUsed by:1740
Symbol 1740 MovieClipUses:1739Used by:1747
Symbol 1741 GraphicUsed by:1742
Symbol 1742 MovieClipUses:1741Used by:1747
Symbol 1743 GraphicUsed by:1744
Symbol 1744 MovieClipUses:1743Used by:1747
Symbol 1745 GraphicUsed by:1746
Symbol 1746 MovieClipUses:1745Used by:1747
Symbol 1747 MovieClip {hair_mania_0827_fla.C7_327}Uses:1736 1738 1402 1740 1742 1744 1464 1746Used by:1748
Symbol 1748 MovieClip {hair_mania_0827_fla.C7__316}Uses:1701 1714 1735 1747Used by:2161
Symbol 1749 GraphicUsed by:1750
Symbol 1750 MovieClipUses:1749Used by:2161
Symbol 1751 GraphicUsed by:1752
Symbol 1752 MovieClipUses:1751Used by:1800
Symbol 1753 GraphicUsed by:1772
Symbol 1754 GraphicUsed by:1755
Symbol 1755 MovieClipUses:1754Used by:1764
Symbol 1756 GraphicUsed by:1757
Symbol 1757 MovieClipUses:1756Used by:1764
Symbol 1758 GraphicUsed by:1759
Symbol 1759 MovieClipUses:1758Used by:1764
Symbol 1760 GraphicUsed by:1761
Symbol 1761 MovieClipUses:1760Used by:1764
Symbol 1762 GraphicUsed by:1763
Symbol 1763 MovieClipUses:1762Used by:1764
Symbol 1764 MovieClip {hair_mania_0827_fla.hair8_t_337}Uses:1755 1757 1759 1761 1763Used by:1772
Symbol 1765 GraphicUsed by:1772
Symbol 1766 GraphicUsed by:1772
Symbol 1767 GraphicUsed by:1772
Symbol 1768 GraphicUsed by:1772
Symbol 1769 GraphicUsed by:1772
Symbol 1770 GraphicUsed by:1772
Symbol 1771 GraphicUsed by:1772
Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336}Uses:1753 1764 1765 1766 1767 1768 1769 1770 1771Used by:1800
Symbol 1773 GraphicUsed by:1784
Symbol 1774 GraphicUsed by:1784
Symbol 1775 GraphicUsed by:1776 1777
Symbol 1776 MovieClipUses:1775Used by:1784
Symbol 1777 MovieClipUses:1775Used by:1784
Symbol 1778 GraphicUsed by:1779
Symbol 1779 MovieClipUses:1778Used by:1784
Symbol 1780 GraphicUsed by:1781
Symbol 1781 MovieClipUses:1780Used by:1784
Symbol 1782 GraphicUsed by:1783
Symbol 1783 MovieClipUses:1782Used by:1784
Symbol 1784 MovieClipUses:1773 1774 1776 1777 1779 1781 1783Used by:1791
Symbol 1785 GraphicUsed by:1791
Symbol 1786 GraphicUsed by:1791
Symbol 1787 GraphicUsed by:1791
Symbol 1788 GraphicUsed by:1791
Symbol 1789 GraphicUsed by:1791
Symbol 1790 GraphicUsed by:1791
Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343}Uses:1784 1785 1786 1787 1788 1789 1790 1396Used by:1800
Symbol 1792 GraphicUsed by:1799
Symbol 1793 GraphicUsed by:1794 2105
Symbol 1794 MovieClipUses:1793Used by:1799
Symbol 1795 GraphicUsed by:1796
Symbol 1796 MovieClipUses:1795Used by:1799
Symbol 1797 GraphicUsed by:1798
Symbol 1798 MovieClipUses:1797Used by:1799
Symbol 1799 MovieClip {hair_mania_0827_fla.C8_350}Uses:1792 1402 1794 1796 1464 1798Used by:1800
Symbol 1800 MovieClip {hair_mania_0827_fla.C8__334}Uses:1752 1772 1791 1799Used by:2161
Symbol 1801 GraphicUsed by:1802
Symbol 1802 MovieClipUses:1801Used by:2161
Symbol 1803 GraphicUsed by:1804
Symbol 1804 MovieClipUses:1803Used by:1849
Symbol 1805 ShapeTweeningUsed by:1809
Symbol 1806 GraphicUsed by:1809 1814
Symbol 1807 GraphicUsed by:1809 1814
Symbol 1808 GraphicUsed by:1809
Symbol 1809 MovieClipUses:1805 1806 1807 1808Used by:1814
Symbol 1810 GraphicUsed by:1814
Symbol 1811 GraphicUsed by:1814
Symbol 1812 GraphicUsed by:1814
Symbol 1813 GraphicUsed by:1814
Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357}Uses:1809 1810 1806 1807 1811 1812 1813Used by:1849
Symbol 1815 GraphicUsed by:1829
Symbol 1816 GraphicUsed by:1829
Symbol 1817 GraphicUsed by:1818
Symbol 1818 MovieClipUses:1817Used by:1829 1836
Symbol 1819 GraphicUsed by:1820
Symbol 1820 MovieClipUses:1819Used by:1829 1836
Symbol 1821 GraphicUsed by:1822
Symbol 1822 MovieClipUses:1821Used by:1829
Symbol 1823 GraphicUsed by:1824
Symbol 1824 MovieClipUses:1823Used by:1829 1836
Symbol 1825 GraphicUsed by:1826
Symbol 1826 MovieClipUses:1825Used by:1829
Symbol 1827 GraphicUsed by:1828
Symbol 1828 MovieClipUses:1827Used by:1829 1836
Symbol 1829 MovieClipUses:1815 1816 1818 1820 1822 1824 1826 1828Used by:1836
Symbol 1830 GraphicUsed by:1836
Symbol 1831 GraphicUsed by:1836
Symbol 1832 GraphicUsed by:1836
Symbol 1833 GraphicUsed by:1836
Symbol 1834 GraphicUsed by:1836
Symbol 1835 GraphicUsed by:1836
Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359}Uses:1829 1830 1831 1832 1833 1834 1835 1818 1820 1828 1824 1396Used by:1849
Symbol 1837 GraphicUsed by:1848
Symbol 1838 GraphicUsed by:1839
Symbol 1839 MovieClipUses:1838Used by:1848
Symbol 1840 GraphicUsed by:1841
Symbol 1841 MovieClipUses:1840Used by:1848
Symbol 1842 GraphicUsed by:1843
Symbol 1843 MovieClipUses:1842Used by:1848
Symbol 1844 GraphicUsed by:1845
Symbol 1845 MovieClipUses:1844Used by:1848
Symbol 1846 GraphicUsed by:1847
Symbol 1847 MovieClipUses:1846Used by:1848
Symbol 1848 MovieClip {hair_mania_0827_fla.C9_367}Uses:1837 1839 1402 1841 1843 1845 1464 1847Used by:1849
Symbol 1849 MovieClip {hair_mania_0827_fla.C9__355}Uses:1804 1814 1836 1848Used by:2161
Symbol 1850 GraphicUsed by:1851
Symbol 1851 MovieClipUses:1850Used by:2161
Symbol 1852 GraphicUsed by:1904
Symbol 1853 GraphicUsed by:1854
Symbol 1854 MovieClipUses:1853Used by:1904
Symbol 1855 GraphicUsed by:1872
Symbol 1856 GraphicUsed by:1857
Symbol 1857 MovieClipUses:1856Used by:1864 1868
Symbol 1858 GraphicUsed by:1859
Symbol 1859 MovieClipUses:1858Used by:1864 1868
Symbol 1860 GraphicUsed by:1861
Symbol 1861 MovieClipUses:1860Used by:1864 1868
Symbol 1862 GraphicUsed by:1863
Symbol 1863 MovieClipUses:1862Used by:1864 1868
Symbol 1864 MovieClip {hair_mania_0827_fla.char10_harit_377}Uses:1857 1859 1861 1863Used by:1872
Symbol 1865 GraphicUsed by:1872
Symbol 1866 GraphicUsed by:1872
Symbol 1867 GraphicUsed by:1872
Symbol 1868 MovieClipUses:1863 1861 1859 1857Used by:1872
Symbol 1869 GraphicUsed by:1872
Symbol 1870 GraphicUsed by:1872
Symbol 1871 GraphicUsed by:1872
Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376}Uses:1855 1864 1865 1866 1867 1868 1869 1870 1871Used by:1904
Symbol 1873 GraphicUsed by:1891
Symbol 1874 GraphicUsed by:1884
Symbol 1875 GraphicUsed by:1884
Symbol 1876 GraphicUsed by:1877
Symbol 1877 MovieClipUses:1876Used by:1884 1891
Symbol 1878 GraphicUsed by:1879
Symbol 1879 MovieClipUses:1878Used by:1884 1891
Symbol 1880 GraphicUsed by:1881
Symbol 1881 MovieClipUses:1880Used by:1884
Symbol 1882 GraphicUsed by:1883
Symbol 1883 MovieClipUses:1882Used by:1884 1891
Symbol 1884 MovieClipUses:1874 1875 1877 1879 1881 1883Used by:1891
Symbol 1885 GraphicUsed by:1891
Symbol 1886 GraphicUsed by:1891
Symbol 1887 GraphicUsed by:1891
Symbol 1888 GraphicUsed by:1891
Symbol 1889 GraphicUsed by:1891
Symbol 1890 GraphicUsed by:1891
Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383}Uses:1873 1884 1885 1886 1887 1888 1889 1890 1877 1879 1883 1396Used by:1904
Symbol 1892 GraphicUsed by:1903
Symbol 1893 GraphicUsed by:1894
Symbol 1894 MovieClipUses:1893Used by:1903
Symbol 1895 GraphicUsed by:1896
Symbol 1896 MovieClipUses:1895Used by:1903
Symbol 1897 GraphicUsed by:1898
Symbol 1898 MovieClipUses:1897Used by:1903
Symbol 1899 GraphicUsed by:1900
Symbol 1900 MovieClipUses:1899Used by:1903
Symbol 1901 GraphicUsed by:1902
Symbol 1902 MovieClipUses:1901Used by:1903
Symbol 1903 MovieClip {hair_mania_0827_fla.C10_389}Uses:1892 1894 1402 1896 1898 1900 1464 1902Used by:1904
Symbol 1904 MovieClip {hair_mania_0827_fla.C10__374}Uses:1852 1854 1872 1891 1903Used by:2161
Symbol 1905 GraphicUsed by:1906
Symbol 1906 MovieClipUses:1905Used by:2161
Symbol 1907 GraphicUsed by:1908
Symbol 1908 MovieClipUses:1907Used by:1953
Symbol 1909 GraphicUsed by:1920
Symbol 1910 ShapeTweeningUsed by:1913
Symbol 1911 GraphicUsed by:1913
Symbol 1912 GraphicUsed by:1913
Symbol 1913 MovieClip {hair_mania_0827_fla.char11_399}Uses:1910 1911 1912Used by:1920
Symbol 1914 GraphicUsed by:1920
Symbol 1915 GraphicUsed by:1920
Symbol 1916 GraphicUsed by:1920
Symbol 1917 GraphicUsed by:1920
Symbol 1918 GraphicUsed by:1920
Symbol 1919 GraphicUsed by:1920
Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398}Uses:1909 1913 1914 1915 1916 1917 1918 1919Used by:1953
Symbol 1921 GraphicUsed by:1922
Symbol 1922 MovieClipUses:1921Used by:1953
Symbol 1923 GraphicUsed by:1934
Symbol 1924 GraphicUsed by:1925
Symbol 1925 MovieClipUses:1924Used by:1934
Symbol 1926 GraphicUsed by:1927
Symbol 1927 MovieClipUses:1926Used by:1934
Symbol 1928 GraphicUsed by:1929
Symbol 1929 MovieClipUses:1928Used by:1934
Symbol 1930 GraphicUsed by:1931
Symbol 1931 MovieClipUses:1930Used by:1934
Symbol 1932 GraphicUsed by:1933
Symbol 1933 MovieClipUses:1932Used by:1934
Symbol 1934 MovieClip {hair_mania_0827_fla.c11_401}Uses:1923 1925 1402 1927 1929 1931 1464 1933Used by:1953
Symbol 1935 GraphicUsed by:1945
Symbol 1936 GraphicUsed by:1945
Symbol 1937 GraphicUsed by:1938
Symbol 1938 MovieClipUses:1937Used by:1945 1952
Symbol 1939 GraphicUsed by:1940
Symbol 1940 MovieClipUses:1939Used by:1945 1952
Symbol 1941 GraphicUsed by:1942
Symbol 1942 MovieClipUses:1941Used by:1945
Symbol 1943 GraphicUsed by:1944
Symbol 1944 MovieClipUses:1943Used by:1945 1952
Symbol 1945 MovieClipUses:1935 1936 1938 1940 1942 1944Used by:1952
Symbol 1946 GraphicUsed by:1952
Symbol 1947 GraphicUsed by:1952
Symbol 1948 GraphicUsed by:1952
Symbol 1949 GraphicUsed by:1952
Symbol 1950 GraphicUsed by:1952
Symbol 1951 GraphicUsed by:1952
Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407}Uses:1945 1946 1947 1948 1949 1950 1951 1938 1940 1944 1396Used by:1953
Symbol 1953 MovieClip {hair_mania_0827_fla.C11__396}Uses:1908 1920 1922 1934 1952Used by:2161
Symbol 1954 GraphicUsed by:1955
Symbol 1955 MovieClipUses:1954Used by:2161
Symbol 1956 GraphicUsed by:1957
Symbol 1957 MovieClipUses:1956Used by:2010
Symbol 1958 GraphicUsed by:1959
Symbol 1959 MovieClipUses:1958Used by:2010
Symbol 1960 ShapeTweeningUsed by:1963
Symbol 1961 GraphicUsed by:1963
Symbol 1962 GraphicUsed by:1963
Symbol 1963 MovieClipUses:1960 1961 1962Used by:1970
Symbol 1964 GraphicUsed by:1970
Symbol 1965 GraphicUsed by:1970
Symbol 1966 GraphicUsed by:1970
Symbol 1967 GraphicUsed by:1970
Symbol 1968 GraphicUsed by:1970
Symbol 1969 GraphicUsed by:1970
Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417}Uses:1963 1964 1965 1966 1967 1968 1969Used by:2010
Symbol 1971 GraphicUsed by:1987
Symbol 1972 GraphicUsed by:1987
Symbol 1973 GraphicUsed by:1974
Symbol 1974 MovieClipUses:1973Used by:1987 1996
Symbol 1975 GraphicUsed by:1987
Symbol 1976 GraphicUsed by:1977
Symbol 1977 MovieClipUses:1976Used by:1987
Symbol 1978 GraphicUsed by:1979
Symbol 1979 MovieClipUses:1978Used by:1987
Symbol 1980 GraphicUsed by:1987
Symbol 1981 GraphicUsed by:1982
Symbol 1982 MovieClipUses:1981Used by:1987
Symbol 1983 GraphicUsed by:1987
Symbol 1984 GraphicUsed by:1985
Symbol 1985 MovieClipUses:1984Used by:1987 1996
Symbol 1986 GraphicUsed by:1987
Symbol 1987 MovieClipUses:1971 1972 1974 1975 1977 1979 1980 1982 1983 1985 1986Used by:1996
Symbol 1988 GraphicUsed by:1996
Symbol 1989 GraphicUsed by:1996
Symbol 1990 GraphicUsed by:1996
Symbol 1991 GraphicUsed by:1996
Symbol 1992 GraphicUsed by:1996
Symbol 1993 GraphicUsed by:1996
Symbol 1994 GraphicUsed by:1996
Symbol 1995 GraphicUsed by:1996
Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419}Uses:1987 1988 1989 1990 1991 1992 1993 1994 1995 1974 1985 1396Used by:2010
Symbol 1997 GraphicUsed by:2009
Symbol 1998 GraphicUsed by:1999 2004
Symbol 1999 MovieClipUses:1998Used by:2009
Symbol 2000 GraphicUsed by:2001
Symbol 2001 MovieClipUses:2000Used by:2009
Symbol 2002 GraphicUsed by:2003
Symbol 2003 MovieClipUses:2002Used by:2009
Symbol 2004 MovieClipUses:1998Used by:2009
Symbol 2005 GraphicUsed by:2006
Symbol 2006 MovieClipUses:2005Used by:2009
Symbol 2007 GraphicUsed by:2008
Symbol 2008 MovieClipUses:2007Used by:2009
Symbol 2009 MovieClip {hair_mania_0827_fla.c12_426}Uses:1997 1999 1402 2001 2003 2004 1464 2006 2008Used by:2010
Symbol 2010 MovieClip {hair_mania_0827_fla.C12__414}Uses:1957 1959 1970 1996 2009Used by:2161
Symbol 2011 GraphicUsed by:2012
Symbol 2012 MovieClipUses:2011Used by:2161
Symbol 2013 GraphicUsed by:2014
Symbol 2014 MovieClipUses:2013Used by:2069
Symbol 2015 GraphicUsed by:2016
Symbol 2016 MovieClipUses:2015Used by:2069
Symbol 2017 GraphicUsed by:2029
Symbol 2018 GraphicUsed by:2029
Symbol 2019 GraphicUsed by:2029
Symbol 2020 GraphicUsed by:2029
Symbol 2021 GraphicUsed by:2029
Symbol 2022 ShapeTweeningUsed by:2029
Symbol 2023 ShapeTweeningUsed by:2029
Symbol 2024 ShapeTweeningUsed by:2029
Symbol 2025 ShapeTweeningUsed by:2029
Symbol 2026 ShapeTweeningUsed by:2029
Symbol 2027 GraphicUsed by:2029
Symbol 2028 GraphicUsed by:2029
Symbol 2029 MovieClipUses:2017 2018 2019 2020 2021 2022 2023 2024 2025 2026 2027 2028Used by:2036
Symbol 2030 GraphicUsed by:2036
Symbol 2031 GraphicUsed by:2036
Symbol 2032 GraphicUsed by:2036
Symbol 2033 GraphicUsed by:2036
Symbol 2034 GraphicUsed by:2036
Symbol 2035 GraphicUsed by:2036
Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437}Uses:2029 2030 2031 2032 2033 2034 2035Used by:2069
Symbol 2037 GraphicUsed by:2046
Symbol 2038 GraphicUsed by:2046
Symbol 2039 GraphicUsed by:2040 2041
Symbol 2040 MovieClipUses:2039Used by:2046
Symbol 2041 MovieClipUses:2039Used by:2046
Symbol 2042 GraphicUsed by:2043
Symbol 2043 MovieClipUses:2042Used by:2046
Symbol 2044 GraphicUsed by:2045
Symbol 2045 MovieClipUses:2044Used by:2046
Symbol 2046 MovieClipUses:2037 2038 2040 2041 2043 2045Used by:2055
Symbol 2047 GraphicUsed by:2055
Symbol 2048 GraphicUsed by:2055
Symbol 2049 GraphicUsed by:2055
Symbol 2050 GraphicUsed by:2055
Symbol 2051 GraphicUsed by:2055
Symbol 2052 GraphicUsed by:2055
Symbol 2053 GraphicUsed by:2055
Symbol 2054 GraphicUsed by:2055
Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439}Uses:2046 2047 2048 2049 2050 2051 2052 2053 2054 1396Used by:2069
Symbol 2056 GraphicUsed by:2068
Symbol 2057 GraphicUsed by:2058 2063
Symbol 2058 MovieClipUses:2057Used by:2068
Symbol 2059 GraphicUsed by:2060
Symbol 2060 MovieClipUses:2059Used by:2068
Symbol 2061 GraphicUsed by:2062
Symbol 2062 MovieClipUses:2061Used by:2068
Symbol 2063 MovieClipUses:2057Used by:2068
Symbol 2064 GraphicUsed by:2065
Symbol 2065 MovieClipUses:2064Used by:2068
Symbol 2066 GraphicUsed by:2067
Symbol 2067 MovieClipUses:2066Used by:2068
Symbol 2068 MovieClip {hair_mania_0827_fla.c13_445}Uses:2056 2058 1402 2060 2062 2063 1464 2065 2067Used by:2069
Symbol 2069 MovieClip {hair_mania_0827_fla.C13__434}Uses:2014 2016 2036 2055 2068Used by:2161
Symbol 2070 GraphicUsed by:2071
Symbol 2071 MovieClipUses:2070Used by:2161
Symbol 2072 GraphicUsed by:2112
Symbol 2073 ShapeTweeningUsed by:2081
Symbol 2074 GraphicUsed by:2081
Symbol 2075 GraphicUsed by:2081
Symbol 2076 GraphicUsed by:2081
Symbol 2077 GraphicUsed by:2078
Symbol 2078 MovieClipUses:2077Used by:2081
Symbol 2079 GraphicUsed by:2080
Symbol 2080 MovieClipUses:2079Used by:2081
Symbol 2081 MovieClip {hair_mania_0827_fla.char14_455}Uses:2073 2074 2075 2076 2078 2080Used by:2088
Symbol 2082 GraphicUsed by:2088
Symbol 2083 GraphicUsed by:2088
Symbol 2084 GraphicUsed by:2088
Symbol 2085 GraphicUsed by:2088
Symbol 2086 GraphicUsed by:2088
Symbol 2087 GraphicUsed by:2088
Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454}Uses:2081 2082 2083 2084 2085 2086 2087Used by:2112
Symbol 2089 GraphicUsed by:2095
Symbol 2090 GraphicUsed by:2095
Symbol 2091 GraphicUsed by:2092
Symbol 2092 MovieClipUses:2091Used by:2095
Symbol 2093 GraphicUsed by:2094
Symbol 2094 MovieClipUses:2093Used by:2095
Symbol 2095 MovieClipUses:2089 2090 2092 2094Used by:2102
Symbol 2096 GraphicUsed by:2102
Symbol 2097 GraphicUsed by:2102
Symbol 2098 GraphicUsed by:2102
Symbol 2099 GraphicUsed by:2102
Symbol 2100 GraphicUsed by:2102
Symbol 2101 GraphicUsed by:2102
Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458}Uses:2095 2096 2097 2098 2099 2100 2101 1396Used by:2112
Symbol 2103 GraphicUsed by:2111
Symbol 2104 GraphicUsed by:2111
Symbol 2105 MovieClipUses:1793Used by:2111
Symbol 2106 GraphicUsed by:2107
Symbol 2107 MovieClipUses:2106Used by:2111
Symbol 2108 GraphicUsed by:2111
Symbol 2109 GraphicUsed by:2110
Symbol 2110 MovieClipUses:2109Used by:2111
Symbol 2111 MovieClip {hair_mania_0827_fla.c14_462}Uses:2103 2104 1402 2105 2107 2108 1464 2110Used by:2112
Symbol 2112 MovieClip {hair_mania_0827_fla.C14__453}Uses:2072 2088 2102 2111Used by:2161
Symbol 2113 GraphicUsed by:2114
Symbol 2114 MovieClipUses:2113Used by:2161
Symbol 2115 GraphicUsed by:2116
Symbol 2116 MovieClipUses:2115Used by:2158
Symbol 2117 GraphicUsed by:2118
Symbol 2118 MovieClipUses:2117Used by:2120 2126
Symbol 2119 GraphicUsed by:2120
Symbol 2120 MovieClipUses:2118 2119Used by:2126
Symbol 2121 GraphicUsed by:2126
Symbol 2122 GraphicUsed by:2126
Symbol 2123 GraphicUsed by:2126
Symbol 2124 GraphicUsed by:2126
Symbol 2125 GraphicUsed by:2126
Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469}Uses:2120 2121 2118 2122 2123 2124 2125Used by:2158
Symbol 2127 GraphicUsed by:2128
Symbol 2128 MovieClipUses:2127Used by:2143
Symbol 2129 GraphicUsed by:2143
Symbol 2130 GraphicUsed by:2143
Symbol 2131 GraphicUsed by:2143
Symbol 2132 GraphicUsed by:2143
Symbol 2133 GraphicUsed by:2143
Symbol 2134 GraphicUsed by:2143
Symbol 2135 GraphicUsed by:2136
Symbol 2136 MovieClipUses:2135Used by:2143
Symbol 2137 GraphicUsed by:2138
Symbol 2138 MovieClipUses:2137Used by:2143
Symbol 2139 GraphicUsed by:2140
Symbol 2140 MovieClipUses:2139Used by:2143
Symbol 2141 GraphicUsed by:2142
Symbol 2142 MovieClipUses:2141Used by:2143
Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472}Uses:2128 2129 2130 2131 2132 2133 2134 2136 2138 2140 2142 1396Used by:2158
Symbol 2144 GraphicUsed by:2157
Symbol 2145 GraphicUsed by:2146
Symbol 2146 MovieClipUses:2145Used by:2157
Symbol 2147 GraphicUsed by:2148
Symbol 2148 MovieClipUses:2147Used by:2157
Symbol 2149 GraphicUsed by:2150
Symbol 2150 MovieClipUses:2149Used by:2157
Symbol 2151 GraphicUsed by:2152
Symbol 2152 MovieClipUses:2151Used by:2157
Symbol 2153 GraphicUsed by:2154
Symbol 2154 MovieClipUses:2153Used by:2157
Symbol 2155 GraphicUsed by:2156
Symbol 2156 MovieClipUses:2155Used by:2157
Symbol 2157 MovieClip {hair_mania_0827_fla.c15_478}Uses:2144 2146 1402 2148 2150 2152 1464 2154 2156Used by:2158
Symbol 2158 MovieClip {hair_mania_0827_fla.C15__467}Uses:2116 2126 2143 2157Used by:2161
Symbol 2159 GraphicUsed by:2160
Symbol 2160 MovieClipUses:2159Used by:2161
Symbol 2161 MovieClip {hair_mania_0827_fla._char_195}Uses:1414 824 1416 1419 1467 1469 1527 1529 1581 1583 1627 1629 1697 1699 1748 1750 1800 1802 1849 1851 1904 1906 1953 1955 2010 2012 2069 2071 2112 2114 2158 2160Used by:2346
Symbol 2162 GraphicUsed by:2246
Symbol 2163 GraphicUsed by:2192
Symbol 2164 GraphicUsed by:2192 3174
Symbol 2165 GraphicUsed by:2192 2397 3174
Symbol 2166 GraphicUsed by:2192 3174
Symbol 2167 GraphicUsed by:2192 3174
Symbol 2168 GraphicUsed by:2192 3174
Symbol 2169 GraphicUsed by:2192 3174
Symbol 2170 GraphicUsed by:2192 3174
Symbol 2171 GraphicUsed by:2192 3174
Symbol 2172 GraphicUsed by:2192 3174
Symbol 2173 GraphicUsed by:2192 3174
Symbol 2174 GraphicUsed by:2192 3174
Symbol 2175 GraphicUsed by:2192 3174
Symbol 2176 GraphicUsed by:2192 3174
Symbol 2177 GraphicUsed by:2192 3174
Symbol 2178 GraphicUsed by:2192 3174
Symbol 2179 GraphicUsed by:2192 3174
Symbol 2180 GraphicUsed by:2192 3174
Symbol 2181 GraphicUsed by:2192 3174
Symbol 2182 GraphicUsed by:2192 3174
Symbol 2183 GraphicUsed by:2192 3174
Symbol 2184 GraphicUsed by:2192 3174
Symbol 2185 GraphicUsed by:2192 3174
Symbol 2186 GraphicUsed by:2192
Symbol 2187 ShapeTweeningUsed by:2192
Symbol 2188 ShapeTweeningUsed by:2192
Symbol 2189 GraphicUsed by:2192 3174
Symbol 2190 ShapeTweeningUsed by:2192
Symbol 2191 GraphicUsed by:2192 3174
Symbol 2192 MovieClipUses:2163 2164 2165 2166 2167 2168 2169 2170 2171 2172 2173 2174 2175 2176 2177 2178 2179 2180 2181 2182 2183 2184 2185 2186 2187 2188 2189 2190 2191Used by:2246
Symbol 2193 GraphicUsed by:2246
Symbol 2194 GraphicUsed by:2198
Symbol 2195 GraphicUsed by:2198
Symbol 2196 GraphicUsed by:2198
Symbol 2197 GraphicUsed by:2198
Symbol 2198 MovieClipUses:2194 2195 2196 2197Used by:2244 2246
Symbol 2199 GraphicUsed by:2244
Symbol 2200 GraphicUsed by:2201
Symbol 2201 MovieClipUses:2200Used by:2244
Symbol 2202 GraphicUsed by:2244
Symbol 2203 BitmapUsed by:2204
Symbol 2204 GraphicUses:2203Used by:2244
Symbol 2205 BitmapUsed by:2206
Symbol 2206 GraphicUses:2205Used by:2231
Symbol 2207 BitmapUsed by:2208
Symbol 2208 GraphicUses:2207Used by:2231
Symbol 2209 BitmapUsed by:2210
Symbol 2210 GraphicUses:2209Used by:2231
Symbol 2211 BitmapUsed by:2212
Symbol 2212 GraphicUses:2211Used by:2231
Symbol 2213 BitmapUsed by:2214
Symbol 2214 GraphicUses:2213Used by:2231
Symbol 2215 BitmapUsed by:2216
Symbol 2216 GraphicUses:2215Used by:2231
Symbol 2217 BitmapUsed by:2218
Symbol 2218 GraphicUses:2217Used by:2231
Symbol 2219 BitmapUsed by:2220
Symbol 2220 GraphicUses:2219Used by:2231
Symbol 2221 BitmapUsed by:2222
Symbol 2222 GraphicUses:2221Used by:2231
Symbol 2223 BitmapUsed by:2224
Symbol 2224 GraphicUses:2223Used by:2231
Symbol 2225 BitmapUsed by:2226
Symbol 2226 GraphicUses:2225Used by:2231
Symbol 2227 BitmapUsed by:2228
Symbol 2228 GraphicUses:2227Used by:2231
Symbol 2229 BitmapUsed by:2230
Symbol 2230 GraphicUses:2229Used by:2231
Symbol 2231 MovieClipUses:2206 2208 2210 2212 2214 2216 2218 2220 2222 2224 2226 2228 2230Used by:2244
Symbol 2232 BitmapUsed by:2233
Symbol 2233 GraphicUses:2232Used by:2244
Symbol 2234 BitmapUsed by:2235
Symbol 2235 GraphicUses:2234Used by:2244
Symbol 2236 BitmapUsed by:2237
Symbol 2237 GraphicUses:2236Used by:2244
Symbol 2238 BitmapUsed by:2239
Symbol 2239 GraphicUses:2238Used by:2244
Symbol 2240 BitmapUsed by:2241
Symbol 2241 GraphicUses:2240Used by:2244
Symbol 2242 BitmapUsed by:2243
Symbol 2243 GraphicUses:2242Used by:2244
Symbol 2244 MovieClipUses:2199 2201 2198 2202 2204 2231 2233 2235 2237 2239 2241 2243Used by:2246
Symbol 2245 GraphicUsed by:2246
Symbol 2246 MovieClip {hair_mania_0827_fla.Timeline_486}Uses:2162 2192 2193 2198 2244 2245Used by:2346
Symbol 2247 BitmapUsed by:2248
Symbol 2248 GraphicUses:2247Used by:2265
Symbol 2249 BitmapUsed by:2250
Symbol 2250 GraphicUses:2249Used by:2265
Symbol 2251 BitmapUsed by:2252
Symbol 2252 GraphicUses:2251Used by:2265
Symbol 2253 BitmapUsed by:2254
Symbol 2254 GraphicUses:2253Used by:2265
Symbol 2255 BitmapUsed by:2256
Symbol 2256 GraphicUses:2255Used by:2265
Symbol 2257 BitmapUsed by:2258
Symbol 2258 GraphicUses:2257Used by:2265
Symbol 2259 BitmapUsed by:2260
Symbol 2260 GraphicUses:2259Used by:2265
Symbol 2261 BitmapUsed by:2262
Symbol 2262 GraphicUses:2261Used by:2265
Symbol 2263 BitmapUsed by:2264
Symbol 2264 GraphicUses:2263Used by:2265
Symbol 2265 MovieClipUses:2248 2250 2252 2254 2256 2258 2260 2262 2264Used by:2273
Symbol 2266 GraphicUsed by:2270
Symbol 2267 GraphicUsed by:2268
Symbol 2268 MovieClipUses:2267Used by:2270
Symbol 2269 GraphicUsed by:2270
Symbol 2270 MovieClip {hair_mania_0827_fla.timebar_494}Uses:2266 2268 2269Used by:2273 3760
Symbol 2271 GraphicUsed by:2272
Symbol 2272 MovieClipUses:2271Used by:2273 2346 3760
Symbol 2273 MovieClip {hair_mania_0827_fla.think_exit__492}Uses:2265 2270 2272Used by:2346
Symbol 2274 GraphicUsed by:2275
Symbol 2275 MovieClipUses:2274Used by:2346
Symbol 2276 GraphicUsed by:2346
Symbol 2277 GraphicUsed by:2282
Symbol 2278 MovieClipUses:8Used by:2282
Symbol 2279 GraphicUsed by:2280
Symbol 2280 MovieClipUses:2279Used by:2282
Symbol 2281 GraphicUsed by:2282
Symbol 2282 MovieClip {hair_mania_0827_fla.Timeline_498}Uses:2277 2278 2280 2281Used by:2346
Symbol 2283 GraphicUsed by:2284
Symbol 2284 MovieClipUses:2283Used by:2346
Symbol 2285 GraphicUsed by:2346
Symbol 2286 GraphicUsed by:2287
Symbol 2287 MovieClipUses:2286Used by:2288
Symbol 2288 MovieClip {按钮_暂停}Uses:1039 2287Used by:2346
Symbol 2289 GraphicUsed by:2293
Symbol 2290 GraphicUsed by:2291
Symbol 2291 MovieClipUses:2290Used by:2293
Symbol 2292 GraphicUsed by:2293
Symbol 2293 MovieClip {按钮_音量}Uses:2289 1039 2291 6 2292Used by:2346
Symbol 2294 TextUses:148Used by:2308
Symbol 2295 FontUsed by:2296 2307 2310 2321 2783 2795 2854 2866 2987 3375 3376 3377 3598 3599 3635 3664 3676 3687 3699 3706 3718 3729 3742 3745 3758
Symbol 2296 TextUses:2295Used by:2308
Symbol 2297 TextUses:148Used by:2308
Symbol 2298 TextUses:148Used by:2308
Symbol 2299 TextUses:148Used by:2308
Symbol 2300 TextUses:148Used by:2308
Symbol 2301 TextUses:148Used by:2308
Symbol 2302 TextUses:148Used by:2308
Symbol 2303 TextUses:148Used by:2308
Symbol 2304 TextUses:148Used by:2308
Symbol 2305 TextUses:148Used by:2308
Symbol 2306 TextUses:148Used by:2308
Symbol 2307 TextUses:2295Used by:2308
Symbol 2308 MovieClip {targetss}Uses:2294 2296 2297 2298 2299 2300 2301 2302 2303 2304 2305 2306 2307Used by:2346  Timeline
Symbol 2309 TextUses:148Used by:2322
Symbol 2310 TextUses:2295Used by:2322
Symbol 2311 TextUses:148Used by:2322
Symbol 2312 TextUses:148Used by:2322
Symbol 2313 TextUses:148Used by:2322
Symbol 2314 TextUses:148Used by:2322
Symbol 2315 TextUses:148Used by:2322
Symbol 2316 TextUses:148Used by:2322
Symbol 2317 TextUses:148Used by:2322
Symbol 2318 TextUses:148Used by:2322
Symbol 2319 TextUses:148Used by:2322
Symbol 2320 TextUses:148Used by:2322
Symbol 2321 TextUses:2295Used by:2322
Symbol 2322 MovieClip {usedss}Uses:2309 2310 2311 2312 2313 2314 2315 2316 2317 2318 2319 2320 2321Used by:2346  Timeline
Symbol 2323 GraphicUsed by:2324
Symbol 2324 MovieClipUses:2323Used by:2346
Symbol 2325 MovieClipUsed by:2346 2417 3509
Symbol 2326 MovieClipUses:1009Used by:2327
Symbol 2327 MovieClip {hair_mania_0827_fla.__510}Uses:1008 890 2326 1012 1028Used by:2346
Symbol 2328 GraphicUsed by:2329
Symbol 2329 MovieClipUses:2328Used by:2341
Symbol 2330 GraphicUsed by:2331
Symbol 2331 MovieClipUses:2330Used by:2341
Symbol 2332 GraphicUsed by:2333
Symbol 2333 MovieClipUses:2332Used by:2341
Symbol 2334 GraphicUsed by:2340
Symbol 2335 GraphicUsed by:2336
Symbol 2336 MovieClipUses:2335Used by:2340
Symbol 2337 GraphicUsed by:2338
Symbol 2338 MovieClipUses:2337Used by:2340
Symbol 2339 GraphicUsed by:2340
Symbol 2340 MovieClipUses:2334 2336 2338 2339Used by:2341
Symbol 2341 MovieClipUses:2329 2331 2333 2340Used by:2346
Symbol 2342 FontUsed by:2343 2344 2345 3902
Symbol 2343 EditableTextUses:2342Used by:2346
Symbol 2344 EditableTextUses:2342Used by:2346
Symbol 2345 EditableTextUses:2342Used by:2346
Symbol 2346 MovieClip {lib.Game}Uses:1047 1050 1343 1346 2161 2246 2273 2275 2276 2282 394 455 2284 2285 2288 2272 2293 1039 2308 2322 2324 2325 2327 2341 459 2343 2344 2345Used by:Timeline
Symbol 2347 GraphicUsed by:2351
Symbol 2348 GraphicUsed by:2351
Symbol 2349 GraphicUsed by:2351
Symbol 2350 GraphicUsed by:2351
Symbol 2351 MovieClip {按钮_画面质量}Uses:2347 2348 2349 2350Used by:2355
Symbol 2352 GraphicUsed by:2354
Symbol 2353 GraphicUsed by:2354
Symbol 2354 MovieClip {按钮_声音}Uses:2352 2353Used by:2355
Symbol 2355 MovieClip {lib.setQuality}Uses:2351 2354Used by:3509  Timeline
Symbol 2356 GraphicUsed by:2357
Symbol 2357 MovieClipUses:2356Used by:2360
Symbol 2358 GraphicUsed by:2359
Symbol 2359 MovieClipUses:2358Used by:2360
Symbol 2360 MovieClip {lib.BarCtrl}Uses:2357 2359Used by:3639  Timeline
Symbol 2361 GraphicUsed by:2397
Symbol 2362 GraphicUsed by:2397
Symbol 2363 GraphicUsed by:2397
Symbol 2364 GraphicUsed by:2397 3174
Symbol 2365 GraphicUsed by:2397
Symbol 2366 GraphicUsed by:2397
Symbol 2367 GraphicUsed by:2397
Symbol 2368 GraphicUsed by:2397
Symbol 2369 GraphicUsed by:2397
Symbol 2370 GraphicUsed by:2397
Symbol 2371 GraphicUsed by:2397
Symbol 2372 GraphicUsed by:2397
Symbol 2373 GraphicUsed by:2397
Symbol 2374 GraphicUsed by:2397
Symbol 2375 GraphicUsed by:2397
Symbol 2376 GraphicUsed by:2397
Symbol 2377 GraphicUsed by:2397
Symbol 2378 GraphicUsed by:2397
Symbol 2379 GraphicUsed by:2397
Symbol 2380 GraphicUsed by:2397
Symbol 2381 GraphicUsed by:2397
Symbol 2382 GraphicUsed by:2397
Symbol 2383 GraphicUsed by:2397
Symbol 2384 GraphicUsed by:2397
Symbol 2385 GraphicUsed by:2397
Symbol 2386 GraphicUsed by:2397
Symbol 2387 GraphicUsed by:2397
Symbol 2388 GraphicUsed by:2397
Symbol 2389 GraphicUsed by:2397
Symbol 2390 GraphicUsed by:2397
Symbol 2391 GraphicUsed by:2397
Symbol 2392 GraphicUsed by:2397
Symbol 2393 GraphicUsed by:2397
Symbol 2394 GraphicUsed by:2397
Symbol 2395 GraphicUsed by:2397
Symbol 2396 GraphicUsed by:2397
Symbol 2397 MovieClipUses:2361 2362 2363 2165 2364 2365 2366 2367 2368 2369 2370 2371 2372 2373 2374 2375 2376 2377 2378 2379 2380 2381 2382 2383 2384 2385 2386 2387 2388 2389 2390 2391 2392 2393 2394 2395 2396Used by:2400
Symbol 2398 GraphicUsed by:2399
Symbol 2399 MovieClipUses:2398Used by:2400
Symbol 2400 MovieClipUses:2397 2399Used by:2417 3007 3427
Symbol 2401 GraphicUsed by:2402
Symbol 2402 MovieClipUses:2401Used by:2417 3509
Symbol 2403 TextUses:440Used by:2415
Symbol 2404 TextUses:442Used by:2415
Symbol 2405 TextUses:440Used by:2415
Symbol 2406 TextUses:440Used by:2415
Symbol 2407 TextUses:440Used by:2415
Symbol 2408 TextUses:440Used by:2415
Symbol 2409 TextUses:440Used by:2415
Symbol 2410 TextUses:440Used by:2415
Symbol 2411 TextUses:440Used by:2415
Symbol 2412 TextUses:440Used by:2415
Symbol 2413 TextUses:440Used by:2415
Symbol 2414 TextUses:442Used by:2415
Symbol 2415 MovieClip {MAINMENU}Uses:2403 2404 2405 2406 2407 2408 2409 2410 2411 2412 2413 2414Used by:2416  Timeline
Symbol 2416 MovieClip {按钮_MAINMENU}Uses:896 2415Used by:2417 2797 3133
Symbol 2417 MovieClip {lib.Highscore}Uses:10 836 2400 2402 2416 1045 423 2325Used by:Timeline
Symbol 2418 GraphicUsed by:2424
Symbol 2419 GraphicUsed by:2424
Symbol 2420 BitmapUsed by:2421
Symbol 2421 GraphicUses:2420Used by:2422
Symbol 2422 MovieClipUses:2421Used by:2424
Symbol 2423 GraphicUsed by:2424
Symbol 2424 MovieClipUses:2418 2419 2422 2423Used by:2664
Symbol 2425 GraphicUsed by:2426
Symbol 2426 MovieClipUses:2425Used by:2428 2430 2432 2436 2438 2440 2442 2444 2446 2448 2450 2465
Symbol 2427 GraphicUsed by:2428
Symbol 2428 MovieClipUses:2426 2427Used by:2466
Symbol 2429 GraphicUsed by:2430
Symbol 2430 MovieClipUses:2426 2429Used by:2466
Symbol 2431 GraphicUsed by:2432
Symbol 2432 MovieClipUses:2426 2431Used by:2466
Symbol 2433 GraphicUsed by:2434
Symbol 2434 MovieClipUses:2433Used by:2466
Symbol 2435 GraphicUsed by:2436
Symbol 2436 MovieClipUses:2426 2435Used by:2466
Symbol 2437 GraphicUsed by:2438
Symbol 2438 MovieClipUses:2426 2437Used by:2466
Symbol 2439 GraphicUsed by:2440
Symbol 2440 MovieClipUses:2426 2439Used by:2466
Symbol 2441 GraphicUsed by:2442
Symbol 2442 MovieClipUses:2426 2441Used by:2466
Symbol 2443 GraphicUsed by:2444
Symbol 2444 MovieClipUses:2426 2443Used by:2466
Symbol 2445 GraphicUsed by:2446
Symbol 2446 MovieClipUses:2426 2445Used by:2466
Symbol 2447 GraphicUsed by:2448
Symbol 2448 MovieClipUses:2426 2447Used by:2466
Symbol 2449 GraphicUsed by:2450
Symbol 2450 MovieClipUses:2426 2449Used by:2466
Symbol 2451 GraphicUsed by:2465
Symbol 2452 TextUses:158Used by:2465
Symbol 2453 TextUses:158Used by:2465
Symbol 2454 TextUses:158Used by:2465
Symbol 2455 TextUses:158Used by:2465
Symbol 2456 TextUses:158Used by:2465
Symbol 2457 TextUses:158Used by:2465
Symbol 2458 TextUses:158Used by:2465
Symbol 2459 TextUses:158Used by:2465
Symbol 2460 TextUses:158Used by:2465
Symbol 2461 TextUses:158Used by:2465
Symbol 2462 TextUses:158Used by:2465
Symbol 2463 TextUses:158Used by:2465
Symbol 2464 GraphicUsed by:2465
Symbol 2465 MovieClipUses:2426 2451 2452 2453 2454 2455 2456 2457 2458 2459 2460 2461 2462 2463 2464Used by:2466
Symbol 2466 MovieClipUses:2428 2430 2432 2434 2436 2438 2440 2442 2444 2446 2448 2450 2465Used by:2664
Symbol 2467 TextUses:440Used by:2482
Symbol 2468 FontUsed by:2469 2481 2484 2496 2499 2511 2514 2526 2529 2541 2544 2556 2559 2571 2574 2586 2589 2601 2604 2616 2619 2631 2634 2645 2648 2661 3311
Symbol 2469 TextUses:2468Used by:2482
Symbol 2470 TextUses:440Used by:2482
Symbol 2471 TextUses:440Used by:2482
Symbol 2472 TextUses:440Used by:2482
Symbol 2473 TextUses:440Used by:2482
Symbol 2474 TextUses:440Used by:2482
Symbol 2475 TextUses:440Used by:2482
Symbol 2476 TextUses:440Used by:2482
Symbol 2477 TextUses:440Used by:2482
Symbol 2478 TextUses:440Used by:2482
Symbol 2479 TextUses:440Used by:2482
Symbol 2480 TextUses:440Used by:2482
Symbol 2481 TextUses:2468Used by:2482
Symbol 2482 MovieClip {badge_Bighairbadge}Uses:2467 2469 2470 2471 2472 2473 2474 2475 2476 2477 2478 2479 2480 2481Used by:2663  Timeline
Symbol 2483 TextUses:440Used by:2497
Symbol 2484 TextUses:2468Used by:2497
Symbol 2485 TextUses:440Used by:2497
Symbol 2486 TextUses:440Used by:2497
Symbol 2487 TextUses:440Used by:2497
Symbol 2488 TextUses:440Used by:2497
Symbol 2489 TextUses:440Used by:2497
Symbol 2490 TextUses:440Used by:2497
Symbol 2491 TextUses:440Used by:2497
Symbol 2492 TextUses:440Used by:2497
Symbol 2493 TextUses:440Used by:2497
Symbol 2494 TextUses:440Used by:2497
Symbol 2495 TextUses:440Used by:2497
Symbol 2496 TextUses:2468Used by:2497
Symbol 2497 MovieClip {badge_Greathairbadge}Uses:2483 2484 2485 2486 2487 2488 2489 2490 2491 2492 2493 2494 2495 2496Used by:2663  Timeline
Symbol 2498 TextUses:440Used by:2512
Symbol 2499 TextUses:2468Used by:2512
Symbol 2500 TextUses:440Used by:2512
Symbol 2501 TextUses:440Used by:2512
Symbol 2502 TextUses:440Used by:2512
Symbol 2503 TextUses:440Used by:2512
Symbol 2504 TextUses:440Used by:2512
Symbol 2505 TextUses:440Used by:2512
Symbol 2506 TextUses:440Used by:2512
Symbol 2507 TextUses:440Used by:2512
Symbol 2508 TextUses:440Used by:2512
Symbol 2509 TextUses:440Used by:2512
Symbol 2510 TextUses:440Used by:2512
Symbol 2511 TextUses:2468Used by:2512
Symbol 2512 MovieClip {badge_Hugehairbadge}Uses:2498 2499 2500 2501 2502 2503 2504 2505 2506 2507 2508 2509 2510 2511Used by:2663  Timeline
Symbol 2513 TextUses:440Used by:2527
Symbol 2514 TextUses:2468Used by:2527
Symbol 2515 TextUses:440Used by:2527
Symbol 2516 TextUses:440Used by:2527
Symbol 2517 TextUses:440Used by:2527
Symbol 2518 TextUses:440Used by:2527
Symbol 2519 TextUses:440Used by:2527
Symbol 2520 TextUses:440Used by:2527
Symbol 2521 TextUses:440Used by:2527
Symbol 2522 TextUses:440Used by:2527
Symbol 2523 TextUses:440Used by:2527
Symbol 2524 TextUses:440Used by:2527
Symbol 2525 TextUses:440Used by:2527
Symbol 2526 TextUses:2468Used by:2527
Symbol 2527 MovieClip {badge_Blowdryspecialist}Uses:2513 2514 2515 2516 2517 2518 2519 2520 2521 2522 2523 2524 2525 2526Used by:2663  Timeline
Symbol 2528 TextUses:440Used by:2542
Symbol 2529 TextUses:2468Used by:2542
Symbol 2530 TextUses:440Used by:2542
Symbol 2531 TextUses:440Used by:2542
Symbol 2532 TextUses:440Used by:2542
Symbol 2533 TextUses:440Used by:2542
Symbol 2534 TextUses:440Used by:2542
Symbol 2535 TextUses:440Used by:2542
Symbol 2536 TextUses:440Used by:2542
Symbol 2537 TextUses:440Used by:2542
Symbol 2538 TextUses:440Used by:2542
Symbol 2539 TextUses:440Used by:2542
Symbol 2540 TextUses:440Used by:2542
Symbol 2541 TextUses:2468Used by:2542
Symbol 2542 MovieClip {badge_HairMousseMaster}Uses:2528 2529 2530 2531 2532 2533 2534 2535 2536 2537 2538 2539 2540 2541Used by:2663  Timeline
Symbol 2543 TextUses:440Used by:2557
Symbol 2544 TextUses:2468Used by:2557
Symbol 2545 TextUses:440Used by:2557
Symbol 2546 TextUses:440Used by:2557
Symbol 2547 TextUses:440Used by:2557
Symbol 2548 TextUses:440Used by:2557
Symbol 2549 TextUses:440Used by:2557
Symbol 2550 TextUses:440Used by:2557
Symbol 2551 TextUses:440Used by:2557
Symbol 2552 TextUses:440Used by:2557
Symbol 2553 TextUses:440Used by:2557
Symbol 2554 TextUses:440Used by:2557
Symbol 2555 TextUses:440Used by:2557
Symbol 2556 TextUses:2468Used by:2557
Symbol 2557 MovieClip {badge_Peanutbutterbuttercup}Uses:2543 2544 2545 2546 2547 2548 2549 2550 2551 2552 2553 2554 2555 2556Used by:2663  Timeline
Symbol 2558 TextUses:440Used by:2572
Symbol 2559 TextUses:2468Used by:2572
Symbol 2560 TextUses:440Used by:2572
Symbol 2561 TextUses:440Used by:2572
Symbol 2562 TextUses:440Used by:2572
Symbol 2563 TextUses:440Used by:2572
Symbol 2564 TextUses:440Used by:2572
Symbol 2565 TextUses:440Used by:2572
Symbol 2566 TextUses:440Used by:2572
Symbol 2567 TextUses:440Used by:2572
Symbol 2568 TextUses:440Used by:2572
Symbol 2569 TextUses:440Used by:2572
Symbol 2570 TextUses:440Used by:2572
Symbol 2571 TextUses:2468Used by:2572
Symbol 2572 MovieClip {badge_WallpaperWarrior}Uses:2558 2559 2560 2561 2562 2563 2564 2565 2566 2567 2568 2569 2570 2571Used by:2663  Timeline
Symbol 2573 TextUses:440Used by:2587
Symbol 2574 TextUses:2468Used by:2587
Symbol 2575 TextUses:440Used by:2587
Symbol 2576 TextUses:440Used by:2587
Symbol 2577 TextUses:440Used by:2587
Symbol 2578 TextUses:440Used by:2587
Symbol 2579 TextUses:440Used by:2587
Symbol 2580 TextUses:440Used by:2587
Symbol 2581 TextUses:440Used by:2587
Symbol 2582 TextUses:440Used by:2587
Symbol 2583 TextUses:440Used by:2587
Symbol 2584 TextUses:440Used by:2587
Symbol 2585 TextUses:440Used by:2587
Symbol 2586 TextUses:2468Used by:2587
Symbol 2587 MovieClip {badge_CraftyCurler}Uses:2573 2574 2575 2576 2577 2578 2579 2580 2581 2582 2583 2584 2585 2586Used by:2663  Timeline
Symbol 2588 TextUses:440Used by:2602
Symbol 2589 TextUses:2468Used by:2602
Symbol 2590 TextUses:440Used by:2602
Symbol 2591 TextUses:440Used by:2602
Symbol 2592 TextUses:440Used by:2602
Symbol 2593 TextUses:440Used by:2602
Symbol 2594 TextUses:440Used by:2602
Symbol 2595 TextUses:440Used by:2602
Symbol 2596 TextUses:440Used by:2602
Symbol 2597 TextUses:440Used by:2602
Symbol 2598 TextUses:440Used by:2602
Symbol 2599 TextUses:440Used by:2602
Symbol 2600 TextUses:440Used by:2602
Symbol 2601 TextUses:2468Used by:2602
Symbol 2602 MovieClip {badge_AllergicReaction}Uses:2588 2589 2590 2591 2592 2593 2594 2595 2596 2597 2598 2599 2600 2601Used by:2663  Timeline
Symbol 2603 TextUses:440Used by:2617
Symbol 2604 TextUses:2468Used by:2617
Symbol 2605 TextUses:440Used by:2617
Symbol 2606 TextUses:440Used by:2617
Symbol 2607 TextUses:440Used by:2617
Symbol 2608 TextUses:440Used by:2617
Symbol 2609 TextUses:440Used by:2617
Symbol 2610 TextUses:440Used by:2617
Symbol 2611 TextUses:440Used by:2617
Symbol 2612 TextUses:440Used by:2617
Symbol 2613 TextUses:440Used by:2617
Symbol 2614 TextUses:440Used by:2617
Symbol 2615 TextUses:440Used by:2617
Symbol 2616 TextUses:2468Used by:2617
Symbol 2617 MovieClip {badge_Unlawfularrest}Uses:2603 2604 2605 2606 2607 2608 2609 2610 2611 2612 2613 2614 2615 2616Used by:2663  Timeline
Symbol 2618 TextUses:440Used by:2632
Symbol 2619 TextUses:2468Used by:2632
Symbol 2620 TextUses:440Used by:2632
Symbol 2621 TextUses:440Used by:2632
Symbol 2622 TextUses:440Used by:2632
Symbol 2623 TextUses:440Used by:2632
Symbol 2624 TextUses:440Used by:2632
Symbol 2625 TextUses:440Used by:2632
Symbol 2626 TextUses:440Used by:2632
Symbol 2627 TextUses:440Used by:2632
Symbol 2628 TextUses:440Used by:2632
Symbol 2629 TextUses:440Used by:2632
Symbol 2630 TextUses:440Used by:2632
Symbol 2631 TextUses:2468Used by:2632
Symbol 2632 MovieClip {badge_Eggtacy}Uses:2618 2619 2620 2621 2622 2623 2624 2625 2626 2627 2628 2629 2630 2631Used by:2663  Timeline
Symbol 2633 TextUses:440Used by:2646
Symbol 2634 TextUses:2468Used by:2646
Symbol 2635 TextUses:440Used by:2646
Symbol 2636 TextUses:440Used by:2646
Symbol 2637 TextUses:440Used by:2646
Symbol 2638 TextUses:440Used by:2646
Symbol 2639 TextUses:440Used by:2646
Symbol 2640 TextUses:440Used by:2646
Symbol 2641 TextUses:440Used by:2646
Symbol 2642 TextUses:440Used by:2646
Symbol 2643 TextUses:440Used by:2646
Symbol 2644 TextUses:440Used by:2646
Symbol 2645 TextUses:2468Used by:2646
Symbol 2646 MovieClip {badge_ToxinsRus}Uses:2633 2634 2635 2636 2637 2638 2639 2640 2641 2642 2643 2644 2645Used by:2663  Timeline
Symbol 2647 TextUses:440Used by:2662
Symbol 2648 TextUses:2468Used by:2662
Symbol 2649 TextUses:440Used by:2662
Symbol 2650 TextUses:440Used by:2662
Symbol 2651 TextUses:440Used by:2662
Symbol 2652 TextUses:440Used by:2662
Symbol 2653 TextUses:440Used by:2662
Symbol 2654 TextUses:440Used by:2662
Symbol 2655 TextUses:440Used by:2662
Symbol 2656 TextUses:440Used by:2662
Symbol 2657 TextUses:440Used by:2662
Symbol 2658 TextUses:440Used by:2662
Symbol 2659 TextUses:440Used by:2662
Symbol 2660 TextUses:440Used by:2662
Symbol 2661 TextUses:2468Used by:2662
Symbol 2662 MovieClip {badge_Hypnotizinghairstylist}Uses:2647 2648 2649 2650 2651 2652 2653 2654 2655 2656 2657 2658 2659 2660 2661Used by:2663  Timeline
Symbol 2663 MovieClipUses:2482 2497 2512 2527 2542 2557 2572 2587 2602 2617 2632 2646 2662Used by:2664
Symbol 2664 MovieClip {Badge}Uses:2424 2466 2663Used by:2873  Timeline
Symbol 2665 GraphicUsed by:2670
Symbol 2666 GraphicUsed by:2667
Symbol 2667 MovieClipUses:2666 455 394Used by:2670
Symbol 2668 GraphicUsed by:2669
Symbol 2669 ButtonUses:2668Used by:2670
Symbol 2670 MovieClip {ProtectionMC}Uses:2665 2667 2669 423Used by:Timeline
Symbol 2671 GraphicUsed by:2672
Symbol 2672 MovieClipUses:2671Used by:2735 3250
Symbol 2673 GraphicUsed by:2674
Symbol 2674 MovieClipUses:2673Used by:2696 2735 3250 3591 3643
Symbol 2675 GraphicUsed by:2696 3643
Symbol 2676 GraphicUsed by:2677
Symbol 2677 MovieClipUses:2676Used by:2696 3643
Symbol 2678 GraphicUsed by:2696
Symbol 2679 GraphicUsed by:2696 3643
Symbol 2680 GraphicUsed by:2681
Symbol 2681 MovieClipUses:2680 557Used by:2696 3643
Symbol 2682 GraphicUsed by:2696
Symbol 2683 GraphicUsed by:2696
Symbol 2684 GraphicUsed by:2696
Symbol 2685 GraphicUsed by:2696
Symbol 2686 GraphicUsed by:2696
Symbol 2687 GraphicUsed by:2696
Symbol 2688 GraphicUsed by:2696
Symbol 2689 GraphicUsed by:2696
Symbol 2690 GraphicUsed by:2696
Symbol 2691 GraphicUsed by:2696
Symbol 2692 GraphicUsed by:2696
Symbol 2693 GraphicUsed by:2696
Symbol 2694 GraphicUsed by:2696
Symbol 2695 GraphicUsed by:2696
Symbol 2696 MovieClip {_choose_相片}Uses:2674 2675 6 2677 2678 2679 2681 2682 2683 2684 2685 1606 2686 2687 2688 2689 2690 2691 2692 2693 2694 2695Used by:2735 3250 3591  Timeline
Symbol 2697 EditableTextUses:440Used by:2735
Symbol 2698 TextUses:440Used by:2712
Symbol 2699 TextUses:442Used by:2712
Symbol 2700 TextUses:440Used by:2712
Symbol 2701 TextUses:440Used by:2712
Symbol 2702 TextUses:440Used by:2712
Symbol 2703 TextUses:440Used by:2712
Symbol 2704 TextUses:440Used by:2712
Symbol 2705 TextUses:440Used by:2712
Symbol 2706 TextUses:440Used by:2712
Symbol 2707 TextUses:440Used by:2712
Symbol 2708 TextUses:440Used by:2712
Symbol 2709 TextUses:440Used by:2712
Symbol 2710 TextUses:440Used by:2712
Symbol 2711 TextUses:442Used by:2712
Symbol 2712 MovieClip {MyHairManiatt}Uses:2698 2699 2700 2701 2702 2703 2704 2705 2706 2707 2708 2709 2710 2711Used by:2735 3250  Timeline
Symbol 2713 GraphicUsed by:2715
Symbol 2714 GraphicUsed by:2715
Symbol 2715 MovieClip {hair_mania_0827_fla.box0_574}Uses:2713 2714Used by:2735 3250
Symbol 2716 MovieClipUses:6Used by:2735 3250
Symbol 2717 EditableTextUses:156Used by:2735
Symbol 2718 EditableTextUses:440Used by:2735
Symbol 2719 TextUses:440Used by:2733
Symbol 2720 TextUses:442Used by:2733
Symbol 2721 TextUses:440Used by:2733
Symbol 2722 TextUses:440Used by:2733
Symbol 2723 TextUses:440Used by:2733
Symbol 2724 TextUses:440Used by:2733
Symbol 2725 TextUses:440Used by:2733
Symbol 2726 TextUses:440Used by:2733
Symbol 2727 TextUses:440Used by:2733
Symbol 2728 TextUses:440Used by:2733
Symbol 2729 TextUses:440Used by:2733
Symbol 2730 TextUses:440Used by:2733
Symbol 2731 TextUses:440Used by:2733
Symbol 2732 TextUses:442Used by:2733
Symbol 2733 MovieClip {startgame}Uses:2719 2720 2721 2722 2723 2724 2725 2726 2727 2728 2729 2730 2731 2732Used by:2734 3532  Timeline
Symbol 2734 MovieClip {按钮_startgame}Uses:896 2733Used by:2735 2761 3509
Symbol 2735 MovieClip {lib.MailShow}Uses:10 836 2672 2674 423 2696 2697 2712 2715 2716 2717 2718 2734 1045Used by:Timeline
Symbol 2736 GraphicUsed by:2761
Symbol 2737 GraphicUsed by:2752
Symbol 2738 GraphicUsed by:2739
Symbol 2739 MovieClipUses:2738Used by:2752
Symbol 2740 GraphicUsed by:2741
Symbol 2741 MovieClipUses:2740Used by:2752
Symbol 2742 GraphicUsed by:2752
Symbol 2743 GraphicUsed by:2752
Symbol 2744 GraphicUsed by:2752
Symbol 2745 GraphicUsed by:2752
Symbol 2746 GraphicUsed by:2752
Symbol 2747 GraphicUsed by:2752
Symbol 2748 GraphicUsed by:2752
Symbol 2749 GraphicUsed by:2752
Symbol 2750 GraphicUsed by:2752
Symbol 2751 GraphicUsed by:2752
Symbol 2752 MovieClipUses:2737 2739 2741 2742 2743 2744 2745 2746 2747 2748 2749 2750 2751Used by:2761 3509
Symbol 2753 MovieClip {hair_mania_0827_fla.Timeline_582}Uses:1152Used by:2761
Symbol 2754 GraphicUsed by:2756
Symbol 2755 GraphicUsed by:2756
Symbol 2756 MovieClipUses:2754 409 2755Used by:2761
Symbol 2757 EditableTextUses:440Used by:2761
Symbol 2758 GraphicUsed by:2759
Symbol 2759 MovieClipUses:2758Used by:2760
Symbol 2760 MovieClipUses:2759Used by:2761 2873
Symbol 2761 MovieClip {lib.Story}Uses:2736 834 2752 2753 2756 2734 2757 2760Used by:Timeline
Symbol 2762 GraphicUsed by:2797 2849
Symbol 2763 GraphicUsed by:2764 2873 3250
Symbol 2764 MovieClipUses:2763Used by:2797 2849 3007 3187 3427 3682
Symbol 2765 MovieClip {按钮_howtoplay}Uses:896 910Used by:2797 3509
Symbol 2766 TextUses:440Used by:2780
Symbol 2767 TextUses:442Used by:2780
Symbol 2768 TextUses:440Used by:2780
Symbol 2769 TextUses:440Used by:2780
Symbol 2770 TextUses:440Used by:2780
Symbol 2771 TextUses:440Used by:2780
Symbol 2772 TextUses:440Used by:2780
Symbol 2773 TextUses:440Used by:2780
Symbol 2774 TextUses:440Used by:2780
Symbol 2775 TextUses:440Used by:2780
Symbol 2776 TextUses:440Used by:2780
Symbol 2777 TextUses:440Used by:2780
Symbol 2778 TextUses:440Used by:2780
Symbol 2779 TextUses:442Used by:2780
Symbol 2780 MovieClip {BACK}Uses:2766 2767 2768 2769 2770 2771 2772 2773 2774 2775 2776 2777 2778 2779Used by:2781  Timeline
Symbol 2781 MovieClip {按钮_back}Uses:896 2780Used by:2797 3509 3591
Symbol 2782 TextUses:148Used by:2796
Symbol 2783 TextUses:2295Used by:2796
Symbol 2784 TextUses:148Used by:2796
Symbol 2785 TextUses:148Used by:2796
Symbol 2786 TextUses:148Used by:2796
Symbol 2787 TextUses:148Used by:2796
Symbol 2788 TextUses:148Used by:2796
Symbol 2789 TextUses:148Used by:2796
Symbol 2790 TextUses:148Used by:2796
Symbol 2791 TextUses:148Used by:2796
Symbol 2792 TextUses:148Used by:2796
Symbol 2793 TextUses:148Used by:2796
Symbol 2794 TextUses:148Used by:2796
Symbol 2795 TextUses:2295Used by:2796
Symbol 2796 MovieClip {PAUSE}Uses:2782 2783 2784 2785 2786 2787 2788 2789 2790 2791 2792 2793 2794 2795Used by:2797  Timeline
Symbol 2797 MovieClip {lib.Pause}Uses:2762 2764 836 2416 2765 2781 423 2796 1045Used by:Timeline
Symbol 2798 EditableTextUses:440Used by:2849
Symbol 2799 TextUses:440Used by:2813
Symbol 2800 TextUses:442Used by:2813
Symbol 2801 TextUses:440Used by:2813
Symbol 2802 TextUses:440Used by:2813
Symbol 2803 TextUses:440Used by:2813
Symbol 2804 TextUses:440Used by:2813
Symbol 2805 TextUses:440Used by:2813
Symbol 2806 TextUses:440Used by:2813
Symbol 2807 TextUses:440Used by:2813
Symbol 2808 TextUses:440Used by:2813
Symbol 2809 TextUses:440Used by:2813
Symbol 2810 TextUses:440Used by:2813
Symbol 2811 TextUses:440Used by:2813
Symbol 2812 TextUses:442Used by:2813
Symbol 2813 MovieClip {Thehairtargetisset}Uses:2799 2800 2801 2802 2803 2804 2805 2806 2807 2808 2809 2810 2811 2812Used by:2849  Timeline
Symbol 2814 TextUses:440Used by:2829
Symbol 2815 TextUses:442Used by:2829
Symbol 2816 TextUses:440Used by:2829
Symbol 2817 TextUses:440Used by:2829
Symbol 2818 TextUses:440Used by:2829
Symbol 2819 TextUses:440Used by:2829
Symbol 2820 TextUses:440Used by:2829
Symbol 2821 TextUses:440Used by:2829
Symbol 2822 TextUses:440Used by:2829
Symbol 2823 TextUses:440Used by:2829
Symbol 2824 TextUses:440Used by:2829
Symbol 2825 TextUses:440Used by:2829
Symbol 2826 TextUses:440Used by:2829
Symbol 2827 TextUses:440Used by:2829
Symbol 2828 TextUses:442Used by:2829
Symbol 2829 MovieClip {TheToolstargetforthislevelis}Uses:2814 2815 2816 2817 2818 2819 2820 2821 2822 2823 2824 2825 2826 2827 2828Used by:2849  Timeline
Symbol 2830 TextUses:440Used by:2833
Symbol 2831 TextUses:440Used by:2833
Symbol 2832 TextUses:440Used by:2833
Symbol 2833 MovieClipUses:2830 2831 2832Used by:2849
Symbol 2834 TextUses:440Used by:2848
Symbol 2835 TextUses:442Used by:2848
Symbol 2836 TextUses:440Used by:2848
Symbol 2837 TextUses:440Used by:2848
Symbol 2838 TextUses:440Used by:2848
Symbol 2839 TextUses:440Used by:2848
Symbol 2840 TextUses:440Used by:2848
Symbol 2841 TextUses:440Used by:2848
Symbol 2842 TextUses:440Used by:2848
Symbol 2843 TextUses:440Used by:2848
Symbol 2844 TextUses:440Used by:2848
Symbol 2845 TextUses:440Used by:2848
Symbol 2846 TextUses:440Used by:2848
Symbol 2847 TextUses:442Used by:2848
Symbol 2848 MovieClip {GOMAKEIRtt}Uses:2834 2835 2836 2837 2838 2839 2840 2841 2842 2843 2844 2845 2846 2847Used by:2849  Timeline
Symbol 2849 MovieClip {lib.LevelInfo}Uses:2762 2764 2798 2813 2829 2833 2848Used by:Timeline
Symbol 2850 BitmapUsed by:2851
Symbol 2851 GraphicUses:2850Used by:2852
Symbol 2852 MovieClipUses:2851Used by:3007
Symbol 2853 TextUses:148Used by:2867
Symbol 2854 TextUses:2295Used by:2867
Symbol 2855 TextUses:148Used by:2867
Symbol 2856 TextUses:148Used by:2867
Symbol 2857 TextUses:148Used by:2867
Symbol 2858 TextUses:148Used by:2867
Symbol 2859 TextUses:148Used by:2867
Symbol 2860 TextUses:148Used by:2867
Symbol 2861 TextUses:148Used by:2867
Symbol 2862 TextUses:148Used by:2867
Symbol 2863 TextUses:148Used by:2867
Symbol 2864 TextUses:148Used by:2867
Symbol 2865 TextUses:148Used by:2867
Symbol 2866 TextUses:2295Used by:2867
Symbol 2867 MovieClip {GAMECOMPLETEtt}Uses:2853 2854 2855 2856 2857 2858 2859 2860 2861 2862 2863 2864 2865 2866Used by:3007  Timeline
Symbol 2868 FontUsed by:2869 3856
Symbol 2869 EditableTextUses:2868Used by:2873
Symbol 2870 GraphicUsed by:2871
Symbol 2871 MovieClipUses:2870Used by:2872
Symbol 2872 MovieClipUses:2871Used by:2873
Symbol 2873 MovieClip {lib.showBadgeunlock}Uses:2869 2763 2664 2872 2760Used by:3007 3427  Timeline
Symbol 2874 GraphicUsed by:2875
Symbol 2875 MovieClipUses:2874 409Used by:3006 3133 3426
Symbol 2876 TextUses:440Used by:2889
Symbol 2877 TextUses:442Used by:2889
Symbol 2878 TextUses:440Used by:2889
Symbol 2879 TextUses:440Used by:2889
Symbol 2880 TextUses:440Used by:2889
Symbol 2881 TextUses:440Used by:2889
Symbol 2882 TextUses:440Used by:2889
Symbol 2883 TextUses:440Used by:2889
Symbol 2884 TextUses:440Used by:2889
Symbol 2885 TextUses:440Used by:2889
Symbol 2886 TextUses:440Used by:2889
Symbol 2887 TextUses:440Used by:2889
Symbol 2888 TextUses:442Used by:2889
Symbol 2889 MovieClip {SUBMITSCORE}Uses:2876 2877 2878 2879 2880 2881 2882 2883 2884 2885 2886 2887 2888Used by:2890  Timeline
Symbol 2890 MovieClip {按钮_subscore}Uses:896 2889Used by:3006 3133
Symbol 2891 TextUses:440Used by:2905
Symbol 2892 TextUses:442Used by:2905
Symbol 2893 TextUses:440Used by:2905
Symbol 2894 TextUses:440Used by:2905
Symbol 2895 TextUses:440Used by:2905
Symbol 2896 TextUses:440Used by:2905
Symbol 2897 TextUses:440Used by:2905
Symbol 2898 TextUses:440Used by:2905
Symbol 2899 TextUses:440Used by:2905
Symbol 2900 TextUses:440Used by:2905
Symbol 2901 TextUses:440Used by:2905
Symbol 2902 TextUses:440Used by:2905
Symbol 2903 TextUses:440Used by:2905
Symbol 2904 TextUses:442Used by:2905
Symbol 2905 MovieClip {wallofhair}Uses:2891 2892 2893 2894 2895 2896 2897 2898 2899 2900 2901 2902 2903 2904Used by:2906 3639  Timeline
Symbol 2906 MovieClip {按钮_wallofhair}Uses:896 2905Used by:3006 3509
Symbol 2907 TextUses:440Used by:2922
Symbol 2908 TextUses:442Used by:2922
Symbol 2909 TextUses:440Used by:2922
Symbol 2910 TextUses:440Used by:2922
Symbol 2911 TextUses:440Used by:2922
Symbol 2912 TextUses:440Used by:2922
Symbol 2913 TextUses:440Used by:2922
Symbol 2914 TextUses:440Used by:2922
Symbol 2915 TextUses:440Used by:2922
Symbol 2916 TextUses:440Used by:2922
Symbol 2917 TextUses:440Used by:2922
Symbol 2918 TextUses:440Used by:2922
Symbol 2919 TextUses:440Used by:2922
Symbol 2920 TextUses:440Used by:2922
Symbol 2921 TextUses:442Used by:2922
Symbol 2922 MovieClip {sendtofriend}Uses:2907 2908 2909 2910 2911 2912 2913 2914 2915 2916 2917 2918 2919 2920 2921Used by:2923  Timeline
Symbol 2923 MovieClip {按钮SENDTOFRIEND}Uses:896 2922Used by:3006 3426 3640
Symbol 2924 TextUses:440Used by:2937
Symbol 2925 TextUses:442Used by:2937
Symbol 2926 TextUses:440Used by:2937
Symbol 2927 TextUses:440Used by:2937
Symbol 2928 TextUses:440Used by:2937
Symbol 2929 TextUses:440Used by:2937
Symbol 2930 TextUses:440Used by:2937
Symbol 2931 TextUses:440Used by:2937
Symbol 2932 TextUses:440Used by:2937
Symbol 2933 TextUses:440Used by:2937
Symbol 2934 TextUses:440Used by:2937
Symbol 2935 TextUses:440Used by:2937
Symbol 2936 TextUses:442Used by:2937
Symbol 2937 MovieClip {GAMECOMPLETEttt}Uses:2924 2925 2926 2927 2928 2929 2930 2931 2932 2933 2934 2935 2936Used by:3006  Timeline
Symbol 2938 TextUses:440Used by:2952
Symbol 2939 TextUses:442Used by:2952
Symbol 2940 TextUses:440Used by:2952
Symbol 2941 TextUses:440Used by:2952
Symbol 2942 TextUses:440Used by:2952
Symbol 2943 TextUses:440Used by:2952
Symbol 2944 TextUses:440Used by:2952
Symbol 2945 TextUses:440Used by:2952
Symbol 2946 TextUses:440Used by:2952
Symbol 2947 TextUses:440Used by:2952
Symbol 2948 TextUses:440Used by:2952
Symbol 2949 TextUses:440Used by:2952
Symbol 2950 TextUses:440Used by:2952
Symbol 2951 TextUses:442Used by:2952
Symbol 2952 MovieClip {TRYAGAIN}Uses:2938 2939 2940 2941 2942 2943 2944 2945 2946 2947 2948 2949 2950 2951Used by:2953  Timeline
Symbol 2953 MovieClip {按钮_tryagain}Uses:896 2952Used by:3006 3133
Symbol 2954 TextUses:440Used by:2969
Symbol 2955 TextUses:442Used by:2969
Symbol 2956 TextUses:440Used by:2969
Symbol 2957 TextUses:440Used by:2969
Symbol 2958 TextUses:440Used by:2969
Symbol 2959 TextUses:440Used by:2969
Symbol 2960 TextUses:440Used by:2969
Symbol 2961 TextUses:440Used by:2969
Symbol 2962 TextUses:440Used by:2969
Symbol 2963 TextUses:440Used by:2969
Symbol 2964 TextUses:440Used by:2969
Symbol 2965 TextUses:440Used by:2969
Symbol 2966 TextUses:440Used by:2969
Symbol 2967 TextUses:440Used by:2969
Symbol 2968 TextUses:442Used by:2969
Symbol 2969 MovieClip {YAYwelldontt}Uses:2954 2955 2956 2957 2958 2959 2960 2961 2962 2963 2964 2965 2966 2967 2968Used by:3006  Timeline
Symbol 2970 TextUses:440Used by:2984
Symbol 2971 TextUses:442Used by:2984
Symbol 2972 TextUses:440Used by:2984
Symbol 2973 TextUses:440Used by:2984
Symbol 2974 TextUses:440Used by:2984
Symbol 2975 TextUses:440Used by:2984
Symbol 2976 TextUses:440Used by:2984
Symbol 2977 TextUses:440Used by:2984
Symbol 2978 TextUses:440Used by:2984
Symbol 2979 TextUses:440Used by:2984
Symbol 2980 TextUses:440Used by:2984
Symbol 2981 TextUses:440Used by:2984
Symbol 2982 TextUses:440Used by:2984
Symbol 2983 TextUses:442Used by:2984
Symbol 2984 MovieClip {FINALSCOREtt}Uses:2970 2971 2972 2973 2974 2975 2976 2977 2978 2979 2980 2981 2982 2983Used by:3006  Timeline
Symbol 2985 GraphicUsed by:3006
Symbol 2986 EditableTextUses:148Used by:3006
Symbol 2987 EditableTextUses:2295Used by:3006
Symbol 2988 TextUses:440Used by:3002
Symbol 2989 TextUses:442Used by:3002
Symbol 2990 TextUses:440Used by:3002
Symbol 2991 TextUses:440Used by:3002
Symbol 2992 TextUses:440Used by:3002
Symbol 2993 TextUses:440Used by:3002
Symbol 2994 TextUses:440Used by:3002
Symbol 2995 TextUses:440Used by:3002
Symbol 2996 TextUses:440Used by:3002
Symbol 2997 TextUses:440Used by:3002
Symbol 2998 TextUses:440Used by:3002
Symbol 2999 TextUses:440Used by:3002
Symbol 3000 TextUses:440Used by:3002
Symbol 3001 TextUses:442Used by:3002
Symbol 3002 MovieClip {YOURNAME}Uses:2988 2989 2990 2991 2992 2993 2994 2995 2996 2997 2998 2999 3000 3001Used by:3006 3133  Timeline
Symbol 3003 GraphicUsed by:3005
Symbol 3004 GraphicUsed by:3005
Symbol 3005 MovieClip {hair_mania_0827_fla._err_tishi_617}Uses:3003 3004Used by:3006 3133
Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603}Uses:2875 896 1045 2890 2906 2923 2937 2953 2969 2984 2985 2986 2987 3002 3005Used by:3007
Symbol 3007 MovieClip {lib.LevelCompleteEnd}Uses:10 2764 2852 2867 2873 3006 2400 1152Used by:Timeline
Symbol 3008 TextUses:440Used by:3022
Symbol 3009 TextUses:442Used by:3022
Symbol 3010 TextUses:440Used by:3022
Symbol 3011 TextUses:440Used by:3022
Symbol 3012 TextUses:440Used by:3022
Symbol 3013 TextUses:440Used by:3022
Symbol 3014 TextUses:440Used by:3022
Symbol 3015 TextUses:440Used by:3022
Symbol 3016 TextUses:440Used by:3022
Symbol 3017 TextUses:440Used by:3022
Symbol 3018 TextUses:440Used by:3022
Symbol 3019 TextUses:440Used by:3022
Symbol 3020 TextUses:440Used by:3022
Symbol 3021 TextUses:442Used by:3022
Symbol 3022 MovieClip {LEVELFAILED}Uses:3008 3009 3010 3011 3012 3013 3014 3015 3016 3017 3018 3019 3020 3021Used by:3133  Timeline
Symbol 3023 GraphicUsed by:3133
Symbol 3024 EditableTextUses:156Used by:3133
Symbol 3025 EditableTextUses:148Used by:3133
Symbol 3026 TextUses:440Used by:3040
Symbol 3027 TextUses:442Used by:3040
Symbol 3028 TextUses:440Used by:3040
Symbol 3029 TextUses:440Used by:3040
Symbol 3030 TextUses:440Used by:3040
Symbol 3031 TextUses:440Used by:3040
Symbol 3032 TextUses:440Used by:3040
Symbol 3033 TextUses:440Used by:3040
Symbol 3034 TextUses:440Used by:3040
Symbol 3035 TextUses:440Used by:3040
Symbol 3036 TextUses:440Used by:3040
Symbol 3037 TextUses:440Used by:3040
Symbol 3038 TextUses:440Used by:3040
Symbol 3039 TextUses:442Used by:3040
Symbol 3040 MovieClip {GAMEOVERYOULOSE}Uses:3026 3027 3028 3029 3030 3031 3032 3033 3034 3035 3036 3037 3038 3039Used by:3133  Timeline
Symbol 3041 TextUses:440Used by:3055
Symbol 3042 TextUses:442Used by:3055
Symbol 3043 TextUses:440Used by:3055
Symbol 3044 TextUses:440Used by:3055
Symbol 3045 TextUses:440Used by:3055
Symbol 3046 TextUses:440Used by:3055
Symbol 3047 TextUses:440Used by:3055
Symbol 3048 TextUses:440Used by:3055
Symbol 3049 TextUses:440Used by:3055
Symbol 3050 TextUses:440Used by:3055
Symbol 3051 TextUses:440Used by:3055
Symbol 3052 TextUses:440Used by:3055
Symbol 3053 TextUses:440Used by:3055
Symbol 3054 TextUses:442Used by:3055
Symbol 3055 MovieClip {Maybeyouneedtoreadtheinstr}Uses:3041 3042 3043 3044 3045 3046 3047 3048 3049 3050 3051 3052 3053 3054Used by:3117
Symbol 3056 TextUses:440Used by:3071
Symbol 3057 TextUses:442Used by:3071
Symbol 3058 TextUses:440Used by:3071
Symbol 3059 TextUses:440Used by:3071
Symbol 3060 TextUses:440Used by:3071
Symbol 3061 TextUses:440Used by:3071
Symbol 3062 TextUses:440Used by:3071
Symbol 3063 TextUses:440Used by:3071
Symbol 3064 TextUses:440Used by:3071
Symbol 3065 TextUses:440Used by:3071
Symbol 3066 TextUses:440Used by:3071
Symbol 3067 TextUses:440Used by:3071
Symbol 3068 TextUses:440Used by:3071
Symbol 3069 TextUses:440Used by:3071
Symbol 3070 TextUses:442Used by:3071
Symbol 3071 MovieClip {IaskedforaGreatD}Uses:3056 3057 3058 3059 3060 3061 3062 3063 3064 3065 3066 3067 3068 3069 3070Used by:3117
Symbol 3072 TextUses:440Used by:3086
Symbol 3073 TextUses:442Used by:3086
Symbol 3074 TextUses:440Used by:3086
Symbol 3075 TextUses:440Used by:3086
Symbol 3076 TextUses:440Used by:3086
Symbol 3077 TextUses:440Used by:3086
Symbol 3078 TextUses:440Used by:3086
Symbol 3079 TextUses:440Used by:3086
Symbol 3080 TextUses:440Used by:3086
Symbol 3081 TextUses:440Used by:3086
Symbol 3082 TextUses:440Used by:3086
Symbol 3083 TextUses:440Used by:3086
Symbol 3084 TextUses:440Used by:3086
Symbol 3085 TextUses:442Used by:3086
Symbol 3086 MovieClip {HAHA}Uses:3072 3073 3074 3075 3076 3077 3078 3079 3080 3081 3082 3083 3084 3085Used by:3117
Symbol 3087 TextUses:440Used by:3101
Symbol 3088 TextUses:442Used by:3101
Symbol 3089 TextUses:440Used by:3101
Symbol 3090 TextUses:440Used by:3101
Symbol 3091 TextUses:440Used by:3101
Symbol 3092 TextUses:440Used by:3101
Symbol 3093 TextUses:440Used by:3101
Symbol 3094 TextUses:440Used by:3101
Symbol 3095 TextUses:440Used by:3101
Symbol 3096 TextUses:440Used by:3101
Symbol 3097 TextUses:440Used by:3101
Symbol 3098 TextUses:440Used by:3101
Symbol 3099 TextUses:440Used by:3101
Symbol 3100 TextUses:442Used by:3101
Symbol 3101 MovieClip {Doyouknowthe}Uses:3087 3088 3089 3090 3091 3092 3093 3094 3095 3096 3097 3098 3099 3100Used by:3117
Symbol 3102 TextUses:440Used by:3116
Symbol 3103 TextUses:442Used by:3116
Symbol 3104 TextUses:440Used by:3116
Symbol 3105 TextUses:440Used by:3116
Symbol 3106 TextUses:440Used by:3116
Symbol 3107 TextUses:440Used by:3116
Symbol 3108 TextUses:440Used by:3116
Symbol 3109 TextUses:440Used by:3116
Symbol 3110 TextUses:440Used by:3116
Symbol 3111 TextUses:440Used by:3116
Symbol 3112 TextUses:440Used by:3116
Symbol 3113 TextUses:440Used by:3116
Symbol 3114 TextUses:440Used by:3116
Symbol 3115 TextUses:442Used by:3116
Symbol 3116 MovieClip {Isyourmousedisconnecte}Uses:3102 3103 3104 3105 3106 3107 3108 3109 3110 3111 3112 3113 3114 3115Used by:3117
Symbol 3117 MovieClip {hair_mania_0827_fla.Timeline_622}Uses:3055 3071 3086 3101 3116Used by:3133  Timeline
Symbol 3118 TextUses:440Used by:3132
Symbol 3119 TextUses:442Used by:3132
Symbol 3120 TextUses:440Used by:3132
Symbol 3121 TextUses:440Used by:3132
Symbol 3122 TextUses:440Used by:3132
Symbol 3123 TextUses:440Used by:3132
Symbol 3124 TextUses:440Used by:3132
Symbol 3125 TextUses:440Used by:3132
Symbol 3126 TextUses:440Used by:3132
Symbol 3127 TextUses:440Used by:3132
Symbol 3128 TextUses:440Used by:3132
Symbol 3129 TextUses:440Used by:3132
Symbol 3130 TextUses:440Used by:3132
Symbol 3131 TextUses:442Used by:3132
Symbol 3132 MovieClip {FINALSCORE}Uses:3118 3119 3120 3121 3122 3123 3124 3125 3126 3127 3128 3129 3130 3131Used by:3133  Timeline
Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619}Uses:2875 896 2416 1045 2953 2890 3022 3023 3024 3025 3040 3117 3132 3002 3005Used by:3187
Symbol 3134 GraphicUsed by:3174
Symbol 3135 GraphicUsed by:3174
Symbol 3136 GraphicUsed by:3174
Symbol 3137 ShapeTweeningUsed by:3174
Symbol 3138 GraphicUsed by:3174
Symbol 3139 GraphicUsed by:3174
Symbol 3140 GraphicUsed by:3174
Symbol 3141 ShapeTweeningUsed by:3174
Symbol 3142 GraphicUsed by:3174
Symbol 3143 GraphicUsed by:3174
Symbol 3144 GraphicUsed by:3174
Symbol 3145 GraphicUsed by:3174
Symbol 3146 GraphicUsed by:3174
Symbol 3147 ShapeTweeningUsed by:3174
Symbol 3148 ShapeTweeningUsed by:3174
Symbol 3149 ShapeTweeningUsed by:3174
Symbol 3150 ShapeTweeningUsed by:3174
Symbol 3151 GraphicUsed by:3174
Symbol 3152 GraphicUsed by:3174
Symbol 3153 GraphicUsed by:3174
Symbol 3154 ShapeTweeningUsed by:3174
Symbol 3155 GraphicUsed by:3174
Symbol 3156 GraphicUsed by:3174
Symbol 3157 GraphicUsed by:3174
Symbol 3158 GraphicUsed by:3174
Symbol 3159 GraphicUsed by:3174
Symbol 3160 GraphicUsed by:3174
Symbol 3161 GraphicUsed by:3174
Symbol 3162 ShapeTweeningUsed by:3174
Symbol 3163 GraphicUsed by:3174
Symbol 3164 GraphicUsed by:3174
Symbol 3165 GraphicUsed by:3174
Symbol 3166 GraphicUsed by:3174
Symbol 3167 GraphicUsed by:3174
Symbol 3168 GraphicUsed by:3174
Symbol 3169 GraphicUsed by:3174
Symbol 3170 ShapeTweeningUsed by:3174
Symbol 3171 GraphicUsed by:3174
Symbol 3172 ShapeTweeningUsed by:3174
Symbol 3173 ShapeTweeningUsed by:3174
Symbol 3174 MovieClipUses:3134 3135 3136 3137 3138 3139 3140 2164 2165 2364 2166 2167 2168 3141 2169 2170 2171 2172 3142 3143 2173 2174 3144 2175 2176 3145 2177 2178 3146 2179 2180 2181 2182 2183 2184 2185 3147 3148 2189 3149 2191 3150 3151 3152 3153 3154 3155 3156 3157 3158 3159 3160 3161 3162 3163 3164 3165 3166 3167 3168 3169 3170 3171 3172 3173Used by:3187
Symbol 3175 GraphicUsed by:3186
Symbol 3176 GraphicUsed by:3186
Symbol 3177 GraphicUsed by:3186
Symbol 3178 GraphicUsed by:3186
Symbol 3179 GraphicUsed by:3186
Symbol 3180 GraphicUsed by:3186
Symbol 3181 GraphicUsed by:3186
Symbol 3182 GraphicUsed by:3186
Symbol 3183 GraphicUsed by:3186
Symbol 3184 GraphicUsed by:3186
Symbol 3185 GraphicUsed by:3186
Symbol 3186 MovieClipUses:3175 3176 3177 3178 3179 319 3180 3181 3182 3183 3184 3185Used by:3187
Symbol 3187 MovieClip {lib.LevelFail}Uses:10 2764 3133 3174 3186Used by:Timeline
Symbol 3188 GraphicUsed by:3250
Symbol 3189 EditableTextUses:440Used by:3250
Symbol 3190 TextUses:440Used by:3199
Symbol 3191 TextUses:442Used by:3199
Symbol 3192 TextUses:440Used by:3199
Symbol 3193 TextUses:440Used by:3199
Symbol 3194 TextUses:440Used by:3199
Symbol 3195 TextUses:440Used by:3199
Symbol 3196 TextUses:440Used by:3199
Symbol 3197 TextUses:440Used by:3199
Symbol 3198 TextUses:442Used by:3199
Symbol 3199 MovieClip {_link}Uses:3190 3191 3192 3193 3194 3195 3196 3197 3198Used by:3250  Timeline
Symbol 3200 TextUses:440Used by:3214
Symbol 3201 TextUses:442Used by:3214
Symbol 3202 TextUses:440Used by:3214
Symbol 3203 TextUses:440Used by:3214
Symbol 3204 TextUses:440Used by:3214
Symbol 3205 TextUses:440Used by:3214
Symbol 3206 TextUses:440Used by:3214
Symbol 3207 TextUses:440Used by:3214
Symbol 3208 TextUses:440Used by:3214
Symbol 3209 TextUses:440Used by:3214
Symbol 3210 TextUses:440Used by:3214
Symbol 3211 TextUses:440Used by:3214
Symbol 3212 TextUses:440Used by:3214
Symbol 3213 TextUses:442Used by:3214
Symbol 3214 MovieClip {Pickapicture}Uses:3200 3201 3202 3203 3204 3205 3206 3207 3208 3209 3210 3211 3212 3213Used by:3250  Timeline
Symbol 3215 TextUses:440Used by:3230
Symbol 3216 TextUses:442Used by:3230
Symbol 3217 TextUses:440Used by:3230
Symbol 3218 TextUses:440Used by:3230
Symbol 3219 TextUses:440Used by:3230
Symbol 3220 TextUses:440Used by:3230
Symbol 3221 TextUses:440Used by:3230
Symbol 3222 TextUses:440Used by:3230
Symbol 3223 TextUses:440Used by:3230
Symbol 3224 TextUses:440Used by:3230
Symbol 3225 TextUses:440Used by:3230
Symbol 3226 TextUses:440Used by:3230
Symbol 3227 TextUses:440Used by:3230
Symbol 3228 TextUses:440Used by:3230
Symbol 3229 TextUses:442Used by:3230
Symbol 3230 MovieClip {Copythiscodebyclickingt}Uses:3215 3216 3217 3218 3219 3220 3221 3222 3223 3224 3225 3226 3227 3228 3229Used by:3250  Timeline
Symbol 3231 EditableTextUses:156Used by:3250
Symbol 3232 GraphicUsed by:3233
Symbol 3233 MovieClip {选择}Uses:3232Used by:3250  Timeline
Symbol 3234 EditableTextUses:440Used by:3250
Symbol 3235 TextUses:440Used by:3247
Symbol 3236 TextUses:442Used by:3247
Symbol 3237 TextUses:440Used by:3247
Symbol 3238 TextUses:440Used by:3247
Symbol 3239 TextUses:440Used by:3247
Symbol 3240 TextUses:440Used by:3247
Symbol 3241 TextUses:440Used by:3247
Symbol 3242 TextUses:440Used by:3247
Symbol 3243 TextUses:440Used by:3247
Symbol 3244 TextUses:440Used by:3247
Symbol 3245 TextUses:440Used by:3247
Symbol 3246 TextUses:442Used by:3247
Symbol 3247 MovieClip {copy}Uses:3235 3236 3237 3238 3239 3240 3241 3242 3243 3244 3245 3246Used by:3248  Timeline
Symbol 3248 MovieClip {按钮_copy}Uses:896 3247Used by:3250
Symbol 3249 EditableTextUses:156Used by:3250
Symbol 3250 MovieClip {lib.MailSend}Uses:2763 836 3188 2672 2674 423 2696 3189 3199 3214 2712 3230 2715 2716 1042 3231 3233 3234 3248 3249Used by:Timeline
Symbol 3251 TextUses:440Used by:3263
Symbol 3252 TextUses:442Used by:3263
Symbol 3253 TextUses:440Used by:3263
Symbol 3254 TextUses:440Used by:3263
Symbol 3255 TextUses:440Used by:3263
Symbol 3256 TextUses:440Used by:3263
Symbol 3257 TextUses:440Used by:3263
Symbol 3258 TextUses:440Used by:3263
Symbol 3259 TextUses:440Used by:3263
Symbol 3260 TextUses:440Used by:3263
Symbol 3261 TextUses:440Used by:3263
Symbol 3262 TextUses:442Used by:3263
Symbol 3263 MovieClip {CONTINUE}Uses:3251 3252 3253 3254 3255 3256 3257 3258 3259 3260 3261 3262Used by:3264  Timeline
Symbol 3264 MovieClip {按钮_continue}Uses:896 3263Used by:3426 3682
Symbol 3265 TextUses:440Used by:3279
Symbol 3266 TextUses:442Used by:3279
Symbol 3267 TextUses:440Used by:3279
Symbol 3268 TextUses:440Used by:3279
Symbol 3269 TextUses:440Used by:3279
Symbol 3270 TextUses:440Used by:3279
Symbol 3271 TextUses:440Used by:3279
Symbol 3272 TextUses:440Used by:3279
Symbol 3273 TextUses:440Used by:3279
Symbol 3274 TextUses:440Used by:3279
Symbol 3275 TextUses:440Used by:3279
Symbol 3276 TextUses:440Used by:3279
Symbol 3277 TextUses:440Used by:3279
Symbol 3278 TextUses:442Used by:3279
Symbol 3279 MovieClip {LEVELCOMPLETEt}Uses:3265 3266 3267 3268 3269 3270 3271 3272 3273 3274 3275 3276 3277 3278Used by:3426  Timeline
Symbol 3280 TextUses:440Used by:3294
Symbol 3281 TextUses:442Used by:3294
Symbol 3282 TextUses:440Used by:3294
Symbol 3283 TextUses:440Used by:3294
Symbol 3284 TextUses:440Used by:3294
Symbol 3285 TextUses:440Used by:3294
Symbol 3286 TextUses:440Used by:3294
Symbol 3287 TextUses:440Used by:3294
Symbol 3288 TextUses:440Used by:3294
Symbol 3289 TextUses:440Used by:3294
Symbol 3290 TextUses:440Used by:3294
Symbol 3291 TextUses:440Used by:3294
Symbol 3292 TextUses:440Used by:3294
Symbol 3293 TextUses:442Used by:3294
Symbol 3294 MovieClip {Thehairistakingover}Uses:3280 3281 3282 3283 3284 3285 3286 3287 3288 3289 3290 3291 3292 3293Used by:3295
Symbol 3295 MovieClipUses:3294Used by:3426  Timeline
Symbol 3296 TextUses:440Used by:3310
Symbol 3297 TextUses:442Used by:3310
Symbol 3298 TextUses:440Used by:3310
Symbol 3299 TextUses:440Used by:3310
Symbol 3300 TextUses:440Used by:3310
Symbol 3301 TextUses:440Used by:3310
Symbol 3302 TextUses:440Used by:3310
Symbol 3303 TextUses:440Used by:3310
Symbol 3304 TextUses:440Used by:3310
Symbol 3305 TextUses:440Used by:3310
Symbol 3306 TextUses:440Used by:3310
Symbol 3307 TextUses:440Used by:3310
Symbol 3308 TextUses:440Used by:3310
Symbol 3309 TextUses:442Used by:3310
Symbol 3310 MovieClip {wet}Uses:3296 3297 3298 3299 3300 3301 3302 3303 3304 3305 3306 3307 3308 3309Used by:3374
Symbol 3311 TextUses:2468Used by:3374
Symbol 3312 TextUses:440Used by:3326
Symbol 3313 TextUses:442Used by:3326
Symbol 3314 TextUses:440Used by:3326
Symbol 3315 TextUses:440Used by:3326
Symbol 3316 TextUses:440Used by:3326
Symbol 3317 TextUses:440Used by:3326
Symbol 3318 TextUses:440Used by:3326
Symbol 3319 TextUses:440Used by:3326
Symbol 3320 TextUses:440Used by:3326
Symbol 3321 TextUses:440Used by:3326
Symbol 3322 TextUses:440Used by:3326
Symbol 3323 TextUses:440Used by:3326
Symbol 3324 TextUses:440Used by:3326
Symbol 3325 TextUses:442Used by:3326
Symbol 3326 MovieClip {Yourstylingskillsarerigh}Uses:3312 3313 3314 3315 3316 3317 3318 3319 3320 3321 3322 3323 3324 3325Used by:3374
Symbol 3327 TextUses:440Used by:3341
Symbol 3328 TextUses:442Used by:3341
Symbol 3329 TextUses:440Used by:3341
Symbol 3330 TextUses:440Used by:3341
Symbol 3331 TextUses:440Used by:3341
Symbol 3332 TextUses:440Used by:3341
Symbol 3333 TextUses:440Used by:3341
Symbol 3334 TextUses:440Used by:3341
Symbol 3335 TextUses:440Used by:3341
Symbol 3336 TextUses:440Used by:3341
Symbol 3337 TextUses:440Used by:3341
Symbol 3338 TextUses:440Used by:3341
Symbol 3339 TextUses:440Used by:3341
Symbol 3340 TextUses:442Used by:3341
Symbol 3341 MovieClip {Yourcl}Uses:3327 3328 3329 3330 3331 3332 3333 3334 3335 3336 3337 3338 3339 3340Used by:3374
Symbol 3342 TextUses:440Used by:3357
Symbol 3343 TextUses:442Used by:3357
Symbol 3344 TextUses:440Used by:3357
Symbol 3345 TextUses:440Used by:3357
Symbol 3346 TextUses:440Used by:3357
Symbol 3347 TextUses:440Used by:3357
Symbol 3348 TextUses:440Used by:3357
Symbol 3349 TextUses:440Used by:3357
Symbol 3350 TextUses:440Used by:3357
Symbol 3351 TextUses:440Used by:3357
Symbol 3352 TextUses:440Used by:3357
Symbol 3353 TextUses:440Used by:3357
Symbol 3354 TextUses:440Used by:3357
Symbol 3355 TextUses:440Used by:3357
Symbol 3356 TextUses:442Used by:3357
Symbol 3357 MovieClip {PerfectIthinkabi}Uses:3342 3343 3344 3345 3346 3347 3348 3349 3350 3351 3352 3353 3354 3355 3356Used by:3374
Symbol 3358 TextUses:440Used by:3373
Symbol 3359 TextUses:442Used by:3373
Symbol 3360 TextUses:440Used by:3373
Symbol 3361 TextUses:440Used by:3373
Symbol 3362 TextUses:440Used by:3373
Symbol 3363 TextUses:440Used by:3373
Symbol 3364 TextUses:440Used by:3373
Symbol 3365 TextUses:440Used by:3373
Symbol 3366 TextUses:440Used by:3373
Symbol 3367 TextUses:440Used by:3373
Symbol 3368 TextUses:440Used by:3373
Symbol 3369 TextUses:440Used by:3373
Symbol 3370 TextUses:440Used by:3373
Symbol 3371 TextUses:440Used by:3373
Symbol 3372 TextUses:442Used by:3373
Symbol 3373 MovieClip {Fastworkforalooktha}Uses:3358 3359 3360 3361 3362 3363 3364 3365 3366 3367 3368 3369 3370 3371 3372Used by:3374
Symbol 3374 MovieClip {hair_mania_0827_fla.Timeline_645}Uses:3310 3311 3326 3341 3357 3373Used by:3426  Timeline
Symbol 3375 EditableTextUses:2295Used by:3426
Symbol 3376 EditableTextUses:2295Used by:3426
Symbol 3377 EditableTextUses:2295Used by:3426
Symbol 3378 GraphicUsed by:3426
Symbol 3379 TextUses:440Used by:3393
Symbol 3380 TextUses:442Used by:3393
Symbol 3381 TextUses:440Used by:3393
Symbol 3382 TextUses:440Used by:3393
Symbol 3383 TextUses:440Used by:3393
Symbol 3384 TextUses:440Used by:3393
Symbol 3385 TextUses:440Used by:3393
Symbol 3386 TextUses:440Used by:3393
Symbol 3387 TextUses:440Used by:3393
Symbol 3388 TextUses:440Used by:3393
Symbol 3389 TextUses:440Used by:3393
Symbol 3390 TextUses:440Used by:3393
Symbol 3391 TextUses:440Used by:3393
Symbol 3392 TextUses:442Used by:3393
Symbol 3393 MovieClip {HAIRSCOR}Uses:3379 3380 3381 3382 3383 3384 3385 3386 3387 3388 3389 3390 3391 3392Used by:3426  Timeline
Symbol 3394 GraphicUsed by:3426
Symbol 3395 TextUses:440Used by:3409
Symbol 3396 TextUses:442Used by:3409
Symbol 3397 TextUses:440Used by:3409
Symbol 3398 TextUses:440Used by:3409
Symbol 3399 TextUses:440Used by:3409
Symbol 3400 TextUses:440Used by:3409
Symbol 3401 TextUses:440Used by:3409
Symbol 3402 TextUses:440Used by:3409
Symbol 3403 TextUses:440Used by:3409
Symbol 3404 TextUses:440Used by:3409
Symbol 3405 TextUses:440Used by:3409
Symbol 3406 TextUses:440Used by:3409
Symbol 3407 TextUses:440Used by:3409
Symbol 3408 TextUses:442Used by:3409
Symbol 3409 MovieClip {BONUSPOINTS}Uses:3395 3396 3397 3398 3399 3400 3401 3402 3403 3404 3405 3406 3407 3408Used by:3426  Timeline
Symbol 3410 GraphicUsed by:3426
Symbol 3411 TextUses:440Used by:3425
Symbol 3412 TextUses:442Used by:3425
Symbol 3413 TextUses:440Used by:3425
Symbol 3414 TextUses:440Used by:3425
Symbol 3415 TextUses:440Used by:3425
Symbol 3416 TextUses:440Used by:3425
Symbol 3417 TextUses:440Used by:3425
Symbol 3418 TextUses:440Used by:3425
Symbol 3419 TextUses:440Used by:3425
Symbol 3420 TextUses:440Used by:3425
Symbol 3421 TextUses:440Used by:3425
Symbol 3422 TextUses:440Used by:3425
Symbol 3423 TextUses:440Used by:3425
Symbol 3424 TextUses:442Used by:3425
Symbol 3425 MovieClip {TOTALSCORE}Uses:3411 3412 3413 3414 3415 3416 3417 3418 3419 3420 3421 3422 3423 3424Used by:3426  Timeline
Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639}Uses:2875 896 2923 3264 1045 3279 3295 3374 3375 3376 3377 3378 3393 3394 3409 3410 3425Used by:3427
Symbol 3427 MovieClip {lib.LevelComplete}Uses:10 2764 3426 2400 1152 2873Used by:Timeline
Symbol 3428 GraphicUsed by:3435
Symbol 3429 GraphicUsed by:3430
Symbol 3430 MovieClipUses:3429Used by:3435
Symbol 3431 GraphicUsed by:3432
Symbol 3432 MovieClipUses:3431Used by:3435
Symbol 3433 GraphicUsed by:3434
Symbol 3434 MovieClipUses:3433Used by:3435
Symbol 3435 MovieClip {_tool_2}Uses:564 3428 3430 3432 3434Used by:Timeline
Symbol 3436 BitmapUsed by:3437
Symbol 3437 GraphicUses:3436Used by:3438
Symbol 3438 MovieClipUses:3437Used by:3509
Symbol 3439 FontUsed by:3440 3441
Symbol 3440 TextUses:3439Used by:3442
Symbol 3441 TextUses:3439Used by:3442
Symbol 3442 ButtonUses:3440 402 3441Used by:3509
Symbol 3443 GraphicUsed by:3509
Symbol 3444 EditableTextUses:156Used by:3509
Symbol 3445 TextUses:440Used by:3459
Symbol 3446 TextUses:442Used by:3459
Symbol 3447 TextUses:440Used by:3459
Symbol 3448 TextUses:440Used by:3459
Symbol 3449 TextUses:440Used by:3459
Symbol 3450 TextUses:440Used by:3459
Symbol 3451 TextUses:440Used by:3459
Symbol 3452 TextUses:440Used by:3459
Symbol 3453 TextUses:440Used by:3459
Symbol 3454 TextUses:440Used by:3459
Symbol 3455 TextUses:440Used by:3459
Symbol 3456 TextUses:440Used by:3459
Symbol 3457 TextUses:440Used by:3459
Symbol 3458 TextUses:442Used by:3459
Symbol 3459 MovieClip {highscore}Uses:3445 3446 3447 3448 3449 3450 3451 3452 3453 3454 3455 3456 3457 3458Used by:3460  Timeline
Symbol 3460 MovieClip {按钮_highScore}Uses:896 3459Used by:3509
Symbol 3461 TextUses:440Used by:3474
Symbol 3462 TextUses:442Used by:3474
Symbol 3463 TextUses:440Used by:3474
Symbol 3464 TextUses:440Used by:3474
Symbol 3465 TextUses:440Used by:3474
Symbol 3466 TextUses:440Used by:3474
Symbol 3467 TextUses:440Used by:3474
Symbol 3468 TextUses:440Used by:3474
Symbol 3469 TextUses:440Used by:3474
Symbol 3470 TextUses:440Used by:3474
Symbol 3471 TextUses:440Used by:3474
Symbol 3472 TextUses:440Used by:3474
Symbol 3473 TextUses:442Used by:3474
Symbol 3474 MovieClip {BIGHAIR}Uses:3461 3462 3463 3464 3465 3466 3467 3468 3469 3470 3471 3472 3473Used by:3475  Timeline
Symbol 3475 MovieClip {按钮_Big_hair}Uses:896 3474Used by:3509
Symbol 3476 TextUses:440Used by:3489
Symbol 3477 TextUses:442Used by:3489
Symbol 3478 TextUses:440Used by:3489
Symbol 3479 TextUses:440Used by:3489
Symbol 3480 TextUses:440Used by:3489
Symbol 3481 TextUses:440Used by:3489
Symbol 3482 TextUses:440Used by:3489
Symbol 3483 TextUses:440Used by:3489
Symbol 3484 TextUses:440Used by:3489
Symbol 3485 TextUses:440Used by:3489
Symbol 3486 TextUses:440Used by:3489
Symbol 3487 TextUses:440Used by:3489
Symbol 3488 TextUses:442Used by:3489
Symbol 3489 MovieClip {GREATHAIR}Uses:3476 3477 3478 3479 3480 3481 3482 3483 3484 3485 3486 3487 3488Used by:3492  Timeline
Symbol 3490 GraphicUsed by:3491
Symbol 3491 MovieClipUses:3490 557Used by:3492 3508
Symbol 3492 MovieClip {按钮_Great_hair}Uses:896 3489 3491Used by:3509
Symbol 3493 TextUses:440Used by:3507
Symbol 3494 TextUses:442Used by:3507
Symbol 3495 TextUses:440Used by:3507
Symbol 3496 TextUses:440Used by:3507
Symbol 3497 TextUses:440Used by:3507
Symbol 3498 TextUses:440Used by:3507
Symbol 3499 TextUses:440Used by:3507
Symbol 3500 TextUses:440Used by:3507
Symbol 3501 TextUses:440Used by:3507
Symbol 3502 TextUses:440Used by:3507
Symbol 3503 TextUses:440Used by:3507
Symbol 3504 TextUses:440Used by:3507
Symbol 3505 TextUses:440Used by:3507
Symbol 3506 TextUses:442Used by:3507
Symbol 3507 MovieClip {HUGEHAIRss}Uses:3493 3494 3495 3496 3497 3498 3499 3500 3501 3502 3503 3504 3505 3506Used by:3508  Timeline
Symbol 3508 MovieClip {按钮_huge_hair}Uses:896 3507 3491Used by:3509
Symbol 3509 MovieClip {lib.Intro}Uses:10 244 3438 2752 3442 404 2355 2325 3443 522 3444 2402 423 2734 2765 3460 1045 2906 3475 3492 3508 2781Used by:Timeline
Symbol 3510 TextUses:440Used by:3524
Symbol 3511 TextUses:442Used by:3524
Symbol 3512 TextUses:440Used by:3524
Symbol 3513 TextUses:440Used by:3524
Symbol 3514 TextUses:440Used by:3524
Symbol 3515 TextUses:440Used by:3524
Symbol 3516 TextUses:440Used by:3524
Symbol 3517 TextUses:440Used by:3524
Symbol 3518 TextUses:440Used by:3524
Symbol 3519 TextUses:440Used by:3524
Symbol 3520 TextUses:440Used by:3524
Symbol 3521 TextUses:440Used by:3524
Symbol 3522 TextUses:440Used by:3524
Symbol 3523 TextUses:442Used by:3524
Symbol 3524 MovieClip {LevelMap}Uses:3510 3511 3512 3513 3514 3515 3516 3517 3518 3519 3520 3521 3522 3523Used by:3591  Timeline
Symbol 3525 GraphicUsed by:3591
Symbol 3526 EditableTextUses:148Used by:3591
Symbol 3527 EditableTextUses:148Used by:3591
Symbol 3528 EditableTextUses:148Used by:3591
Symbol 3529 EditableTextUses:148Used by:3591
Symbol 3530 EditableTextUses:148Used by:3591
Symbol 3531 EditableTextUses:148Used by:3591
Symbol 3532 MovieClip {按钮_start}Uses:896 2733Used by:3591
Symbol 3533 TextUses:148Used by:3590
Symbol 3534 TextUses:148Used by:3590
Symbol 3535 TextUses:148Used by:3590
Symbol 3536 TextUses:148Used by:3590
Symbol 3537 TextUses:426Used by:3590
Symbol 3538 TextUses:426Used by:3590
Symbol 3539 TextUses:426Used by:3590
Symbol 3540 TextUses:426Used by:3590
Symbol 3541 TextUses:148Used by:3590
Symbol 3542 TextUses:148Used by:3590
Symbol 3543 TextUses:148Used by:3590
Symbol 3544 TextUses:148Used by:3590
Symbol 3545 TextUses:148Used by:3590
Symbol 3546 TextUses:148Used by:3590
Symbol 3547 TextUses:148Used by:3590
Symbol 3548 TextUses:148Used by:3590
Symbol 3549 TextUses:148Used by:3590
Symbol 3550 TextUses:148Used by:3590
Symbol 3551 TextUses:148Used by:3590
Symbol 3552 TextUses:148Used by:3590
Symbol 3553 TextUses:148Used by:3590
Symbol 3554 TextUses:148Used by:3590
Symbol 3555 TextUses:148Used by:3590
Symbol 3556 TextUses:148Used by:3590
Symbol 3557 TextUses:148Used by:3590
Symbol 3558 TextUses:148Used by:3590
Symbol 3559 TextUses:148Used by:3590
Symbol 3560 TextUses:148Used by:3590
Symbol 3561 TextUses:148Used by:3590
Symbol 3562 TextUses:148Used by:3590
Symbol 3563 TextUses:148Used by:3590
Symbol 3564 TextUses:148Used by:3590
Symbol 3565 TextUses:148Used by:3590
Symbol 3566 TextUses:148Used by:3590
Symbol 3567 TextUses:148Used by:3590
Symbol 3568 TextUses:148Used by:3590
Symbol 3569 TextUses:148Used by:3590
Symbol 3570 TextUses:148Used by:3590
Symbol 3571 TextUses:148Used by:3590
Symbol 3572 TextUses:148Used by:3590
Symbol 3573 TextUses:148Used by:3590
Symbol 3574 TextUses:148Used by:3590
Symbol 3575 TextUses:148Used by:3590
Symbol 3576 TextUses:148Used by:3590
Symbol 3577 TextUses:148Used by:3590
Symbol 3578 TextUses:148Used by:3590
Symbol 3579 TextUses:148Used by:3590
Symbol 3580 TextUses:148Used by:3590
Symbol 3581 TextUses:148Used by:3590
Symbol 3582 TextUses:148Used by:3590
Symbol 3583 TextUses:148Used by:3590
Symbol 3584 TextUses:148Used by:3590
Symbol 3585 TextUses:148Used by:3590
Symbol 3586 TextUses:426Used by:3590
Symbol 3587 TextUses:426Used by:3590
Symbol 3588 TextUses:426Used by:3590
Symbol 3589 TextUses:426Used by:3590
Symbol 3590 MovieClip {levelmapinfo}Uses:3533 3534 3535 3536 3537 3538 3539 3540 3541 3542 3543 3544 3545 3546 3547 3548 3549 3550 3551 3552 3553 3554 3555 3556 3557 3558 3559 3560 3561 3562 3563 3564 3565 3566 3567 3568 3569 3570 3571 3572 3573 3574 3575 3576 3577 3578 3579 3580 3581 3582 3583 3584 3585 3586 3587 3588 3589Used by:3591  Timeline
Symbol 3591 MovieClip {lib.Levelmap}Uses:10 834 836 896 3524 2674 2696 3525 3526 3527 3528 3529 3530 3531 3532 2781 3590 1045Used by:Timeline
Symbol 3592 GraphicUsed by:3637 3638
Symbol 3593 GraphicUsed by:3636
Symbol 3594 TextUses:148Used by:3636 3904
Symbol 3595 TextUses:148Used by:3636
Symbol 3596 GraphicUsed by:3636
Symbol 3597 GraphicUsed by:3636
Symbol 3598 TextUses:2295Used by:3636
Symbol 3599 TextUses:2295Used by:3636
Symbol 3600 GraphicUsed by:3636
Symbol 3601 TextUses:148Used by:3636
Symbol 3602 TextUses:148Used by:3636
Symbol 3603 GraphicUsed by:3636
Symbol 3604 TextUses:148Used by:3636
Symbol 3605 TextUses:148Used by:3636
Symbol 3606 GraphicUsed by:3636
Symbol 3607 TextUses:148Used by:3636
Symbol 3608 TextUses:148Used by:3636
Symbol 3609 GraphicUsed by:3636
Symbol 3610 TextUses:148Used by:3636
Symbol 3611 TextUses:148Used by:3636
Symbol 3612 GraphicUsed by:3636
Symbol 3613 TextUses:148Used by:3636
Symbol 3614 TextUses:148Used by:3636
Symbol 3615 GraphicUsed by:3636
Symbol 3616 TextUses:148Used by:3636
Symbol 3617 TextUses:148Used by:3636
Symbol 3618 GraphicUsed by:3636
Symbol 3619 TextUses:148Used by:3636
Symbol 3620 TextUses:148Used by:3636
Symbol 3621 GraphicUsed by:3636
Symbol 3622 TextUses:148Used by:3636
Symbol 3623 TextUses:148Used by:3636
Symbol 3624 GraphicUsed by:3636
Symbol 3625 TextUses:148Used by:3636
Symbol 3626 TextUses:148Used by:3636
Symbol 3627 GraphicUsed by:3636
Symbol 3628 TextUses:148Used by:3636
Symbol 3629 TextUses:148Used by:3636
Symbol 3630 GraphicUsed by:3636
Symbol 3631 TextUses:148Used by:3636
Symbol 3632 TextUses:148Used by:3636
Symbol 3633 GraphicUsed by:3636
Symbol 3634 GraphicUsed by:3636
Symbol 3635 TextUses:2295Used by:3636
Symbol 3636 MovieClip {WARNING}Uses:3593 3594 3595 3596 3597 3598 3599 3600 3601 3602 3603 3604 3605 3606 3607 3608 3609 3610 3611 3612 3613 3614 3615 3616 3617 3618 3619 3620 3621 3622 3623 3624 3625 3626 3627 3628 3629 3630 3631 3632 3633 3634 3635Used by:3638  Timeline
Symbol 3637 MovieClipUses:3592Used by:3638
Symbol 3638 MovieClip {lib.Warning}Uses:3592 3636 3637Used by:Timeline
Symbol 3639 MovieClip {lib.Wallofhairfame_badge}Uses:836 896 2905 2360Used by:3640
Symbol 3640 MovieClip {lib.Wallofhairfame}Uses:10 834 3639 1042 1045 2923Used by:Timeline
Symbol 3641 TextUses:426Used by:Timeline
Symbol 3642 GraphicUsed by:3643
Symbol 3643 MovieClip {_choose_2}Uses:2674 2675 6 834 2677 3642 2679 2681Used by:Timeline
Symbol 3644 GraphicUsed by:3660
Symbol 3645 GraphicUsed by:3660
Symbol 3646 GraphicUsed by:3660
Symbol 3647 GraphicUsed by:3660
Symbol 3648 GraphicUsed by:3660
Symbol 3649 GraphicUsed by:3660
Symbol 3650 GraphicUsed by:3660
Symbol 3651 GraphicUsed by:3660
Symbol 3652 GraphicUsed by:3660
Symbol 3653 GraphicUsed by:3660
Symbol 3654 GraphicUsed by:3660
Symbol 3655 GraphicUsed by:3660
Symbol 3656 GraphicUsed by:3660
Symbol 3657 GraphicUsed by:3660
Symbol 3658 GraphicUsed by:3660
Symbol 3659 GraphicUsed by:3660
Symbol 3660 MovieClip {txt_levelComplete}Uses:3644 3645 3646 3647 3648 3649 3650 3651 3652 3653 3654 3655 3656 3657 3658 3659Used by:3661  Timeline
Symbol 3661 MovieClip {LevelComplete_show}Uses:402 3660Used by:Timeline
Symbol 3662 GraphicUsed by:3678
Symbol 3663 TextUses:148Used by:3677
Symbol 3664 TextUses:2295Used by:3677
Symbol 3665 TextUses:148Used by:3677
Symbol 3666 TextUses:148Used by:3677
Symbol 3667 TextUses:148Used by:3677
Symbol 3668 TextUses:148Used by:3677
Symbol 3669 TextUses:148Used by:3677
Symbol 3670 TextUses:148Used by:3677
Symbol 3671 TextUses:148Used by:3677
Symbol 3672 TextUses:148Used by:3677
Symbol 3673 TextUses:148Used by:3677
Symbol 3674 TextUses:148Used by:3677
Symbol 3675 TextUses:148Used by:3677
Symbol 3676 TextUses:2295Used by:3677
Symbol 3677 MovieClip {txt_levelfail}Uses:3663 3664 3665 3666 3667 3668 3669 3670 3671 3672 3673 3674 3675 3676Used by:3678  Timeline
Symbol 3678 MovieClip {_levelShow}Uses:3662 3677Used by:Timeline
Symbol 3679 GraphicUsed by:3680
Symbol 3680 MovieClipUses:3679 409Used by:3682
Symbol 3681 EditableTextUses:148Used by:3682
Symbol 3682 MovieClip {_unlockNewTool}Uses:2764 3680 3264 3681Used by:Timeline
Symbol 3683 GraphicUsed by:3701
Symbol 3684 GraphicUsed by:3685
Symbol 3685 MovieClipUses:3684Used by:3701
Symbol 3686 TextUses:148Used by:3700
Symbol 3687 TextUses:2295Used by:3700
Symbol 3688 TextUses:148Used by:3700
Symbol 3689 TextUses:148Used by:3700
Symbol 3690 TextUses:148Used by:3700
Symbol 3691 TextUses:148Used by:3700
Symbol 3692 TextUses:148Used by:3700
Symbol 3693 TextUses:148Used by:3700
Symbol 3694 TextUses:148Used by:3700
Symbol 3695 TextUses:148Used by:3700
Symbol 3696 TextUses:148Used by:3700
Symbol 3697 TextUses:148Used by:3700
Symbol 3698 TextUses:148Used by:3700
Symbol 3699 TextUses:2295Used by:3700
Symbol 3700 MovieClip {txt_space}Uses:3686 3687 3688 3689 3690 3691 3692 3693 3694 3695 3696 3697 3698 3699Used by:3701  Timeline
Symbol 3701 MovieClipUses:3683 3685 3700Used by:3760
Symbol 3702 GraphicUsed by:3703
Symbol 3703 MovieClipUses:3702Used by:3704
Symbol 3704 MovieClipUses:3703Used by:3760
Symbol 3705 TextUses:148Used by:3719
Symbol 3706 TextUses:2295Used by:3719
Symbol 3707 TextUses:148Used by:3719
Symbol 3708 TextUses:148Used by:3719
Symbol 3709 TextUses:148Used by:3719
Symbol 3710 TextUses:148Used by:3719
Symbol 3711 TextUses:148Used by:3719
Symbol 3712 TextUses:148Used by:3719
Symbol 3713 TextUses:148Used by:3719
Symbol 3714 TextUses:148Used by:3719
Symbol 3715 TextUses:148Used by:3719
Symbol 3716 TextUses:148Used by:3719
Symbol 3717 TextUses:148Used by:3719
Symbol 3718 TextUses:2295Used by:3719
Symbol 3719 MovieClip {txt_great}Uses:3705 3706 3707 3708 3709 3710 3711 3712 3713 3714 3715 3716 3717 3718Used by:3760  Timeline
Symbol 3720 GraphicUsed by:3721
Symbol 3721 MovieClipUses:3720Used by:3760
Symbol 3722 GraphicUsed by:3723
Symbol 3723 MovieClipUses:3722Used by:3760
Symbol 3724 GraphicUsed by:3725
Symbol 3725 MovieClipUses:3724Used by:3760
Symbol 3726 GraphicUsed by:3727
Symbol 3727 MovieClipUses:3726Used by:3760
Symbol 3728 TextUses:148Used by:3743
Symbol 3729 TextUses:2295Used by:3743
Symbol 3730 TextUses:148Used by:3743
Symbol 3731 TextUses:148Used by:3743
Symbol 3732 TextUses:148Used by:3743
Symbol 3733 TextUses:148Used by:3743
Symbol 3734 TextUses:148Used by:3743
Symbol 3735 TextUses:148Used by:3743
Symbol 3736 TextUses:148Used by:3743
Symbol 3737 TextUses:148Used by:3743
Symbol 3738 TextUses:148Used by:3743
Symbol 3739 TextUses:148Used by:3743
Symbol 3740 TextUses:148Used by:3743
Symbol 3741 TextUses:148Used by:3743
Symbol 3742 TextUses:2295Used by:3743
Symbol 3743 MovieClip {Faketoolss}Uses:3728 3729 3730 3731 3732 3733 3734 3735 3736 3737 3738 3739 3740 3741 3742Used by:3760  Timeline
Symbol 3744 TextUses:148Used by:3759
Symbol 3745 TextUses:2295Used by:3759
Symbol 3746 TextUses:148Used by:3759
Symbol 3747 TextUses:148Used by:3759
Symbol 3748 TextUses:148Used by:3759
Symbol 3749 TextUses:148Used by:3759
Symbol 3750 TextUses:148Used by:3759
Symbol 3751 TextUses:148Used by:3759
Symbol 3752 TextUses:148Used by:3759
Symbol 3753 TextUses:148Used by:3759
Symbol 3754 TextUses:148Used by:3759
Symbol 3755 TextUses:148Used by:3759
Symbol 3756 TextUses:148Used by:3759
Symbol 3757 TextUses:148Used by:3759
Symbol 3758 TextUses:2295Used by:3759
Symbol 3759 MovieClip {Toobad}Uses:3744 3745 3746 3747 3748 3749 3750 3751 3752 3753 3754 3755 3756 3757 3758Used by:3760  Timeline
Symbol 3760 MovieClip {lib.Space_Tishi}Uses:402 3701 3704 2270 2272 3719 3721 3723 3725 3727 3743 3759Used by:Timeline
Symbol 3761 GraphicUsed by:3770
Symbol 3762 GraphicUsed by:3763
Symbol 3763 MovieClipUses:3762Used by:3770
Symbol 3764 GraphicUsed by:3765
Symbol 3765 MovieClipUses:3764Used by:3770
Symbol 3766 GraphicUsed by:3767
Symbol 3767 MovieClipUses:3766Used by:3770
Symbol 3768 GraphicUsed by:3769
Symbol 3769 MovieClipUses:3768Used by:3770
Symbol 3770 MovieClip {_tool_7}Uses:3761 3763 3765 3767 3769Used by:Timeline
Symbol 3771 GraphicUsed by:3772
Symbol 3772 MovieClipUses:3771Used by:3783
Symbol 3773 GraphicUsed by:3774
Symbol 3774 MovieClipUses:3773Used by:3783
Symbol 3775 GraphicUsed by:3783
Symbol 3776 GraphicUsed by:3783
Symbol 3777 GraphicUsed by:3778
Symbol 3778 MovieClipUses:3777Used by:3783
Symbol 3779 GraphicUsed by:3780
Symbol 3780 MovieClipUses:3779Used by:3783
Symbol 3781 GraphicUsed by:3782
Symbol 3782 MovieClipUses:3781Used by:3783
Symbol 3783 MovieClip {_tool_14}Uses:3772 3774 3775 3776 3778 3780 3782Used by:Timeline
Symbol 3784 MovieClip {_tool_17}Uses:795Used by:Timeline
Symbol 3785 GraphicUsed by:3802
Symbol 3786 GraphicUsed by:3802
Symbol 3787 GraphicUsed by:3802
Symbol 3788 GraphicUsed by:3802
Symbol 3789 GraphicUsed by:3802
Symbol 3790 GraphicUsed by:3802
Symbol 3791 GraphicUsed by:3802
Symbol 3792 GraphicUsed by:3802
Symbol 3793 GraphicUsed by:3802
Symbol 3794 GraphicUsed by:3802
Symbol 3795 GraphicUsed by:3802
Symbol 3796 GraphicUsed by:3802
Symbol 3797 GraphicUsed by:3802
Symbol 3798 GraphicUsed by:3802
Symbol 3799 GraphicUsed by:3802
Symbol 3800 GraphicUsed by:3802
Symbol 3801 GraphicUsed by:3802
Symbol 3802 MovieClip {_tool_9}Uses:3785 678 3786 3787 3788 3789 3790 3791 3792 3793 3794 3795 3796 3797 3798 3799 3800 3801Used by:Timeline
Symbol 3803 GraphicUsed by:3813
Symbol 3804 GraphicUsed by:3813
Symbol 3805 GraphicUsed by:3813
Symbol 3806 GraphicUsed by:3813
Symbol 3807 GraphicUsed by:3813
Symbol 3808 GraphicUsed by:3813
Symbol 3809 GraphicUsed by:3813
Symbol 3810 GraphicUsed by:3813
Symbol 3811 GraphicUsed by:3813
Symbol 3812 GraphicUsed by:3813
Symbol 3813 MovieClip {_tool_3}Uses:3803 3804 3805 3806 3807 3808 3809 3810 3811 3812Used by:Timeline
Symbol 3814 GraphicUsed by:3845
Symbol 3815 GraphicUsed by:3845
Symbol 3816 GraphicUsed by:3845
Symbol 3817 GraphicUsed by:3845
Symbol 3818 GraphicUsed by:3845
Symbol 3819 GraphicUsed by:3845
Symbol 3820 GraphicUsed by:3845
Symbol 3821 GraphicUsed by:3845
Symbol 3822 GraphicUsed by:3845
Symbol 3823 GraphicUsed by:3845
Symbol 3824 GraphicUsed by:3845
Symbol 3825 GraphicUsed by:3845
Symbol 3826 GraphicUsed by:3845
Symbol 3827 GraphicUsed by:3845
Symbol 3828 GraphicUsed by:3845
Symbol 3829 GraphicUsed by:3845
Symbol 3830 GraphicUsed by:3845
Symbol 3831 GraphicUsed by:3845
Symbol 3832 GraphicUsed by:3845
Symbol 3833 GraphicUsed by:3845
Symbol 3834 GraphicUsed by:3845
Symbol 3835 GraphicUsed by:3845
Symbol 3836 GraphicUsed by:3845
Symbol 3837 GraphicUsed by:3845
Symbol 3838 GraphicUsed by:3845
Symbol 3839 GraphicUsed by:3845
Symbol 3840 GraphicUsed by:3845
Symbol 3841 GraphicUsed by:3845
Symbol 3842 GraphicUsed by:3845
Symbol 3843 GraphicUsed by:3845
Symbol 3844 GraphicUsed by:3845
Symbol 3845 MovieClip {_tool_6}Uses:3814 3815 3816 3817 3818 3819 3820 3821 3822 3823 3824 3825 3826 3827 3828 3829 3830 3831 3832 3833 3834 3835 3836 3837 3838 3839 3840 3841 3842 3843 3844Used by:Timeline
Symbol 3846 MovieClip {_tool_24}Uses:815Used by:Timeline
Symbol 3847 GraphicUsed by:3848
Symbol 3848 MovieClipUses:3847Used by:3855
Symbol 3849 GraphicUsed by:3850
Symbol 3850 MovieClipUses:3849Used by:3853
Symbol 3851 GraphicUsed by:3852
Symbol 3852 MovieClipUses:3851Used by:3853
Symbol 3853 MovieClipUses:3850 3852Used by:3854
Symbol 3854 MovieClip {hair_mania_0827_fla.Timeline_718}Uses:3853Used by:3855
Symbol 3855 MovieClip {_tool_19}Uses:3848 3854Used by:Timeline
Symbol 3856 EditableTextUses:2868Used by:3891
Symbol 3857 SoundUsed by:3891
Symbol 3858 Sound {sound10_pen}Used by:3891
Symbol 3859 Sound {sound23_daxiang}Used by:3891
Symbol 3860 Sound {button_click}Used by:3891
Symbol 3861 Sound {sound11_shui}Used by:3891
Symbol 3862 Sound {sound24_kafei}Used by:3891
Symbol 3863 SoundUsed by:3891
Symbol 3864 Sound {sound13_yagao}Used by:3891
Symbol 3865 Sound {sound25_zazhi}Used by:3891
Symbol 3866 Sound {button_over}Used by:3891
Symbol 3867 Sound {sound14_fajuan}Used by:3891
Symbol 3868 Sound {sound28_shoukao}Used by:3891
Symbol 3869 Sound {gougou_jiao}Used by:3891
Symbol 3870 Sound {sound15_jidan}Used by:3891
Symbol 3871 Sound {sound29_huaibiao}Used by:3891
Symbol 3872 Sound {sound_d1}Used by:3891
Symbol 3873 Sound {sound16_pijiu}Used by:3891
Symbol 3874 Sound {sound3_dadanqi}Used by:3891
Symbol 3875 Sound {sound_d2}Used by:3891
Symbol 3876 Sound {sound19_roushun}Used by:3891
Symbol 3877 Sound {sound4_shasha}Used by:3891
Symbol 3878 Sound {sound_d3}Used by:3891
Symbol 3879 Sound {sound2_baozha}Used by:3891
Symbol 3880 Sound {sound5_feng}Used by:3891
Symbol 3881 Sound {sound_d4}Used by:3891
Symbol 3882 Sound {sound20_yu}Used by:3891
Symbol 3883 Sound {sound6_haixiao}Used by:3891
Symbol 3884 Sound {sound_gold}Used by:3891
Symbol 3885 Sound {sound21_tixu}Used by:3891
Symbol 3886 Sound {sound7_qiqiu}Used by:3891
Symbol 3887 Sound {sound0_cuifengji}Used by:3891
Symbol 3888 Sound {sound22_yundou}Used by:3891
Symbol 3889 Sound {sound8_pen}Used by:3891
Symbol 3890 Sound {sound1_shandian}Used by:3891
Symbol 3891 MovieClip {hair_mania_0827_fla.Timeline_722}Uses:3856 3857 3858 3859 3860 3861 3862 3863 3864 3865 3866 3867 3868 3869 3870 3871 3872 3873 3874 3875 3876 3877 3878 3879 3880 3881 3882 3883 3884 3885 3886 3887 3888 3889 3890Used by:Timeline
Symbol 3892 EditableTextUses:280Used by:Timeline
Symbol 3893 EditableTextUses:148Used by:Timeline
Symbol 3894 MovieClip {Click11}Uses:933 938 943 948 953 958 963 968 973 978 983 988 993 998 1003Used by:Timeline
Symbol 3895 MovieClip {Clickdraganddrop111}Uses:936 941 946 951 956 961 966 971 976 981 986 991 996 1001 1006Used by:Timeline
Symbol 3896 TextUses:440Used by:3901
Symbol 3897 TextUses:440Used by:3901
Symbol 3898 TextUses:440Used by:3901
Symbol 3899 TextUses:440Used by:3901
Symbol 3900 TextUses:440Used by:3901
Symbol 3901 MovieClipUses:3896 3897 3898 3899 3900Used by:Timeline
Symbol 3902 TextUses:2342Used by:3903
Symbol 3903 MovieClipUses:3902Used by:Timeline
Symbol 3904 MovieClipUses:3594Used by:Timeline
Symbol 3905 TextUses:148Used by:3907
Symbol 3906 TextUses:148Used by:3907
Symbol 3907 MovieClipUses:3905 3906Used by:Timeline
Symbol 3908 TextUses:440Used by:3909
Symbol 3909 MovieClipUses:3908Used by:Timeline
Symbol 3910 TextUses:440Used by:3911
Symbol 3911 MovieClipUses:3910Used by:Timeline
Symbol 3912 TextUses:440Used by:3913
Symbol 3913 MovieClipUses:3912Used by:Timeline
Symbol 3914 TextUses:440Used by:3915
Symbol 3915 MovieClipUses:3914Used by:Timeline
Symbol 3916 TextUses:440Used by:3917
Symbol 3917 MovieClipUses:3916Used by:Timeline
Symbol 3918 MovieClip {Clicdragandmovemousein}Uses:935 940 945 950 955 960 965 970 975 980 985 990 995 1000 1005Used by:Timeline
Symbol 3919 MovieClip {Clickdragandm}Uses:934 939 944 949 954 959 964 969 974 979 984 989 994 999 1004Used by:Timeline
Symbol 3920 TextUses:440Used by:3921
Symbol 3921 MovieClipUses:3920Used by:Timeline
Symbol 3922 TextUses:440Used by:3923
Symbol 3923 MovieClipUses:3922Used by:Timeline
Symbol 3924 TextUses:440Used by:3925
Symbol 3925 MovieClipUses:3924Used by:Timeline
Symbol 3926 TextUses:440Used by:3927
Symbol 3927 MovieClipUses:3926Used by:Timeline
Streaming Sound 1Used by:Symbol 518 MovieClip {hair_mania_0827_fla.logologo_51}

Instance Names

"__id3_"Frame 1Symbol 522 MovieClip {spill.localisation.LanguageSelectBox}
"flag"Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835} Frame 1Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833}
"text"Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835} Frame 1Symbol 32 EditableText
"l_de"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_en_us"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_fr"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_it"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_nl"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_pl"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_se"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_br"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_cn"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_en_uk"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_es"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_id"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_jp"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_pt"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_ru"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"l_in"Symbol 34 MovieClip {spill.localisation.LanguageSelectPopup_mc} Frame 1Symbol 33 MovieClip {hair_mania_0827_fla.l_br_835}
"_language_show"Symbol 53 MovieClip {spill.localisation.LanguageSelectBox_mc} Frame 1Symbol 52 MovieClip
"flag"Symbol 53 MovieClip {spill.localisation.LanguageSelectBox_mc} Frame 1Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833}
"bt0"Symbol 164 MovieClip {lib.TestCode} Frame 1Symbol 150 MovieClip
"mianban"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 152 MovieClip {hair_mania_0827_fla.test_mianban_779}
"bt_close"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 155 MovieClip
"txt_show"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 157 EditableText
"__id2_"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 146 MovieClip {fl.controls.UIScrollBar}
"bt_unlock"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 145 MovieClip {fl.controls.Button}
"bt_lock"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 145 MovieClip {fl.controls.Button}
"setLevel"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 145 MovieClip {fl.controls.Button}
"reset"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 145 MovieClip {fl.controls.Button}
"combobox"Symbol 164 MovieClip {lib.TestCode} Frame 2Symbol 126 MovieClip {fl.controls.ComboBox}
"_txt"Symbol 243 MovieClip {Lethe_Button_Up} Frame 1Symbol 241 MovieClip {Lethe_Day_Text}
"_txt"Symbol 268 MovieClip {Lethe_Button_Up2} Frame 1Symbol 227 MovieClip {Lethe_Week_Text}
"_txt"Symbol 269 MovieClip {Lethe_Button_Up3} Frame 1Symbol 213 MovieClip {Lethe_Month_Text}
"_txt"Symbol 273 MovieClip {Lethe_Button_Down} Frame 1Symbol 272 MovieClip
"_txt"Symbol 274 MovieClip {Lethe_Button_Down2} Frame 1Symbol 272 MovieClip
"_txt"Symbol 275 MovieClip {Lethe_Button_Down3} Frame 1Symbol 272 MovieClip
"loadingtxt"Symbol 519 MovieClip {lib.Loading} Frame 1Symbol 424 EditableText
"loadbar"Symbol 519 MovieClip {lib.Loading} Frame 1Symbol 457 MovieClip
"bt_games"Symbol 519 MovieClip {lib.Loading} Frame 1Symbol 459 Button
"boundingBox_mc"Symbol 528 MovieClip {com.google.analytics.components.FlashTracker} Frame 1Symbol 524 MovieClip
"_mc"Symbol 561 MovieClip {hair_mania_0827_fla.Timeline_75} Frame 1Symbol 560 MovieClip
"mc"Symbol 677 MovieClip {hair_mania_0827_fla.Timeline_103} Frame 1Symbol 633 MovieClip
"mc"Symbol 783 MovieClip {hair_mania_0827_fla.Timeline_125} Frame 1Symbol 778 MovieClip
"mc"Symbol 784 MovieClip {hair_mania_0827_fla.Timeline_124} Frame 1Symbol 778 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 1Symbol 555 MovieClip {hair_mania_0827_fla.Timeline_69}
"mc"Symbol 830 MovieClip {lib.tool} Frame 1Symbol 555 MovieClip {hair_mania_0827_fla.Timeline_69}
"lock"Symbol 830 MovieClip {lib.tool} Frame 1Symbol 557 MovieClip
"_mc"Symbol 830 MovieClip {lib.tool} Frame 1Symbol 561 MovieClip {hair_mania_0827_fla.Timeline_75}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 2Symbol 564 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 2Symbol 564 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 3Symbol 566 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 3Symbol 566 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 4Symbol 577 MovieClip {hair_mania_0827_fla.Timeline_79}
"mc"Symbol 830 MovieClip {lib.tool} Frame 4Symbol 577 MovieClip {hair_mania_0827_fla.Timeline_79}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 5Symbol 579 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 5Symbol 594 MovieClip {hair_mania_0827_fla.Timeline_83}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 6Symbol 596 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 6Symbol 596 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 7Symbol 598 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 7Symbol 598 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 8Symbol 607 MovieClip {hair_mania_0827_fla.Timeline_92}
"mc"Symbol 830 MovieClip {lib.tool} Frame 8Symbol 607 MovieClip {hair_mania_0827_fla.Timeline_92}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 9Symbol 630 MovieClip {hair_mania_0827_fla.Timeline_97}
"mc"Symbol 830 MovieClip {lib.tool} Frame 9Symbol 630 MovieClip {hair_mania_0827_fla.Timeline_97}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 10Symbol 633 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 10Symbol 677 MovieClip {hair_mania_0827_fla.Timeline_103}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 11Symbol 679 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 11Symbol 679 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 12Symbol 698 MovieClip {hair_mania_0827_fla.Timeline_108}
"mc"Symbol 830 MovieClip {lib.tool} Frame 12Symbol 698 MovieClip {hair_mania_0827_fla.Timeline_108}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 13Symbol 745 MovieClip {hair_mania_0827_fla.Timeline_110}
"mc"Symbol 830 MovieClip {lib.tool} Frame 13Symbol 745 MovieClip {hair_mania_0827_fla.Timeline_110}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 14Symbol 756 MovieClip {hair_mania_0827_fla.Timeline_113}
"mc"Symbol 830 MovieClip {lib.tool} Frame 14Symbol 756 MovieClip {hair_mania_0827_fla.Timeline_113}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 15Symbol 773 MovieClip {hair_mania_0827_fla.Timeline_118}
"mc"Symbol 830 MovieClip {lib.tool} Frame 15Symbol 773 MovieClip {hair_mania_0827_fla.Timeline_118}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 16Symbol 775 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 16Symbol 775 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 17Symbol 778 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 17Symbol 784 MovieClip {hair_mania_0827_fla.Timeline_124}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 18Symbol 793 MovieClip {hair_mania_0827_fla.Timeline_130}
"mc"Symbol 830 MovieClip {lib.tool} Frame 18Symbol 793 MovieClip {hair_mania_0827_fla.Timeline_130}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 19Symbol 795 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 19Symbol 795 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 20Symbol 799 MovieClip {hair_mania_0827_fla.Timeline_136}
"mc"Symbol 830 MovieClip {lib.tool} Frame 20Symbol 799 MovieClip {hair_mania_0827_fla.Timeline_136}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 21Symbol 802 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 21Symbol 802 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 22Symbol 808 MovieClip {hair_mania_0827_fla.Timeline_139}
"mc"Symbol 830 MovieClip {lib.tool} Frame 22Symbol 808 MovieClip {hair_mania_0827_fla.Timeline_139}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 23Symbol 813 MovieClip {hair_mania_0827_fla.Timeline_142}
"mc"Symbol 830 MovieClip {lib.tool} Frame 23Symbol 813 MovieClip {hair_mania_0827_fla.Timeline_142}
"shadow"Symbol 830 MovieClip {lib.tool} Frame 24Symbol 815 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 24Symbol 815 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 25Symbol 817 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 25Symbol 817 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 26Symbol 819 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 26Symbol 819 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 27Symbol 821 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 27Symbol 821 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 28Symbol 825 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 28Symbol 825 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 29Symbol 828 MovieClip
"mc"Symbol 830 MovieClip {lib.tool} Frame 29Symbol 828 MovieClip
"shadow"Symbol 830 MovieClip {lib.tool} Frame 30Symbol 829 MovieClip {hair_mania_0827_fla.Timeline_152}
"mc"Symbol 830 MovieClip {lib.tool} Frame 30Symbol 829 MovieClip {hair_mania_0827_fla.Timeline_152}
"mc"Symbol 911 MovieClip {hair_mania_0827_fla.Timeline_167} Frame 1Symbol 829 MovieClip {hair_mania_0827_fla.Timeline_152}
"mc"Symbol 911 MovieClip {hair_mania_0827_fla.Timeline_167} Frame 1Symbol 828 MovieClip
"mc"Symbol 911 MovieClip {hair_mania_0827_fla.Timeline_167} Frame 1Symbol 825 MovieClip
"mc"Symbol 911 MovieClip {hair_mania_0827_fla.Timeline_167} Frame 1Symbol 821 MovieClip
"mc"Symbol 911 MovieClip {hair_mania_0827_fla.Timeline_167} Frame 1Symbol 819 MovieClip
"quan"Symbol 1012 MovieClip {hair_mania_0827_fla.__173} Frame 1Symbol 1011 MovieClip
"bt"Symbol 1045 MovieClip {按钮_moregame} Frame 1Symbol 1044 MovieClip
"bg"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 834 MovieClip
"mc"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 1029 MovieClip {hair_mania_0827_fla._howtoplay__155}
"bt2"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 1033 Button
"bt1"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 1033 Button
"bt0"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 1037 Button
"bt_back"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 1042 MovieClip {按钮_返回}
"bt_more"Symbol 1046 MovieClip {lib.HowToPlay} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"mc"Symbol 1343 MovieClip {_dog} Frame 1Symbol 1105 MovieClip {hair_mania_0827_fla.__187}
"mc"Symbol 1343 MovieClip {_dog} Frame 12Symbol 1152 MovieClip
"hair"Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197} Frame 1Symbol 1361 MovieClip {hair_mania_0827_fla.char0_hair__198}
"hair"Symbol 1414 MovieClip {hair_mania_0827_fla.C1_196} Frame 1Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197}
"face"Symbol 1414 MovieClip {hair_mania_0827_fla.C1_196} Frame 1Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200}
"arm"Symbol 1414 MovieClip {hair_mania_0827_fla.C1_196} Frame 1Symbol 1413 MovieClip {hair_mania_0827_fla.C1_213}
"hair"Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226} Frame 1Symbol 1427 MovieClip
"hair"Symbol 1467 MovieClip {hair_mania_0827_fla.C2__224} Frame 1Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226}
"face"Symbol 1467 MovieClip {hair_mania_0827_fla.C2__224} Frame 1Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229}
"arm"Symbol 1467 MovieClip {hair_mania_0827_fla.C2__224} Frame 1Symbol 1466 MovieClip {hair_mania_0827_fla.c2_236}
"hair"Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245} Frame 1Symbol 1490 MovieClip {hair_mania_0827_fla.hair3__246}
"hair"Symbol 1527 MovieClip {hair_mania_0827_fla.C3__243} Frame 1Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245}
"face"Symbol 1527 MovieClip {hair_mania_0827_fla.C3__243} Frame 1Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254}
"arm"Symbol 1527 MovieClip {hair_mania_0827_fla.C3__243} Frame 1Symbol 1526 MovieClip {hair_mania_0827_fla.c3_262}
"hair"Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269} Frame 1Symbol 1548 MovieClip
"hair"Symbol 1581 MovieClip {hair_mania_0827_fla.C4_267} Frame 1Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269}
"face"Symbol 1581 MovieClip {hair_mania_0827_fla.C4_267} Frame 1Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271}
"arm"Symbol 1581 MovieClip {hair_mania_0827_fla.C4_267} Frame 1Symbol 1580 MovieClip {hair_mania_0827_fla.c4_277}
"hair"Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284} Frame 1Symbol 1587 MovieClip {hair_mania_0827_fla.char5_1_285}
"hair"Symbol 1627 MovieClip {hair_mania_0827_fla.C5__282} Frame 1Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284}
"face"Symbol 1627 MovieClip {hair_mania_0827_fla.C5__282} Frame 1Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286}
"arm"Symbol 1627 MovieClip {hair_mania_0827_fla.C5__282} Frame 1Symbol 1626 MovieClip {hair_mania_0827_fla.c5_293}
"hair"Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303} Frame 1Symbol 1664 MovieClip
"hair"Symbol 1697 MovieClip {hair_mania_0827_fla.C6__301} Frame 1Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303}
"face"Symbol 1697 MovieClip {hair_mania_0827_fla.C6__301} Frame 1Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306}
"arm"Symbol 1697 MovieClip {hair_mania_0827_fla.C6__301} Frame 1Symbol 1696 MovieClip {hair_mania_0827_fla.C6_309}
"hair"Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318} Frame 1Symbol 1708 MovieClip
"hair"Symbol 1748 MovieClip {hair_mania_0827_fla.C7__316} Frame 1Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318}
"face"Symbol 1748 MovieClip {hair_mania_0827_fla.C7__316} Frame 1Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320}
"arm"Symbol 1748 MovieClip {hair_mania_0827_fla.C7__316} Frame 1Symbol 1747 MovieClip {hair_mania_0827_fla.C7_327}
"hair"Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336} Frame 1Symbol 1764 MovieClip {hair_mania_0827_fla.hair8_t_337}
"hair"Symbol 1800 MovieClip {hair_mania_0827_fla.C8__334} Frame 1Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336}
"face"Symbol 1800 MovieClip {hair_mania_0827_fla.C8__334} Frame 1Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343}
"arm"Symbol 1800 MovieClip {hair_mania_0827_fla.C8__334} Frame 1Symbol 1799 MovieClip {hair_mania_0827_fla.C8_350}
"hair"Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357} Frame 1Symbol 1809 MovieClip
"hair"Symbol 1849 MovieClip {hair_mania_0827_fla.C9__355} Frame 1Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357}
"face"Symbol 1849 MovieClip {hair_mania_0827_fla.C9__355} Frame 1Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359}
"arm"Symbol 1849 MovieClip {hair_mania_0827_fla.C9__355} Frame 1Symbol 1848 MovieClip {hair_mania_0827_fla.C9_367}
"hair"Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376} Frame 1Symbol 1864 MovieClip {hair_mania_0827_fla.char10_harit_377}
"hair"Symbol 1904 MovieClip {hair_mania_0827_fla.C10__374} Frame 1Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376}
"face"Symbol 1904 MovieClip {hair_mania_0827_fla.C10__374} Frame 1Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383}
"arm"Symbol 1904 MovieClip {hair_mania_0827_fla.C10__374} Frame 1Symbol 1903 MovieClip {hair_mania_0827_fla.C10_389}
"hair"Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398} Frame 1Symbol 1913 MovieClip {hair_mania_0827_fla.char11_399}
"hair"Symbol 1953 MovieClip {hair_mania_0827_fla.C11__396} Frame 1Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398}
"arm"Symbol 1953 MovieClip {hair_mania_0827_fla.C11__396} Frame 1Symbol 1934 MovieClip {hair_mania_0827_fla.c11_401}
"face"Symbol 1953 MovieClip {hair_mania_0827_fla.C11__396} Frame 1Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407}
"hair"Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417} Frame 1Symbol 1963 MovieClip
"hair"Symbol 2010 MovieClip {hair_mania_0827_fla.C12__414} Frame 1Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417}
"face"Symbol 2010 MovieClip {hair_mania_0827_fla.C12__414} Frame 1Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419}
"arm"Symbol 2010 MovieClip {hair_mania_0827_fla.C12__414} Frame 1Symbol 2009 MovieClip {hair_mania_0827_fla.c12_426}
"hair"Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437} Frame 1Symbol 2029 MovieClip
"hair"Symbol 2069 MovieClip {hair_mania_0827_fla.C13__434} Frame 1Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437}
"face"Symbol 2069 MovieClip {hair_mania_0827_fla.C13__434} Frame 1Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439}
"arm"Symbol 2069 MovieClip {hair_mania_0827_fla.C13__434} Frame 1Symbol 2068 MovieClip {hair_mania_0827_fla.c13_445}
"hair"Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454} Frame 1Symbol 2081 MovieClip {hair_mania_0827_fla.char14_455}
"hair"Symbol 2112 MovieClip {hair_mania_0827_fla.C14__453} Frame 1Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454}
"face"Symbol 2112 MovieClip {hair_mania_0827_fla.C14__453} Frame 1Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458}
"arm"Symbol 2112 MovieClip {hair_mania_0827_fla.C14__453} Frame 1Symbol 2111 MovieClip {hair_mania_0827_fla.c14_462}
"hair"Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469} Frame 1Symbol 2120 MovieClip
"hair"Symbol 2158 MovieClip {hair_mania_0827_fla.C15__467} Frame 1Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469}
"face"Symbol 2158 MovieClip {hair_mania_0827_fla.C15__467} Frame 1Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472}
"arm"Symbol 2158 MovieClip {hair_mania_0827_fla.C15__467} Frame 1Symbol 2157 MovieClip {hair_mania_0827_fla.c15_478}
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 1Symbol 1414 MovieClip {hair_mania_0827_fla.C1_196}
"yanzhao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 1Symbol 824 MovieClip {hair_mania_0827_fla.Timeline_150}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 1Symbol 1416 MovieClip
"fanwei"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 1Symbol 1419 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 2Symbol 1467 MovieClip {hair_mania_0827_fla.C2__224}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 2Symbol 1469 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 3Symbol 1527 MovieClip {hair_mania_0827_fla.C3__243}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 3Symbol 1529 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 4Symbol 1581 MovieClip {hair_mania_0827_fla.C4_267}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 4Symbol 1583 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 5Symbol 1627 MovieClip {hair_mania_0827_fla.C5__282}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 5Symbol 1629 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 6Symbol 1697 MovieClip {hair_mania_0827_fla.C6__301}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 6Symbol 1699 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 7Symbol 1748 MovieClip {hair_mania_0827_fla.C7__316}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 7Symbol 1750 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 8Symbol 1800 MovieClip {hair_mania_0827_fla.C8__334}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 8Symbol 1802 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 9Symbol 1849 MovieClip {hair_mania_0827_fla.C9__355}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 9Symbol 1851 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 10Symbol 1904 MovieClip {hair_mania_0827_fla.C10__374}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 10Symbol 1906 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 11Symbol 1953 MovieClip {hair_mania_0827_fla.C11__396}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 11Symbol 1955 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 12Symbol 2010 MovieClip {hair_mania_0827_fla.C12__414}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 12Symbol 2012 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 13Symbol 2069 MovieClip {hair_mania_0827_fla.C13__434}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 13Symbol 2071 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 14Symbol 2112 MovieClip {hair_mania_0827_fla.C14__453}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 14Symbol 2114 MovieClip
"char"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 15Symbol 2158 MovieClip {hair_mania_0827_fla.C15__467}
"shoukao"Symbol 2161 MovieClip {hair_mania_0827_fla._char_195} Frame 15Symbol 2160 MovieClip
"bar"Symbol 2270 MovieClip {hair_mania_0827_fla.timebar_494} Frame 1Symbol 2268 MovieClip
"timebar"Symbol 2273 MovieClip {hair_mania_0827_fla.think_exit__492} Frame 1Symbol 2270 MovieClip {hair_mania_0827_fla.timebar_494}
"masks"Symbol 2282 MovieClip {hair_mania_0827_fla.Timeline_498} Frame 1Symbol 2278 MovieClip
"bar"Symbol 2282 MovieClip {hair_mania_0827_fla.Timeline_498} Frame 1Symbol 2280 MovieClip
"bg"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 1050 MovieClip
"dog"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 1343 MovieClip {_dog}
"椅子"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 1346 MovieClip
"char"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2161 MovieClip {hair_mania_0827_fla._char_195}
"mania"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2246 MovieClip {hair_mania_0827_fla.Timeline_486}
"think_exit"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2273 MovieClip {hair_mania_0827_fla.think_exit__492}
"powerBar"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2282 MovieClip {hair_mania_0827_fla.Timeline_498}
"logo_mainscreen"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 394 MovieClip {spill.localisation.BrandingLogo}
"ball"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2284 MovieClip
"bt_paused"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2288 MovieClip {按钮_暂停}
"bt_sound"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2293 MovieClip {按钮_音量}
"tool_l"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2324 MovieClip
"tool_r"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2324 MovieClip
"loader"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2325 MovieClip
"toolIntro"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2327 MovieClip {hair_mania_0827_fla.__510}
"clock"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2341 MovieClip
"bt_games"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 459 Button
"time_txt"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2343 EditableText
"tool_target"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2344 EditableText
"tool_used_text"Symbol 2346 MovieClip {lib.Game} Frame 1Symbol 2345 EditableText
"bt0"Symbol 2355 MovieClip {lib.setQuality} Frame 1Symbol 2351 MovieClip {按钮_画面质量}
"bt1"Symbol 2355 MovieClip {lib.setQuality} Frame 1Symbol 2354 MovieClip {按钮_声音}
"bar_back"Symbol 2360 MovieClip {lib.BarCtrl} Frame 1Symbol 2357 MovieClip
"bar"Symbol 2360 MovieClip {lib.BarCtrl} Frame 1Symbol 2359 MovieClip
"bt"Symbol 2416 MovieClip {按钮_MAINMENU} Frame 1Symbol 896 MovieClip
"bt0"Symbol 2417 MovieClip {lib.Highscore} Frame 1Symbol 2416 MovieClip {按钮_MAINMENU}
"bt1"Symbol 2417 MovieClip {lib.Highscore} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"loader"Symbol 2417 MovieClip {lib.Highscore} Frame 1Symbol 2325 MovieClip
"jiangbei"Symbol 2664 MovieClip {Badge} Frame 1Symbol 2466 MovieClip
"txt"Symbol 2664 MovieClip {Badge} Frame 1Symbol 2663 MovieClip
"playgame"Symbol 2670 MovieClip {ProtectionMC} Frame 1Symbol 2669 Button
"lock"Symbol 2696 MovieClip {_choose_相片} Frame 1Symbol 2681 MovieClip
"bt"Symbol 2734 MovieClip {按钮_startgame} Frame 1Symbol 896 MovieClip
"img"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2696 MovieClip {_choose_相片}
"customer"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2697 EditableText
"box0"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2715 MovieClip {hair_mania_0827_fla.box0_574}
"box1"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2715 MovieClip {hair_mania_0827_fla.box0_574}
"bt_space"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2716 MovieClip
"txt_imput"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2717 EditableText
"txt_name"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2718 EditableText
"bt_start"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 2734 MovieClip {按钮_startgame}
"bt_more"Symbol 2735 MovieClip {lib.MailShow} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"mc"Symbol 2753 MovieClip {hair_mania_0827_fla.Timeline_582} Frame 1Symbol 1152 MovieClip
"bt_start_game"Symbol 2761 MovieClip {lib.Story} Frame 1Symbol 2734 MovieClip {按钮_startgame}
"txt"Symbol 2761 MovieClip {lib.Story} Frame 1Symbol 2757 EditableText
"bt"Symbol 2765 MovieClip {按钮_howtoplay} Frame 1Symbol 896 MovieClip
"bt"Symbol 2781 MovieClip {按钮_back} Frame 1Symbol 896 MovieClip
"bg"Symbol 2797 MovieClip {lib.Pause} Frame 1Symbol 836 MovieClip
"bt0"Symbol 2797 MovieClip {lib.Pause} Frame 1Symbol 2416 MovieClip {按钮_MAINMENU}
"bt1"Symbol 2797 MovieClip {lib.Pause} Frame 1Symbol 2765 MovieClip {按钮_howtoplay}
"bt2"Symbol 2797 MovieClip {lib.Pause} Frame 1Symbol 2781 MovieClip {按钮_back}
"bt3"Symbol 2797 MovieClip {lib.Pause} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"bg"Symbol 2849 MovieClip {lib.LevelInfo} Frame 1Symbol 2764 MovieClip
"txt"Symbol 2849 MovieClip {lib.LevelInfo} Frame 1Symbol 2798 EditableText
"_num"Symbol 2849 MovieClip {lib.LevelInfo} Frame 76Symbol 2833 MovieClip
"_num"Symbol 2849 MovieClip {lib.LevelInfo} Frame 148Symbol 2848 MovieClip {GOMAKEIRtt}
"img"Symbol 2873 MovieClip {lib.showBadgeunlock} Frame 2Symbol 2664 MovieClip {Badge}
"bt"Symbol 2890 MovieClip {按钮_subscore} Frame 1Symbol 896 MovieClip
"bt"Symbol 2906 MovieClip {按钮_wallofhair} Frame 1Symbol 896 MovieClip
"bt"Symbol 2923 MovieClip {按钮SENDTOFRIEND} Frame 1Symbol 896 MovieClip
"bt"Symbol 2953 MovieClip {按钮_tryagain} Frame 1Symbol 896 MovieClip
"bt3"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"bt0"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2890 MovieClip {按钮_subscore}
"bt4"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2906 MovieClip {按钮_wallofhair}
"bt5"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2923 MovieClip {按钮SENDTOFRIEND}
"bt1"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2953 MovieClip {按钮_tryagain}
"username"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2986 EditableText
"score"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2987 EditableText
"err"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 3005 MovieClip {hair_mania_0827_fla._err_tishi_617}
"bt2"Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603} Frame 1Symbol 2953 MovieClip {按钮_tryagain}
"bg"Symbol 3007 MovieClip {lib.LevelCompleteEnd} Frame 1Symbol 2764 MovieClip
"showbadge"Symbol 3007 MovieClip {lib.LevelCompleteEnd} Frame 107Symbol 2873 MovieClip {lib.showBadgeunlock}
"plane"Symbol 3007 MovieClip {lib.LevelCompleteEnd} Frame 116Symbol 3006 MovieClip {hair_mania_0827_fla._complete_plan_603}
"char1"Symbol 3007 MovieClip {lib.LevelCompleteEnd} Frame 116Symbol 2400 MovieClip
"char0"Symbol 3007 MovieClip {lib.LevelCompleteEnd} Frame 116Symbol 1152 MovieClip
"bt1"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 2416 MovieClip {按钮_MAINMENU}
"bt3"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"bt2"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 2953 MovieClip {按钮_tryagain}
"bt0"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 2890 MovieClip {按钮_subscore}
"score"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 3024 EditableText
"username"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 3025 EditableText
"txt"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 3117 MovieClip {hair_mania_0827_fla.Timeline_622}
"err"Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619} Frame 1Symbol 3005 MovieClip {hair_mania_0827_fla._err_tishi_617}
"bg"Symbol 3187 MovieClip {lib.LevelFail} Frame 1Symbol 2764 MovieClip
"plane"Symbol 3187 MovieClip {lib.LevelFail} Frame 1Symbol 3133 MovieClip {hair_mania_0827_fla._level_plan_619}
"char1"Symbol 3187 MovieClip {lib.LevelFail} Frame 1Symbol 3174 MovieClip
"char0"Symbol 3187 MovieClip {lib.LevelFail} Frame 1Symbol 3186 MovieClip
"bt"Symbol 3248 MovieClip {按钮_copy} Frame 1Symbol 896 MovieClip
"img"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2696 MovieClip {_choose_相片}
"customer"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3189 EditableText
"link"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3199 MovieClip {_link}
"box0"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2715 MovieClip {hair_mania_0827_fla.box0_574}
"box1"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2715 MovieClip {hair_mania_0827_fla.box0_574}
"bt_space"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2716 MovieClip
"bt_back"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 1042 MovieClip {按钮_返回}
"txt_imput"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3231 EditableText
"img0"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img1"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img2"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 2696 MovieClip {_choose_相片}
"pageup"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3233 MovieClip {选择}
"pagedown"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3233 MovieClip {选择}
"txt_name"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3234 EditableText
"bt_copy"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3248 MovieClip {按钮_copy}
"urls"Symbol 3250 MovieClip {lib.MailSend} Frame 1Symbol 3249 EditableText
"bt"Symbol 3264 MovieClip {按钮_continue} Frame 1Symbol 896 MovieClip
"bt1"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 2923 MovieClip {按钮SENDTOFRIEND}
"bt0"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 3264 MovieClip {按钮_continue}
"bt2"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"txt"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 3374 MovieClip {hair_mania_0827_fla.Timeline_645}
"txt0"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 3375 EditableText
"txt1"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 3376 EditableText
"txt2"Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639} Frame 1Symbol 3377 EditableText
"bg"Symbol 3427 MovieClip {lib.LevelComplete} Frame 1Symbol 2764 MovieClip
"plane"Symbol 3427 MovieClip {lib.LevelComplete} Frame 1Symbol 3426 MovieClip {hair_mania_0827_fla.levelcomplete_plane_639}
"char0"Symbol 3427 MovieClip {lib.LevelComplete} Frame 1Symbol 2400 MovieClip
"char1"Symbol 3427 MovieClip {lib.LevelComplete} Frame 1Symbol 1152 MovieClip
"showbadge"Symbol 3427 MovieClip {lib.LevelComplete} Frame 1Symbol 2873 MovieClip {lib.showBadgeunlock}
"mc"Symbol 3435 MovieClip {_tool_2} Frame 1Symbol 564 MovieClip
"bt"Symbol 3460 MovieClip {按钮_highScore} Frame 1Symbol 896 MovieClip
"bt"Symbol 3475 MovieClip {按钮_Big_hair} Frame 1Symbol 896 MovieClip
"bt"Symbol 3492 MovieClip {按钮_Great_hair} Frame 1Symbol 896 MovieClip
"lock"Symbol 3492 MovieClip {按钮_Great_hair} Frame 1Symbol 3491 MovieClip
"bt"Symbol 3508 MovieClip {按钮_huge_hair} Frame 1Symbol 896 MovieClip
"lock"Symbol 3508 MovieClip {按钮_huge_hair} Frame 1Symbol 3491 MovieClip
"gameportal"Symbol 3509 MovieClip {lib.Intro} Frame 1Symbol 3442 Button
"loader"Symbol 3509 MovieClip {lib.Intro} Frame 1Symbol 2325 MovieClip
"loader"Symbol 3509 MovieClip {lib.Intro} Frame 1Symbol 2325 MovieClip
"__id4_"Symbol 3509 MovieClip {lib.Intro} Frame 1Symbol 522 MovieClip {spill.localisation.LanguageSelectBox}
"bt0"Symbol 3509 MovieClip {lib.Intro} Frame 33Symbol 2734 MovieClip {按钮_startgame}
"bt1"Symbol 3509 MovieClip {lib.Intro} Frame 33Symbol 2765 MovieClip {按钮_howtoplay}
"bt2"Symbol 3509 MovieClip {lib.Intro} Frame 33Symbol 3460 MovieClip {按钮_highScore}
"bt4"Symbol 3509 MovieClip {lib.Intro} Frame 33Symbol 1045 MovieClip {按钮_moregame}
"bt3"Symbol 3509 MovieClip {lib.Intro} Frame 33Symbol 2906 MovieClip {按钮_wallofhair}
"bt10"Symbol 3509 MovieClip {lib.Intro} Frame 47Symbol 3475 MovieClip {按钮_Big_hair}
"bt11"Symbol 3509 MovieClip {lib.Intro} Frame 47Symbol 3492 MovieClip {按钮_Great_hair}
"bt12"Symbol 3509 MovieClip {lib.Intro} Frame 47Symbol 3508 MovieClip {按钮_huge_hair}
"bt13"Symbol 3509 MovieClip {lib.Intro} Frame 47Symbol 2781 MovieClip {按钮_back}
"bt"Symbol 3532 MovieClip {按钮_start} Frame 1Symbol 896 MovieClip
"img"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img0"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img1"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img2"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img3"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2696 MovieClip {_choose_相片}
"img4"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2696 MovieClip {_choose_相片}
"txt5"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3526 EditableText
"txt0"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3527 EditableText
"txt1"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3528 EditableText
"txt2"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3529 EditableText
"txt3"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3530 EditableText
"txt4"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3531 EditableText
"bt"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 3532 MovieClip {按钮_start}
"bt_back"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 2781 MovieClip {按钮_back}
"bt_more"Symbol 3591 MovieClip {lib.Levelmap} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"bar"Symbol 3639 MovieClip {lib.Wallofhairfame_badge} Frame 1Symbol 2360 MovieClip {lib.BarCtrl}
"wall"Symbol 3640 MovieClip {lib.Wallofhairfame} Frame 1Symbol 3639 MovieClip {lib.Wallofhairfame_badge}
"bt0"Symbol 3640 MovieClip {lib.Wallofhairfame} Frame 1Symbol 1042 MovieClip {按钮_返回}
"bt_more"Symbol 3640 MovieClip {lib.Wallofhairfame} Frame 1Symbol 1045 MovieClip {按钮_moregame}
"bt1"Symbol 3640 MovieClip {lib.Wallofhairfame} Frame 1Symbol 2923 MovieClip {按钮SENDTOFRIEND}
"lock"Symbol 3643 MovieClip {_choose_2} Frame 1Symbol 2681 MovieClip
"bg"Symbol 3682 MovieClip {_unlockNewTool} Frame 1Symbol 2764 MovieClip
"bt0"Symbol 3682 MovieClip {_unlockNewTool} Frame 1Symbol 3264 MovieClip {按钮_continue}
"txt"Symbol 3682 MovieClip {_unlockNewTool} Frame 1Symbol 3681 EditableText
"timebar"Symbol 3760 MovieClip {lib.Space_Tishi} Frame 1Symbol 2270 MovieClip {hair_mania_0827_fla.timebar_494}
"mc"Symbol 3784 MovieClip {_tool_17} Frame 1Symbol 795 MovieClip
"mc"Symbol 3846 MovieClip {_tool_24} Frame 1Symbol 815 MovieClip

Special Tags

FileAttributes (69)Timeline Frame 1Access network only, Metadata not present, AS3.

Labels

"loading"Frame 1
"first"Frame 12
"game"Frame 24
"br"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 1
"nl"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 2
"cn"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 3
"de"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 4
"es"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 5
"fr"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 6
"in"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 7
"it"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 8
"jp"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 9
"my"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 10
"ph"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 11
"pl"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 12
"pt"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 13
"ru"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 14
"se"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 15
"tr"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 16
"en_uk"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 17
"en_us"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 18
"id"Symbol 30 MovieClip {hair_mania_0827_fla.flag_icon_833} Frame 19
"PortuguêsBR"Symbol 52 MovieClip Frame 1
"中文"Symbol 52 MovieClip Frame 2
"Deutsch"Symbol 52 MovieClip Frame 3
"English (UK)"Symbol 52 MovieClip Frame 4
"English (US)"Symbol 52 MovieClip Frame 5
"Español"Symbol 52 MovieClip Frame 6
"Français"Symbol 52 MovieClip Frame 7
"Bahasa Ind."Symbol 52 MovieClip Frame 8
"India"Symbol 52 MovieClip Frame 9
"Italiano"Symbol 52 MovieClip Frame 10
"日本語"Symbol 52 MovieClip Frame 11
"Nederlands"Symbol 52 MovieClip Frame 12
"Português"Symbol 52 MovieClip Frame 13
"Polski"Symbol 52 MovieClip Frame 14
"Русский язык"Symbol 52 MovieClip Frame 15
"Svenska"Symbol 52 MovieClip Frame 16
"www.agame.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 1
"www.game.com.cn"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 2
"www.zapjuegos.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 3
"www.spel.nl"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 4
"www.jeu.fr"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 5
"www.spielen.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 6
"www.clickjogos.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 7
"www.giocaregratis.it"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 8
"www.spel.eu"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 9
"www.mygames.co.uk"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 10
"www.flashgames.ru"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 11
"www.game.co.in"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 12
"www.games.co.id"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 13
"www.minigry.pl"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 14
"www.asoyun.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 15
"www.game.com.my"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 16
"www.gamesgames.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 17
"www.spelletjes.nl"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 18
"www.jeux.fr"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 19
"www.jetztspielen.de"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 20
"www.gry.pl"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 21
"www.spela.se"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 22
"www.gioco.it"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 23
"www.juegos.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 24
"www.ojogos.com.br"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 25
"www.ourgames.ru"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 26
"www.games.co.uk"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 27
"www.oyunlar123.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 28
"www.girlsgogames.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 29
"www.girlsgogames.nl"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 30
"www.girlsgogames.fr"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 31
"www.girlsgogames.es"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 32
"www.girlsgogames.de"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 33
"www.girlsgogames.pl"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 34
"www.girlsgogames.se"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 35
"www.girlsgogames.it"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 36
"www.juegosdechicas.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 37
"www.girlsgogames.co.uk"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 38
"www.girlsgogames.com.br"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 39
"www.girlsgogames.ru"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 40
"www.girlsgogames.in"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 41
"www.girlsgogamestr.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 42
"www.ojogos.pt"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 43
"www.laro.com.ph"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 44
"www.egames.jp"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 45
"www.a10.com"Symbol 394 MovieClip {spill.localisation.BrandingLogo} Frame 46
"end"Symbol 744 MovieClip {hair_mania_0827_fla.Timeline_112} Frame 8
"moden3"Symbol 1105 MovieClip {hair_mania_0827_fla.__187} Frame 1
"moden0"Symbol 1105 MovieClip {hair_mania_0827_fla.__187} Frame 10
"moden4"Symbol 1105 MovieClip {hair_mania_0827_fla.__187} Frame 13
"moden1"Symbol 1105 MovieClip {hair_mania_0827_fla.__187} Frame 23
"walk"Symbol 1343 MovieClip {_dog} Frame 1
"cry"Symbol 1343 MovieClip {_dog} Frame 12
"sleep"Symbol 1343 MovieClip {_dog} Frame 25
"moden0"Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197} Frame 1
"moden1"Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197} Frame 11
"moden3"Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197} Frame 22
"moden4"Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197} Frame 31
"moden5"Symbol 1366 MovieClip {hair_mania_0827_fla.C1_197} Frame 41
"moden0"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 1
"moden1"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 10
"moden2"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 21
"moden3"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 30
"moden4"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 40
"moden5"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 50
"moden6"Symbol 1397 MovieClip {hair_mania_0827_fla.C1_200} Frame 61
"moden0"Symbol 1413 MovieClip {hair_mania_0827_fla.C1_213} Frame 1
"moden1"Symbol 1413 MovieClip {hair_mania_0827_fla.C1_213} Frame 9
"moden2"Symbol 1413 MovieClip {hair_mania_0827_fla.C1_213} Frame 18
"moden0"Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226} Frame 1
"moden1"Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226} Frame 12
"moden3"Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226} Frame 23
"moden4"Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226} Frame 32
"moden5"Symbol 1432 MovieClip {hair_mania_0827_fla.c2_226} Frame 42
"moden0"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 1
"moden1"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 10
"moden2"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 21
"moden3"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 30
"moden4"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 40
"moden5"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 50
"moden6"Symbol 1453 MovieClip {hair_mania_0827_fla.c2_229} Frame 61
"moden0"Symbol 1466 MovieClip {hair_mania_0827_fla.c2_236} Frame 1
"moden1"Symbol 1466 MovieClip {hair_mania_0827_fla.c2_236} Frame 9
"moden2"Symbol 1466 MovieClip {hair_mania_0827_fla.c2_236} Frame 18
"moden0"Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245} Frame 1
"moden1"Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245} Frame 11
"moden3"Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245} Frame 22
"moden4"Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245} Frame 31
"moden5"Symbol 1496 MovieClip {hair_mania_0827_fla.c3_245} Frame 41
"moden0"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 1
"moden1"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 10
"moden2"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 21
"moden3"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 30
"moden4"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 40
"moden5"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 50
"moden6"Symbol 1517 MovieClip {hair_mania_0827_fla.c3_254} Frame 61
"moden0"Symbol 1526 MovieClip {hair_mania_0827_fla.c3_262} Frame 1
"moden1"Symbol 1526 MovieClip {hair_mania_0827_fla.c3_262} Frame 9
"moden2"Symbol 1526 MovieClip {hair_mania_0827_fla.c3_262} Frame 18
"moden0"Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269} Frame 1
"moden1"Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269} Frame 11
"moden3"Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269} Frame 22
"moden4"Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269} Frame 31
"moden5"Symbol 1554 MovieClip {hair_mania_0827_fla.c4_269} Frame 41
"moden0"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 1
"moden1"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 10
"moden2"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 21
"moden3"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 30
"moden4"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 40
"moden5"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 50
"moden6"Symbol 1572 MovieClip {hair_mania_0827_fla.c4_271} Frame 61
"moden0"Symbol 1580 MovieClip {hair_mania_0827_fla.c4_277} Frame 1
"moden1"Symbol 1580 MovieClip {hair_mania_0827_fla.c4_277} Frame 9
"moden2"Symbol 1580 MovieClip {hair_mania_0827_fla.c4_277} Frame 18
"moden0"Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284} Frame 1
"moden1"Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284} Frame 11
"moden3"Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284} Frame 22
"moden4"Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284} Frame 31
"moden5"Symbol 1593 MovieClip {hair_mania_0827_fla.c5_284} Frame 41
"moden0"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 1
"moden1"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 10
"moden2"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 21
"moden3"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 30
"moden4"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 40
"moden5"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 50
"moden6"Symbol 1613 MovieClip {hair_mania_0827_fla.c5_286} Frame 60
"moden0"Symbol 1626 MovieClip {hair_mania_0827_fla.c5_293} Frame 1
"moden1"Symbol 1626 MovieClip {hair_mania_0827_fla.c5_293} Frame 9
"moden2"Symbol 1626 MovieClip {hair_mania_0827_fla.c5_293} Frame 18
"moden0"Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303} Frame 1
"moden1"Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303} Frame 11
"moden3"Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303} Frame 22
"moden4"Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303} Frame 31
"moden5"Symbol 1673 MovieClip {hair_mania_0827_fla.C6_303} Frame 41
"moden0"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 1
"moden1"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 10
"moden2"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 21
"moden3"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 30
"moden4"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 40
"moden5"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 50
"moden6"Symbol 1684 MovieClip {hair_mania_0827_fla.C6_306} Frame 61
"moden0"Symbol 1696 MovieClip {hair_mania_0827_fla.C6_309} Frame 1
"moden1"Symbol 1696 MovieClip {hair_mania_0827_fla.C6_309} Frame 9
"moden2"Symbol 1696 MovieClip {hair_mania_0827_fla.C6_309} Frame 18
"moden0"Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318} Frame 1
"moden1"Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318} Frame 11
"moden3"Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318} Frame 22
"moden4"Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318} Frame 31
"moden5"Symbol 1714 MovieClip {hair_mania_0827_fla.C7_318} Frame 41
"moden0"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 1
"moden1"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 10
"moden2"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 21
"moden3"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 30
"moden4"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 40
"moden5"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 50
"moden6"Symbol 1735 MovieClip {hair_mania_0827_fla.C7_320} Frame 61
"moden0"Symbol 1747 MovieClip {hair_mania_0827_fla.C7_327} Frame 1
"moden1"Symbol 1747 MovieClip {hair_mania_0827_fla.C7_327} Frame 9
"moden2"Symbol 1747 MovieClip {hair_mania_0827_fla.C7_327} Frame 18
"moden0"Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336} Frame 1
"moden1"Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336} Frame 11
"moden3"Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336} Frame 22
"moden4"Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336} Frame 31
"moden5"Symbol 1772 MovieClip {hair_mania_0827_fla.C8_336} Frame 41
"moden0"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 1
"moden1"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 10
"moden2"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 21
"moden3"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 30
"moden4"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 40
"moden5"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 50
"moden6"Symbol 1791 MovieClip {hair_mania_0827_fla.C8_343} Frame 61
"moden0"Symbol 1799 MovieClip {hair_mania_0827_fla.C8_350} Frame 1
"moden1"Symbol 1799 MovieClip {hair_mania_0827_fla.C8_350} Frame 9
"moden2"Symbol 1799 MovieClip {hair_mania_0827_fla.C8_350} Frame 18
"moden0"Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357} Frame 1
"moden1"Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357} Frame 11
"moden3"Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357} Frame 22
"moden4"Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357} Frame 31
"moden5"Symbol 1814 MovieClip {hair_mania_0827_fla.C9_357} Frame 41
"moden0"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 1
"moden1"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 10
"moden2"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 21
"moden3"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 30
"moden4"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 40
"moden5"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 50
"moden6"Symbol 1836 MovieClip {hair_mania_0827_fla.C9_359} Frame 61
"moden0"Symbol 1848 MovieClip {hair_mania_0827_fla.C9_367} Frame 1
"moden1"Symbol 1848 MovieClip {hair_mania_0827_fla.C9_367} Frame 9
"moden2"Symbol 1848 MovieClip {hair_mania_0827_fla.C9_367} Frame 18
"moden0"Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376} Frame 1
"moden1"Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376} Frame 11
"moden3"Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376} Frame 22
"moden4"Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376} Frame 31
"moden5"Symbol 1872 MovieClip {hair_mania_0827_fla.C10_376} Frame 41
"moden0"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 1
"moden1"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 10
"moden2"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 21
"moden3"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 30
"moden4"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 40
"moden5"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 50
"moden6"Symbol 1891 MovieClip {hair_mania_0827_fla.C10_383} Frame 61
"moden0"Symbol 1903 MovieClip {hair_mania_0827_fla.C10_389} Frame 1
"moden1"Symbol 1903 MovieClip {hair_mania_0827_fla.C10_389} Frame 9
"moden2"Symbol 1903 MovieClip {hair_mania_0827_fla.C10_389} Frame 18
"moden0"Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398} Frame 1
"moden1"Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398} Frame 11
"moden3"Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398} Frame 22
"moden4"Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398} Frame 31
"moden5"Symbol 1920 MovieClip {hair_mania_0827_fla.c11_398} Frame 41
"moden0"Symbol 1934 MovieClip {hair_mania_0827_fla.c11_401} Frame 1
"moden1"Symbol 1934 MovieClip {hair_mania_0827_fla.c11_401} Frame 9
"moden2"Symbol 1934 MovieClip {hair_mania_0827_fla.c11_401} Frame 18
"moden0"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 1
"moden1"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 10
"moden2"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 21
"moden3"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 30
"moden4"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 40
"moden5"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 50
"moden6"Symbol 1952 MovieClip {hair_mania_0827_fla.c11_407} Frame 63
"moden0"Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417} Frame 1
"moden1"Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417} Frame 11
"moden3"Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417} Frame 22
"moden4"Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417} Frame 31
"moden5"Symbol 1970 MovieClip {hair_mania_0827_fla.c12_417} Frame 41
"moden0"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 1
"moden1"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 10
"moden2"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 21
"moden3"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 30
"moden4"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 40
"moden5"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 50
"moden6"Symbol 1996 MovieClip {hair_mania_0827_fla.c12_419} Frame 63
"moden0"Symbol 2009 MovieClip {hair_mania_0827_fla.c12_426} Frame 1
"moden1"Symbol 2009 MovieClip {hair_mania_0827_fla.c12_426} Frame 9
"moden2"Symbol 2009 MovieClip {hair_mania_0827_fla.c12_426} Frame 18
"moden0"Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437} Frame 1
"moden1"Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437} Frame 11
"moden3"Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437} Frame 22
"moden4"Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437} Frame 31
"moden5"Symbol 2036 MovieClip {hair_mania_0827_fla.c13_437} Frame 41
"moden0"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 1
"moden1"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 10
"moden2"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 21
"moden3"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 30
"moden4"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 40
"moden5"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 50
"moden6"Symbol 2055 MovieClip {hair_mania_0827_fla.c13_439} Frame 62
"moden0"Symbol 2068 MovieClip {hair_mania_0827_fla.c13_445} Frame 1
"moden1"Symbol 2068 MovieClip {hair_mania_0827_fla.c13_445} Frame 9
"moden2"Symbol 2068 MovieClip {hair_mania_0827_fla.c13_445} Frame 18
"moden0"Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454} Frame 1
"moden1"Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454} Frame 11
"moden3"Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454} Frame 22
"moden4"Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454} Frame 31
"moden5"Symbol 2088 MovieClip {hair_mania_0827_fla.c14_454} Frame 41
"moden0"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 1
"moden1"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 10
"moden2"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 21
"moden3"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 30
"moden4"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 40
"moden5"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 50
"moden6"Symbol 2102 MovieClip {hair_mania_0827_fla.c14_458} Frame 62
"moden0"Symbol 2111 MovieClip {hair_mania_0827_fla.c14_462} Frame 1
"moden1"Symbol 2111 MovieClip {hair_mania_0827_fla.c14_462} Frame 9
"moden2"Symbol 2111 MovieClip {hair_mania_0827_fla.c14_462} Frame 18
"moden0"Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469} Frame 1
"moden1"Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469} Frame 11
"moden3"Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469} Frame 22
"moden4"Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469} Frame 31
"moden5"Symbol 2126 MovieClip {hair_mania_0827_fla.c15_469} Frame 41
"moden0"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 1
"moden1"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 10
"moden2"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 21
"moden3"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 30
"moden4"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 40
"moden5"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 50
"moden6"Symbol 2143 MovieClip {hair_mania_0827_fla.c15_472} Frame 61
"moden0"Symbol 2157 MovieClip {hair_mania_0827_fla.c15_478} Frame 1
"moden1"Symbol 2157 MovieClip {hair_mania_0827_fla.c15_478} Frame 9
"moden2"Symbol 2157 MovieClip {hair_mania_0827_fla.c15_478} Frame 18
"moden0"Symbol 2246 MovieClip {hair_mania_0827_fla.Timeline_486} Frame 1
"moden1"Symbol 2246 MovieClip {hair_mania_0827_fla.Timeline_486} Frame 12
"moden2"Symbol 2246 MovieClip {hair_mania_0827_fla.Timeline_486} Frame 25
"chooselevel"Symbol 3509 MovieClip {lib.Intro} Frame 47
"bad0"Symbol 3760 MovieClip {lib.Space_Tishi} Frame 36
"bad1"Symbol 3760 MovieClip {lib.Space_Tishi} Frame 73




http://swfchan.com/51/254404/info.shtml
Created: 14/8 -2023 16:32:35 Last modified: 14/8 -2023 16:32:35 Server time: 30/04 -2026 12:58:49